parent
d37b526d38
commit
06b49e3e7d
@ -0,0 +1,218 @@ |
|||||||
|
{ |
||||||
|
"name": "nodejs", |
||||||
|
"version": "1.0.0", |
||||||
|
"lockfileVersion": 2, |
||||||
|
"requires": true, |
||||||
|
"packages": { |
||||||
|
"node_modules/@socket.io/component-emitter": { |
||||||
|
"version": "3.1.0", |
||||||
|
"resolved": "https://registry.npmjs.org/@socket.io/component-emitter/-/component-emitter-3.1.0.tgz", |
||||||
|
"integrity": "sha512-+9jVqKhRSpsc591z5vX+X5Yyw+he/HCB4iQ/RYxw35CEPaY1gnsNE43nf9n9AaYjAQrTiI/mOwKUKdUs9vf7Xg==" |
||||||
|
}, |
||||||
|
"node_modules/@types/node": { |
||||||
|
"version": "18.7.5", |
||||||
|
"resolved": "https://registry.npmjs.org/@types/node/-/node-18.7.5.tgz", |
||||||
|
"integrity": "sha512-NcKK6Ts+9LqdHJaW6HQmgr7dT/i3GOHG+pt6BiWv++5SnjtRd4NXeiuN2kA153SjhXPR/AhHIPHPbrsbpUVOww==" |
||||||
|
}, |
||||||
|
"node_modules/data-uri-to-buffer": { |
||||||
|
"version": "4.0.0", |
||||||
|
"resolved": "https://registry.npmjs.org/data-uri-to-buffer/-/data-uri-to-buffer-4.0.0.tgz", |
||||||
|
"integrity": "sha512-Vr3mLBA8qWmcuschSLAOogKgQ/Jwxulv3RNE4FXnYWRGujzrRWQI4m12fQqRkwX06C0KanhLr4hK+GydchZsaA==", |
||||||
|
"engines": { |
||||||
|
"node": ">= 12" |
||||||
|
} |
||||||
|
}, |
||||||
|
"node_modules/debug": { |
||||||
|
"version": "4.3.4", |
||||||
|
"resolved": "https://registry.npmjs.org/debug/-/debug-4.3.4.tgz", |
||||||
|
"integrity": "sha512-PRWFHuSU3eDtQJPvnNY7Jcket1j0t5OuOsFzPPzsekD52Zl8qUfFIPEiswXqIvHWGVHOgX+7G/vCNNhehwxfkQ==", |
||||||
|
"dependencies": { |
||||||
|
"ms": "2.1.2" |
||||||
|
}, |
||||||
|
"engines": { |
||||||
|
"node": ">=6.0" |
||||||
|
}, |
||||||
|
"peerDependenciesMeta": { |
||||||
|
"supports-color": { |
||||||
|
"optional": true |
||||||
|
} |
||||||
|
} |
||||||
|
}, |
||||||
|
"node_modules/dotenv": { |
||||||
|
"version": "16.0.1", |
||||||
|
"resolved": "https://registry.npmjs.org/dotenv/-/dotenv-16.0.1.tgz", |
||||||
|
"integrity": "sha512-1K6hR6wtk2FviQ4kEiSjFiH5rpzEVi8WW0x96aztHVMhEspNpc4DVOUTEHtEva5VThQ8IaBX1Pe4gSzpVVUsKQ==", |
||||||
|
"engines": { |
||||||
|
"node": ">=12" |
||||||
|
} |
||||||
|
}, |
||||||
|
"node_modules/engine.io-client": { |
||||||
|
"version": "6.2.2", |
||||||
|
"resolved": "https://registry.npmjs.org/engine.io-client/-/engine.io-client-6.2.2.tgz", |
||||||
|
"integrity": "sha512-8ZQmx0LQGRTYkHuogVZuGSpDqYZtCM/nv8zQ68VZ+JkOpazJ7ICdsSpaO6iXwvaU30oFg5QJOJWj8zWqhbKjkQ==", |
||||||
|
"dependencies": { |
||||||
|
"@socket.io/component-emitter": "~3.1.0", |
||||||
|
"debug": "~4.3.1", |
||||||
|
"engine.io-parser": "~5.0.3", |
||||||
|
"ws": "~8.2.3", |
||||||
|
"xmlhttprequest-ssl": "~2.0.0" |
||||||
|
} |
||||||
|
}, |
||||||
|
"node_modules/engine.io-parser": { |
||||||
|
"version": "5.0.4", |
||||||
|
"resolved": "https://registry.npmjs.org/engine.io-parser/-/engine.io-parser-5.0.4.tgz", |
||||||
|
"integrity": "sha512-+nVFp+5z1E3HcToEnO7ZIj3g+3k9389DvWtvJZz0T6/eOCPIyyxehFcedoYrZQrp0LgQbD9pPXhpMBKMd5QURg==", |
||||||
|
"engines": { |
||||||
|
"node": ">=10.0.0" |
||||||
|
} |
||||||
|
}, |
||||||
|
"node_modules/fetch-blob": { |
||||||
|
"version": "3.2.0", |
||||||
|
"resolved": "https://registry.npmjs.org/fetch-blob/-/fetch-blob-3.2.0.tgz", |
||||||
|
"integrity": "sha512-7yAQpD2UMJzLi1Dqv7qFYnPbaPx7ZfFK6PiIxQ4PfkGPyNyl2Ugx+a/umUonmKqjhM4DnfbMvdX6otXq83soQQ==", |
||||||
|
"funding": [ |
||||||
|
{ |
||||||
|
"type": "github", |
||||||
|
"url": "https://github.com/sponsors/jimmywarting" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"type": "paypal", |
||||||
|
"url": "https://paypal.me/jimmywarting" |
||||||
|
} |
||||||
|
], |
||||||
|
"dependencies": { |
||||||
|
"node-domexception": "^1.0.0", |
||||||
|
"web-streams-polyfill": "^3.0.3" |
||||||
|
}, |
||||||
|
"engines": { |
||||||
|
"node": "^12.20 || >= 14.13" |
||||||
|
} |
||||||
|
}, |
||||||
|
"node_modules/formdata-polyfill": { |
||||||
|
"version": "4.0.10", |
||||||
|
"resolved": "https://registry.npmjs.org/formdata-polyfill/-/formdata-polyfill-4.0.10.tgz", |
||||||
|
"integrity": "sha512-buewHzMvYL29jdeQTVILecSaZKnt/RJWjoZCF5OW60Z67/GmSLBkOFM7qh1PI3zFNtJbaZL5eQu1vLfazOwj4g==", |
||||||
|
"dependencies": { |
||||||
|
"fetch-blob": "^3.1.2" |
||||||
|
}, |
||||||
|
"engines": { |
||||||
|
"node": ">=12.20.0" |
||||||
|
} |
||||||
|
}, |
||||||
|
"node_modules/heap": { |
||||||
|
"version": "0.2.5", |
||||||
|
"resolved": "https://registry.npmjs.org/heap/-/heap-0.2.5.tgz", |
||||||
|
"integrity": "sha512-G7HLD+WKcrOyJP5VQwYZNC3Z6FcQ7YYjEFiFoIj8PfEr73mu421o8B1N5DKUcc8K37EsJ2XXWA8DtrDz/2dReg==" |
||||||
|
}, |
||||||
|
"node_modules/ms": { |
||||||
|
"version": "2.1.2", |
||||||
|
"resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", |
||||||
|
"integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==" |
||||||
|
}, |
||||||
|
"node_modules/node-domexception": { |
||||||
|
"version": "1.0.0", |
||||||
|
"resolved": "https://registry.npmjs.org/node-domexception/-/node-domexception-1.0.0.tgz", |
||||||
|
"integrity": "sha512-/jKZoMpw0F8GRwl4/eLROPA3cfcXtLApP0QzLmUT/HuPCZWyB7IY9ZrMeKw2O/nFIqPQB3PVM9aYm0F312AXDQ==", |
||||||
|
"funding": [ |
||||||
|
{ |
||||||
|
"type": "github", |
||||||
|
"url": "https://github.com/sponsors/jimmywarting" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"type": "github", |
||||||
|
"url": "https://paypal.me/jimmywarting" |
||||||
|
} |
||||||
|
], |
||||||
|
"engines": { |
||||||
|
"node": ">=10.5.0" |
||||||
|
} |
||||||
|
}, |
||||||
|
"node_modules/node-fetch": { |
||||||
|
"version": "3.2.10", |
||||||
|
"resolved": "https://registry.npmjs.org/node-fetch/-/node-fetch-3.2.10.tgz", |
||||||
|
"integrity": "sha512-MhuzNwdURnZ1Cp4XTazr69K0BTizsBroX7Zx3UgDSVcZYKF/6p0CBe4EUb/hLqmzVhl0UpYfgRljQ4yxE+iCxA==", |
||||||
|
"dependencies": { |
||||||
|
"data-uri-to-buffer": "^4.0.0", |
||||||
|
"fetch-blob": "^3.1.4", |
||||||
|
"formdata-polyfill": "^4.0.10" |
||||||
|
}, |
||||||
|
"engines": { |
||||||
|
"node": "^12.20.0 || ^14.13.1 || >=16.0.0" |
||||||
|
}, |
||||||
|
"funding": { |
||||||
|
"type": "opencollective", |
||||||
|
"url": "https://opencollective.com/node-fetch" |
||||||
|
} |
||||||
|
}, |
||||||
|
"node_modules/pathfinding": { |
||||||
|
"version": "0.4.18", |
||||||
|
"resolved": "https://registry.npmjs.org/pathfinding/-/pathfinding-0.4.18.tgz", |
||||||
|
"integrity": "sha512-R0TGEQ9GRcFCDvAWlJAWC+KGJ9SLbW4c0nuZRcioVlXVTlw+F5RvXQ8SQgSqI9KXWC1ew95vgmIiyaWTlCe9Ag==", |
||||||
|
"dependencies": { |
||||||
|
"heap": "0.2.5" |
||||||
|
} |
||||||
|
}, |
||||||
|
"node_modules/socket.io-client": { |
||||||
|
"version": "4.5.1", |
||||||
|
"resolved": "https://registry.npmjs.org/socket.io-client/-/socket.io-client-4.5.1.tgz", |
||||||
|
"integrity": "sha512-e6nLVgiRYatS+AHXnOnGi4ocOpubvOUCGhyWw8v+/FxW8saHkinG6Dfhi9TU0Kt/8mwJIAASxvw6eujQmjdZVA==", |
||||||
|
"dependencies": { |
||||||
|
"@socket.io/component-emitter": "~3.1.0", |
||||||
|
"debug": "~4.3.2", |
||||||
|
"engine.io-client": "~6.2.1", |
||||||
|
"socket.io-parser": "~4.2.0" |
||||||
|
}, |
||||||
|
"engines": { |
||||||
|
"node": ">=10.0.0" |
||||||
|
} |
||||||
|
}, |
||||||
|
"node_modules/socket.io-parser": { |
||||||
|
"version": "4.2.1", |
||||||
|
"resolved": "https://registry.npmjs.org/socket.io-parser/-/socket.io-parser-4.2.1.tgz", |
||||||
|
"integrity": "sha512-V4GrkLy+HeF1F/en3SpUaM+7XxYXpuMUWLGde1kSSh5nQMN4hLrbPIkD+otwh6q9R6NOQBN4AMaOZ2zVjui82g==", |
||||||
|
"dependencies": { |
||||||
|
"@socket.io/component-emitter": "~3.1.0", |
||||||
|
"debug": "~4.3.1" |
||||||
|
}, |
||||||
|
"engines": { |
||||||
|
"node": ">=10.0.0" |
||||||
|
} |
||||||
|
}, |
||||||
|
"node_modules/web-streams-polyfill": { |
||||||
|
"version": "3.2.1", |
||||||
|
"resolved": "https://registry.npmjs.org/web-streams-polyfill/-/web-streams-polyfill-3.2.1.tgz", |
||||||
|
"integrity": "sha512-e0MO3wdXWKrLbL0DgGnUV7WHVuw9OUvL4hjgnPkIeEvESk74gAITi5G606JtZPp39cd8HA9VQzCIvA49LpPN5Q==", |
||||||
|
"engines": { |
||||||
|
"node": ">= 8" |
||||||
|
} |
||||||
|
}, |
||||||
|
"node_modules/ws": { |
||||||
|
"version": "8.2.3", |
||||||
|
"resolved": "https://registry.npmjs.org/ws/-/ws-8.2.3.tgz", |
||||||
|
"integrity": "sha512-wBuoj1BDpC6ZQ1B7DWQBYVLphPWkm8i9Y0/3YdHjHKHiohOJ1ws+3OccDWtH+PoC9DZD5WOTrJvNbWvjS6JWaA==", |
||||||
|
"engines": { |
||||||
|
"node": ">=10.0.0" |
||||||
|
}, |
||||||
|
"peerDependencies": { |
||||||
|
"bufferutil": "^4.0.1", |
||||||
|
"utf-8-validate": "^5.0.2" |
||||||
|
}, |
||||||
|
"peerDependenciesMeta": { |
||||||
|
"bufferutil": { |
||||||
|
"optional": true |
||||||
|
}, |
||||||
|
"utf-8-validate": { |
||||||
|
"optional": true |
||||||
|
} |
||||||
|
} |
||||||
|
}, |
||||||
|
"node_modules/xmlhttprequest-ssl": { |
||||||
|
"version": "2.0.0", |
||||||
|
"resolved": "https://registry.npmjs.org/xmlhttprequest-ssl/-/xmlhttprequest-ssl-2.0.0.tgz", |
||||||
|
"integrity": "sha512-QKxVRxiRACQcVuQEYFsI1hhkrMlrXHPegbbd1yn9UHOmRxY+si12nQYzri3vbzt8VdTTRviqcKxcyllFas5z2A==", |
||||||
|
"engines": { |
||||||
|
"node": ">=0.4.0" |
||||||
|
} |
||||||
|
} |
||||||
|
} |
||||||
|
} |
@ -0,0 +1,24 @@ |
|||||||
|
(The MIT License) |
||||||
|
|
||||||
|
Copyright (c) 2014 Component contributors <dev@component.io> |
||||||
|
|
||||||
|
Permission is hereby granted, free of charge, to any person |
||||||
|
obtaining a copy of this software and associated documentation |
||||||
|
files (the "Software"), to deal in the Software without |
||||||
|
restriction, including without limitation the rights to use, |
||||||
|
copy, modify, merge, publish, distribute, sublicense, and/or sell |
||||||
|
copies of the Software, and to permit persons to whom the |
||||||
|
Software is furnished to do so, subject to the following |
||||||
|
conditions: |
||||||
|
|
||||||
|
The above copyright notice and this permission notice shall be |
||||||
|
included in all copies or substantial portions of the Software. |
||||||
|
|
||||||
|
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, |
||||||
|
EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES |
||||||
|
OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND |
||||||
|
NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT |
||||||
|
HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, |
||||||
|
WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING |
||||||
|
FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR |
||||||
|
OTHER DEALINGS IN THE SOFTWARE. |
@ -0,0 +1,74 @@ |
|||||||
|
# Emitter [](https://travis-ci.org/component/emitter) |
||||||
|
|
||||||
|
Event emitter component. |
||||||
|
|
||||||
|
## Installation |
||||||
|
|
||||||
|
``` |
||||||
|
$ component install component/emitter |
||||||
|
``` |
||||||
|
|
||||||
|
## API |
||||||
|
|
||||||
|
### Emitter(obj) |
||||||
|
|
||||||
|
The `Emitter` may also be used as a mixin. For example |
||||||
|
a "plain" object may become an emitter, or you may |
||||||
|
extend an existing prototype. |
||||||
|
|
||||||
|
As an `Emitter` instance: |
||||||
|
|
||||||
|
```js |
||||||
|
var Emitter = require('emitter'); |
||||||
|
var emitter = new Emitter; |
||||||
|
emitter.emit('something'); |
||||||
|
``` |
||||||
|
|
||||||
|
As a mixin: |
||||||
|
|
||||||
|
```js |
||||||
|
var Emitter = require('emitter'); |
||||||
|
var user = { name: 'tobi' }; |
||||||
|
Emitter(user); |
||||||
|
|
||||||
|
user.emit('im a user'); |
||||||
|
``` |
||||||
|
|
||||||
|
As a prototype mixin: |
||||||
|
|
||||||
|
```js |
||||||
|
var Emitter = require('emitter'); |
||||||
|
Emitter(User.prototype); |
||||||
|
``` |
||||||
|
|
||||||
|
### Emitter#on(event, fn) |
||||||
|
|
||||||
|
Register an `event` handler `fn`. |
||||||
|
|
||||||
|
### Emitter#once(event, fn) |
||||||
|
|
||||||
|
Register a single-shot `event` handler `fn`, |
||||||
|
removed immediately after it is invoked the |
||||||
|
first time. |
||||||
|
|
||||||
|
### Emitter#off(event, fn) |
||||||
|
|
||||||
|
* Pass `event` and `fn` to remove a listener. |
||||||
|
* Pass `event` to remove all listeners on that event. |
||||||
|
* Pass nothing to remove all listeners on all events. |
||||||
|
|
||||||
|
### Emitter#emit(event, ...) |
||||||
|
|
||||||
|
Emit an `event` with variable option args. |
||||||
|
|
||||||
|
### Emitter#listeners(event) |
||||||
|
|
||||||
|
Return an array of callbacks, or an empty array. |
||||||
|
|
||||||
|
### Emitter#hasListeners(event) |
||||||
|
|
||||||
|
Check if this emitter has `event` handlers. |
||||||
|
|
||||||
|
## License |
||||||
|
|
||||||
|
MIT |
@ -0,0 +1,179 @@ |
|||||||
|
/** |
||||||
|
* An events map is an interface that maps event names to their value, which |
||||||
|
* represents the type of the `on` listener. |
||||||
|
*/ |
||||||
|
export interface EventsMap { |
||||||
|
[event: string]: any; |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* The default events map, used if no EventsMap is given. Using this EventsMap |
||||||
|
* is equivalent to accepting all event names, and any data. |
||||||
|
*/ |
||||||
|
export interface DefaultEventsMap { |
||||||
|
[event: string]: (...args: any[]) => void; |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Returns a union type containing all the keys of an event map. |
||||||
|
*/ |
||||||
|
export type EventNames<Map extends EventsMap> = keyof Map & (string | symbol); |
||||||
|
|
||||||
|
/** The tuple type representing the parameters of an event listener */ |
||||||
|
export type EventParams< |
||||||
|
Map extends EventsMap, |
||||||
|
Ev extends EventNames<Map> |
||||||
|
> = Parameters<Map[Ev]>; |
||||||
|
|
||||||
|
/** |
||||||
|
* The event names that are either in ReservedEvents or in UserEvents |
||||||
|
*/ |
||||||
|
export type ReservedOrUserEventNames< |
||||||
|
ReservedEventsMap extends EventsMap, |
||||||
|
UserEvents extends EventsMap |
||||||
|
> = EventNames<ReservedEventsMap> | EventNames<UserEvents>; |
||||||
|
|
||||||
|
/** |
||||||
|
* Type of a listener of a user event or a reserved event. If `Ev` is in |
||||||
|
* `ReservedEvents`, the reserved event listener is returned. |
||||||
|
*/ |
||||||
|
export type ReservedOrUserListener< |
||||||
|
ReservedEvents extends EventsMap, |
||||||
|
UserEvents extends EventsMap, |
||||||
|
Ev extends ReservedOrUserEventNames<ReservedEvents, UserEvents> |
||||||
|
> = FallbackToUntypedListener< |
||||||
|
Ev extends EventNames<ReservedEvents> |
||||||
|
? ReservedEvents[Ev] |
||||||
|
: Ev extends EventNames<UserEvents> |
||||||
|
? UserEvents[Ev] |
||||||
|
: never |
||||||
|
>; |
||||||
|
|
||||||
|
/** |
||||||
|
* Returns an untyped listener type if `T` is `never`; otherwise, returns `T`. |
||||||
|
* |
||||||
|
* This is a hack to mitigate https://github.com/socketio/socket.io/issues/3833.
|
||||||
|
* Needed because of https://github.com/microsoft/TypeScript/issues/41778
|
||||||
|
*/ |
||||||
|
type FallbackToUntypedListener<T> = [T] extends [never] |
||||||
|
? (...args: any[]) => void | Promise<void> |
||||||
|
: T; |
||||||
|
|
||||||
|
/** |
||||||
|
* Strictly typed version of an `EventEmitter`. A `TypedEventEmitter` takes type |
||||||
|
* parameters for mappings of event names to event data types, and strictly |
||||||
|
* types method calls to the `EventEmitter` according to these event maps. |
||||||
|
* |
||||||
|
* @typeParam ListenEvents - `EventsMap` of user-defined events that can be |
||||||
|
* listened to with `on` or `once` |
||||||
|
* @typeParam EmitEvents - `EventsMap` of user-defined events that can be |
||||||
|
* emitted with `emit` |
||||||
|
* @typeParam ReservedEvents - `EventsMap` of reserved events, that can be |
||||||
|
* emitted by socket.io with `emitReserved`, and can be listened to with |
||||||
|
* `listen`. |
||||||
|
*/ |
||||||
|
export class Emitter< |
||||||
|
ListenEvents extends EventsMap, |
||||||
|
EmitEvents extends EventsMap, |
||||||
|
ReservedEvents extends EventsMap = {} |
||||||
|
> { |
||||||
|
/** |
||||||
|
* Adds the `listener` function as an event listener for `ev`. |
||||||
|
* |
||||||
|
* @param ev Name of the event |
||||||
|
* @param listener Callback function |
||||||
|
*/ |
||||||
|
on<Ev extends ReservedOrUserEventNames<ReservedEvents, ListenEvents>>( |
||||||
|
ev: Ev, |
||||||
|
listener: ReservedOrUserListener<ReservedEvents, ListenEvents, Ev> |
||||||
|
): this; |
||||||
|
|
||||||
|
/** |
||||||
|
* Adds a one-time `listener` function as an event listener for `ev`. |
||||||
|
* |
||||||
|
* @param ev Name of the event |
||||||
|
* @param listener Callback function |
||||||
|
*/ |
||||||
|
once<Ev extends ReservedOrUserEventNames<ReservedEvents, ListenEvents>>( |
||||||
|
ev: Ev, |
||||||
|
listener: ReservedOrUserListener<ReservedEvents, ListenEvents, Ev> |
||||||
|
): this; |
||||||
|
|
||||||
|
/** |
||||||
|
* Removes the `listener` function as an event listener for `ev`. |
||||||
|
* |
||||||
|
* @param ev Name of the event |
||||||
|
* @param listener Callback function |
||||||
|
*/ |
||||||
|
off<Ev extends ReservedOrUserEventNames<ReservedEvents, ListenEvents>>( |
||||||
|
ev?: Ev, |
||||||
|
listener?: ReservedOrUserListener<ReservedEvents, ListenEvents, Ev> |
||||||
|
): this; |
||||||
|
|
||||||
|
/** |
||||||
|
* Emits an event. |
||||||
|
* |
||||||
|
* @param ev Name of the event |
||||||
|
* @param args Values to send to listeners of this event |
||||||
|
*/ |
||||||
|
emit<Ev extends EventNames<EmitEvents>>( |
||||||
|
ev: Ev, |
||||||
|
...args: EventParams<EmitEvents, Ev> |
||||||
|
): this; |
||||||
|
|
||||||
|
/** |
||||||
|
* Emits a reserved event. |
||||||
|
* |
||||||
|
* This method is `protected`, so that only a class extending |
||||||
|
* `StrictEventEmitter` can emit its own reserved events. |
||||||
|
* |
||||||
|
* @param ev Reserved event name |
||||||
|
* @param args Arguments to emit along with the event |
||||||
|
*/ |
||||||
|
protected emitReserved<Ev extends EventNames<ReservedEvents>>( |
||||||
|
ev: Ev, |
||||||
|
...args: EventParams<ReservedEvents, Ev> |
||||||
|
): this; |
||||||
|
|
||||||
|
/** |
||||||
|
* Returns the listeners listening to an event. |
||||||
|
* |
||||||
|
* @param event Event name |
||||||
|
* @returns Array of listeners subscribed to `event` |
||||||
|
*/ |
||||||
|
listeners<Ev extends ReservedOrUserEventNames<ReservedEvents, ListenEvents>>( |
||||||
|
event: Ev |
||||||
|
): ReservedOrUserListener<ReservedEvents, ListenEvents, Ev>[]; |
||||||
|
|
||||||
|
/** |
||||||
|
* Returns true if there is a listener for this event. |
||||||
|
* |
||||||
|
* @param event Event name |
||||||
|
* @returns boolean |
||||||
|
*/ |
||||||
|
hasListeners< |
||||||
|
Ev extends ReservedOrUserEventNames<ReservedEvents, ListenEvents> |
||||||
|
>(event: Ev): boolean; |
||||||
|
|
||||||
|
/** |
||||||
|
* Removes the `listener` function as an event listener for `ev`. |
||||||
|
* |
||||||
|
* @param ev Name of the event |
||||||
|
* @param listener Callback function |
||||||
|
*/ |
||||||
|
removeListener< |
||||||
|
Ev extends ReservedOrUserEventNames<ReservedEvents, ListenEvents> |
||||||
|
>( |
||||||
|
ev?: Ev, |
||||||
|
listener?: ReservedOrUserListener<ReservedEvents, ListenEvents, Ev> |
||||||
|
): this; |
||||||
|
|
||||||
|
/** |
||||||
|
* Removes all `listener` function as an event listener for `ev`. |
||||||
|
* |
||||||
|
* @param ev Name of the event |
||||||
|
*/ |
||||||
|
removeAllListeners< |
||||||
|
Ev extends ReservedOrUserEventNames<ReservedEvents, ListenEvents> |
||||||
|
>(ev?: Ev): this; |
||||||
|
} |
@ -0,0 +1,176 @@ |
|||||||
|
|
||||||
|
/** |
||||||
|
* Expose `Emitter`. |
||||||
|
*/ |
||||||
|
|
||||||
|
exports.Emitter = Emitter; |
||||||
|
|
||||||
|
/** |
||||||
|
* Initialize a new `Emitter`. |
||||||
|
* |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
|
||||||
|
function Emitter(obj) { |
||||||
|
if (obj) return mixin(obj); |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Mixin the emitter properties. |
||||||
|
* |
||||||
|
* @param {Object} obj |
||||||
|
* @return {Object} |
||||||
|
* @api private |
||||||
|
*/ |
||||||
|
|
||||||
|
function mixin(obj) { |
||||||
|
for (var key in Emitter.prototype) { |
||||||
|
obj[key] = Emitter.prototype[key]; |
||||||
|
} |
||||||
|
return obj; |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Listen on the given `event` with `fn`. |
||||||
|
* |
||||||
|
* @param {String} event |
||||||
|
* @param {Function} fn |
||||||
|
* @return {Emitter} |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
|
||||||
|
Emitter.prototype.on = |
||||||
|
Emitter.prototype.addEventListener = function(event, fn){ |
||||||
|
this._callbacks = this._callbacks || {}; |
||||||
|
(this._callbacks['$' + event] = this._callbacks['$' + event] || []) |
||||||
|
.push(fn); |
||||||
|
return this; |
||||||
|
}; |
||||||
|
|
||||||
|
/** |
||||||
|
* Adds an `event` listener that will be invoked a single |
||||||
|
* time then automatically removed. |
||||||
|
* |
||||||
|
* @param {String} event |
||||||
|
* @param {Function} fn |
||||||
|
* @return {Emitter} |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
|
||||||
|
Emitter.prototype.once = function(event, fn){ |
||||||
|
function on() { |
||||||
|
this.off(event, on); |
||||||
|
fn.apply(this, arguments); |
||||||
|
} |
||||||
|
|
||||||
|
on.fn = fn; |
||||||
|
this.on(event, on); |
||||||
|
return this; |
||||||
|
}; |
||||||
|
|
||||||
|
/** |
||||||
|
* Remove the given callback for `event` or all |
||||||
|
* registered callbacks. |
||||||
|
* |
||||||
|
* @param {String} event |
||||||
|
* @param {Function} fn |
||||||
|
* @return {Emitter} |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
|
||||||
|
Emitter.prototype.off = |
||||||
|
Emitter.prototype.removeListener = |
||||||
|
Emitter.prototype.removeAllListeners = |
||||||
|
Emitter.prototype.removeEventListener = function(event, fn){ |
||||||
|
this._callbacks = this._callbacks || {}; |
||||||
|
|
||||||
|
// all
|
||||||
|
if (0 == arguments.length) { |
||||||
|
this._callbacks = {}; |
||||||
|
return this; |
||||||
|
} |
||||||
|
|
||||||
|
// specific event
|
||||||
|
var callbacks = this._callbacks['$' + event]; |
||||||
|
if (!callbacks) return this; |
||||||
|
|
||||||
|
// remove all handlers
|
||||||
|
if (1 == arguments.length) { |
||||||
|
delete this._callbacks['$' + event]; |
||||||
|
return this; |
||||||
|
} |
||||||
|
|
||||||
|
// remove specific handler
|
||||||
|
var cb; |
||||||
|
for (var i = 0; i < callbacks.length; i++) { |
||||||
|
cb = callbacks[i]; |
||||||
|
if (cb === fn || cb.fn === fn) { |
||||||
|
callbacks.splice(i, 1); |
||||||
|
break; |
||||||
|
} |
||||||
|
} |
||||||
|
|
||||||
|
// Remove event specific arrays for event types that no
|
||||||
|
// one is subscribed for to avoid memory leak.
|
||||||
|
if (callbacks.length === 0) { |
||||||
|
delete this._callbacks['$' + event]; |
||||||
|
} |
||||||
|
|
||||||
|
return this; |
||||||
|
}; |
||||||
|
|
||||||
|
/** |
||||||
|
* Emit `event` with the given args. |
||||||
|
* |
||||||
|
* @param {String} event |
||||||
|
* @param {Mixed} ... |
||||||
|
* @return {Emitter} |
||||||
|
*/ |
||||||
|
|
||||||
|
Emitter.prototype.emit = function(event){ |
||||||
|
this._callbacks = this._callbacks || {}; |
||||||
|
|
||||||
|
var args = new Array(arguments.length - 1) |
||||||
|
, callbacks = this._callbacks['$' + event]; |
||||||
|
|
||||||
|
for (var i = 1; i < arguments.length; i++) { |
||||||
|
args[i - 1] = arguments[i]; |
||||||
|
} |
||||||
|
|
||||||
|
if (callbacks) { |
||||||
|
callbacks = callbacks.slice(0); |
||||||
|
for (var i = 0, len = callbacks.length; i < len; ++i) { |
||||||
|
callbacks[i].apply(this, args); |
||||||
|
} |
||||||
|
} |
||||||
|
|
||||||
|
return this; |
||||||
|
}; |
||||||
|
|
||||||
|
// alias used for reserved events (protected method)
|
||||||
|
Emitter.prototype.emitReserved = Emitter.prototype.emit; |
||||||
|
|
||||||
|
/** |
||||||
|
* Return array of callbacks for `event`. |
||||||
|
* |
||||||
|
* @param {String} event |
||||||
|
* @return {Array} |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
|
||||||
|
Emitter.prototype.listeners = function(event){ |
||||||
|
this._callbacks = this._callbacks || {}; |
||||||
|
return this._callbacks['$' + event] || []; |
||||||
|
}; |
||||||
|
|
||||||
|
/** |
||||||
|
* Check if this emitter has `event` handlers. |
||||||
|
* |
||||||
|
* @param {String} event |
||||||
|
* @return {Boolean} |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
|
||||||
|
Emitter.prototype.hasListeners = function(event){ |
||||||
|
return !! this.listeners(event).length; |
||||||
|
}; |
@ -0,0 +1,169 @@ |
|||||||
|
/** |
||||||
|
* Initialize a new `Emitter`. |
||||||
|
* |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
|
||||||
|
export function Emitter(obj) { |
||||||
|
if (obj) return mixin(obj); |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Mixin the emitter properties. |
||||||
|
* |
||||||
|
* @param {Object} obj |
||||||
|
* @return {Object} |
||||||
|
* @api private |
||||||
|
*/ |
||||||
|
|
||||||
|
function mixin(obj) { |
||||||
|
for (var key in Emitter.prototype) { |
||||||
|
obj[key] = Emitter.prototype[key]; |
||||||
|
} |
||||||
|
return obj; |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Listen on the given `event` with `fn`. |
||||||
|
* |
||||||
|
* @param {String} event |
||||||
|
* @param {Function} fn |
||||||
|
* @return {Emitter} |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
|
||||||
|
Emitter.prototype.on = |
||||||
|
Emitter.prototype.addEventListener = function(event, fn){ |
||||||
|
this._callbacks = this._callbacks || {}; |
||||||
|
(this._callbacks['$' + event] = this._callbacks['$' + event] || []) |
||||||
|
.push(fn); |
||||||
|
return this; |
||||||
|
}; |
||||||
|
|
||||||
|
/** |
||||||
|
* Adds an `event` listener that will be invoked a single |
||||||
|
* time then automatically removed. |
||||||
|
* |
||||||
|
* @param {String} event |
||||||
|
* @param {Function} fn |
||||||
|
* @return {Emitter} |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
|
||||||
|
Emitter.prototype.once = function(event, fn){ |
||||||
|
function on() { |
||||||
|
this.off(event, on); |
||||||
|
fn.apply(this, arguments); |
||||||
|
} |
||||||
|
|
||||||
|
on.fn = fn; |
||||||
|
this.on(event, on); |
||||||
|
return this; |
||||||
|
}; |
||||||
|
|
||||||
|
/** |
||||||
|
* Remove the given callback for `event` or all |
||||||
|
* registered callbacks. |
||||||
|
* |
||||||
|
* @param {String} event |
||||||
|
* @param {Function} fn |
||||||
|
* @return {Emitter} |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
|
||||||
|
Emitter.prototype.off = |
||||||
|
Emitter.prototype.removeListener = |
||||||
|
Emitter.prototype.removeAllListeners = |
||||||
|
Emitter.prototype.removeEventListener = function(event, fn){ |
||||||
|
this._callbacks = this._callbacks || {}; |
||||||
|
|
||||||
|
// all
|
||||||
|
if (0 == arguments.length) { |
||||||
|
this._callbacks = {}; |
||||||
|
return this; |
||||||
|
} |
||||||
|
|
||||||
|
// specific event
|
||||||
|
var callbacks = this._callbacks['$' + event]; |
||||||
|
if (!callbacks) return this; |
||||||
|
|
||||||
|
// remove all handlers
|
||||||
|
if (1 == arguments.length) { |
||||||
|
delete this._callbacks['$' + event]; |
||||||
|
return this; |
||||||
|
} |
||||||
|
|
||||||
|
// remove specific handler
|
||||||
|
var cb; |
||||||
|
for (var i = 0; i < callbacks.length; i++) { |
||||||
|
cb = callbacks[i]; |
||||||
|
if (cb === fn || cb.fn === fn) { |
||||||
|
callbacks.splice(i, 1); |
||||||
|
break; |
||||||
|
} |
||||||
|
} |
||||||
|
|
||||||
|
// Remove event specific arrays for event types that no
|
||||||
|
// one is subscribed for to avoid memory leak.
|
||||||
|
if (callbacks.length === 0) { |
||||||
|
delete this._callbacks['$' + event]; |
||||||
|
} |
||||||
|
|
||||||
|
return this; |
||||||
|
}; |
||||||
|
|
||||||
|
/** |
||||||
|
* Emit `event` with the given args. |
||||||
|
* |
||||||
|
* @param {String} event |
||||||
|
* @param {Mixed} ... |
||||||
|
* @return {Emitter} |
||||||
|
*/ |
||||||
|
|
||||||
|
Emitter.prototype.emit = function(event){ |
||||||
|
this._callbacks = this._callbacks || {}; |
||||||
|
|
||||||
|
var args = new Array(arguments.length - 1) |
||||||
|
, callbacks = this._callbacks['$' + event]; |
||||||
|
|
||||||
|
for (var i = 1; i < arguments.length; i++) { |
||||||
|
args[i - 1] = arguments[i]; |
||||||
|
} |
||||||
|
|
||||||
|
if (callbacks) { |
||||||
|
callbacks = callbacks.slice(0); |
||||||
|
for (var i = 0, len = callbacks.length; i < len; ++i) { |
||||||
|
callbacks[i].apply(this, args); |
||||||
|
} |
||||||
|
} |
||||||
|
|
||||||
|
return this; |
||||||
|
}; |
||||||
|
|
||||||
|
// alias used for reserved events (protected method)
|
||||||
|
Emitter.prototype.emitReserved = Emitter.prototype.emit; |
||||||
|
|
||||||
|
/** |
||||||
|
* Return array of callbacks for `event`. |
||||||
|
* |
||||||
|
* @param {String} event |
||||||
|
* @return {Array} |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
|
||||||
|
Emitter.prototype.listeners = function(event){ |
||||||
|
this._callbacks = this._callbacks || {}; |
||||||
|
return this._callbacks['$' + event] || []; |
||||||
|
}; |
||||||
|
|
||||||
|
/** |
||||||
|
* Check if this emitter has `event` handlers. |
||||||
|
* |
||||||
|
* @param {String} event |
||||||
|
* @return {Boolean} |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
|
||||||
|
Emitter.prototype.hasListeners = function(event){ |
||||||
|
return !! this.listeners(event).length; |
||||||
|
}; |
@ -0,0 +1,31 @@ |
|||||||
|
{ |
||||||
|
"name": "@socket.io/component-emitter", |
||||||
|
"description": "Event emitter", |
||||||
|
"version": "3.1.0", |
||||||
|
"license": "MIT", |
||||||
|
"devDependencies": { |
||||||
|
"mocha": "*", |
||||||
|
"should": "*" |
||||||
|
}, |
||||||
|
"component": { |
||||||
|
"scripts": { |
||||||
|
"emitter/index.js": "index.js" |
||||||
|
} |
||||||
|
}, |
||||||
|
"main": "index.js", |
||||||
|
"module": "index.mjs", |
||||||
|
"types": "index.d.ts", |
||||||
|
"repository": { |
||||||
|
"type": "git", |
||||||
|
"url": "https://github.com/socketio/emitter.git" |
||||||
|
}, |
||||||
|
"scripts": { |
||||||
|
"test": "make test" |
||||||
|
}, |
||||||
|
"files": [ |
||||||
|
"index.js", |
||||||
|
"index.mjs", |
||||||
|
"index.d.ts", |
||||||
|
"LICENSE" |
||||||
|
] |
||||||
|
} |
@ -0,0 +1,21 @@ |
|||||||
|
MIT License |
||||||
|
|
||||||
|
Copyright (c) Microsoft Corporation. |
||||||
|
|
||||||
|
Permission is hereby granted, free of charge, to any person obtaining a copy |
||||||
|
of this software and associated documentation files (the "Software"), to deal |
||||||
|
in the Software without restriction, including without limitation the rights |
||||||
|
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell |
||||||
|
copies of the Software, and to permit persons to whom the Software is |
||||||
|
furnished to do so, subject to the following conditions: |
||||||
|
|
||||||
|
The above copyright notice and this permission notice shall be included in all |
||||||
|
copies or substantial portions of the Software. |
||||||
|
|
||||||
|
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR |
||||||
|
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, |
||||||
|
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE |
||||||
|
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER |
||||||
|
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, |
||||||
|
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE |
||||||
|
SOFTWARE |
@ -0,0 +1,16 @@ |
|||||||
|
# Installation |
||||||
|
> `npm install --save @types/node` |
||||||
|
|
||||||
|
# Summary |
||||||
|
This package contains type definitions for Node.js (https://nodejs.org/). |
||||||
|
|
||||||
|
# Details |
||||||
|
Files were exported from https://github.com/DefinitelyTyped/DefinitelyTyped/tree/master/types/node. |
||||||
|
|
||||||
|
### Additional Details |
||||||
|
* Last updated: Mon, 15 Aug 2022 18:32:42 GMT |
||||||
|
* Dependencies: none |
||||||
|
* Global values: `AbortController`, `AbortSignal`, `__dirname`, `__filename`, `console`, `exports`, `gc`, `global`, `module`, `process`, `require`, `structuredClone` |
||||||
|
|
||||||
|
# Credits |
||||||
|
These definitions were written by [Microsoft TypeScript](https://github.com/Microsoft), [DefinitelyTyped](https://github.com/DefinitelyTyped), [Alberto Schiabel](https://github.com/jkomyno), [Alvis HT Tang](https://github.com/alvis), [Andrew Makarov](https://github.com/r3nya), [Benjamin Toueg](https://github.com/btoueg), [Chigozirim C.](https://github.com/smac89), [David Junger](https://github.com/touffy), [Deividas Bakanas](https://github.com/DeividasBakanas), [Eugene Y. Q. Shen](https://github.com/eyqs), [Hannes Magnusson](https://github.com/Hannes-Magnusson-CK), [Huw](https://github.com/hoo29), [Kelvin Jin](https://github.com/kjin), [Klaus Meinhardt](https://github.com/ajafff), [Lishude](https://github.com/islishude), [Mariusz Wiktorczyk](https://github.com/mwiktorczyk), [Mohsen Azimi](https://github.com/mohsen1), [Nicolas Even](https://github.com/n-e), [Nikita Galkin](https://github.com/galkin), [Parambir Singh](https://github.com/parambirs), [Sebastian Silbermann](https://github.com/eps1lon), [Simon Schick](https://github.com/SimonSchick), [Thomas den Hollander](https://github.com/ThomasdenH), [Wilco Bakker](https://github.com/WilcoBakker), [wwwy3y3](https://github.com/wwwy3y3), [Samuel Ainsworth](https://github.com/samuela), [Kyle Uehlein](https://github.com/kuehlein), [Thanik Bhongbhibhat](https://github.com/bhongy), [Marcin Kopacz](https://github.com/chyzwar), [Trivikram Kamat](https://github.com/trivikr), [Junxiao Shi](https://github.com/yoursunny), [Ilia Baryshnikov](https://github.com/qwelias), [ExE Boss](https://github.com/ExE-Boss), [Piotr Błażejewicz](https://github.com/peterblazejewicz), [Anna Henningsen](https://github.com/addaleax), [Victor Perin](https://github.com/victorperin), [Yongsheng Zhang](https://github.com/ZYSzys), [NodeJS Contributors](https://github.com/NodeJS), [Linus Unnebäck](https://github.com/LinusU), [wafuwafu13](https://github.com/wafuwafu13), and [Matteo Collina](https://github.com/mcollina). |
@ -0,0 +1,911 @@ |
|||||||
|
/** |
||||||
|
* The `assert` module provides a set of assertion functions for verifying |
||||||
|
* invariants. |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/assert.js)
|
||||||
|
*/ |
||||||
|
declare module 'assert' { |
||||||
|
/** |
||||||
|
* An alias of {@link ok}. |
||||||
|
* @since v0.5.9 |
||||||
|
* @param value The input that is checked for being truthy. |
||||||
|
*/ |
||||||
|
function assert(value: unknown, message?: string | Error): asserts value; |
||||||
|
namespace assert { |
||||||
|
/** |
||||||
|
* Indicates the failure of an assertion. All errors thrown by the `assert` module |
||||||
|
* will be instances of the `AssertionError` class. |
||||||
|
*/ |
||||||
|
class AssertionError extends Error { |
||||||
|
actual: unknown; |
||||||
|
expected: unknown; |
||||||
|
operator: string; |
||||||
|
generatedMessage: boolean; |
||||||
|
code: 'ERR_ASSERTION'; |
||||||
|
constructor(options?: { |
||||||
|
/** If provided, the error message is set to this value. */ |
||||||
|
message?: string | undefined; |
||||||
|
/** The `actual` property on the error instance. */ |
||||||
|
actual?: unknown | undefined; |
||||||
|
/** The `expected` property on the error instance. */ |
||||||
|
expected?: unknown | undefined; |
||||||
|
/** The `operator` property on the error instance. */ |
||||||
|
operator?: string | undefined; |
||||||
|
/** If provided, the generated stack trace omits frames before this function. */ |
||||||
|
// tslint:disable-next-line:ban-types
|
||||||
|
stackStartFn?: Function | undefined; |
||||||
|
}); |
||||||
|
} |
||||||
|
/** |
||||||
|
* This feature is currently experimental and behavior might still change. |
||||||
|
* @since v14.2.0, v12.19.0 |
||||||
|
* @experimental |
||||||
|
*/ |
||||||
|
class CallTracker { |
||||||
|
/** |
||||||
|
* The wrapper function is expected to be called exactly `exact` times. If the |
||||||
|
* function has not been called exactly `exact` times when `tracker.verify()` is called, then `tracker.verify()` will throw an |
||||||
|
* error. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert'; |
||||||
|
* |
||||||
|
* // Creates call tracker.
|
||||||
|
* const tracker = new assert.CallTracker(); |
||||||
|
* |
||||||
|
* function func() {} |
||||||
|
* |
||||||
|
* // Returns a function that wraps func() that must be called exact times
|
||||||
|
* // before tracker.verify().
|
||||||
|
* const callsfunc = tracker.calls(func); |
||||||
|
* ``` |
||||||
|
* @since v14.2.0, v12.19.0 |
||||||
|
* @param [fn='A no-op function'] |
||||||
|
* @param [exact=1] |
||||||
|
* @return that wraps `fn`. |
||||||
|
*/ |
||||||
|
calls(exact?: number): () => void; |
||||||
|
calls<Func extends (...args: any[]) => any>(fn?: Func, exact?: number): Func; |
||||||
|
/** |
||||||
|
* The arrays contains information about the expected and actual number of calls of |
||||||
|
* the functions that have not been called the expected number of times. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert'; |
||||||
|
* |
||||||
|
* // Creates call tracker.
|
||||||
|
* const tracker = new assert.CallTracker(); |
||||||
|
* |
||||||
|
* function func() {} |
||||||
|
* |
||||||
|
* function foo() {} |
||||||
|
* |
||||||
|
* // Returns a function that wraps func() that must be called exact times
|
||||||
|
* // before tracker.verify().
|
||||||
|
* const callsfunc = tracker.calls(func, 2); |
||||||
|
* |
||||||
|
* // Returns an array containing information on callsfunc()
|
||||||
|
* tracker.report(); |
||||||
|
* // [
|
||||||
|
* // {
|
||||||
|
* // message: 'Expected the func function to be executed 2 time(s) but was
|
||||||
|
* // executed 0 time(s).',
|
||||||
|
* // actual: 0,
|
||||||
|
* // expected: 2,
|
||||||
|
* // operator: 'func',
|
||||||
|
* // stack: stack trace
|
||||||
|
* // }
|
||||||
|
* // ]
|
||||||
|
* ``` |
||||||
|
* @since v14.2.0, v12.19.0 |
||||||
|
* @return of objects containing information about the wrapper functions returned by `calls`. |
||||||
|
*/ |
||||||
|
report(): CallTrackerReportInformation[]; |
||||||
|
/** |
||||||
|
* Iterates through the list of functions passed to `tracker.calls()` and will throw an error for functions that |
||||||
|
* have not been called the expected number of times. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert'; |
||||||
|
* |
||||||
|
* // Creates call tracker.
|
||||||
|
* const tracker = new assert.CallTracker(); |
||||||
|
* |
||||||
|
* function func() {} |
||||||
|
* |
||||||
|
* // Returns a function that wraps func() that must be called exact times
|
||||||
|
* // before tracker.verify().
|
||||||
|
* const callsfunc = tracker.calls(func, 2); |
||||||
|
* |
||||||
|
* callsfunc(); |
||||||
|
* |
||||||
|
* // Will throw an error since callsfunc() was only called once.
|
||||||
|
* tracker.verify(); |
||||||
|
* ``` |
||||||
|
* @since v14.2.0, v12.19.0 |
||||||
|
*/ |
||||||
|
verify(): void; |
||||||
|
} |
||||||
|
interface CallTrackerReportInformation { |
||||||
|
message: string; |
||||||
|
/** The actual number of times the function was called. */ |
||||||
|
actual: number; |
||||||
|
/** The number of times the function was expected to be called. */ |
||||||
|
expected: number; |
||||||
|
/** The name of the function that is wrapped. */ |
||||||
|
operator: string; |
||||||
|
/** A stack trace of the function. */ |
||||||
|
stack: object; |
||||||
|
} |
||||||
|
type AssertPredicate = RegExp | (new () => object) | ((thrown: unknown) => boolean) | object | Error; |
||||||
|
/** |
||||||
|
* Throws an `AssertionError` with the provided error message or a default |
||||||
|
* error message. If the `message` parameter is an instance of an `Error` then |
||||||
|
* it will be thrown instead of the `AssertionError`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* assert.fail(); |
||||||
|
* // AssertionError [ERR_ASSERTION]: Failed
|
||||||
|
* |
||||||
|
* assert.fail('boom'); |
||||||
|
* // AssertionError [ERR_ASSERTION]: boom
|
||||||
|
* |
||||||
|
* assert.fail(new TypeError('need array')); |
||||||
|
* // TypeError: need array
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Using `assert.fail()` with more than two arguments is possible but deprecated. |
||||||
|
* See below for further details. |
||||||
|
* @since v0.1.21 |
||||||
|
* @param [message='Failed'] |
||||||
|
*/ |
||||||
|
function fail(message?: string | Error): never; |
||||||
|
/** @deprecated since v10.0.0 - use fail([message]) or other assert functions instead. */ |
||||||
|
function fail( |
||||||
|
actual: unknown, |
||||||
|
expected: unknown, |
||||||
|
message?: string | Error, |
||||||
|
operator?: string, |
||||||
|
// tslint:disable-next-line:ban-types
|
||||||
|
stackStartFn?: Function |
||||||
|
): never; |
||||||
|
/** |
||||||
|
* Tests if `value` is truthy. It is equivalent to`assert.equal(!!value, true, message)`. |
||||||
|
* |
||||||
|
* If `value` is not truthy, an `AssertionError` is thrown with a `message`property set equal to the value of the `message` parameter. If the `message`parameter is `undefined`, a default |
||||||
|
* error message is assigned. If the `message`parameter is an instance of an `Error` then it will be thrown instead of the`AssertionError`. |
||||||
|
* If no arguments are passed in at all `message` will be set to the string:`` 'No value argument passed to `assert.ok()`' ``. |
||||||
|
* |
||||||
|
* Be aware that in the `repl` the error message will be different to the one |
||||||
|
* thrown in a file! See below for further details. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* assert.ok(true); |
||||||
|
* // OK
|
||||||
|
* assert.ok(1); |
||||||
|
* // OK
|
||||||
|
* |
||||||
|
* assert.ok(); |
||||||
|
* // AssertionError: No value argument passed to `assert.ok()`
|
||||||
|
* |
||||||
|
* assert.ok(false, 'it\'s false'); |
||||||
|
* // AssertionError: it's false
|
||||||
|
* |
||||||
|
* // In the repl:
|
||||||
|
* assert.ok(typeof 123 === 'string'); |
||||||
|
* // AssertionError: false == true
|
||||||
|
* |
||||||
|
* // In a file (e.g. test.js):
|
||||||
|
* assert.ok(typeof 123 === 'string'); |
||||||
|
* // AssertionError: The expression evaluated to a falsy value:
|
||||||
|
* //
|
||||||
|
* // assert.ok(typeof 123 === 'string')
|
||||||
|
* |
||||||
|
* assert.ok(false); |
||||||
|
* // AssertionError: The expression evaluated to a falsy value:
|
||||||
|
* //
|
||||||
|
* // assert.ok(false)
|
||||||
|
* |
||||||
|
* assert.ok(0); |
||||||
|
* // AssertionError: The expression evaluated to a falsy value:
|
||||||
|
* //
|
||||||
|
* // assert.ok(0)
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* // Using `assert()` works the same:
|
||||||
|
* assert(0); |
||||||
|
* // AssertionError: The expression evaluated to a falsy value:
|
||||||
|
* //
|
||||||
|
* // assert(0)
|
||||||
|
* ``` |
||||||
|
* @since v0.1.21 |
||||||
|
*/ |
||||||
|
function ok(value: unknown, message?: string | Error): asserts value; |
||||||
|
/** |
||||||
|
* **Strict assertion mode** |
||||||
|
* |
||||||
|
* An alias of {@link strictEqual}. |
||||||
|
* |
||||||
|
* **Legacy assertion mode** |
||||||
|
* |
||||||
|
* > Stability: 3 - Legacy: Use {@link strictEqual} instead. |
||||||
|
* |
||||||
|
* Tests shallow, coercive equality between the `actual` and `expected` parameters |
||||||
|
* using the [`==` operator](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Operators/Equality). `NaN` is specially handled
|
||||||
|
* and treated as being identical if both sides are `NaN`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert'; |
||||||
|
* |
||||||
|
* assert.equal(1, 1); |
||||||
|
* // OK, 1 == 1
|
||||||
|
* assert.equal(1, '1'); |
||||||
|
* // OK, 1 == '1'
|
||||||
|
* assert.equal(NaN, NaN); |
||||||
|
* // OK
|
||||||
|
* |
||||||
|
* assert.equal(1, 2); |
||||||
|
* // AssertionError: 1 == 2
|
||||||
|
* assert.equal({ a: { b: 1 } }, { a: { b: 1 } }); |
||||||
|
* // AssertionError: { a: { b: 1 } } == { a: { b: 1 } }
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* If the values are not equal, an `AssertionError` is thrown with a `message`property set equal to the value of the `message` parameter. If the `message`parameter is undefined, a default |
||||||
|
* error message is assigned. If the `message`parameter is an instance of an `Error` then it will be thrown instead of the`AssertionError`. |
||||||
|
* @since v0.1.21 |
||||||
|
*/ |
||||||
|
function equal(actual: unknown, expected: unknown, message?: string | Error): void; |
||||||
|
/** |
||||||
|
* **Strict assertion mode** |
||||||
|
* |
||||||
|
* An alias of {@link notStrictEqual}. |
||||||
|
* |
||||||
|
* **Legacy assertion mode** |
||||||
|
* |
||||||
|
* > Stability: 3 - Legacy: Use {@link notStrictEqual} instead. |
||||||
|
* |
||||||
|
* Tests shallow, coercive inequality with the [`!=` operator](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Operators/Inequality). `NaN` is
|
||||||
|
* specially handled and treated as being identical if both sides are `NaN`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert'; |
||||||
|
* |
||||||
|
* assert.notEqual(1, 2); |
||||||
|
* // OK
|
||||||
|
* |
||||||
|
* assert.notEqual(1, 1); |
||||||
|
* // AssertionError: 1 != 1
|
||||||
|
* |
||||||
|
* assert.notEqual(1, '1'); |
||||||
|
* // AssertionError: 1 != '1'
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* If the values are equal, an `AssertionError` is thrown with a `message`property set equal to the value of the `message` parameter. If the `message`parameter is undefined, a default error |
||||||
|
* message is assigned. If the `message`parameter is an instance of an `Error` then it will be thrown instead of the`AssertionError`. |
||||||
|
* @since v0.1.21 |
||||||
|
*/ |
||||||
|
function notEqual(actual: unknown, expected: unknown, message?: string | Error): void; |
||||||
|
/** |
||||||
|
* **Strict assertion mode** |
||||||
|
* |
||||||
|
* An alias of {@link deepStrictEqual}. |
||||||
|
* |
||||||
|
* **Legacy assertion mode** |
||||||
|
* |
||||||
|
* > Stability: 3 - Legacy: Use {@link deepStrictEqual} instead. |
||||||
|
* |
||||||
|
* Tests for deep equality between the `actual` and `expected` parameters. Consider |
||||||
|
* using {@link deepStrictEqual} instead. {@link deepEqual} can have |
||||||
|
* surprising results. |
||||||
|
* |
||||||
|
* _Deep equality_ means that the enumerable "own" properties of child objects |
||||||
|
* are also recursively evaluated by the following rules. |
||||||
|
* @since v0.1.21 |
||||||
|
*/ |
||||||
|
function deepEqual(actual: unknown, expected: unknown, message?: string | Error): void; |
||||||
|
/** |
||||||
|
* **Strict assertion mode** |
||||||
|
* |
||||||
|
* An alias of {@link notDeepStrictEqual}. |
||||||
|
* |
||||||
|
* **Legacy assertion mode** |
||||||
|
* |
||||||
|
* > Stability: 3 - Legacy: Use {@link notDeepStrictEqual} instead. |
||||||
|
* |
||||||
|
* Tests for any deep inequality. Opposite of {@link deepEqual}. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert'; |
||||||
|
* |
||||||
|
* const obj1 = { |
||||||
|
* a: { |
||||||
|
* b: 1 |
||||||
|
* } |
||||||
|
* }; |
||||||
|
* const obj2 = { |
||||||
|
* a: { |
||||||
|
* b: 2 |
||||||
|
* } |
||||||
|
* }; |
||||||
|
* const obj3 = { |
||||||
|
* a: { |
||||||
|
* b: 1 |
||||||
|
* } |
||||||
|
* }; |
||||||
|
* const obj4 = Object.create(obj1); |
||||||
|
* |
||||||
|
* assert.notDeepEqual(obj1, obj1); |
||||||
|
* // AssertionError: { a: { b: 1 } } notDeepEqual { a: { b: 1 } }
|
||||||
|
* |
||||||
|
* assert.notDeepEqual(obj1, obj2); |
||||||
|
* // OK
|
||||||
|
* |
||||||
|
* assert.notDeepEqual(obj1, obj3); |
||||||
|
* // AssertionError: { a: { b: 1 } } notDeepEqual { a: { b: 1 } }
|
||||||
|
* |
||||||
|
* assert.notDeepEqual(obj1, obj4); |
||||||
|
* // OK
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* If the values are deeply equal, an `AssertionError` is thrown with a`message` property set equal to the value of the `message` parameter. If the`message` parameter is undefined, a default |
||||||
|
* error message is assigned. If the`message` parameter is an instance of an `Error` then it will be thrown |
||||||
|
* instead of the `AssertionError`. |
||||||
|
* @since v0.1.21 |
||||||
|
*/ |
||||||
|
function notDeepEqual(actual: unknown, expected: unknown, message?: string | Error): void; |
||||||
|
/** |
||||||
|
* Tests strict equality between the `actual` and `expected` parameters as |
||||||
|
* determined by [`Object.is()`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/is).
|
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* assert.strictEqual(1, 2); |
||||||
|
* // AssertionError [ERR_ASSERTION]: Expected inputs to be strictly equal:
|
||||||
|
* //
|
||||||
|
* // 1 !== 2
|
||||||
|
* |
||||||
|
* assert.strictEqual(1, 1); |
||||||
|
* // OK
|
||||||
|
* |
||||||
|
* assert.strictEqual('Hello foobar', 'Hello World!'); |
||||||
|
* // AssertionError [ERR_ASSERTION]: Expected inputs to be strictly equal:
|
||||||
|
* // + actual - expected
|
||||||
|
* //
|
||||||
|
* // + 'Hello foobar'
|
||||||
|
* // - 'Hello World!'
|
||||||
|
* // ^
|
||||||
|
* |
||||||
|
* const apples = 1; |
||||||
|
* const oranges = 2; |
||||||
|
* assert.strictEqual(apples, oranges, `apples ${apples} !== oranges ${oranges}`); |
||||||
|
* // AssertionError [ERR_ASSERTION]: apples 1 !== oranges 2
|
||||||
|
* |
||||||
|
* assert.strictEqual(1, '1', new TypeError('Inputs are not identical')); |
||||||
|
* // TypeError: Inputs are not identical
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* If the values are not strictly equal, an `AssertionError` is thrown with a`message` property set equal to the value of the `message` parameter. If the`message` parameter is undefined, a |
||||||
|
* default error message is assigned. If the`message` parameter is an instance of an `Error` then it will be thrown |
||||||
|
* instead of the `AssertionError`. |
||||||
|
* @since v0.1.21 |
||||||
|
*/ |
||||||
|
function strictEqual<T>(actual: unknown, expected: T, message?: string | Error): asserts actual is T; |
||||||
|
/** |
||||||
|
* Tests strict inequality between the `actual` and `expected` parameters as |
||||||
|
* determined by [`Object.is()`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/is).
|
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* assert.notStrictEqual(1, 2); |
||||||
|
* // OK
|
||||||
|
* |
||||||
|
* assert.notStrictEqual(1, 1); |
||||||
|
* // AssertionError [ERR_ASSERTION]: Expected "actual" to be strictly unequal to:
|
||||||
|
* //
|
||||||
|
* // 1
|
||||||
|
* |
||||||
|
* assert.notStrictEqual(1, '1'); |
||||||
|
* // OK
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* If the values are strictly equal, an `AssertionError` is thrown with a`message` property set equal to the value of the `message` parameter. If the`message` parameter is undefined, a |
||||||
|
* default error message is assigned. If the`message` parameter is an instance of an `Error` then it will be thrown |
||||||
|
* instead of the `AssertionError`. |
||||||
|
* @since v0.1.21 |
||||||
|
*/ |
||||||
|
function notStrictEqual(actual: unknown, expected: unknown, message?: string | Error): void; |
||||||
|
/** |
||||||
|
* Tests for deep equality between the `actual` and `expected` parameters. |
||||||
|
* "Deep" equality means that the enumerable "own" properties of child objects |
||||||
|
* are recursively evaluated also by the following rules. |
||||||
|
* @since v1.2.0 |
||||||
|
*/ |
||||||
|
function deepStrictEqual<T>(actual: unknown, expected: T, message?: string | Error): asserts actual is T; |
||||||
|
/** |
||||||
|
* Tests for deep strict inequality. Opposite of {@link deepStrictEqual}. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* assert.notDeepStrictEqual({ a: 1 }, { a: '1' }); |
||||||
|
* // OK
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* If the values are deeply and strictly equal, an `AssertionError` is thrown |
||||||
|
* with a `message` property set equal to the value of the `message` parameter. If |
||||||
|
* the `message` parameter is undefined, a default error message is assigned. If |
||||||
|
* the `message` parameter is an instance of an `Error` then it will be thrown |
||||||
|
* instead of the `AssertionError`. |
||||||
|
* @since v1.2.0 |
||||||
|
*/ |
||||||
|
function notDeepStrictEqual(actual: unknown, expected: unknown, message?: string | Error): void; |
||||||
|
/** |
||||||
|
* Expects the function `fn` to throw an error. |
||||||
|
* |
||||||
|
* If specified, `error` can be a [`Class`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Classes),
|
||||||
|
* [`RegExp`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Guide/Regular_Expressions), a validation function,
|
||||||
|
* a validation object where each property will be tested for strict deep equality, |
||||||
|
* or an instance of error where each property will be tested for strict deep |
||||||
|
* equality including the non-enumerable `message` and `name` properties. When |
||||||
|
* using an object, it is also possible to use a regular expression, when |
||||||
|
* validating against a string property. See below for examples. |
||||||
|
* |
||||||
|
* If specified, `message` will be appended to the message provided by the`AssertionError` if the `fn` call fails to throw or in case the error validation |
||||||
|
* fails. |
||||||
|
* |
||||||
|
* Custom validation object/error instance: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* const err = new TypeError('Wrong value'); |
||||||
|
* err.code = 404; |
||||||
|
* err.foo = 'bar'; |
||||||
|
* err.info = { |
||||||
|
* nested: true, |
||||||
|
* baz: 'text' |
||||||
|
* }; |
||||||
|
* err.reg = /abc/i; |
||||||
|
* |
||||||
|
* assert.throws( |
||||||
|
* () => { |
||||||
|
* throw err; |
||||||
|
* }, |
||||||
|
* { |
||||||
|
* name: 'TypeError', |
||||||
|
* message: 'Wrong value', |
||||||
|
* info: { |
||||||
|
* nested: true, |
||||||
|
* baz: 'text' |
||||||
|
* } |
||||||
|
* // Only properties on the validation object will be tested for.
|
||||||
|
* // Using nested objects requires all properties to be present. Otherwise
|
||||||
|
* // the validation is going to fail.
|
||||||
|
* } |
||||||
|
* ); |
||||||
|
* |
||||||
|
* // Using regular expressions to validate error properties:
|
||||||
|
* throws( |
||||||
|
* () => { |
||||||
|
* throw err; |
||||||
|
* }, |
||||||
|
* { |
||||||
|
* // The `name` and `message` properties are strings and using regular
|
||||||
|
* // expressions on those will match against the string. If they fail, an
|
||||||
|
* // error is thrown.
|
||||||
|
* name: /^TypeError$/, |
||||||
|
* message: /Wrong/, |
||||||
|
* foo: 'bar', |
||||||
|
* info: { |
||||||
|
* nested: true, |
||||||
|
* // It is not possible to use regular expressions for nested properties!
|
||||||
|
* baz: 'text' |
||||||
|
* }, |
||||||
|
* // The `reg` property contains a regular expression and only if the
|
||||||
|
* // validation object contains an identical regular expression, it is going
|
||||||
|
* // to pass.
|
||||||
|
* reg: /abc/i |
||||||
|
* } |
||||||
|
* ); |
||||||
|
* |
||||||
|
* // Fails due to the different `message` and `name` properties:
|
||||||
|
* throws( |
||||||
|
* () => { |
||||||
|
* const otherErr = new Error('Not found'); |
||||||
|
* // Copy all enumerable properties from `err` to `otherErr`.
|
||||||
|
* for (const [key, value] of Object.entries(err)) { |
||||||
|
* otherErr[key] = value; |
||||||
|
* } |
||||||
|
* throw otherErr; |
||||||
|
* }, |
||||||
|
* // The error's `message` and `name` properties will also be checked when using
|
||||||
|
* // an error as validation object.
|
||||||
|
* err |
||||||
|
* ); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Validate instanceof using constructor: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* assert.throws( |
||||||
|
* () => { |
||||||
|
* throw new Error('Wrong value'); |
||||||
|
* }, |
||||||
|
* Error |
||||||
|
* ); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Validate error message using [`RegExp`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Guide/Regular_Expressions):
|
||||||
|
* |
||||||
|
* Using a regular expression runs `.toString` on the error object, and will |
||||||
|
* therefore also include the error name. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* assert.throws( |
||||||
|
* () => { |
||||||
|
* throw new Error('Wrong value'); |
||||||
|
* }, |
||||||
|
* /^Error: Wrong value$/ |
||||||
|
* ); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Custom error validation: |
||||||
|
* |
||||||
|
* The function must return `true` to indicate all internal validations passed. |
||||||
|
* It will otherwise fail with an `AssertionError`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* assert.throws( |
||||||
|
* () => { |
||||||
|
* throw new Error('Wrong value'); |
||||||
|
* }, |
||||||
|
* (err) => { |
||||||
|
* assert(err instanceof Error); |
||||||
|
* assert(/value/.test(err)); |
||||||
|
* // Avoid returning anything from validation functions besides `true`.
|
||||||
|
* // Otherwise, it's not clear what part of the validation failed. Instead,
|
||||||
|
* // throw an error about the specific validation that failed (as done in this
|
||||||
|
* // example) and add as much helpful debugging information to that error as
|
||||||
|
* // possible.
|
||||||
|
* return true; |
||||||
|
* }, |
||||||
|
* 'unexpected error' |
||||||
|
* ); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* `error` cannot be a string. If a string is provided as the second |
||||||
|
* argument, then `error` is assumed to be omitted and the string will be used for`message` instead. This can lead to easy-to-miss mistakes. Using the same |
||||||
|
* message as the thrown error message is going to result in an`ERR_AMBIGUOUS_ARGUMENT` error. Please read the example below carefully if using |
||||||
|
* a string as the second argument gets considered: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* function throwingFirst() { |
||||||
|
* throw new Error('First'); |
||||||
|
* } |
||||||
|
* |
||||||
|
* function throwingSecond() { |
||||||
|
* throw new Error('Second'); |
||||||
|
* } |
||||||
|
* |
||||||
|
* function notThrowing() {} |
||||||
|
* |
||||||
|
* // The second argument is a string and the input function threw an Error.
|
||||||
|
* // The first case will not throw as it does not match for the error message
|
||||||
|
* // thrown by the input function!
|
||||||
|
* assert.throws(throwingFirst, 'Second'); |
||||||
|
* // In the next example the message has no benefit over the message from the
|
||||||
|
* // error and since it is not clear if the user intended to actually match
|
||||||
|
* // against the error message, Node.js throws an `ERR_AMBIGUOUS_ARGUMENT` error.
|
||||||
|
* assert.throws(throwingSecond, 'Second'); |
||||||
|
* // TypeError [ERR_AMBIGUOUS_ARGUMENT]
|
||||||
|
* |
||||||
|
* // The string is only used (as message) in case the function does not throw:
|
||||||
|
* assert.throws(notThrowing, 'Second'); |
||||||
|
* // AssertionError [ERR_ASSERTION]: Missing expected exception: Second
|
||||||
|
* |
||||||
|
* // If it was intended to match for the error message do this instead:
|
||||||
|
* // It does not throw because the error messages match.
|
||||||
|
* assert.throws(throwingSecond, /Second$/); |
||||||
|
* |
||||||
|
* // If the error message does not match, an AssertionError is thrown.
|
||||||
|
* assert.throws(throwingFirst, /Second$/); |
||||||
|
* // AssertionError [ERR_ASSERTION]
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Due to the confusing error-prone notation, avoid a string as the second |
||||||
|
* argument. |
||||||
|
* @since v0.1.21 |
||||||
|
*/ |
||||||
|
function throws(block: () => unknown, message?: string | Error): void; |
||||||
|
function throws(block: () => unknown, error: AssertPredicate, message?: string | Error): void; |
||||||
|
/** |
||||||
|
* Asserts that the function `fn` does not throw an error. |
||||||
|
* |
||||||
|
* Using `assert.doesNotThrow()` is actually not useful because there |
||||||
|
* is no benefit in catching an error and then rethrowing it. Instead, consider |
||||||
|
* adding a comment next to the specific code path that should not throw and keep |
||||||
|
* error messages as expressive as possible. |
||||||
|
* |
||||||
|
* When `assert.doesNotThrow()` is called, it will immediately call the `fn`function. |
||||||
|
* |
||||||
|
* If an error is thrown and it is the same type as that specified by the `error`parameter, then an `AssertionError` is thrown. If the error is of a |
||||||
|
* different type, or if the `error` parameter is undefined, the error is |
||||||
|
* propagated back to the caller. |
||||||
|
* |
||||||
|
* If specified, `error` can be a [`Class`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Classes),
|
||||||
|
* [`RegExp`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Guide/Regular_Expressions) or a validation
|
||||||
|
* function. See {@link throws} for more details. |
||||||
|
* |
||||||
|
* The following, for instance, will throw the `TypeError` because there is no |
||||||
|
* matching error type in the assertion: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* assert.doesNotThrow( |
||||||
|
* () => { |
||||||
|
* throw new TypeError('Wrong value'); |
||||||
|
* }, |
||||||
|
* SyntaxError |
||||||
|
* ); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* However, the following will result in an `AssertionError` with the message |
||||||
|
* 'Got unwanted exception...': |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* assert.doesNotThrow( |
||||||
|
* () => { |
||||||
|
* throw new TypeError('Wrong value'); |
||||||
|
* }, |
||||||
|
* TypeError |
||||||
|
* ); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* If an `AssertionError` is thrown and a value is provided for the `message`parameter, the value of `message` will be appended to the `AssertionError` message: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* assert.doesNotThrow( |
||||||
|
* () => { |
||||||
|
* throw new TypeError('Wrong value'); |
||||||
|
* }, |
||||||
|
* /Wrong value/, |
||||||
|
* 'Whoops' |
||||||
|
* ); |
||||||
|
* // Throws: AssertionError: Got unwanted exception: Whoops
|
||||||
|
* ``` |
||||||
|
* @since v0.1.21 |
||||||
|
*/ |
||||||
|
function doesNotThrow(block: () => unknown, message?: string | Error): void; |
||||||
|
function doesNotThrow(block: () => unknown, error: AssertPredicate, message?: string | Error): void; |
||||||
|
/** |
||||||
|
* Throws `value` if `value` is not `undefined` or `null`. This is useful when |
||||||
|
* testing the `error` argument in callbacks. The stack trace contains all frames |
||||||
|
* from the error passed to `ifError()` including the potential new frames for`ifError()` itself. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* assert.ifError(null); |
||||||
|
* // OK
|
||||||
|
* assert.ifError(0); |
||||||
|
* // AssertionError [ERR_ASSERTION]: ifError got unwanted exception: 0
|
||||||
|
* assert.ifError('error'); |
||||||
|
* // AssertionError [ERR_ASSERTION]: ifError got unwanted exception: 'error'
|
||||||
|
* assert.ifError(new Error()); |
||||||
|
* // AssertionError [ERR_ASSERTION]: ifError got unwanted exception: Error
|
||||||
|
* |
||||||
|
* // Create some random error frames.
|
||||||
|
* let err; |
||||||
|
* (function errorFrame() { |
||||||
|
* err = new Error('test error'); |
||||||
|
* })(); |
||||||
|
* |
||||||
|
* (function ifErrorFrame() { |
||||||
|
* assert.ifError(err); |
||||||
|
* })(); |
||||||
|
* // AssertionError [ERR_ASSERTION]: ifError got unwanted exception: test error
|
||||||
|
* // at ifErrorFrame
|
||||||
|
* // at errorFrame
|
||||||
|
* ``` |
||||||
|
* @since v0.1.97 |
||||||
|
*/ |
||||||
|
function ifError(value: unknown): asserts value is null | undefined; |
||||||
|
/** |
||||||
|
* Awaits the `asyncFn` promise or, if `asyncFn` is a function, immediately |
||||||
|
* calls the function and awaits the returned promise to complete. It will then |
||||||
|
* check that the promise is rejected. |
||||||
|
* |
||||||
|
* If `asyncFn` is a function and it throws an error synchronously,`assert.rejects()` will return a rejected `Promise` with that error. If the |
||||||
|
* function does not return a promise, `assert.rejects()` will return a rejected`Promise` with an `ERR_INVALID_RETURN_VALUE` error. In both cases the error |
||||||
|
* handler is skipped. |
||||||
|
* |
||||||
|
* Besides the async nature to await the completion behaves identically to {@link throws}. |
||||||
|
* |
||||||
|
* If specified, `error` can be a [`Class`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Classes),
|
||||||
|
* [`RegExp`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Guide/Regular_Expressions), a validation function,
|
||||||
|
* an object where each property will be tested for, or an instance of error where |
||||||
|
* each property will be tested for including the non-enumerable `message` and`name` properties. |
||||||
|
* |
||||||
|
* If specified, `message` will be the message provided by the `AssertionError` if the `asyncFn` fails to reject. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* await assert.rejects( |
||||||
|
* async () => { |
||||||
|
* throw new TypeError('Wrong value'); |
||||||
|
* }, |
||||||
|
* { |
||||||
|
* name: 'TypeError', |
||||||
|
* message: 'Wrong value' |
||||||
|
* } |
||||||
|
* ); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* await assert.rejects( |
||||||
|
* async () => { |
||||||
|
* throw new TypeError('Wrong value'); |
||||||
|
* }, |
||||||
|
* (err) => { |
||||||
|
* assert.strictEqual(err.name, 'TypeError'); |
||||||
|
* assert.strictEqual(err.message, 'Wrong value'); |
||||||
|
* return true; |
||||||
|
* } |
||||||
|
* ); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* assert.rejects( |
||||||
|
* Promise.reject(new Error('Wrong value')), |
||||||
|
* Error |
||||||
|
* ).then(() => { |
||||||
|
* // ...
|
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* `error` cannot be a string. If a string is provided as the second |
||||||
|
* argument, then `error` is assumed to be omitted and the string will be used for`message` instead. This can lead to easy-to-miss mistakes. Please read the |
||||||
|
* example in {@link throws} carefully if using a string as the second |
||||||
|
* argument gets considered. |
||||||
|
* @since v10.0.0 |
||||||
|
*/ |
||||||
|
function rejects(block: (() => Promise<unknown>) | Promise<unknown>, message?: string | Error): Promise<void>; |
||||||
|
function rejects(block: (() => Promise<unknown>) | Promise<unknown>, error: AssertPredicate, message?: string | Error): Promise<void>; |
||||||
|
/** |
||||||
|
* Awaits the `asyncFn` promise or, if `asyncFn` is a function, immediately |
||||||
|
* calls the function and awaits the returned promise to complete. It will then |
||||||
|
* check that the promise is not rejected. |
||||||
|
* |
||||||
|
* If `asyncFn` is a function and it throws an error synchronously,`assert.doesNotReject()` will return a rejected `Promise` with that error. If |
||||||
|
* the function does not return a promise, `assert.doesNotReject()` will return a |
||||||
|
* rejected `Promise` with an `ERR_INVALID_RETURN_VALUE` error. In both cases |
||||||
|
* the error handler is skipped. |
||||||
|
* |
||||||
|
* Using `assert.doesNotReject()` is actually not useful because there is little |
||||||
|
* benefit in catching a rejection and then rejecting it again. Instead, consider |
||||||
|
* adding a comment next to the specific code path that should not reject and keep |
||||||
|
* error messages as expressive as possible. |
||||||
|
* |
||||||
|
* If specified, `error` can be a [`Class`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Classes),
|
||||||
|
* [`RegExp`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Guide/Regular_Expressions) or a validation
|
||||||
|
* function. See {@link throws} for more details. |
||||||
|
* |
||||||
|
* Besides the async nature to await the completion behaves identically to {@link doesNotThrow}. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* await assert.doesNotReject( |
||||||
|
* async () => { |
||||||
|
* throw new TypeError('Wrong value'); |
||||||
|
* }, |
||||||
|
* SyntaxError |
||||||
|
* ); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* assert.doesNotReject(Promise.reject(new TypeError('Wrong value'))) |
||||||
|
* .then(() => { |
||||||
|
* // ...
|
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* @since v10.0.0 |
||||||
|
*/ |
||||||
|
function doesNotReject(block: (() => Promise<unknown>) | Promise<unknown>, message?: string | Error): Promise<void>; |
||||||
|
function doesNotReject(block: (() => Promise<unknown>) | Promise<unknown>, error: AssertPredicate, message?: string | Error): Promise<void>; |
||||||
|
/** |
||||||
|
* Expects the `string` input to match the regular expression. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* assert.match('I will fail', /pass/); |
||||||
|
* // AssertionError [ERR_ASSERTION]: The input did not match the regular ...
|
||||||
|
* |
||||||
|
* assert.match(123, /pass/); |
||||||
|
* // AssertionError [ERR_ASSERTION]: The "string" argument must be of type string.
|
||||||
|
* |
||||||
|
* assert.match('I will pass', /pass/); |
||||||
|
* // OK
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* If the values do not match, or if the `string` argument is of another type than`string`, an `AssertionError` is thrown with a `message` property set equal |
||||||
|
* to the value of the `message` parameter. If the `message` parameter is |
||||||
|
* undefined, a default error message is assigned. If the `message` parameter is an |
||||||
|
* instance of an `Error` then it will be thrown instead of the `AssertionError`. |
||||||
|
* @since v13.6.0, v12.16.0 |
||||||
|
*/ |
||||||
|
function match(value: string, regExp: RegExp, message?: string | Error): void; |
||||||
|
/** |
||||||
|
* Expects the `string` input not to match the regular expression. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import assert from 'assert/strict'; |
||||||
|
* |
||||||
|
* assert.doesNotMatch('I will fail', /fail/); |
||||||
|
* // AssertionError [ERR_ASSERTION]: The input was expected to not match the ...
|
||||||
|
* |
||||||
|
* assert.doesNotMatch(123, /pass/); |
||||||
|
* // AssertionError [ERR_ASSERTION]: The "string" argument must be of type string.
|
||||||
|
* |
||||||
|
* assert.doesNotMatch('I will pass', /different/); |
||||||
|
* // OK
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* If the values do match, or if the `string` argument is of another type than`string`, an `AssertionError` is thrown with a `message` property set equal |
||||||
|
* to the value of the `message` parameter. If the `message` parameter is |
||||||
|
* undefined, a default error message is assigned. If the `message` parameter is an |
||||||
|
* instance of an `Error` then it will be thrown instead of the `AssertionError`. |
||||||
|
* @since v13.6.0, v12.16.0 |
||||||
|
*/ |
||||||
|
function doesNotMatch(value: string, regExp: RegExp, message?: string | Error): void; |
||||||
|
const strict: Omit<typeof assert, 'equal' | 'notEqual' | 'deepEqual' | 'notDeepEqual' | 'ok' | 'strictEqual' | 'deepStrictEqual' | 'ifError' | 'strict'> & { |
||||||
|
(value: unknown, message?: string | Error): asserts value; |
||||||
|
equal: typeof strictEqual; |
||||||
|
notEqual: typeof notStrictEqual; |
||||||
|
deepEqual: typeof deepStrictEqual; |
||||||
|
notDeepEqual: typeof notDeepStrictEqual; |
||||||
|
// Mapped types and assertion functions are incompatible?
|
||||||
|
// TS2775: Assertions require every name in the call target
|
||||||
|
// to be declared with an explicit type annotation.
|
||||||
|
ok: typeof ok; |
||||||
|
strictEqual: typeof strictEqual; |
||||||
|
deepStrictEqual: typeof deepStrictEqual; |
||||||
|
ifError: typeof ifError; |
||||||
|
strict: typeof strict; |
||||||
|
}; |
||||||
|
} |
||||||
|
export = assert; |
||||||
|
} |
||||||
|
declare module 'node:assert' { |
||||||
|
import assert = require('assert'); |
||||||
|
export = assert; |
||||||
|
} |
@ -0,0 +1,8 @@ |
|||||||
|
declare module 'assert/strict' { |
||||||
|
import { strict } from 'node:assert'; |
||||||
|
export = strict; |
||||||
|
} |
||||||
|
declare module 'node:assert/strict' { |
||||||
|
import { strict } from 'node:assert'; |
||||||
|
export = strict; |
||||||
|
} |
@ -0,0 +1,501 @@ |
|||||||
|
/** |
||||||
|
* The `async_hooks` module provides an API to track asynchronous resources. It |
||||||
|
* can be accessed using: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import async_hooks from 'async_hooks'; |
||||||
|
* ``` |
||||||
|
* @experimental |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/async_hooks.js)
|
||||||
|
*/ |
||||||
|
declare module 'async_hooks' { |
||||||
|
/** |
||||||
|
* ```js
|
||||||
|
* import { executionAsyncId } from 'async_hooks'; |
||||||
|
* |
||||||
|
* console.log(executionAsyncId()); // 1 - bootstrap
|
||||||
|
* fs.open(path, 'r', (err, fd) => { |
||||||
|
* console.log(executionAsyncId()); // 6 - open()
|
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* The ID returned from `executionAsyncId()` is related to execution timing, not |
||||||
|
* causality (which is covered by `triggerAsyncId()`): |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const server = net.createServer((conn) => { |
||||||
|
* // Returns the ID of the server, not of the new connection, because the
|
||||||
|
* // callback runs in the execution scope of the server's MakeCallback().
|
||||||
|
* async_hooks.executionAsyncId(); |
||||||
|
* |
||||||
|
* }).listen(port, () => { |
||||||
|
* // Returns the ID of a TickObject (process.nextTick()) because all
|
||||||
|
* // callbacks passed to .listen() are wrapped in a nextTick().
|
||||||
|
* async_hooks.executionAsyncId(); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Promise contexts may not get precise `executionAsyncIds` by default. |
||||||
|
* See the section on `promise execution tracking`. |
||||||
|
* @since v8.1.0 |
||||||
|
* @return The `asyncId` of the current execution context. Useful to track when something calls. |
||||||
|
*/ |
||||||
|
function executionAsyncId(): number; |
||||||
|
/** |
||||||
|
* Resource objects returned by `executionAsyncResource()` are most often internal |
||||||
|
* Node.js handle objects with undocumented APIs. Using any functions or properties |
||||||
|
* on the object is likely to crash your application and should be avoided. |
||||||
|
* |
||||||
|
* Using `executionAsyncResource()` in the top-level execution context will |
||||||
|
* return an empty object as there is no handle or request object to use, |
||||||
|
* but having an object representing the top-level can be helpful. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import { open } from 'fs'; |
||||||
|
* import { executionAsyncId, executionAsyncResource } from 'async_hooks'; |
||||||
|
* |
||||||
|
* console.log(executionAsyncId(), executionAsyncResource()); // 1 {}
|
||||||
|
* open(new URL(import.meta.url), 'r', (err, fd) => { |
||||||
|
* console.log(executionAsyncId(), executionAsyncResource()); // 7 FSReqWrap
|
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* This can be used to implement continuation local storage without the |
||||||
|
* use of a tracking `Map` to store the metadata: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import { createServer } from 'http'; |
||||||
|
* import { |
||||||
|
* executionAsyncId, |
||||||
|
* executionAsyncResource, |
||||||
|
* createHook |
||||||
|
* } from 'async_hooks'; |
||||||
|
* const sym = Symbol('state'); // Private symbol to avoid pollution
|
||||||
|
* |
||||||
|
* createHook({ |
||||||
|
* init(asyncId, type, triggerAsyncId, resource) { |
||||||
|
* const cr = executionAsyncResource(); |
||||||
|
* if (cr) { |
||||||
|
* resource[sym] = cr[sym]; |
||||||
|
* } |
||||||
|
* } |
||||||
|
* }).enable(); |
||||||
|
* |
||||||
|
* const server = createServer((req, res) => { |
||||||
|
* executionAsyncResource()[sym] = { state: req.url }; |
||||||
|
* setTimeout(function() { |
||||||
|
* res.end(JSON.stringify(executionAsyncResource()[sym])); |
||||||
|
* }, 100); |
||||||
|
* }).listen(3000); |
||||||
|
* ``` |
||||||
|
* @since v13.9.0, v12.17.0 |
||||||
|
* @return The resource representing the current execution. Useful to store data within the resource. |
||||||
|
*/ |
||||||
|
function executionAsyncResource(): object; |
||||||
|
/** |
||||||
|
* ```js
|
||||||
|
* const server = net.createServer((conn) => { |
||||||
|
* // The resource that caused (or triggered) this callback to be called
|
||||||
|
* // was that of the new connection. Thus the return value of triggerAsyncId()
|
||||||
|
* // is the asyncId of "conn".
|
||||||
|
* async_hooks.triggerAsyncId(); |
||||||
|
* |
||||||
|
* }).listen(port, () => { |
||||||
|
* // Even though all callbacks passed to .listen() are wrapped in a nextTick()
|
||||||
|
* // the callback itself exists because the call to the server's .listen()
|
||||||
|
* // was made. So the return value would be the ID of the server.
|
||||||
|
* async_hooks.triggerAsyncId(); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Promise contexts may not get valid `triggerAsyncId`s by default. See |
||||||
|
* the section on `promise execution tracking`. |
||||||
|
* @return The ID of the resource responsible for calling the callback that is currently being executed. |
||||||
|
*/ |
||||||
|
function triggerAsyncId(): number; |
||||||
|
interface HookCallbacks { |
||||||
|
/** |
||||||
|
* Called when a class is constructed that has the possibility to emit an asynchronous event. |
||||||
|
* @param asyncId a unique ID for the async resource |
||||||
|
* @param type the type of the async resource |
||||||
|
* @param triggerAsyncId the unique ID of the async resource in whose execution context this async resource was created |
||||||
|
* @param resource reference to the resource representing the async operation, needs to be released during destroy |
||||||
|
*/ |
||||||
|
init?(asyncId: number, type: string, triggerAsyncId: number, resource: object): void; |
||||||
|
/** |
||||||
|
* When an asynchronous operation is initiated or completes a callback is called to notify the user. |
||||||
|
* The before callback is called just before said callback is executed. |
||||||
|
* @param asyncId the unique identifier assigned to the resource about to execute the callback. |
||||||
|
*/ |
||||||
|
before?(asyncId: number): void; |
||||||
|
/** |
||||||
|
* Called immediately after the callback specified in before is completed. |
||||||
|
* @param asyncId the unique identifier assigned to the resource which has executed the callback. |
||||||
|
*/ |
||||||
|
after?(asyncId: number): void; |
||||||
|
/** |
||||||
|
* Called when a promise has resolve() called. This may not be in the same execution id |
||||||
|
* as the promise itself. |
||||||
|
* @param asyncId the unique id for the promise that was resolve()d. |
||||||
|
*/ |
||||||
|
promiseResolve?(asyncId: number): void; |
||||||
|
/** |
||||||
|
* Called after the resource corresponding to asyncId is destroyed |
||||||
|
* @param asyncId a unique ID for the async resource |
||||||
|
*/ |
||||||
|
destroy?(asyncId: number): void; |
||||||
|
} |
||||||
|
interface AsyncHook { |
||||||
|
/** |
||||||
|
* Enable the callbacks for a given AsyncHook instance. If no callbacks are provided enabling is a noop. |
||||||
|
*/ |
||||||
|
enable(): this; |
||||||
|
/** |
||||||
|
* Disable the callbacks for a given AsyncHook instance from the global pool of AsyncHook callbacks to be executed. Once a hook has been disabled it will not be called again until enabled. |
||||||
|
*/ |
||||||
|
disable(): this; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Registers functions to be called for different lifetime events of each async |
||||||
|
* operation. |
||||||
|
* |
||||||
|
* The callbacks `init()`/`before()`/`after()`/`destroy()` are called for the |
||||||
|
* respective asynchronous event during a resource's lifetime. |
||||||
|
* |
||||||
|
* All callbacks are optional. For example, if only resource cleanup needs to |
||||||
|
* be tracked, then only the `destroy` callback needs to be passed. The |
||||||
|
* specifics of all functions that can be passed to `callbacks` is in the `Hook Callbacks` section. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import { createHook } from 'async_hooks'; |
||||||
|
* |
||||||
|
* const asyncHook = createHook({ |
||||||
|
* init(asyncId, type, triggerAsyncId, resource) { }, |
||||||
|
* destroy(asyncId) { } |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* The callbacks will be inherited via the prototype chain: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* class MyAsyncCallbacks { |
||||||
|
* init(asyncId, type, triggerAsyncId, resource) { } |
||||||
|
* destroy(asyncId) {} |
||||||
|
* } |
||||||
|
* |
||||||
|
* class MyAddedCallbacks extends MyAsyncCallbacks { |
||||||
|
* before(asyncId) { } |
||||||
|
* after(asyncId) { } |
||||||
|
* } |
||||||
|
* |
||||||
|
* const asyncHook = async_hooks.createHook(new MyAddedCallbacks()); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Because promises are asynchronous resources whose lifecycle is tracked |
||||||
|
* via the async hooks mechanism, the `init()`, `before()`, `after()`, and`destroy()` callbacks _must not_ be async functions that return promises. |
||||||
|
* @since v8.1.0 |
||||||
|
* @param callbacks The `Hook Callbacks` to register |
||||||
|
* @return Instance used for disabling and enabling hooks |
||||||
|
*/ |
||||||
|
function createHook(callbacks: HookCallbacks): AsyncHook; |
||||||
|
interface AsyncResourceOptions { |
||||||
|
/** |
||||||
|
* The ID of the execution context that created this async event. |
||||||
|
* @default executionAsyncId() |
||||||
|
*/ |
||||||
|
triggerAsyncId?: number | undefined; |
||||||
|
/** |
||||||
|
* Disables automatic `emitDestroy` when the object is garbage collected. |
||||||
|
* This usually does not need to be set (even if `emitDestroy` is called |
||||||
|
* manually), unless the resource's `asyncId` is retrieved and the |
||||||
|
* sensitive API's `emitDestroy` is called with it. |
||||||
|
* @default false |
||||||
|
*/ |
||||||
|
requireManualDestroy?: boolean | undefined; |
||||||
|
} |
||||||
|
/** |
||||||
|
* The class `AsyncResource` is designed to be extended by the embedder's async |
||||||
|
* resources. Using this, users can easily trigger the lifetime events of their |
||||||
|
* own resources. |
||||||
|
* |
||||||
|
* The `init` hook will trigger when an `AsyncResource` is instantiated. |
||||||
|
* |
||||||
|
* The following is an overview of the `AsyncResource` API. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import { AsyncResource, executionAsyncId } from 'async_hooks'; |
||||||
|
* |
||||||
|
* // AsyncResource() is meant to be extended. Instantiating a
|
||||||
|
* // new AsyncResource() also triggers init. If triggerAsyncId is omitted then
|
||||||
|
* // async_hook.executionAsyncId() is used.
|
||||||
|
* const asyncResource = new AsyncResource( |
||||||
|
* type, { triggerAsyncId: executionAsyncId(), requireManualDestroy: false } |
||||||
|
* ); |
||||||
|
* |
||||||
|
* // Run a function in the execution context of the resource. This will
|
||||||
|
* // * establish the context of the resource
|
||||||
|
* // * trigger the AsyncHooks before callbacks
|
||||||
|
* // * call the provided function `fn` with the supplied arguments
|
||||||
|
* // * trigger the AsyncHooks after callbacks
|
||||||
|
* // * restore the original execution context
|
||||||
|
* asyncResource.runInAsyncScope(fn, thisArg, ...args); |
||||||
|
* |
||||||
|
* // Call AsyncHooks destroy callbacks.
|
||||||
|
* asyncResource.emitDestroy(); |
||||||
|
* |
||||||
|
* // Return the unique ID assigned to the AsyncResource instance.
|
||||||
|
* asyncResource.asyncId(); |
||||||
|
* |
||||||
|
* // Return the trigger ID for the AsyncResource instance.
|
||||||
|
* asyncResource.triggerAsyncId(); |
||||||
|
* ``` |
||||||
|
*/ |
||||||
|
class AsyncResource { |
||||||
|
/** |
||||||
|
* AsyncResource() is meant to be extended. Instantiating a |
||||||
|
* new AsyncResource() also triggers init. If triggerAsyncId is omitted then |
||||||
|
* async_hook.executionAsyncId() is used. |
||||||
|
* @param type The type of async event. |
||||||
|
* @param triggerAsyncId The ID of the execution context that created |
||||||
|
* this async event (default: `executionAsyncId()`), or an |
||||||
|
* AsyncResourceOptions object (since v9.3.0) |
||||||
|
*/ |
||||||
|
constructor(type: string, triggerAsyncId?: number | AsyncResourceOptions); |
||||||
|
/** |
||||||
|
* Binds the given function to the current execution context. |
||||||
|
* |
||||||
|
* The returned function will have an `asyncResource` property referencing |
||||||
|
* the `AsyncResource` to which the function is bound. |
||||||
|
* @since v14.8.0, v12.19.0 |
||||||
|
* @param fn The function to bind to the current execution context. |
||||||
|
* @param type An optional name to associate with the underlying `AsyncResource`. |
||||||
|
*/ |
||||||
|
static bind<Func extends (this: ThisArg, ...args: any[]) => any, ThisArg>( |
||||||
|
fn: Func, |
||||||
|
type?: string, |
||||||
|
thisArg?: ThisArg |
||||||
|
): Func & { |
||||||
|
asyncResource: AsyncResource; |
||||||
|
}; |
||||||
|
/** |
||||||
|
* Binds the given function to execute to this `AsyncResource`'s scope. |
||||||
|
* |
||||||
|
* The returned function will have an `asyncResource` property referencing |
||||||
|
* the `AsyncResource` to which the function is bound. |
||||||
|
* @since v14.8.0, v12.19.0 |
||||||
|
* @param fn The function to bind to the current `AsyncResource`. |
||||||
|
*/ |
||||||
|
bind<Func extends (...args: any[]) => any>( |
||||||
|
fn: Func |
||||||
|
): Func & { |
||||||
|
asyncResource: AsyncResource; |
||||||
|
}; |
||||||
|
/** |
||||||
|
* Call the provided function with the provided arguments in the execution context |
||||||
|
* of the async resource. This will establish the context, trigger the AsyncHooks |
||||||
|
* before callbacks, call the function, trigger the AsyncHooks after callbacks, and |
||||||
|
* then restore the original execution context. |
||||||
|
* @since v9.6.0 |
||||||
|
* @param fn The function to call in the execution context of this async resource. |
||||||
|
* @param thisArg The receiver to be used for the function call. |
||||||
|
* @param args Optional arguments to pass to the function. |
||||||
|
*/ |
||||||
|
runInAsyncScope<This, Result>(fn: (this: This, ...args: any[]) => Result, thisArg?: This, ...args: any[]): Result; |
||||||
|
/** |
||||||
|
* Call all `destroy` hooks. This should only ever be called once. An error will |
||||||
|
* be thrown if it is called more than once. This **must** be manually called. If |
||||||
|
* the resource is left to be collected by the GC then the `destroy` hooks will |
||||||
|
* never be called. |
||||||
|
* @return A reference to `asyncResource`. |
||||||
|
*/ |
||||||
|
emitDestroy(): this; |
||||||
|
/** |
||||||
|
* @return The unique `asyncId` assigned to the resource. |
||||||
|
*/ |
||||||
|
asyncId(): number; |
||||||
|
/** |
||||||
|
* |
||||||
|
* @return The same `triggerAsyncId` that is passed to the `AsyncResource` constructor. |
||||||
|
*/ |
||||||
|
triggerAsyncId(): number; |
||||||
|
} |
||||||
|
/** |
||||||
|
* This class creates stores that stay coherent through asynchronous operations. |
||||||
|
* |
||||||
|
* While you can create your own implementation on top of the `async_hooks` module,`AsyncLocalStorage` should be preferred as it is a performant and memory safe |
||||||
|
* implementation that involves significant optimizations that are non-obvious to |
||||||
|
* implement. |
||||||
|
* |
||||||
|
* The following example uses `AsyncLocalStorage` to build a simple logger |
||||||
|
* that assigns IDs to incoming HTTP requests and includes them in messages |
||||||
|
* logged within each request. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import http from 'http'; |
||||||
|
* import { AsyncLocalStorage } from 'async_hooks'; |
||||||
|
* |
||||||
|
* const asyncLocalStorage = new AsyncLocalStorage(); |
||||||
|
* |
||||||
|
* function logWithId(msg) { |
||||||
|
* const id = asyncLocalStorage.getStore(); |
||||||
|
* console.log(`${id !== undefined ? id : '-'}:`, msg); |
||||||
|
* } |
||||||
|
* |
||||||
|
* let idSeq = 0; |
||||||
|
* http.createServer((req, res) => { |
||||||
|
* asyncLocalStorage.run(idSeq++, () => { |
||||||
|
* logWithId('start'); |
||||||
|
* // Imagine any chain of async operations here
|
||||||
|
* setImmediate(() => { |
||||||
|
* logWithId('finish'); |
||||||
|
* res.end(); |
||||||
|
* }); |
||||||
|
* }); |
||||||
|
* }).listen(8080); |
||||||
|
* |
||||||
|
* http.get('http://localhost:8080'); |
||||||
|
* http.get('http://localhost:8080'); |
||||||
|
* // Prints:
|
||||||
|
* // 0: start
|
||||||
|
* // 1: start
|
||||||
|
* // 0: finish
|
||||||
|
* // 1: finish
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Each instance of `AsyncLocalStorage` maintains an independent storage context. |
||||||
|
* Multiple instances can safely exist simultaneously without risk of interfering |
||||||
|
* with each other's data. |
||||||
|
* @since v13.10.0, v12.17.0 |
||||||
|
*/ |
||||||
|
class AsyncLocalStorage<T> { |
||||||
|
/** |
||||||
|
* Disables the instance of `AsyncLocalStorage`. All subsequent calls |
||||||
|
* to `asyncLocalStorage.getStore()` will return `undefined` until`asyncLocalStorage.run()` or `asyncLocalStorage.enterWith()` is called again. |
||||||
|
* |
||||||
|
* When calling `asyncLocalStorage.disable()`, all current contexts linked to the |
||||||
|
* instance will be exited. |
||||||
|
* |
||||||
|
* Calling `asyncLocalStorage.disable()` is required before the`asyncLocalStorage` can be garbage collected. This does not apply to stores |
||||||
|
* provided by the `asyncLocalStorage`, as those objects are garbage collected |
||||||
|
* along with the corresponding async resources. |
||||||
|
* |
||||||
|
* Use this method when the `asyncLocalStorage` is not in use anymore |
||||||
|
* in the current process. |
||||||
|
* @since v13.10.0, v12.17.0 |
||||||
|
* @experimental |
||||||
|
*/ |
||||||
|
disable(): void; |
||||||
|
/** |
||||||
|
* Returns the current store. |
||||||
|
* If called outside of an asynchronous context initialized by |
||||||
|
* calling `asyncLocalStorage.run()` or `asyncLocalStorage.enterWith()`, it |
||||||
|
* returns `undefined`. |
||||||
|
* @since v13.10.0, v12.17.0 |
||||||
|
*/ |
||||||
|
getStore(): T | undefined; |
||||||
|
/** |
||||||
|
* Runs a function synchronously within a context and returns its |
||||||
|
* return value. The store is not accessible outside of the callback function. |
||||||
|
* The store is accessible to any asynchronous operations created within the |
||||||
|
* callback. |
||||||
|
* |
||||||
|
* The optional `args` are passed to the callback function. |
||||||
|
* |
||||||
|
* If the callback function throws an error, the error is thrown by `run()` too. |
||||||
|
* The stacktrace is not impacted by this call and the context is exited. |
||||||
|
* |
||||||
|
* Example: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const store = { id: 2 }; |
||||||
|
* try { |
||||||
|
* asyncLocalStorage.run(store, () => { |
||||||
|
* asyncLocalStorage.getStore(); // Returns the store object
|
||||||
|
* setTimeout(() => { |
||||||
|
* asyncLocalStorage.getStore(); // Returns the store object
|
||||||
|
* }, 200); |
||||||
|
* throw new Error(); |
||||||
|
* }); |
||||||
|
* } catch (e) { |
||||||
|
* asyncLocalStorage.getStore(); // Returns undefined
|
||||||
|
* // The error will be caught here
|
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v13.10.0, v12.17.0 |
||||||
|
*/ |
||||||
|
run<R, TArgs extends any[]>(store: T, callback: (...args: TArgs) => R, ...args: TArgs): R; |
||||||
|
/** |
||||||
|
* Runs a function synchronously outside of a context and returns its |
||||||
|
* return value. The store is not accessible within the callback function or |
||||||
|
* the asynchronous operations created within the callback. Any `getStore()`call done within the callback function will always return `undefined`. |
||||||
|
* |
||||||
|
* The optional `args` are passed to the callback function. |
||||||
|
* |
||||||
|
* If the callback function throws an error, the error is thrown by `exit()` too. |
||||||
|
* The stacktrace is not impacted by this call and the context is re-entered. |
||||||
|
* |
||||||
|
* Example: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* // Within a call to run
|
||||||
|
* try { |
||||||
|
* asyncLocalStorage.getStore(); // Returns the store object or value
|
||||||
|
* asyncLocalStorage.exit(() => { |
||||||
|
* asyncLocalStorage.getStore(); // Returns undefined
|
||||||
|
* throw new Error(); |
||||||
|
* }); |
||||||
|
* } catch (e) { |
||||||
|
* asyncLocalStorage.getStore(); // Returns the same object or value
|
||||||
|
* // The error will be caught here
|
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v13.10.0, v12.17.0 |
||||||
|
* @experimental |
||||||
|
*/ |
||||||
|
exit<R, TArgs extends any[]>(callback: (...args: TArgs) => R, ...args: TArgs): R; |
||||||
|
/** |
||||||
|
* Transitions into the context for the remainder of the current |
||||||
|
* synchronous execution and then persists the store through any following |
||||||
|
* asynchronous calls. |
||||||
|
* |
||||||
|
* Example: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const store = { id: 1 }; |
||||||
|
* // Replaces previous store with the given store object
|
||||||
|
* asyncLocalStorage.enterWith(store); |
||||||
|
* asyncLocalStorage.getStore(); // Returns the store object
|
||||||
|
* someAsyncOperation(() => { |
||||||
|
* asyncLocalStorage.getStore(); // Returns the same object
|
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* This transition will continue for the _entire_ synchronous execution. |
||||||
|
* This means that if, for example, the context is entered within an event |
||||||
|
* handler subsequent event handlers will also run within that context unless |
||||||
|
* specifically bound to another context with an `AsyncResource`. That is why`run()` should be preferred over `enterWith()` unless there are strong reasons |
||||||
|
* to use the latter method. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const store = { id: 1 }; |
||||||
|
* |
||||||
|
* emitter.on('my-event', () => { |
||||||
|
* asyncLocalStorage.enterWith(store); |
||||||
|
* }); |
||||||
|
* emitter.on('my-event', () => { |
||||||
|
* asyncLocalStorage.getStore(); // Returns the same object
|
||||||
|
* }); |
||||||
|
* |
||||||
|
* asyncLocalStorage.getStore(); // Returns undefined
|
||||||
|
* emitter.emit('my-event'); |
||||||
|
* asyncLocalStorage.getStore(); // Returns the same object
|
||||||
|
* ``` |
||||||
|
* @since v13.11.0, v12.17.0 |
||||||
|
* @experimental |
||||||
|
*/ |
||||||
|
enterWith(store: T): void; |
||||||
|
} |
||||||
|
} |
||||||
|
declare module 'node:async_hooks' { |
||||||
|
export * from 'async_hooks'; |
||||||
|
} |
File diff suppressed because it is too large
Load Diff
File diff suppressed because it is too large
Load Diff
@ -0,0 +1,410 @@ |
|||||||
|
/** |
||||||
|
* Clusters of Node.js processes can be used to run multiple instances of Node.js |
||||||
|
* that can distribute workloads among their application threads. When process |
||||||
|
* isolation is not needed, use the `worker_threads` module instead, which |
||||||
|
* allows running multiple application threads within a single Node.js instance. |
||||||
|
* |
||||||
|
* The cluster module allows easy creation of child processes that all share |
||||||
|
* server ports. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import cluster from 'cluster'; |
||||||
|
* import http from 'http'; |
||||||
|
* import { cpus } from 'os'; |
||||||
|
* import process from 'process'; |
||||||
|
* |
||||||
|
* const numCPUs = cpus().length; |
||||||
|
* |
||||||
|
* if (cluster.isPrimary) { |
||||||
|
* console.log(`Primary ${process.pid} is running`); |
||||||
|
* |
||||||
|
* // Fork workers.
|
||||||
|
* for (let i = 0; i < numCPUs; i++) { |
||||||
|
* cluster.fork(); |
||||||
|
* } |
||||||
|
* |
||||||
|
* cluster.on('exit', (worker, code, signal) => { |
||||||
|
* console.log(`worker ${worker.process.pid} died`); |
||||||
|
* }); |
||||||
|
* } else { |
||||||
|
* // Workers can share any TCP connection
|
||||||
|
* // In this case it is an HTTP server
|
||||||
|
* http.createServer((req, res) => { |
||||||
|
* res.writeHead(200); |
||||||
|
* res.end('hello world\n'); |
||||||
|
* }).listen(8000); |
||||||
|
* |
||||||
|
* console.log(`Worker ${process.pid} started`); |
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Running Node.js will now share port 8000 between the workers: |
||||||
|
* |
||||||
|
* ```console
|
||||||
|
* $ node server.js |
||||||
|
* Primary 3596 is running |
||||||
|
* Worker 4324 started |
||||||
|
* Worker 4520 started |
||||||
|
* Worker 6056 started |
||||||
|
* Worker 5644 started |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* On Windows, it is not yet possible to set up a named pipe server in a worker. |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/cluster.js)
|
||||||
|
*/ |
||||||
|
declare module 'cluster' { |
||||||
|
import * as child from 'node:child_process'; |
||||||
|
import EventEmitter = require('node:events'); |
||||||
|
import * as net from 'node:net'; |
||||||
|
export interface ClusterSettings { |
||||||
|
execArgv?: string[] | undefined; // default: process.execArgv
|
||||||
|
exec?: string | undefined; |
||||||
|
args?: string[] | undefined; |
||||||
|
silent?: boolean | undefined; |
||||||
|
stdio?: any[] | undefined; |
||||||
|
uid?: number | undefined; |
||||||
|
gid?: number | undefined; |
||||||
|
inspectPort?: number | (() => number) | undefined; |
||||||
|
} |
||||||
|
export interface Address { |
||||||
|
address: string; |
||||||
|
port: number; |
||||||
|
addressType: number | 'udp4' | 'udp6'; // 4, 6, -1, "udp4", "udp6"
|
||||||
|
} |
||||||
|
/** |
||||||
|
* A `Worker` object contains all public information and method about a worker. |
||||||
|
* In the primary it can be obtained using `cluster.workers`. In a worker |
||||||
|
* it can be obtained using `cluster.worker`. |
||||||
|
* @since v0.7.0 |
||||||
|
*/ |
||||||
|
export class Worker extends EventEmitter { |
||||||
|
/** |
||||||
|
* Each new worker is given its own unique id, this id is stored in the`id`. |
||||||
|
* |
||||||
|
* While a worker is alive, this is the key that indexes it in`cluster.workers`. |
||||||
|
* @since v0.8.0 |
||||||
|
*/ |
||||||
|
id: number; |
||||||
|
/** |
||||||
|
* All workers are created using `child_process.fork()`, the returned object |
||||||
|
* from this function is stored as `.process`. In a worker, the global `process`is stored. |
||||||
|
* |
||||||
|
* See: `Child Process module`. |
||||||
|
* |
||||||
|
* Workers will call `process.exit(0)` if the `'disconnect'` event occurs |
||||||
|
* on `process` and `.exitedAfterDisconnect` is not `true`. This protects against |
||||||
|
* accidental disconnection. |
||||||
|
* @since v0.7.0 |
||||||
|
*/ |
||||||
|
process: child.ChildProcess; |
||||||
|
/** |
||||||
|
* Send a message to a worker or primary, optionally with a handle. |
||||||
|
* |
||||||
|
* In the primary, this sends a message to a specific worker. It is identical to `ChildProcess.send()`. |
||||||
|
* |
||||||
|
* In a worker, this sends a message to the primary. It is identical to`process.send()`. |
||||||
|
* |
||||||
|
* This example will echo back all messages from the primary: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* if (cluster.isPrimary) { |
||||||
|
* const worker = cluster.fork(); |
||||||
|
* worker.send('hi there'); |
||||||
|
* |
||||||
|
* } else if (cluster.isWorker) { |
||||||
|
* process.on('message', (msg) => { |
||||||
|
* process.send(msg); |
||||||
|
* }); |
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v0.7.0 |
||||||
|
* @param options The `options` argument, if present, is an object used to parameterize the sending of certain types of handles. `options` supports the following properties: |
||||||
|
*/ |
||||||
|
send(message: child.Serializable, callback?: (error: Error | null) => void): boolean; |
||||||
|
send(message: child.Serializable, sendHandle: child.SendHandle, callback?: (error: Error | null) => void): boolean; |
||||||
|
send(message: child.Serializable, sendHandle: child.SendHandle, options?: child.MessageOptions, callback?: (error: Error | null) => void): boolean; |
||||||
|
/** |
||||||
|
* This function will kill the worker. In the primary worker, it does this by |
||||||
|
* disconnecting the `worker.process`, and once disconnected, killing with`signal`. In the worker, it does it by killing the process with `signal`. |
||||||
|
* |
||||||
|
* The `kill()` function kills the worker process without waiting for a graceful |
||||||
|
* disconnect, it has the same behavior as `worker.process.kill()`. |
||||||
|
* |
||||||
|
* This method is aliased as `worker.destroy()` for backwards compatibility. |
||||||
|
* |
||||||
|
* In a worker, `process.kill()` exists, but it is not this function; |
||||||
|
* it is `kill()`. |
||||||
|
* @since v0.9.12 |
||||||
|
* @param [signal='SIGTERM'] Name of the kill signal to send to the worker process. |
||||||
|
*/ |
||||||
|
kill(signal?: string): void; |
||||||
|
destroy(signal?: string): void; |
||||||
|
/** |
||||||
|
* In a worker, this function will close all servers, wait for the `'close'` event |
||||||
|
* on those servers, and then disconnect the IPC channel. |
||||||
|
* |
||||||
|
* In the primary, an internal message is sent to the worker causing it to call`.disconnect()` on itself. |
||||||
|
* |
||||||
|
* Causes `.exitedAfterDisconnect` to be set. |
||||||
|
* |
||||||
|
* After a server is closed, it will no longer accept new connections, |
||||||
|
* but connections may be accepted by any other listening worker. Existing |
||||||
|
* connections will be allowed to close as usual. When no more connections exist, |
||||||
|
* see `server.close()`, the IPC channel to the worker will close allowing it |
||||||
|
* to die gracefully. |
||||||
|
* |
||||||
|
* The above applies _only_ to server connections, client connections are not |
||||||
|
* automatically closed by workers, and disconnect does not wait for them to close |
||||||
|
* before exiting. |
||||||
|
* |
||||||
|
* In a worker, `process.disconnect` exists, but it is not this function; |
||||||
|
* it is `disconnect()`. |
||||||
|
* |
||||||
|
* Because long living server connections may block workers from disconnecting, it |
||||||
|
* may be useful to send a message, so application specific actions may be taken to |
||||||
|
* close them. It also may be useful to implement a timeout, killing a worker if |
||||||
|
* the `'disconnect'` event has not been emitted after some time. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* if (cluster.isPrimary) { |
||||||
|
* const worker = cluster.fork(); |
||||||
|
* let timeout; |
||||||
|
* |
||||||
|
* worker.on('listening', (address) => { |
||||||
|
* worker.send('shutdown'); |
||||||
|
* worker.disconnect(); |
||||||
|
* timeout = setTimeout(() => { |
||||||
|
* worker.kill(); |
||||||
|
* }, 2000); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* worker.on('disconnect', () => { |
||||||
|
* clearTimeout(timeout); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* } else if (cluster.isWorker) { |
||||||
|
* const net = require('net'); |
||||||
|
* const server = net.createServer((socket) => { |
||||||
|
* // Connections never end
|
||||||
|
* }); |
||||||
|
* |
||||||
|
* server.listen(8000); |
||||||
|
* |
||||||
|
* process.on('message', (msg) => { |
||||||
|
* if (msg === 'shutdown') { |
||||||
|
* // Initiate graceful close of any connections to server
|
||||||
|
* } |
||||||
|
* }); |
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v0.7.7 |
||||||
|
* @return A reference to `worker`. |
||||||
|
*/ |
||||||
|
disconnect(): void; |
||||||
|
/** |
||||||
|
* This function returns `true` if the worker is connected to its primary via its |
||||||
|
* IPC channel, `false` otherwise. A worker is connected to its primary after it |
||||||
|
* has been created. It is disconnected after the `'disconnect'` event is emitted. |
||||||
|
* @since v0.11.14 |
||||||
|
*/ |
||||||
|
isConnected(): boolean; |
||||||
|
/** |
||||||
|
* This function returns `true` if the worker's process has terminated (either |
||||||
|
* because of exiting or being signaled). Otherwise, it returns `false`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import cluster from 'cluster'; |
||||||
|
* import http from 'http'; |
||||||
|
* import { cpus } from 'os'; |
||||||
|
* import process from 'process'; |
||||||
|
* |
||||||
|
* const numCPUs = cpus().length; |
||||||
|
* |
||||||
|
* if (cluster.isPrimary) { |
||||||
|
* console.log(`Primary ${process.pid} is running`); |
||||||
|
* |
||||||
|
* // Fork workers.
|
||||||
|
* for (let i = 0; i < numCPUs; i++) { |
||||||
|
* cluster.fork(); |
||||||
|
* } |
||||||
|
* |
||||||
|
* cluster.on('fork', (worker) => { |
||||||
|
* console.log('worker is dead:', worker.isDead()); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* cluster.on('exit', (worker, code, signal) => { |
||||||
|
* console.log('worker is dead:', worker.isDead()); |
||||||
|
* }); |
||||||
|
* } else { |
||||||
|
* // Workers can share any TCP connection. In this case, it is an HTTP server.
|
||||||
|
* http.createServer((req, res) => { |
||||||
|
* res.writeHead(200); |
||||||
|
* res.end(`Current process\n ${process.pid}`); |
||||||
|
* process.kill(process.pid); |
||||||
|
* }).listen(8000); |
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v0.11.14 |
||||||
|
*/ |
||||||
|
isDead(): boolean; |
||||||
|
/** |
||||||
|
* This property is `true` if the worker exited due to `.disconnect()`. |
||||||
|
* If the worker exited any other way, it is `false`. If the |
||||||
|
* worker has not exited, it is `undefined`. |
||||||
|
* |
||||||
|
* The boolean `worker.exitedAfterDisconnect` allows distinguishing between |
||||||
|
* voluntary and accidental exit, the primary may choose not to respawn a worker |
||||||
|
* based on this value. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* cluster.on('exit', (worker, code, signal) => { |
||||||
|
* if (worker.exitedAfterDisconnect === true) { |
||||||
|
* console.log('Oh, it was just voluntary – no need to worry'); |
||||||
|
* } |
||||||
|
* }); |
||||||
|
* |
||||||
|
* // kill worker
|
||||||
|
* worker.kill(); |
||||||
|
* ``` |
||||||
|
* @since v6.0.0 |
||||||
|
*/ |
||||||
|
exitedAfterDisconnect: boolean; |
||||||
|
/** |
||||||
|
* events.EventEmitter |
||||||
|
* 1. disconnect |
||||||
|
* 2. error |
||||||
|
* 3. exit |
||||||
|
* 4. listening |
||||||
|
* 5. message |
||||||
|
* 6. online |
||||||
|
*/ |
||||||
|
addListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
addListener(event: 'disconnect', listener: () => void): this; |
||||||
|
addListener(event: 'error', listener: (error: Error) => void): this; |
||||||
|
addListener(event: 'exit', listener: (code: number, signal: string) => void): this; |
||||||
|
addListener(event: 'listening', listener: (address: Address) => void): this; |
||||||
|
addListener(event: 'message', listener: (message: any, handle: net.Socket | net.Server) => void): this; // the handle is a net.Socket or net.Server object, or undefined.
|
||||||
|
addListener(event: 'online', listener: () => void): this; |
||||||
|
emit(event: string | symbol, ...args: any[]): boolean; |
||||||
|
emit(event: 'disconnect'): boolean; |
||||||
|
emit(event: 'error', error: Error): boolean; |
||||||
|
emit(event: 'exit', code: number, signal: string): boolean; |
||||||
|
emit(event: 'listening', address: Address): boolean; |
||||||
|
emit(event: 'message', message: any, handle: net.Socket | net.Server): boolean; |
||||||
|
emit(event: 'online'): boolean; |
||||||
|
on(event: string, listener: (...args: any[]) => void): this; |
||||||
|
on(event: 'disconnect', listener: () => void): this; |
||||||
|
on(event: 'error', listener: (error: Error) => void): this; |
||||||
|
on(event: 'exit', listener: (code: number, signal: string) => void): this; |
||||||
|
on(event: 'listening', listener: (address: Address) => void): this; |
||||||
|
on(event: 'message', listener: (message: any, handle: net.Socket | net.Server) => void): this; // the handle is a net.Socket or net.Server object, or undefined.
|
||||||
|
on(event: 'online', listener: () => void): this; |
||||||
|
once(event: string, listener: (...args: any[]) => void): this; |
||||||
|
once(event: 'disconnect', listener: () => void): this; |
||||||
|
once(event: 'error', listener: (error: Error) => void): this; |
||||||
|
once(event: 'exit', listener: (code: number, signal: string) => void): this; |
||||||
|
once(event: 'listening', listener: (address: Address) => void): this; |
||||||
|
once(event: 'message', listener: (message: any, handle: net.Socket | net.Server) => void): this; // the handle is a net.Socket or net.Server object, or undefined.
|
||||||
|
once(event: 'online', listener: () => void): this; |
||||||
|
prependListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
prependListener(event: 'disconnect', listener: () => void): this; |
||||||
|
prependListener(event: 'error', listener: (error: Error) => void): this; |
||||||
|
prependListener(event: 'exit', listener: (code: number, signal: string) => void): this; |
||||||
|
prependListener(event: 'listening', listener: (address: Address) => void): this; |
||||||
|
prependListener(event: 'message', listener: (message: any, handle: net.Socket | net.Server) => void): this; // the handle is a net.Socket or net.Server object, or undefined.
|
||||||
|
prependListener(event: 'online', listener: () => void): this; |
||||||
|
prependOnceListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
prependOnceListener(event: 'disconnect', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'error', listener: (error: Error) => void): this; |
||||||
|
prependOnceListener(event: 'exit', listener: (code: number, signal: string) => void): this; |
||||||
|
prependOnceListener(event: 'listening', listener: (address: Address) => void): this; |
||||||
|
prependOnceListener(event: 'message', listener: (message: any, handle: net.Socket | net.Server) => void): this; // the handle is a net.Socket or net.Server object, or undefined.
|
||||||
|
prependOnceListener(event: 'online', listener: () => void): this; |
||||||
|
} |
||||||
|
export interface Cluster extends EventEmitter { |
||||||
|
disconnect(callback?: () => void): void; |
||||||
|
fork(env?: any): Worker; |
||||||
|
/** @deprecated since v16.0.0 - use isPrimary. */ |
||||||
|
readonly isMaster: boolean; |
||||||
|
readonly isPrimary: boolean; |
||||||
|
readonly isWorker: boolean; |
||||||
|
schedulingPolicy: number; |
||||||
|
readonly settings: ClusterSettings; |
||||||
|
/** @deprecated since v16.0.0 - use setupPrimary. */ |
||||||
|
setupMaster(settings?: ClusterSettings): void; |
||||||
|
/** |
||||||
|
* `setupPrimary` is used to change the default 'fork' behavior. Once called, the settings will be present in cluster.settings. |
||||||
|
*/ |
||||||
|
setupPrimary(settings?: ClusterSettings): void; |
||||||
|
readonly worker?: Worker | undefined; |
||||||
|
readonly workers?: NodeJS.Dict<Worker> | undefined; |
||||||
|
readonly SCHED_NONE: number; |
||||||
|
readonly SCHED_RR: number; |
||||||
|
/** |
||||||
|
* events.EventEmitter |
||||||
|
* 1. disconnect |
||||||
|
* 2. exit |
||||||
|
* 3. fork |
||||||
|
* 4. listening |
||||||
|
* 5. message |
||||||
|
* 6. online |
||||||
|
* 7. setup |
||||||
|
*/ |
||||||
|
addListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
addListener(event: 'disconnect', listener: (worker: Worker) => void): this; |
||||||
|
addListener(event: 'exit', listener: (worker: Worker, code: number, signal: string) => void): this; |
||||||
|
addListener(event: 'fork', listener: (worker: Worker) => void): this; |
||||||
|
addListener(event: 'listening', listener: (worker: Worker, address: Address) => void): this; |
||||||
|
addListener(event: 'message', listener: (worker: Worker, message: any, handle: net.Socket | net.Server) => void): this; // the handle is a net.Socket or net.Server object, or undefined.
|
||||||
|
addListener(event: 'online', listener: (worker: Worker) => void): this; |
||||||
|
addListener(event: 'setup', listener: (settings: ClusterSettings) => void): this; |
||||||
|
emit(event: string | symbol, ...args: any[]): boolean; |
||||||
|
emit(event: 'disconnect', worker: Worker): boolean; |
||||||
|
emit(event: 'exit', worker: Worker, code: number, signal: string): boolean; |
||||||
|
emit(event: 'fork', worker: Worker): boolean; |
||||||
|
emit(event: 'listening', worker: Worker, address: Address): boolean; |
||||||
|
emit(event: 'message', worker: Worker, message: any, handle: net.Socket | net.Server): boolean; |
||||||
|
emit(event: 'online', worker: Worker): boolean; |
||||||
|
emit(event: 'setup', settings: ClusterSettings): boolean; |
||||||
|
on(event: string, listener: (...args: any[]) => void): this; |
||||||
|
on(event: 'disconnect', listener: (worker: Worker) => void): this; |
||||||
|
on(event: 'exit', listener: (worker: Worker, code: number, signal: string) => void): this; |
||||||
|
on(event: 'fork', listener: (worker: Worker) => void): this; |
||||||
|
on(event: 'listening', listener: (worker: Worker, address: Address) => void): this; |
||||||
|
on(event: 'message', listener: (worker: Worker, message: any, handle: net.Socket | net.Server) => void): this; // the handle is a net.Socket or net.Server object, or undefined.
|
||||||
|
on(event: 'online', listener: (worker: Worker) => void): this; |
||||||
|
on(event: 'setup', listener: (settings: ClusterSettings) => void): this; |
||||||
|
once(event: string, listener: (...args: any[]) => void): this; |
||||||
|
once(event: 'disconnect', listener: (worker: Worker) => void): this; |
||||||
|
once(event: 'exit', listener: (worker: Worker, code: number, signal: string) => void): this; |
||||||
|
once(event: 'fork', listener: (worker: Worker) => void): this; |
||||||
|
once(event: 'listening', listener: (worker: Worker, address: Address) => void): this; |
||||||
|
once(event: 'message', listener: (worker: Worker, message: any, handle: net.Socket | net.Server) => void): this; // the handle is a net.Socket or net.Server object, or undefined.
|
||||||
|
once(event: 'online', listener: (worker: Worker) => void): this; |
||||||
|
once(event: 'setup', listener: (settings: ClusterSettings) => void): this; |
||||||
|
prependListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
prependListener(event: 'disconnect', listener: (worker: Worker) => void): this; |
||||||
|
prependListener(event: 'exit', listener: (worker: Worker, code: number, signal: string) => void): this; |
||||||
|
prependListener(event: 'fork', listener: (worker: Worker) => void): this; |
||||||
|
prependListener(event: 'listening', listener: (worker: Worker, address: Address) => void): this; |
||||||
|
// the handle is a net.Socket or net.Server object, or undefined.
|
||||||
|
prependListener(event: 'message', listener: (worker: Worker, message: any, handle?: net.Socket | net.Server) => void): this; |
||||||
|
prependListener(event: 'online', listener: (worker: Worker) => void): this; |
||||||
|
prependListener(event: 'setup', listener: (settings: ClusterSettings) => void): this; |
||||||
|
prependOnceListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
prependOnceListener(event: 'disconnect', listener: (worker: Worker) => void): this; |
||||||
|
prependOnceListener(event: 'exit', listener: (worker: Worker, code: number, signal: string) => void): this; |
||||||
|
prependOnceListener(event: 'fork', listener: (worker: Worker) => void): this; |
||||||
|
prependOnceListener(event: 'listening', listener: (worker: Worker, address: Address) => void): this; |
||||||
|
// the handle is a net.Socket or net.Server object, or undefined.
|
||||||
|
prependOnceListener(event: 'message', listener: (worker: Worker, message: any, handle: net.Socket | net.Server) => void): this; |
||||||
|
prependOnceListener(event: 'online', listener: (worker: Worker) => void): this; |
||||||
|
prependOnceListener(event: 'setup', listener: (settings: ClusterSettings) => void): this; |
||||||
|
} |
||||||
|
const cluster: Cluster; |
||||||
|
export default cluster; |
||||||
|
} |
||||||
|
declare module 'node:cluster' { |
||||||
|
export * from 'cluster'; |
||||||
|
export { default as default } from 'cluster'; |
||||||
|
} |
@ -0,0 +1,412 @@ |
|||||||
|
/** |
||||||
|
* The `console` module provides a simple debugging console that is similar to the |
||||||
|
* JavaScript console mechanism provided by web browsers. |
||||||
|
* |
||||||
|
* The module exports two specific components: |
||||||
|
* |
||||||
|
* * A `Console` class with methods such as `console.log()`, `console.error()` and`console.warn()` that can be used to write to any Node.js stream. |
||||||
|
* * A global `console` instance configured to write to `process.stdout` and `process.stderr`. The global `console` can be used without calling`require('console')`. |
||||||
|
* |
||||||
|
* _**Warning**_: The global console object's methods are neither consistently |
||||||
|
* synchronous like the browser APIs they resemble, nor are they consistently |
||||||
|
* asynchronous like all other Node.js streams. See the `note on process I/O` for |
||||||
|
* more information. |
||||||
|
* |
||||||
|
* Example using the global `console`: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* console.log('hello world'); |
||||||
|
* // Prints: hello world, to stdout
|
||||||
|
* console.log('hello %s', 'world'); |
||||||
|
* // Prints: hello world, to stdout
|
||||||
|
* console.error(new Error('Whoops, something bad happened')); |
||||||
|
* // Prints error message and stack trace to stderr:
|
||||||
|
* // Error: Whoops, something bad happened
|
||||||
|
* // at [eval]:5:15
|
||||||
|
* // at Script.runInThisContext (node:vm:132:18)
|
||||||
|
* // at Object.runInThisContext (node:vm:309:38)
|
||||||
|
* // at node:internal/process/execution:77:19
|
||||||
|
* // at [eval]-wrapper:6:22
|
||||||
|
* // at evalScript (node:internal/process/execution:76:60)
|
||||||
|
* // at node:internal/main/eval_string:23:3
|
||||||
|
* |
||||||
|
* const name = 'Will Robinson'; |
||||||
|
* console.warn(`Danger ${name}! Danger!`); |
||||||
|
* // Prints: Danger Will Robinson! Danger!, to stderr
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Example using the `Console` class: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const out = getStreamSomehow(); |
||||||
|
* const err = getStreamSomehow(); |
||||||
|
* const myConsole = new console.Console(out, err); |
||||||
|
* |
||||||
|
* myConsole.log('hello world'); |
||||||
|
* // Prints: hello world, to out
|
||||||
|
* myConsole.log('hello %s', 'world'); |
||||||
|
* // Prints: hello world, to out
|
||||||
|
* myConsole.error(new Error('Whoops, something bad happened')); |
||||||
|
* // Prints: [Error: Whoops, something bad happened], to err
|
||||||
|
* |
||||||
|
* const name = 'Will Robinson'; |
||||||
|
* myConsole.warn(`Danger ${name}! Danger!`); |
||||||
|
* // Prints: Danger Will Robinson! Danger!, to err
|
||||||
|
* ``` |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/console.js)
|
||||||
|
*/ |
||||||
|
declare module 'console' { |
||||||
|
import console = require('node:console'); |
||||||
|
export = console; |
||||||
|
} |
||||||
|
declare module 'node:console' { |
||||||
|
import { InspectOptions } from 'node:util'; |
||||||
|
global { |
||||||
|
// This needs to be global to avoid TS2403 in case lib.dom.d.ts is present in the same build
|
||||||
|
interface Console { |
||||||
|
Console: console.ConsoleConstructor; |
||||||
|
/** |
||||||
|
* `console.assert()` writes a message if `value` is [falsy](https://developer.mozilla.org/en-US/docs/Glossary/Falsy) or omitted. It only
|
||||||
|
* writes a message and does not otherwise affect execution. The output always |
||||||
|
* starts with `"Assertion failed"`. If provided, `message` is formatted using `util.format()`. |
||||||
|
* |
||||||
|
* If `value` is [truthy](https://developer.mozilla.org/en-US/docs/Glossary/Truthy), nothing happens.
|
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* console.assert(true, 'does nothing'); |
||||||
|
* |
||||||
|
* console.assert(false, 'Whoops %s work', 'didn\'t'); |
||||||
|
* // Assertion failed: Whoops didn't work
|
||||||
|
* |
||||||
|
* console.assert(); |
||||||
|
* // Assertion failed
|
||||||
|
* ``` |
||||||
|
* @since v0.1.101 |
||||||
|
* @param value The value tested for being truthy. |
||||||
|
* @param message All arguments besides `value` are used as error message. |
||||||
|
*/ |
||||||
|
assert(value: any, message?: string, ...optionalParams: any[]): void; |
||||||
|
/** |
||||||
|
* When `stdout` is a TTY, calling `console.clear()` will attempt to clear the |
||||||
|
* TTY. When `stdout` is not a TTY, this method does nothing. |
||||||
|
* |
||||||
|
* The specific operation of `console.clear()` can vary across operating systems |
||||||
|
* and terminal types. For most Linux operating systems, `console.clear()`operates similarly to the `clear` shell command. On Windows, `console.clear()`will clear only the output in the |
||||||
|
* current terminal viewport for the Node.js |
||||||
|
* binary. |
||||||
|
* @since v8.3.0 |
||||||
|
*/ |
||||||
|
clear(): void; |
||||||
|
/** |
||||||
|
* Maintains an internal counter specific to `label` and outputs to `stdout` the |
||||||
|
* number of times `console.count()` has been called with the given `label`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* > console.count() |
||||||
|
* default: 1 |
||||||
|
* undefined |
||||||
|
* > console.count('default') |
||||||
|
* default: 2 |
||||||
|
* undefined |
||||||
|
* > console.count('abc') |
||||||
|
* abc: 1 |
||||||
|
* undefined |
||||||
|
* > console.count('xyz') |
||||||
|
* xyz: 1 |
||||||
|
* undefined |
||||||
|
* > console.count('abc') |
||||||
|
* abc: 2 |
||||||
|
* undefined |
||||||
|
* > console.count() |
||||||
|
* default: 3 |
||||||
|
* undefined |
||||||
|
* > |
||||||
|
* ``` |
||||||
|
* @since v8.3.0 |
||||||
|
* @param label The display label for the counter. |
||||||
|
*/ |
||||||
|
count(label?: string): void; |
||||||
|
/** |
||||||
|
* Resets the internal counter specific to `label`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* > console.count('abc'); |
||||||
|
* abc: 1 |
||||||
|
* undefined |
||||||
|
* > console.countReset('abc'); |
||||||
|
* undefined |
||||||
|
* > console.count('abc'); |
||||||
|
* abc: 1 |
||||||
|
* undefined |
||||||
|
* > |
||||||
|
* ``` |
||||||
|
* @since v8.3.0 |
||||||
|
* @param label The display label for the counter. |
||||||
|
*/ |
||||||
|
countReset(label?: string): void; |
||||||
|
/** |
||||||
|
* The `console.debug()` function is an alias for {@link log}. |
||||||
|
* @since v8.0.0 |
||||||
|
*/ |
||||||
|
debug(message?: any, ...optionalParams: any[]): void; |
||||||
|
/** |
||||||
|
* Uses `util.inspect()` on `obj` and prints the resulting string to `stdout`. |
||||||
|
* This function bypasses any custom `inspect()` function defined on `obj`. |
||||||
|
* @since v0.1.101 |
||||||
|
*/ |
||||||
|
dir(obj: any, options?: InspectOptions): void; |
||||||
|
/** |
||||||
|
* This method calls `console.log()` passing it the arguments received. |
||||||
|
* This method does not produce any XML formatting. |
||||||
|
* @since v8.0.0 |
||||||
|
*/ |
||||||
|
dirxml(...data: any[]): void; |
||||||
|
/** |
||||||
|
* Prints to `stderr` with newline. Multiple arguments can be passed, with the |
||||||
|
* first used as the primary message and all additional used as substitution |
||||||
|
* values similar to [`printf(3)`](http://man7.org/linux/man-pages/man3/printf.3.html) (the arguments are all passed to `util.format()`).
|
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const code = 5; |
||||||
|
* console.error('error #%d', code); |
||||||
|
* // Prints: error #5, to stderr
|
||||||
|
* console.error('error', code); |
||||||
|
* // Prints: error 5, to stderr
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* If formatting elements (e.g. `%d`) are not found in the first string then `util.inspect()` is called on each argument and the resulting string |
||||||
|
* values are concatenated. See `util.format()` for more information. |
||||||
|
* @since v0.1.100 |
||||||
|
*/ |
||||||
|
error(message?: any, ...optionalParams: any[]): void; |
||||||
|
/** |
||||||
|
* Increases indentation of subsequent lines by spaces for `groupIndentation`length. |
||||||
|
* |
||||||
|
* If one or more `label`s are provided, those are printed first without the |
||||||
|
* additional indentation. |
||||||
|
* @since v8.5.0 |
||||||
|
*/ |
||||||
|
group(...label: any[]): void; |
||||||
|
/** |
||||||
|
* An alias for {@link group}. |
||||||
|
* @since v8.5.0 |
||||||
|
*/ |
||||||
|
groupCollapsed(...label: any[]): void; |
||||||
|
/** |
||||||
|
* Decreases indentation of subsequent lines by spaces for `groupIndentation`length. |
||||||
|
* @since v8.5.0 |
||||||
|
*/ |
||||||
|
groupEnd(): void; |
||||||
|
/** |
||||||
|
* The `console.info()` function is an alias for {@link log}. |
||||||
|
* @since v0.1.100 |
||||||
|
*/ |
||||||
|
info(message?: any, ...optionalParams: any[]): void; |
||||||
|
/** |
||||||
|
* Prints to `stdout` with newline. Multiple arguments can be passed, with the |
||||||
|
* first used as the primary message and all additional used as substitution |
||||||
|
* values similar to [`printf(3)`](http://man7.org/linux/man-pages/man3/printf.3.html) (the arguments are all passed to `util.format()`).
|
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const count = 5; |
||||||
|
* console.log('count: %d', count); |
||||||
|
* // Prints: count: 5, to stdout
|
||||||
|
* console.log('count:', count); |
||||||
|
* // Prints: count: 5, to stdout
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* See `util.format()` for more information. |
||||||
|
* @since v0.1.100 |
||||||
|
*/ |
||||||
|
log(message?: any, ...optionalParams: any[]): void; |
||||||
|
/** |
||||||
|
* Try to construct a table with the columns of the properties of `tabularData`(or use `properties`) and rows of `tabularData` and log it. Falls back to just |
||||||
|
* logging the argument if it can’t be parsed as tabular. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* // These can't be parsed as tabular data
|
||||||
|
* console.table(Symbol()); |
||||||
|
* // Symbol()
|
||||||
|
* |
||||||
|
* console.table(undefined); |
||||||
|
* // undefined
|
||||||
|
* |
||||||
|
* console.table([{ a: 1, b: 'Y' }, { a: 'Z', b: 2 }]); |
||||||
|
* // ┌─────────┬─────┬─────┐
|
||||||
|
* // │ (index) │ a │ b │
|
||||||
|
* // ├─────────┼─────┼─────┤
|
||||||
|
* // │ 0 │ 1 │ 'Y' │
|
||||||
|
* // │ 1 │ 'Z' │ 2 │
|
||||||
|
* // └─────────┴─────┴─────┘
|
||||||
|
* |
||||||
|
* console.table([{ a: 1, b: 'Y' }, { a: 'Z', b: 2 }], ['a']); |
||||||
|
* // ┌─────────┬─────┐
|
||||||
|
* // │ (index) │ a │
|
||||||
|
* // ├─────────┼─────┤
|
||||||
|
* // │ 0 │ 1 │
|
||||||
|
* // │ 1 │ 'Z' │
|
||||||
|
* // └─────────┴─────┘
|
||||||
|
* ``` |
||||||
|
* @since v10.0.0 |
||||||
|
* @param properties Alternate properties for constructing the table. |
||||||
|
*/ |
||||||
|
table(tabularData: any, properties?: ReadonlyArray<string>): void; |
||||||
|
/** |
||||||
|
* Starts a timer that can be used to compute the duration of an operation. Timers |
||||||
|
* are identified by a unique `label`. Use the same `label` when calling {@link timeEnd} to stop the timer and output the elapsed time in |
||||||
|
* suitable time units to `stdout`. For example, if the elapsed |
||||||
|
* time is 3869ms, `console.timeEnd()` displays "3.869s". |
||||||
|
* @since v0.1.104 |
||||||
|
*/ |
||||||
|
time(label?: string): void; |
||||||
|
/** |
||||||
|
* Stops a timer that was previously started by calling {@link time} and |
||||||
|
* prints the result to `stdout`: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* console.time('100-elements'); |
||||||
|
* for (let i = 0; i < 100; i++) {} |
||||||
|
* console.timeEnd('100-elements'); |
||||||
|
* // prints 100-elements: 225.438ms
|
||||||
|
* ``` |
||||||
|
* @since v0.1.104 |
||||||
|
*/ |
||||||
|
timeEnd(label?: string): void; |
||||||
|
/** |
||||||
|
* For a timer that was previously started by calling {@link time}, prints |
||||||
|
* the elapsed time and other `data` arguments to `stdout`: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* console.time('process'); |
||||||
|
* const value = expensiveProcess1(); // Returns 42
|
||||||
|
* console.timeLog('process', value); |
||||||
|
* // Prints "process: 365.227ms 42".
|
||||||
|
* doExpensiveProcess2(value); |
||||||
|
* console.timeEnd('process'); |
||||||
|
* ``` |
||||||
|
* @since v10.7.0 |
||||||
|
*/ |
||||||
|
timeLog(label?: string, ...data: any[]): void; |
||||||
|
/** |
||||||
|
* Prints to `stderr` the string `'Trace: '`, followed by the `util.format()` formatted message and stack trace to the current position in the code. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* console.trace('Show me'); |
||||||
|
* // Prints: (stack trace will vary based on where trace is called)
|
||||||
|
* // Trace: Show me
|
||||||
|
* // at repl:2:9
|
||||||
|
* // at REPLServer.defaultEval (repl.js:248:27)
|
||||||
|
* // at bound (domain.js:287:14)
|
||||||
|
* // at REPLServer.runBound [as eval] (domain.js:300:12)
|
||||||
|
* // at REPLServer.<anonymous> (repl.js:412:12)
|
||||||
|
* // at emitOne (events.js:82:20)
|
||||||
|
* // at REPLServer.emit (events.js:169:7)
|
||||||
|
* // at REPLServer.Interface._onLine (readline.js:210:10)
|
||||||
|
* // at REPLServer.Interface._line (readline.js:549:8)
|
||||||
|
* // at REPLServer.Interface._ttyWrite (readline.js:826:14)
|
||||||
|
* ``` |
||||||
|
* @since v0.1.104 |
||||||
|
*/ |
||||||
|
trace(message?: any, ...optionalParams: any[]): void; |
||||||
|
/** |
||||||
|
* The `console.warn()` function is an alias for {@link error}. |
||||||
|
* @since v0.1.100 |
||||||
|
*/ |
||||||
|
warn(message?: any, ...optionalParams: any[]): void; |
||||||
|
// --- Inspector mode only ---
|
||||||
|
/** |
||||||
|
* This method does not display anything unless used in the inspector. |
||||||
|
* Starts a JavaScript CPU profile with an optional label. |
||||||
|
*/ |
||||||
|
profile(label?: string): void; |
||||||
|
/** |
||||||
|
* This method does not display anything unless used in the inspector. |
||||||
|
* Stops the current JavaScript CPU profiling session if one has been started and prints the report to the Profiles panel of the inspector. |
||||||
|
*/ |
||||||
|
profileEnd(label?: string): void; |
||||||
|
/** |
||||||
|
* This method does not display anything unless used in the inspector. |
||||||
|
* Adds an event with the label `label` to the Timeline panel of the inspector. |
||||||
|
*/ |
||||||
|
timeStamp(label?: string): void; |
||||||
|
} |
||||||
|
/** |
||||||
|
* The `console` module provides a simple debugging console that is similar to the |
||||||
|
* JavaScript console mechanism provided by web browsers. |
||||||
|
* |
||||||
|
* The module exports two specific components: |
||||||
|
* |
||||||
|
* * A `Console` class with methods such as `console.log()`, `console.error()` and`console.warn()` that can be used to write to any Node.js stream. |
||||||
|
* * A global `console` instance configured to write to `process.stdout` and `process.stderr`. The global `console` can be used without calling`require('console')`. |
||||||
|
* |
||||||
|
* _**Warning**_: The global console object's methods are neither consistently |
||||||
|
* synchronous like the browser APIs they resemble, nor are they consistently |
||||||
|
* asynchronous like all other Node.js streams. See the `note on process I/O` for |
||||||
|
* more information. |
||||||
|
* |
||||||
|
* Example using the global `console`: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* console.log('hello world'); |
||||||
|
* // Prints: hello world, to stdout
|
||||||
|
* console.log('hello %s', 'world'); |
||||||
|
* // Prints: hello world, to stdout
|
||||||
|
* console.error(new Error('Whoops, something bad happened')); |
||||||
|
* // Prints error message and stack trace to stderr:
|
||||||
|
* // Error: Whoops, something bad happened
|
||||||
|
* // at [eval]:5:15
|
||||||
|
* // at Script.runInThisContext (node:vm:132:18)
|
||||||
|
* // at Object.runInThisContext (node:vm:309:38)
|
||||||
|
* // at node:internal/process/execution:77:19
|
||||||
|
* // at [eval]-wrapper:6:22
|
||||||
|
* // at evalScript (node:internal/process/execution:76:60)
|
||||||
|
* // at node:internal/main/eval_string:23:3
|
||||||
|
* |
||||||
|
* const name = 'Will Robinson'; |
||||||
|
* console.warn(`Danger ${name}! Danger!`); |
||||||
|
* // Prints: Danger Will Robinson! Danger!, to stderr
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Example using the `Console` class: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const out = getStreamSomehow(); |
||||||
|
* const err = getStreamSomehow(); |
||||||
|
* const myConsole = new console.Console(out, err); |
||||||
|
* |
||||||
|
* myConsole.log('hello world'); |
||||||
|
* // Prints: hello world, to out
|
||||||
|
* myConsole.log('hello %s', 'world'); |
||||||
|
* // Prints: hello world, to out
|
||||||
|
* myConsole.error(new Error('Whoops, something bad happened')); |
||||||
|
* // Prints: [Error: Whoops, something bad happened], to err
|
||||||
|
* |
||||||
|
* const name = 'Will Robinson'; |
||||||
|
* myConsole.warn(`Danger ${name}! Danger!`); |
||||||
|
* // Prints: Danger Will Robinson! Danger!, to err
|
||||||
|
* ``` |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v16.4.2/lib/console.js)
|
||||||
|
*/ |
||||||
|
namespace console { |
||||||
|
interface ConsoleConstructorOptions { |
||||||
|
stdout: NodeJS.WritableStream; |
||||||
|
stderr?: NodeJS.WritableStream | undefined; |
||||||
|
ignoreErrors?: boolean | undefined; |
||||||
|
colorMode?: boolean | 'auto' | undefined; |
||||||
|
inspectOptions?: InspectOptions | undefined; |
||||||
|
/** |
||||||
|
* Set group indentation |
||||||
|
* @default 2 |
||||||
|
*/ |
||||||
|
groupIndentation?: number | undefined; |
||||||
|
} |
||||||
|
interface ConsoleConstructor { |
||||||
|
prototype: Console; |
||||||
|
new (stdout: NodeJS.WritableStream, stderr?: NodeJS.WritableStream, ignoreErrors?: boolean): Console; |
||||||
|
new (options: ConsoleConstructorOptions): Console; |
||||||
|
} |
||||||
|
} |
||||||
|
var console: Console; |
||||||
|
} |
||||||
|
export = globalThis.console; |
||||||
|
} |
@ -0,0 +1,18 @@ |
|||||||
|
/** @deprecated since v6.3.0 - use constants property exposed by the relevant module instead. */ |
||||||
|
declare module 'constants' { |
||||||
|
import { constants as osConstants, SignalConstants } from 'node:os'; |
||||||
|
import { constants as cryptoConstants } from 'node:crypto'; |
||||||
|
import { constants as fsConstants } from 'node:fs'; |
||||||
|
|
||||||
|
const exp: typeof osConstants.errno & |
||||||
|
typeof osConstants.priority & |
||||||
|
SignalConstants & |
||||||
|
typeof cryptoConstants & |
||||||
|
typeof fsConstants; |
||||||
|
export = exp; |
||||||
|
} |
||||||
|
|
||||||
|
declare module 'node:constants' { |
||||||
|
import constants = require('constants'); |
||||||
|
export = constants; |
||||||
|
} |
File diff suppressed because it is too large
Load Diff
@ -0,0 +1,545 @@ |
|||||||
|
/** |
||||||
|
* The `dgram` module provides an implementation of UDP datagram sockets. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import dgram from 'dgram'; |
||||||
|
* |
||||||
|
* const server = dgram.createSocket('udp4'); |
||||||
|
* |
||||||
|
* server.on('error', (err) => { |
||||||
|
* console.log(`server error:\n${err.stack}`); |
||||||
|
* server.close(); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* server.on('message', (msg, rinfo) => { |
||||||
|
* console.log(`server got: ${msg} from ${rinfo.address}:${rinfo.port}`); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* server.on('listening', () => { |
||||||
|
* const address = server.address(); |
||||||
|
* console.log(`server listening ${address.address}:${address.port}`); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* server.bind(41234); |
||||||
|
* // Prints: server listening 0.0.0.0:41234
|
||||||
|
* ``` |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/dgram.js)
|
||||||
|
*/ |
||||||
|
declare module 'dgram' { |
||||||
|
import { AddressInfo } from 'node:net'; |
||||||
|
import * as dns from 'node:dns'; |
||||||
|
import { EventEmitter, Abortable } from 'node:events'; |
||||||
|
interface RemoteInfo { |
||||||
|
address: string; |
||||||
|
family: 'IPv4' | 'IPv6'; |
||||||
|
port: number; |
||||||
|
size: number; |
||||||
|
} |
||||||
|
interface BindOptions { |
||||||
|
port?: number | undefined; |
||||||
|
address?: string | undefined; |
||||||
|
exclusive?: boolean | undefined; |
||||||
|
fd?: number | undefined; |
||||||
|
} |
||||||
|
type SocketType = 'udp4' | 'udp6'; |
||||||
|
interface SocketOptions extends Abortable { |
||||||
|
type: SocketType; |
||||||
|
reuseAddr?: boolean | undefined; |
||||||
|
/** |
||||||
|
* @default false |
||||||
|
*/ |
||||||
|
ipv6Only?: boolean | undefined; |
||||||
|
recvBufferSize?: number | undefined; |
||||||
|
sendBufferSize?: number | undefined; |
||||||
|
lookup?: ((hostname: string, options: dns.LookupOneOptions, callback: (err: NodeJS.ErrnoException | null, address: string, family: number) => void) => void) | undefined; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Creates a `dgram.Socket` object. Once the socket is created, calling `socket.bind()` will instruct the socket to begin listening for datagram |
||||||
|
* messages. When `address` and `port` are not passed to `socket.bind()` the |
||||||
|
* method will bind the socket to the "all interfaces" address on a random port |
||||||
|
* (it does the right thing for both `udp4` and `udp6` sockets). The bound address |
||||||
|
* and port can be retrieved using `socket.address().address` and `socket.address().port`. |
||||||
|
* |
||||||
|
* If the `signal` option is enabled, calling `.abort()` on the corresponding`AbortController` is similar to calling `.close()` on the socket: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const controller = new AbortController(); |
||||||
|
* const { signal } = controller; |
||||||
|
* const server = dgram.createSocket({ type: 'udp4', signal }); |
||||||
|
* server.on('message', (msg, rinfo) => { |
||||||
|
* console.log(`server got: ${msg} from ${rinfo.address}:${rinfo.port}`); |
||||||
|
* }); |
||||||
|
* // Later, when you want to close the server.
|
||||||
|
* controller.abort(); |
||||||
|
* ``` |
||||||
|
* @since v0.11.13 |
||||||
|
* @param options Available options are: |
||||||
|
* @param callback Attached as a listener for `'message'` events. Optional. |
||||||
|
*/ |
||||||
|
function createSocket(type: SocketType, callback?: (msg: Buffer, rinfo: RemoteInfo) => void): Socket; |
||||||
|
function createSocket(options: SocketOptions, callback?: (msg: Buffer, rinfo: RemoteInfo) => void): Socket; |
||||||
|
/** |
||||||
|
* Encapsulates the datagram functionality. |
||||||
|
* |
||||||
|
* New instances of `dgram.Socket` are created using {@link createSocket}. |
||||||
|
* The `new` keyword is not to be used to create `dgram.Socket` instances. |
||||||
|
* @since v0.1.99 |
||||||
|
*/ |
||||||
|
class Socket extends EventEmitter { |
||||||
|
/** |
||||||
|
* Tells the kernel to join a multicast group at the given `multicastAddress` and`multicastInterface` using the `IP_ADD_MEMBERSHIP` socket option. If the`multicastInterface` argument is not |
||||||
|
* specified, the operating system will choose |
||||||
|
* one interface and will add membership to it. To add membership to every |
||||||
|
* available interface, call `addMembership` multiple times, once per interface. |
||||||
|
* |
||||||
|
* When called on an unbound socket, this method will implicitly bind to a random |
||||||
|
* port, listening on all interfaces. |
||||||
|
* |
||||||
|
* When sharing a UDP socket across multiple `cluster` workers, the`socket.addMembership()` function must be called only once or an`EADDRINUSE` error will occur: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import cluster from 'cluster'; |
||||||
|
* import dgram from 'dgram'; |
||||||
|
* |
||||||
|
* if (cluster.isPrimary) { |
||||||
|
* cluster.fork(); // Works ok.
|
||||||
|
* cluster.fork(); // Fails with EADDRINUSE.
|
||||||
|
* } else { |
||||||
|
* const s = dgram.createSocket('udp4'); |
||||||
|
* s.bind(1234, () => { |
||||||
|
* s.addMembership('224.0.0.114'); |
||||||
|
* }); |
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v0.6.9 |
||||||
|
*/ |
||||||
|
addMembership(multicastAddress: string, multicastInterface?: string): void; |
||||||
|
/** |
||||||
|
* Returns an object containing the address information for a socket. |
||||||
|
* For UDP sockets, this object will contain `address`, `family` and `port`properties. |
||||||
|
* |
||||||
|
* This method throws `EBADF` if called on an unbound socket. |
||||||
|
* @since v0.1.99 |
||||||
|
*/ |
||||||
|
address(): AddressInfo; |
||||||
|
/** |
||||||
|
* For UDP sockets, causes the `dgram.Socket` to listen for datagram |
||||||
|
* messages on a named `port` and optional `address`. If `port` is not |
||||||
|
* specified or is `0`, the operating system will attempt to bind to a |
||||||
|
* random port. If `address` is not specified, the operating system will |
||||||
|
* attempt to listen on all addresses. Once binding is complete, a`'listening'` event is emitted and the optional `callback` function is |
||||||
|
* called. |
||||||
|
* |
||||||
|
* Specifying both a `'listening'` event listener and passing a`callback` to the `socket.bind()` method is not harmful but not very |
||||||
|
* useful. |
||||||
|
* |
||||||
|
* A bound datagram socket keeps the Node.js process running to receive |
||||||
|
* datagram messages. |
||||||
|
* |
||||||
|
* If binding fails, an `'error'` event is generated. In rare case (e.g. |
||||||
|
* attempting to bind with a closed socket), an `Error` may be thrown. |
||||||
|
* |
||||||
|
* Example of a UDP server listening on port 41234: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import dgram from 'dgram'; |
||||||
|
* |
||||||
|
* const server = dgram.createSocket('udp4'); |
||||||
|
* |
||||||
|
* server.on('error', (err) => { |
||||||
|
* console.log(`server error:\n${err.stack}`); |
||||||
|
* server.close(); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* server.on('message', (msg, rinfo) => { |
||||||
|
* console.log(`server got: ${msg} from ${rinfo.address}:${rinfo.port}`); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* server.on('listening', () => { |
||||||
|
* const address = server.address(); |
||||||
|
* console.log(`server listening ${address.address}:${address.port}`); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* server.bind(41234); |
||||||
|
* // Prints: server listening 0.0.0.0:41234
|
||||||
|
* ``` |
||||||
|
* @since v0.1.99 |
||||||
|
* @param callback with no parameters. Called when binding is complete. |
||||||
|
*/ |
||||||
|
bind(port?: number, address?: string, callback?: () => void): this; |
||||||
|
bind(port?: number, callback?: () => void): this; |
||||||
|
bind(callback?: () => void): this; |
||||||
|
bind(options: BindOptions, callback?: () => void): this; |
||||||
|
/** |
||||||
|
* Close the underlying socket and stop listening for data on it. If a callback is |
||||||
|
* provided, it is added as a listener for the `'close'` event. |
||||||
|
* @since v0.1.99 |
||||||
|
* @param callback Called when the socket has been closed. |
||||||
|
*/ |
||||||
|
close(callback?: () => void): this; |
||||||
|
/** |
||||||
|
* Associates the `dgram.Socket` to a remote address and port. Every |
||||||
|
* message sent by this handle is automatically sent to that destination. Also, |
||||||
|
* the socket will only receive messages from that remote peer. |
||||||
|
* Trying to call `connect()` on an already connected socket will result |
||||||
|
* in an `ERR_SOCKET_DGRAM_IS_CONNECTED` exception. If `address` is not |
||||||
|
* provided, `'127.0.0.1'` (for `udp4` sockets) or `'::1'` (for `udp6` sockets) |
||||||
|
* will be used by default. Once the connection is complete, a `'connect'` event |
||||||
|
* is emitted and the optional `callback` function is called. In case of failure, |
||||||
|
* the `callback` is called or, failing this, an `'error'` event is emitted. |
||||||
|
* @since v12.0.0 |
||||||
|
* @param callback Called when the connection is completed or on error. |
||||||
|
*/ |
||||||
|
connect(port: number, address?: string, callback?: () => void): void; |
||||||
|
connect(port: number, callback: () => void): void; |
||||||
|
/** |
||||||
|
* A synchronous function that disassociates a connected `dgram.Socket` from |
||||||
|
* its remote address. Trying to call `disconnect()` on an unbound or already |
||||||
|
* disconnected socket will result in an `ERR_SOCKET_DGRAM_NOT_CONNECTED` exception. |
||||||
|
* @since v12.0.0 |
||||||
|
*/ |
||||||
|
disconnect(): void; |
||||||
|
/** |
||||||
|
* Instructs the kernel to leave a multicast group at `multicastAddress` using the`IP_DROP_MEMBERSHIP` socket option. This method is automatically called by the |
||||||
|
* kernel when the socket is closed or the process terminates, so most apps will |
||||||
|
* never have reason to call this. |
||||||
|
* |
||||||
|
* If `multicastInterface` is not specified, the operating system will attempt to |
||||||
|
* drop membership on all valid interfaces. |
||||||
|
* @since v0.6.9 |
||||||
|
*/ |
||||||
|
dropMembership(multicastAddress: string, multicastInterface?: string): void; |
||||||
|
/** |
||||||
|
* This method throws `ERR_SOCKET_BUFFER_SIZE` if called on an unbound socket. |
||||||
|
* @since v8.7.0 |
||||||
|
* @return the `SO_RCVBUF` socket receive buffer size in bytes. |
||||||
|
*/ |
||||||
|
getRecvBufferSize(): number; |
||||||
|
/** |
||||||
|
* This method throws `ERR_SOCKET_BUFFER_SIZE` if called on an unbound socket. |
||||||
|
* @since v8.7.0 |
||||||
|
* @return the `SO_SNDBUF` socket send buffer size in bytes. |
||||||
|
*/ |
||||||
|
getSendBufferSize(): number; |
||||||
|
/** |
||||||
|
* By default, binding a socket will cause it to block the Node.js process from |
||||||
|
* exiting as long as the socket is open. The `socket.unref()` method can be used |
||||||
|
* to exclude the socket from the reference counting that keeps the Node.js |
||||||
|
* process active. The `socket.ref()` method adds the socket back to the reference |
||||||
|
* counting and restores the default behavior. |
||||||
|
* |
||||||
|
* Calling `socket.ref()` multiples times will have no additional effect. |
||||||
|
* |
||||||
|
* The `socket.ref()` method returns a reference to the socket so calls can be |
||||||
|
* chained. |
||||||
|
* @since v0.9.1 |
||||||
|
*/ |
||||||
|
ref(): this; |
||||||
|
/** |
||||||
|
* Returns an object containing the `address`, `family`, and `port` of the remote |
||||||
|
* endpoint. This method throws an `ERR_SOCKET_DGRAM_NOT_CONNECTED` exception |
||||||
|
* if the socket is not connected. |
||||||
|
* @since v12.0.0 |
||||||
|
*/ |
||||||
|
remoteAddress(): AddressInfo; |
||||||
|
/** |
||||||
|
* Broadcasts a datagram on the socket. |
||||||
|
* For connectionless sockets, the destination `port` and `address` must be |
||||||
|
* specified. Connected sockets, on the other hand, will use their associated |
||||||
|
* remote endpoint, so the `port` and `address` arguments must not be set. |
||||||
|
* |
||||||
|
* The `msg` argument contains the message to be sent. |
||||||
|
* Depending on its type, different behavior can apply. If `msg` is a `Buffer`, |
||||||
|
* any `TypedArray` or a `DataView`, |
||||||
|
* the `offset` and `length` specify the offset within the `Buffer` where the |
||||||
|
* message begins and the number of bytes in the message, respectively. |
||||||
|
* If `msg` is a `String`, then it is automatically converted to a `Buffer`with `'utf8'` encoding. With messages that |
||||||
|
* contain multi-byte characters, `offset` and `length` will be calculated with |
||||||
|
* respect to `byte length` and not the character position. |
||||||
|
* If `msg` is an array, `offset` and `length` must not be specified. |
||||||
|
* |
||||||
|
* The `address` argument is a string. If the value of `address` is a host name, |
||||||
|
* DNS will be used to resolve the address of the host. If `address` is not |
||||||
|
* provided or otherwise nullish, `'127.0.0.1'` (for `udp4` sockets) or `'::1'`(for `udp6` sockets) will be used by default. |
||||||
|
* |
||||||
|
* If the socket has not been previously bound with a call to `bind`, the socket |
||||||
|
* is assigned a random port number and is bound to the "all interfaces" address |
||||||
|
* (`'0.0.0.0'` for `udp4` sockets, `'::0'` for `udp6` sockets.) |
||||||
|
* |
||||||
|
* An optional `callback` function may be specified to as a way of reporting |
||||||
|
* DNS errors or for determining when it is safe to reuse the `buf` object. |
||||||
|
* DNS lookups delay the time to send for at least one tick of the |
||||||
|
* Node.js event loop. |
||||||
|
* |
||||||
|
* The only way to know for sure that the datagram has been sent is by using a`callback`. If an error occurs and a `callback` is given, the error will be |
||||||
|
* passed as the first argument to the `callback`. If a `callback` is not given, |
||||||
|
* the error is emitted as an `'error'` event on the `socket` object. |
||||||
|
* |
||||||
|
* Offset and length are optional but both _must_ be set if either are used. |
||||||
|
* They are supported only when the first argument is a `Buffer`, a `TypedArray`, |
||||||
|
* or a `DataView`. |
||||||
|
* |
||||||
|
* This method throws `ERR_SOCKET_BAD_PORT` if called on an unbound socket. |
||||||
|
* |
||||||
|
* Example of sending a UDP packet to a port on `localhost`; |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import dgram from 'dgram'; |
||||||
|
* import { Buffer } from 'buffer'; |
||||||
|
* |
||||||
|
* const message = Buffer.from('Some bytes'); |
||||||
|
* const client = dgram.createSocket('udp4'); |
||||||
|
* client.send(message, 41234, 'localhost', (err) => { |
||||||
|
* client.close(); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Example of sending a UDP packet composed of multiple buffers to a port on`127.0.0.1`; |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import dgram from 'dgram'; |
||||||
|
* import { Buffer } from 'buffer'; |
||||||
|
* |
||||||
|
* const buf1 = Buffer.from('Some '); |
||||||
|
* const buf2 = Buffer.from('bytes'); |
||||||
|
* const client = dgram.createSocket('udp4'); |
||||||
|
* client.send([buf1, buf2], 41234, (err) => { |
||||||
|
* client.close(); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Sending multiple buffers might be faster or slower depending on the |
||||||
|
* application and operating system. Run benchmarks to |
||||||
|
* determine the optimal strategy on a case-by-case basis. Generally speaking, |
||||||
|
* however, sending multiple buffers is faster. |
||||||
|
* |
||||||
|
* Example of sending a UDP packet using a socket connected to a port on`localhost`: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import dgram from 'dgram'; |
||||||
|
* import { Buffer } from 'buffer'; |
||||||
|
* |
||||||
|
* const message = Buffer.from('Some bytes'); |
||||||
|
* const client = dgram.createSocket('udp4'); |
||||||
|
* client.connect(41234, 'localhost', (err) => { |
||||||
|
* client.send(message, (err) => { |
||||||
|
* client.close(); |
||||||
|
* }); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* @since v0.1.99 |
||||||
|
* @param msg Message to be sent. |
||||||
|
* @param offset Offset in the buffer where the message starts. |
||||||
|
* @param length Number of bytes in the message. |
||||||
|
* @param port Destination port. |
||||||
|
* @param address Destination host name or IP address. |
||||||
|
* @param callback Called when the message has been sent. |
||||||
|
*/ |
||||||
|
send(msg: string | Uint8Array | ReadonlyArray<any>, port?: number, address?: string, callback?: (error: Error | null, bytes: number) => void): void; |
||||||
|
send(msg: string | Uint8Array | ReadonlyArray<any>, port?: number, callback?: (error: Error | null, bytes: number) => void): void; |
||||||
|
send(msg: string | Uint8Array | ReadonlyArray<any>, callback?: (error: Error | null, bytes: number) => void): void; |
||||||
|
send(msg: string | Uint8Array, offset: number, length: number, port?: number, address?: string, callback?: (error: Error | null, bytes: number) => void): void; |
||||||
|
send(msg: string | Uint8Array, offset: number, length: number, port?: number, callback?: (error: Error | null, bytes: number) => void): void; |
||||||
|
send(msg: string | Uint8Array, offset: number, length: number, callback?: (error: Error | null, bytes: number) => void): void; |
||||||
|
/** |
||||||
|
* Sets or clears the `SO_BROADCAST` socket option. When set to `true`, UDP |
||||||
|
* packets may be sent to a local interface's broadcast address. |
||||||
|
* |
||||||
|
* This method throws `EBADF` if called on an unbound socket. |
||||||
|
* @since v0.6.9 |
||||||
|
*/ |
||||||
|
setBroadcast(flag: boolean): void; |
||||||
|
/** |
||||||
|
* _All references to scope in this section are referring to [IPv6 Zone Indices](https://en.wikipedia.org/wiki/IPv6_address#Scoped_literal_IPv6_addresses), which are defined by [RFC
|
||||||
|
* 4007](https://tools.ietf.org/html/rfc4007). In string form, an IP_
|
||||||
|
* _with a scope index is written as `'IP%scope'` where scope is an interface name_ |
||||||
|
* _or interface number._ |
||||||
|
* |
||||||
|
* Sets the default outgoing multicast interface of the socket to a chosen |
||||||
|
* interface or back to system interface selection. The `multicastInterface` must |
||||||
|
* be a valid string representation of an IP from the socket's family. |
||||||
|
* |
||||||
|
* For IPv4 sockets, this should be the IP configured for the desired physical |
||||||
|
* interface. All packets sent to multicast on the socket will be sent on the |
||||||
|
* interface determined by the most recent successful use of this call. |
||||||
|
* |
||||||
|
* For IPv6 sockets, `multicastInterface` should include a scope to indicate the |
||||||
|
* interface as in the examples that follow. In IPv6, individual `send` calls can |
||||||
|
* also use explicit scope in addresses, so only packets sent to a multicast |
||||||
|
* address without specifying an explicit scope are affected by the most recent |
||||||
|
* successful use of this call. |
||||||
|
* |
||||||
|
* This method throws `EBADF` if called on an unbound socket. |
||||||
|
* |
||||||
|
* #### Example: IPv6 outgoing multicast interface |
||||||
|
* |
||||||
|
* On most systems, where scope format uses the interface name: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const socket = dgram.createSocket('udp6'); |
||||||
|
* |
||||||
|
* socket.bind(1234, () => { |
||||||
|
* socket.setMulticastInterface('::%eth1'); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* On Windows, where scope format uses an interface number: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const socket = dgram.createSocket('udp6'); |
||||||
|
* |
||||||
|
* socket.bind(1234, () => { |
||||||
|
* socket.setMulticastInterface('::%2'); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* #### Example: IPv4 outgoing multicast interface |
||||||
|
* |
||||||
|
* All systems use an IP of the host on the desired physical interface: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const socket = dgram.createSocket('udp4'); |
||||||
|
* |
||||||
|
* socket.bind(1234, () => { |
||||||
|
* socket.setMulticastInterface('10.0.0.2'); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* @since v8.6.0 |
||||||
|
*/ |
||||||
|
setMulticastInterface(multicastInterface: string): void; |
||||||
|
/** |
||||||
|
* Sets or clears the `IP_MULTICAST_LOOP` socket option. When set to `true`, |
||||||
|
* multicast packets will also be received on the local interface. |
||||||
|
* |
||||||
|
* This method throws `EBADF` if called on an unbound socket. |
||||||
|
* @since v0.3.8 |
||||||
|
*/ |
||||||
|
setMulticastLoopback(flag: boolean): boolean; |
||||||
|
/** |
||||||
|
* Sets the `IP_MULTICAST_TTL` socket option. While TTL generally stands for |
||||||
|
* "Time to Live", in this context it specifies the number of IP hops that a |
||||||
|
* packet is allowed to travel through, specifically for multicast traffic. Each |
||||||
|
* router or gateway that forwards a packet decrements the TTL. If the TTL is |
||||||
|
* decremented to 0 by a router, it will not be forwarded. |
||||||
|
* |
||||||
|
* The `ttl` argument may be between 0 and 255\. The default on most systems is `1`. |
||||||
|
* |
||||||
|
* This method throws `EBADF` if called on an unbound socket. |
||||||
|
* @since v0.3.8 |
||||||
|
*/ |
||||||
|
setMulticastTTL(ttl: number): number; |
||||||
|
/** |
||||||
|
* Sets the `SO_RCVBUF` socket option. Sets the maximum socket receive buffer |
||||||
|
* in bytes. |
||||||
|
* |
||||||
|
* This method throws `ERR_SOCKET_BUFFER_SIZE` if called on an unbound socket. |
||||||
|
* @since v8.7.0 |
||||||
|
*/ |
||||||
|
setRecvBufferSize(size: number): void; |
||||||
|
/** |
||||||
|
* Sets the `SO_SNDBUF` socket option. Sets the maximum socket send buffer |
||||||
|
* in bytes. |
||||||
|
* |
||||||
|
* This method throws `ERR_SOCKET_BUFFER_SIZE` if called on an unbound socket. |
||||||
|
* @since v8.7.0 |
||||||
|
*/ |
||||||
|
setSendBufferSize(size: number): void; |
||||||
|
/** |
||||||
|
* Sets the `IP_TTL` socket option. While TTL generally stands for "Time to Live", |
||||||
|
* in this context it specifies the number of IP hops that a packet is allowed to |
||||||
|
* travel through. Each router or gateway that forwards a packet decrements the |
||||||
|
* TTL. If the TTL is decremented to 0 by a router, it will not be forwarded. |
||||||
|
* Changing TTL values is typically done for network probes or when multicasting. |
||||||
|
* |
||||||
|
* The `ttl` argument may be between 1 and 255\. The default on most systems |
||||||
|
* is 64. |
||||||
|
* |
||||||
|
* This method throws `EBADF` if called on an unbound socket. |
||||||
|
* @since v0.1.101 |
||||||
|
*/ |
||||||
|
setTTL(ttl: number): number; |
||||||
|
/** |
||||||
|
* By default, binding a socket will cause it to block the Node.js process from |
||||||
|
* exiting as long as the socket is open. The `socket.unref()` method can be used |
||||||
|
* to exclude the socket from the reference counting that keeps the Node.js |
||||||
|
* process active, allowing the process to exit even if the socket is still |
||||||
|
* listening. |
||||||
|
* |
||||||
|
* Calling `socket.unref()` multiple times will have no addition effect. |
||||||
|
* |
||||||
|
* The `socket.unref()` method returns a reference to the socket so calls can be |
||||||
|
* chained. |
||||||
|
* @since v0.9.1 |
||||||
|
*/ |
||||||
|
unref(): this; |
||||||
|
/** |
||||||
|
* Tells the kernel to join a source-specific multicast channel at the given`sourceAddress` and `groupAddress`, using the `multicastInterface` with the`IP_ADD_SOURCE_MEMBERSHIP` socket |
||||||
|
* option. If the `multicastInterface` argument |
||||||
|
* is not specified, the operating system will choose one interface and will add |
||||||
|
* membership to it. To add membership to every available interface, call`socket.addSourceSpecificMembership()` multiple times, once per interface. |
||||||
|
* |
||||||
|
* When called on an unbound socket, this method will implicitly bind to a random |
||||||
|
* port, listening on all interfaces. |
||||||
|
* @since v13.1.0, v12.16.0 |
||||||
|
*/ |
||||||
|
addSourceSpecificMembership(sourceAddress: string, groupAddress: string, multicastInterface?: string): void; |
||||||
|
/** |
||||||
|
* Instructs the kernel to leave a source-specific multicast channel at the given`sourceAddress` and `groupAddress` using the `IP_DROP_SOURCE_MEMBERSHIP`socket option. This method is |
||||||
|
* automatically called by the kernel when the |
||||||
|
* socket is closed or the process terminates, so most apps will never have |
||||||
|
* reason to call this. |
||||||
|
* |
||||||
|
* If `multicastInterface` is not specified, the operating system will attempt to |
||||||
|
* drop membership on all valid interfaces. |
||||||
|
* @since v13.1.0, v12.16.0 |
||||||
|
*/ |
||||||
|
dropSourceSpecificMembership(sourceAddress: string, groupAddress: string, multicastInterface?: string): void; |
||||||
|
/** |
||||||
|
* events.EventEmitter |
||||||
|
* 1. close |
||||||
|
* 2. connect |
||||||
|
* 3. error |
||||||
|
* 4. listening |
||||||
|
* 5. message |
||||||
|
*/ |
||||||
|
addListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
addListener(event: 'close', listener: () => void): this; |
||||||
|
addListener(event: 'connect', listener: () => void): this; |
||||||
|
addListener(event: 'error', listener: (err: Error) => void): this; |
||||||
|
addListener(event: 'listening', listener: () => void): this; |
||||||
|
addListener(event: 'message', listener: (msg: Buffer, rinfo: RemoteInfo) => void): this; |
||||||
|
emit(event: string | symbol, ...args: any[]): boolean; |
||||||
|
emit(event: 'close'): boolean; |
||||||
|
emit(event: 'connect'): boolean; |
||||||
|
emit(event: 'error', err: Error): boolean; |
||||||
|
emit(event: 'listening'): boolean; |
||||||
|
emit(event: 'message', msg: Buffer, rinfo: RemoteInfo): boolean; |
||||||
|
on(event: string, listener: (...args: any[]) => void): this; |
||||||
|
on(event: 'close', listener: () => void): this; |
||||||
|
on(event: 'connect', listener: () => void): this; |
||||||
|
on(event: 'error', listener: (err: Error) => void): this; |
||||||
|
on(event: 'listening', listener: () => void): this; |
||||||
|
on(event: 'message', listener: (msg: Buffer, rinfo: RemoteInfo) => void): this; |
||||||
|
once(event: string, listener: (...args: any[]) => void): this; |
||||||
|
once(event: 'close', listener: () => void): this; |
||||||
|
once(event: 'connect', listener: () => void): this; |
||||||
|
once(event: 'error', listener: (err: Error) => void): this; |
||||||
|
once(event: 'listening', listener: () => void): this; |
||||||
|
once(event: 'message', listener: (msg: Buffer, rinfo: RemoteInfo) => void): this; |
||||||
|
prependListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
prependListener(event: 'close', listener: () => void): this; |
||||||
|
prependListener(event: 'connect', listener: () => void): this; |
||||||
|
prependListener(event: 'error', listener: (err: Error) => void): this; |
||||||
|
prependListener(event: 'listening', listener: () => void): this; |
||||||
|
prependListener(event: 'message', listener: (msg: Buffer, rinfo: RemoteInfo) => void): this; |
||||||
|
prependOnceListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
prependOnceListener(event: 'close', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'connect', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'error', listener: (err: Error) => void): this; |
||||||
|
prependOnceListener(event: 'listening', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'message', listener: (msg: Buffer, rinfo: RemoteInfo) => void): this; |
||||||
|
} |
||||||
|
} |
||||||
|
declare module 'node:dgram' { |
||||||
|
export * from 'dgram'; |
||||||
|
} |
@ -0,0 +1,153 @@ |
|||||||
|
/** |
||||||
|
* The `diagnostics_channel` module provides an API to create named channels |
||||||
|
* to report arbitrary message data for diagnostics purposes. |
||||||
|
* |
||||||
|
* It can be accessed using: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import diagnostics_channel from 'diagnostics_channel'; |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* It is intended that a module writer wanting to report diagnostics messages |
||||||
|
* will create one or many top-level channels to report messages through. |
||||||
|
* Channels may also be acquired at runtime but it is not encouraged |
||||||
|
* due to the additional overhead of doing so. Channels may be exported for |
||||||
|
* convenience, but as long as the name is known it can be acquired anywhere. |
||||||
|
* |
||||||
|
* If you intend for your module to produce diagnostics data for others to |
||||||
|
* consume it is recommended that you include documentation of what named |
||||||
|
* channels are used along with the shape of the message data. Channel names |
||||||
|
* should generally include the module name to avoid collisions with data from |
||||||
|
* other modules.
|
||||||
|
* @experimental |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/diagnostics_channel.js)
|
||||||
|
*/ |
||||||
|
declare module 'diagnostics_channel' { |
||||||
|
/** |
||||||
|
* Check if there are active subscribers to the named channel. This is helpful if |
||||||
|
* the message you want to send might be expensive to prepare. |
||||||
|
* |
||||||
|
* This API is optional but helpful when trying to publish messages from very |
||||||
|
* performance-sensitive code. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import diagnostics_channel from 'diagnostics_channel'; |
||||||
|
* |
||||||
|
* if (diagnostics_channel.hasSubscribers('my-channel')) { |
||||||
|
* // There are subscribers, prepare and publish message
|
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v15.1.0, v14.17.0 |
||||||
|
* @param name The channel name |
||||||
|
* @return If there are active subscribers |
||||||
|
*/ |
||||||
|
function hasSubscribers(name: string): boolean; |
||||||
|
/** |
||||||
|
* This is the primary entry-point for anyone wanting to interact with a named |
||||||
|
* channel. It produces a channel object which is optimized to reduce overhead at |
||||||
|
* publish time as much as possible. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import diagnostics_channel from 'diagnostics_channel'; |
||||||
|
* |
||||||
|
* const channel = diagnostics_channel.channel('my-channel'); |
||||||
|
* ``` |
||||||
|
* @since v15.1.0, v14.17.0 |
||||||
|
* @param name The channel name |
||||||
|
* @return The named channel object |
||||||
|
*/ |
||||||
|
function channel(name: string): Channel; |
||||||
|
type ChannelListener = (message: unknown, name: string) => void; |
||||||
|
/** |
||||||
|
* The class `Channel` represents an individual named channel within the data |
||||||
|
* pipeline. It is use to track subscribers and to publish messages when there |
||||||
|
* are subscribers present. It exists as a separate object to avoid channel |
||||||
|
* lookups at publish time, enabling very fast publish speeds and allowing |
||||||
|
* for heavy use while incurring very minimal cost. Channels are created with {@link channel}, constructing a channel directly |
||||||
|
* with `new Channel(name)` is not supported. |
||||||
|
* @since v15.1.0, v14.17.0 |
||||||
|
*/ |
||||||
|
class Channel { |
||||||
|
readonly name: string; |
||||||
|
/** |
||||||
|
* Check if there are active subscribers to this channel. This is helpful if |
||||||
|
* the message you want to send might be expensive to prepare. |
||||||
|
* |
||||||
|
* This API is optional but helpful when trying to publish messages from very |
||||||
|
* performance-sensitive code. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import diagnostics_channel from 'diagnostics_channel'; |
||||||
|
* |
||||||
|
* const channel = diagnostics_channel.channel('my-channel'); |
||||||
|
* |
||||||
|
* if (channel.hasSubscribers) { |
||||||
|
* // There are subscribers, prepare and publish message
|
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v15.1.0, v14.17.0 |
||||||
|
*/ |
||||||
|
readonly hasSubscribers: boolean; |
||||||
|
private constructor(name: string); |
||||||
|
/** |
||||||
|
* Publish a message to any subscribers to the channel. This will |
||||||
|
* trigger message handlers synchronously so they will execute within |
||||||
|
* the same context. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import diagnostics_channel from 'diagnostics_channel'; |
||||||
|
* |
||||||
|
* const channel = diagnostics_channel.channel('my-channel'); |
||||||
|
* |
||||||
|
* channel.publish({ |
||||||
|
* some: 'message' |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* @since v15.1.0, v14.17.0 |
||||||
|
* @param message The message to send to the channel subscribers |
||||||
|
*/ |
||||||
|
publish(message: unknown): void; |
||||||
|
/** |
||||||
|
* Register a message handler to subscribe to this channel. This message handler |
||||||
|
* will be run synchronously whenever a message is published to the channel. Any |
||||||
|
* errors thrown in the message handler will trigger an `'uncaughtException'`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import diagnostics_channel from 'diagnostics_channel'; |
||||||
|
* |
||||||
|
* const channel = diagnostics_channel.channel('my-channel'); |
||||||
|
* |
||||||
|
* channel.subscribe((message, name) => { |
||||||
|
* // Received data
|
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* @since v15.1.0, v14.17.0 |
||||||
|
* @param onMessage The handler to receive channel messages |
||||||
|
*/ |
||||||
|
subscribe(onMessage: ChannelListener): void; |
||||||
|
/** |
||||||
|
* Remove a message handler previously registered to this channel with `channel.subscribe(onMessage)`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import diagnostics_channel from 'diagnostics_channel'; |
||||||
|
* |
||||||
|
* const channel = diagnostics_channel.channel('my-channel'); |
||||||
|
* |
||||||
|
* function onMessage(message, name) { |
||||||
|
* // Received data
|
||||||
|
* } |
||||||
|
* |
||||||
|
* channel.subscribe(onMessage); |
||||||
|
* |
||||||
|
* channel.unsubscribe(onMessage); |
||||||
|
* ``` |
||||||
|
* @since v15.1.0, v14.17.0 |
||||||
|
* @param onMessage The previous subscribed handler to remove |
||||||
|
* @return `true` if the handler was found, `false` otherwise. |
||||||
|
*/ |
||||||
|
unsubscribe(onMessage: ChannelListener): void; |
||||||
|
} |
||||||
|
} |
||||||
|
declare module 'node:diagnostics_channel' { |
||||||
|
export * from 'diagnostics_channel'; |
||||||
|
} |
@ -0,0 +1,659 @@ |
|||||||
|
/** |
||||||
|
* The `dns` module enables name resolution. For example, use it to look up IP |
||||||
|
* addresses of host names. |
||||||
|
* |
||||||
|
* Although named for the [Domain Name System (DNS)](https://en.wikipedia.org/wiki/Domain_Name_System), it does not always use the
|
||||||
|
* DNS protocol for lookups. {@link lookup} uses the operating system |
||||||
|
* facilities to perform name resolution. It may not need to perform any network |
||||||
|
* communication. To perform name resolution the way other applications on the same |
||||||
|
* system do, use {@link lookup}. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const dns = require('dns'); |
||||||
|
* |
||||||
|
* dns.lookup('example.org', (err, address, family) => { |
||||||
|
* console.log('address: %j family: IPv%s', address, family); |
||||||
|
* }); |
||||||
|
* // address: "93.184.216.34" family: IPv4
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* All other functions in the `dns` module connect to an actual DNS server to |
||||||
|
* perform name resolution. They will always use the network to perform DNS |
||||||
|
* queries. These functions do not use the same set of configuration files used by {@link lookup} (e.g. `/etc/hosts`). Use these functions to always perform |
||||||
|
* DNS queries, bypassing other name-resolution facilities. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const dns = require('dns'); |
||||||
|
* |
||||||
|
* dns.resolve4('archive.org', (err, addresses) => { |
||||||
|
* if (err) throw err; |
||||||
|
* |
||||||
|
* console.log(`addresses: ${JSON.stringify(addresses)}`); |
||||||
|
* |
||||||
|
* addresses.forEach((a) => { |
||||||
|
* dns.reverse(a, (err, hostnames) => { |
||||||
|
* if (err) { |
||||||
|
* throw err; |
||||||
|
* } |
||||||
|
* console.log(`reverse for ${a}: ${JSON.stringify(hostnames)}`); |
||||||
|
* }); |
||||||
|
* }); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* See the `Implementation considerations section` for more information. |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/dns.js)
|
||||||
|
*/ |
||||||
|
declare module 'dns' { |
||||||
|
import * as dnsPromises from 'node:dns/promises'; |
||||||
|
// Supported getaddrinfo flags.
|
||||||
|
export const ADDRCONFIG: number; |
||||||
|
export const V4MAPPED: number; |
||||||
|
/** |
||||||
|
* If `dns.V4MAPPED` is specified, return resolved IPv6 addresses as |
||||||
|
* well as IPv4 mapped IPv6 addresses. |
||||||
|
*/ |
||||||
|
export const ALL: number; |
||||||
|
export interface LookupOptions { |
||||||
|
family?: number | undefined; |
||||||
|
hints?: number | undefined; |
||||||
|
all?: boolean | undefined; |
||||||
|
/** |
||||||
|
* @default true |
||||||
|
*/ |
||||||
|
verbatim?: boolean | undefined; |
||||||
|
} |
||||||
|
export interface LookupOneOptions extends LookupOptions { |
||||||
|
all?: false | undefined; |
||||||
|
} |
||||||
|
export interface LookupAllOptions extends LookupOptions { |
||||||
|
all: true; |
||||||
|
} |
||||||
|
export interface LookupAddress { |
||||||
|
address: string; |
||||||
|
family: number; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Resolves a host name (e.g. `'nodejs.org'`) into the first found A (IPv4) or |
||||||
|
* AAAA (IPv6) record. All `option` properties are optional. If `options` is an |
||||||
|
* integer, then it must be `4` or `6` – if `options` is not provided, then IPv4 |
||||||
|
* and IPv6 addresses are both returned if found. |
||||||
|
* |
||||||
|
* With the `all` option set to `true`, the arguments for `callback` change to`(err, addresses)`, with `addresses` being an array of objects with the |
||||||
|
* properties `address` and `family`. |
||||||
|
* |
||||||
|
* On error, `err` is an `Error` object, where `err.code` is the error code. |
||||||
|
* Keep in mind that `err.code` will be set to `'ENOTFOUND'` not only when |
||||||
|
* the host name does not exist but also when the lookup fails in other ways |
||||||
|
* such as no available file descriptors. |
||||||
|
* |
||||||
|
* `dns.lookup()` does not necessarily have anything to do with the DNS protocol. |
||||||
|
* The implementation uses an operating system facility that can associate names |
||||||
|
* with addresses, and vice versa. This implementation can have subtle but |
||||||
|
* important consequences on the behavior of any Node.js program. Please take some |
||||||
|
* time to consult the `Implementation considerations section` before using`dns.lookup()`. |
||||||
|
* |
||||||
|
* Example usage: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const dns = require('dns'); |
||||||
|
* const options = { |
||||||
|
* family: 6, |
||||||
|
* hints: dns.ADDRCONFIG | dns.V4MAPPED, |
||||||
|
* }; |
||||||
|
* dns.lookup('example.com', options, (err, address, family) => |
||||||
|
* console.log('address: %j family: IPv%s', address, family)); |
||||||
|
* // address: "2606:2800:220:1:248:1893:25c8:1946" family: IPv6
|
||||||
|
* |
||||||
|
* // When options.all is true, the result will be an Array.
|
||||||
|
* options.all = true; |
||||||
|
* dns.lookup('example.com', options, (err, addresses) => |
||||||
|
* console.log('addresses: %j', addresses)); |
||||||
|
* // addresses: [{"address":"2606:2800:220:1:248:1893:25c8:1946","family":6}]
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* If this method is invoked as its `util.promisify()` ed version, and `all`is not set to `true`, it returns a `Promise` for an `Object` with `address` and`family` properties. |
||||||
|
* @since v0.1.90 |
||||||
|
*/ |
||||||
|
export function lookup(hostname: string, family: number, callback: (err: NodeJS.ErrnoException | null, address: string, family: number) => void): void; |
||||||
|
export function lookup(hostname: string, options: LookupOneOptions, callback: (err: NodeJS.ErrnoException | null, address: string, family: number) => void): void; |
||||||
|
export function lookup(hostname: string, options: LookupAllOptions, callback: (err: NodeJS.ErrnoException | null, addresses: LookupAddress[]) => void): void; |
||||||
|
export function lookup(hostname: string, options: LookupOptions, callback: (err: NodeJS.ErrnoException | null, address: string | LookupAddress[], family: number) => void): void; |
||||||
|
export function lookup(hostname: string, callback: (err: NodeJS.ErrnoException | null, address: string, family: number) => void): void; |
||||||
|
export namespace lookup { |
||||||
|
function __promisify__(hostname: string, options: LookupAllOptions): Promise<LookupAddress[]>; |
||||||
|
function __promisify__(hostname: string, options?: LookupOneOptions | number): Promise<LookupAddress>; |
||||||
|
function __promisify__(hostname: string, options: LookupOptions): Promise<LookupAddress | LookupAddress[]>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Resolves the given `address` and `port` into a host name and service using |
||||||
|
* the operating system's underlying `getnameinfo` implementation. |
||||||
|
* |
||||||
|
* If `address` is not a valid IP address, a `TypeError` will be thrown. |
||||||
|
* The `port` will be coerced to a number. If it is not a legal port, a `TypeError`will be thrown. |
||||||
|
* |
||||||
|
* On an error, `err` is an `Error` object, where `err.code` is the error code. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const dns = require('dns'); |
||||||
|
* dns.lookupService('127.0.0.1', 22, (err, hostname, service) => { |
||||||
|
* console.log(hostname, service); |
||||||
|
* // Prints: localhost ssh
|
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* If this method is invoked as its `util.promisify()` ed version, it returns a`Promise` for an `Object` with `hostname` and `service` properties. |
||||||
|
* @since v0.11.14 |
||||||
|
*/ |
||||||
|
export function lookupService(address: string, port: number, callback: (err: NodeJS.ErrnoException | null, hostname: string, service: string) => void): void; |
||||||
|
export namespace lookupService { |
||||||
|
function __promisify__( |
||||||
|
address: string, |
||||||
|
port: number |
||||||
|
): Promise<{ |
||||||
|
hostname: string; |
||||||
|
service: string; |
||||||
|
}>; |
||||||
|
} |
||||||
|
export interface ResolveOptions { |
||||||
|
ttl: boolean; |
||||||
|
} |
||||||
|
export interface ResolveWithTtlOptions extends ResolveOptions { |
||||||
|
ttl: true; |
||||||
|
} |
||||||
|
export interface RecordWithTtl { |
||||||
|
address: string; |
||||||
|
ttl: number; |
||||||
|
} |
||||||
|
/** @deprecated Use `AnyARecord` or `AnyAaaaRecord` instead. */ |
||||||
|
export type AnyRecordWithTtl = AnyARecord | AnyAaaaRecord; |
||||||
|
export interface AnyARecord extends RecordWithTtl { |
||||||
|
type: 'A'; |
||||||
|
} |
||||||
|
export interface AnyAaaaRecord extends RecordWithTtl { |
||||||
|
type: 'AAAA'; |
||||||
|
} |
||||||
|
export interface CaaRecord { |
||||||
|
critial: number; |
||||||
|
issue?: string | undefined; |
||||||
|
issuewild?: string | undefined; |
||||||
|
iodef?: string | undefined; |
||||||
|
contactemail?: string | undefined; |
||||||
|
contactphone?: string | undefined; |
||||||
|
} |
||||||
|
export interface MxRecord { |
||||||
|
priority: number; |
||||||
|
exchange: string; |
||||||
|
} |
||||||
|
export interface AnyMxRecord extends MxRecord { |
||||||
|
type: 'MX'; |
||||||
|
} |
||||||
|
export interface NaptrRecord { |
||||||
|
flags: string; |
||||||
|
service: string; |
||||||
|
regexp: string; |
||||||
|
replacement: string; |
||||||
|
order: number; |
||||||
|
preference: number; |
||||||
|
} |
||||||
|
export interface AnyNaptrRecord extends NaptrRecord { |
||||||
|
type: 'NAPTR'; |
||||||
|
} |
||||||
|
export interface SoaRecord { |
||||||
|
nsname: string; |
||||||
|
hostmaster: string; |
||||||
|
serial: number; |
||||||
|
refresh: number; |
||||||
|
retry: number; |
||||||
|
expire: number; |
||||||
|
minttl: number; |
||||||
|
} |
||||||
|
export interface AnySoaRecord extends SoaRecord { |
||||||
|
type: 'SOA'; |
||||||
|
} |
||||||
|
export interface SrvRecord { |
||||||
|
priority: number; |
||||||
|
weight: number; |
||||||
|
port: number; |
||||||
|
name: string; |
||||||
|
} |
||||||
|
export interface AnySrvRecord extends SrvRecord { |
||||||
|
type: 'SRV'; |
||||||
|
} |
||||||
|
export interface AnyTxtRecord { |
||||||
|
type: 'TXT'; |
||||||
|
entries: string[]; |
||||||
|
} |
||||||
|
export interface AnyNsRecord { |
||||||
|
type: 'NS'; |
||||||
|
value: string; |
||||||
|
} |
||||||
|
export interface AnyPtrRecord { |
||||||
|
type: 'PTR'; |
||||||
|
value: string; |
||||||
|
} |
||||||
|
export interface AnyCnameRecord { |
||||||
|
type: 'CNAME'; |
||||||
|
value: string; |
||||||
|
} |
||||||
|
export type AnyRecord = AnyARecord | AnyAaaaRecord | AnyCnameRecord | AnyMxRecord | AnyNaptrRecord | AnyNsRecord | AnyPtrRecord | AnySoaRecord | AnySrvRecord | AnyTxtRecord; |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve a host name (e.g. `'nodejs.org'`) into an array |
||||||
|
* of the resource records. The `callback` function has arguments`(err, records)`. When successful, `records` will be an array of resource |
||||||
|
* records. The type and structure of individual results varies based on `rrtype`: |
||||||
|
* |
||||||
|
* <omitted> |
||||||
|
* |
||||||
|
* On error, `err` is an `Error` object, where `err.code` is one of the `DNS error codes`. |
||||||
|
* @since v0.1.27 |
||||||
|
* @param hostname Host name to resolve. |
||||||
|
* @param [rrtype='A'] Resource record type. |
||||||
|
*/ |
||||||
|
export function resolve(hostname: string, callback: (err: NodeJS.ErrnoException | null, addresses: string[]) => void): void; |
||||||
|
export function resolve(hostname: string, rrtype: 'A', callback: (err: NodeJS.ErrnoException | null, addresses: string[]) => void): void; |
||||||
|
export function resolve(hostname: string, rrtype: 'AAAA', callback: (err: NodeJS.ErrnoException | null, addresses: string[]) => void): void; |
||||||
|
export function resolve(hostname: string, rrtype: 'ANY', callback: (err: NodeJS.ErrnoException | null, addresses: AnyRecord[]) => void): void; |
||||||
|
export function resolve(hostname: string, rrtype: 'CNAME', callback: (err: NodeJS.ErrnoException | null, addresses: string[]) => void): void; |
||||||
|
export function resolve(hostname: string, rrtype: 'MX', callback: (err: NodeJS.ErrnoException | null, addresses: MxRecord[]) => void): void; |
||||||
|
export function resolve(hostname: string, rrtype: 'NAPTR', callback: (err: NodeJS.ErrnoException | null, addresses: NaptrRecord[]) => void): void; |
||||||
|
export function resolve(hostname: string, rrtype: 'NS', callback: (err: NodeJS.ErrnoException | null, addresses: string[]) => void): void; |
||||||
|
export function resolve(hostname: string, rrtype: 'PTR', callback: (err: NodeJS.ErrnoException | null, addresses: string[]) => void): void; |
||||||
|
export function resolve(hostname: string, rrtype: 'SOA', callback: (err: NodeJS.ErrnoException | null, addresses: SoaRecord) => void): void; |
||||||
|
export function resolve(hostname: string, rrtype: 'SRV', callback: (err: NodeJS.ErrnoException | null, addresses: SrvRecord[]) => void): void; |
||||||
|
export function resolve(hostname: string, rrtype: 'TXT', callback: (err: NodeJS.ErrnoException | null, addresses: string[][]) => void): void; |
||||||
|
export function resolve( |
||||||
|
hostname: string, |
||||||
|
rrtype: string, |
||||||
|
callback: (err: NodeJS.ErrnoException | null, addresses: string[] | MxRecord[] | NaptrRecord[] | SoaRecord | SrvRecord[] | string[][] | AnyRecord[]) => void |
||||||
|
): void; |
||||||
|
export namespace resolve { |
||||||
|
function __promisify__(hostname: string, rrtype?: 'A' | 'AAAA' | 'CNAME' | 'NS' | 'PTR'): Promise<string[]>; |
||||||
|
function __promisify__(hostname: string, rrtype: 'ANY'): Promise<AnyRecord[]>; |
||||||
|
function __promisify__(hostname: string, rrtype: 'MX'): Promise<MxRecord[]>; |
||||||
|
function __promisify__(hostname: string, rrtype: 'NAPTR'): Promise<NaptrRecord[]>; |
||||||
|
function __promisify__(hostname: string, rrtype: 'SOA'): Promise<SoaRecord>; |
||||||
|
function __promisify__(hostname: string, rrtype: 'SRV'): Promise<SrvRecord[]>; |
||||||
|
function __promisify__(hostname: string, rrtype: 'TXT'): Promise<string[][]>; |
||||||
|
function __promisify__(hostname: string, rrtype: string): Promise<string[] | MxRecord[] | NaptrRecord[] | SoaRecord | SrvRecord[] | string[][] | AnyRecord[]>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve a IPv4 addresses (`A` records) for the`hostname`. The `addresses` argument passed to the `callback` function |
||||||
|
* will contain an array of IPv4 addresses (e.g.`['74.125.79.104', '74.125.79.105', '74.125.79.106']`). |
||||||
|
* @since v0.1.16 |
||||||
|
* @param hostname Host name to resolve. |
||||||
|
*/ |
||||||
|
export function resolve4(hostname: string, callback: (err: NodeJS.ErrnoException | null, addresses: string[]) => void): void; |
||||||
|
export function resolve4(hostname: string, options: ResolveWithTtlOptions, callback: (err: NodeJS.ErrnoException | null, addresses: RecordWithTtl[]) => void): void; |
||||||
|
export function resolve4(hostname: string, options: ResolveOptions, callback: (err: NodeJS.ErrnoException | null, addresses: string[] | RecordWithTtl[]) => void): void; |
||||||
|
export namespace resolve4 { |
||||||
|
function __promisify__(hostname: string): Promise<string[]>; |
||||||
|
function __promisify__(hostname: string, options: ResolveWithTtlOptions): Promise<RecordWithTtl[]>; |
||||||
|
function __promisify__(hostname: string, options?: ResolveOptions): Promise<string[] | RecordWithTtl[]>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve a IPv6 addresses (`AAAA` records) for the`hostname`. The `addresses` argument passed to the `callback` function |
||||||
|
* will contain an array of IPv6 addresses. |
||||||
|
* @since v0.1.16 |
||||||
|
* @param hostname Host name to resolve. |
||||||
|
*/ |
||||||
|
export function resolve6(hostname: string, callback: (err: NodeJS.ErrnoException | null, addresses: string[]) => void): void; |
||||||
|
export function resolve6(hostname: string, options: ResolveWithTtlOptions, callback: (err: NodeJS.ErrnoException | null, addresses: RecordWithTtl[]) => void): void; |
||||||
|
export function resolve6(hostname: string, options: ResolveOptions, callback: (err: NodeJS.ErrnoException | null, addresses: string[] | RecordWithTtl[]) => void): void; |
||||||
|
export namespace resolve6 { |
||||||
|
function __promisify__(hostname: string): Promise<string[]>; |
||||||
|
function __promisify__(hostname: string, options: ResolveWithTtlOptions): Promise<RecordWithTtl[]>; |
||||||
|
function __promisify__(hostname: string, options?: ResolveOptions): Promise<string[] | RecordWithTtl[]>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve `CNAME` records for the `hostname`. The`addresses` argument passed to the `callback` function |
||||||
|
* will contain an array of canonical name records available for the `hostname`(e.g. `['bar.example.com']`). |
||||||
|
* @since v0.3.2 |
||||||
|
*/ |
||||||
|
export function resolveCname(hostname: string, callback: (err: NodeJS.ErrnoException | null, addresses: string[]) => void): void; |
||||||
|
export namespace resolveCname { |
||||||
|
function __promisify__(hostname: string): Promise<string[]>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve `CAA` records for the `hostname`. The`addresses` argument passed to the `callback` function |
||||||
|
* will contain an array of certification authority authorization records |
||||||
|
* available for the `hostname` (e.g. `[{critical: 0, iodef: 'mailto:pki@example.com'}, {critical: 128, issue: 'pki.example.com'}]`). |
||||||
|
* @since v15.0.0, v14.17.0 |
||||||
|
*/ |
||||||
|
export function resolveCaa(hostname: string, callback: (err: NodeJS.ErrnoException | null, records: CaaRecord[]) => void): void; |
||||||
|
export namespace resolveCaa { |
||||||
|
function __promisify__(hostname: string): Promise<CaaRecord[]>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve mail exchange records (`MX` records) for the`hostname`. The `addresses` argument passed to the `callback` function will |
||||||
|
* contain an array of objects containing both a `priority` and `exchange`property (e.g. `[{priority: 10, exchange: 'mx.example.com'}, ...]`). |
||||||
|
* @since v0.1.27 |
||||||
|
*/ |
||||||
|
export function resolveMx(hostname: string, callback: (err: NodeJS.ErrnoException | null, addresses: MxRecord[]) => void): void; |
||||||
|
export namespace resolveMx { |
||||||
|
function __promisify__(hostname: string): Promise<MxRecord[]>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve regular expression based records (`NAPTR`records) for the `hostname`. The `addresses` argument passed to the `callback`function will contain an array of |
||||||
|
* objects with the following properties: |
||||||
|
* |
||||||
|
* * `flags` |
||||||
|
* * `service` |
||||||
|
* * `regexp` |
||||||
|
* * `replacement` |
||||||
|
* * `order` |
||||||
|
* * `preference` |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* { |
||||||
|
* flags: 's', |
||||||
|
* service: 'SIP+D2U', |
||||||
|
* regexp: '', |
||||||
|
* replacement: '_sip._udp.example.com', |
||||||
|
* order: 30, |
||||||
|
* preference: 100 |
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v0.9.12 |
||||||
|
*/ |
||||||
|
export function resolveNaptr(hostname: string, callback: (err: NodeJS.ErrnoException | null, addresses: NaptrRecord[]) => void): void; |
||||||
|
export namespace resolveNaptr { |
||||||
|
function __promisify__(hostname: string): Promise<NaptrRecord[]>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve name server records (`NS` records) for the`hostname`. The `addresses` argument passed to the `callback` function will |
||||||
|
* contain an array of name server records available for `hostname`(e.g. `['ns1.example.com', 'ns2.example.com']`). |
||||||
|
* @since v0.1.90 |
||||||
|
*/ |
||||||
|
export function resolveNs(hostname: string, callback: (err: NodeJS.ErrnoException | null, addresses: string[]) => void): void; |
||||||
|
export namespace resolveNs { |
||||||
|
function __promisify__(hostname: string): Promise<string[]>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve pointer records (`PTR` records) for the`hostname`. The `addresses` argument passed to the `callback` function will |
||||||
|
* be an array of strings containing the reply records. |
||||||
|
* @since v6.0.0 |
||||||
|
*/ |
||||||
|
export function resolvePtr(hostname: string, callback: (err: NodeJS.ErrnoException | null, addresses: string[]) => void): void; |
||||||
|
export namespace resolvePtr { |
||||||
|
function __promisify__(hostname: string): Promise<string[]>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve a start of authority record (`SOA` record) for |
||||||
|
* the `hostname`. The `address` argument passed to the `callback` function will |
||||||
|
* be an object with the following properties: |
||||||
|
* |
||||||
|
* * `nsname` |
||||||
|
* * `hostmaster` |
||||||
|
* * `serial` |
||||||
|
* * `refresh` |
||||||
|
* * `retry` |
||||||
|
* * `expire` |
||||||
|
* * `minttl` |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* { |
||||||
|
* nsname: 'ns.example.com', |
||||||
|
* hostmaster: 'root.example.com', |
||||||
|
* serial: 2013101809, |
||||||
|
* refresh: 10000, |
||||||
|
* retry: 2400, |
||||||
|
* expire: 604800, |
||||||
|
* minttl: 3600 |
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v0.11.10 |
||||||
|
*/ |
||||||
|
export function resolveSoa(hostname: string, callback: (err: NodeJS.ErrnoException | null, address: SoaRecord) => void): void; |
||||||
|
export namespace resolveSoa { |
||||||
|
function __promisify__(hostname: string): Promise<SoaRecord>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve service records (`SRV` records) for the`hostname`. The `addresses` argument passed to the `callback` function will |
||||||
|
* be an array of objects with the following properties: |
||||||
|
* |
||||||
|
* * `priority` |
||||||
|
* * `weight` |
||||||
|
* * `port` |
||||||
|
* * `name` |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* { |
||||||
|
* priority: 10, |
||||||
|
* weight: 5, |
||||||
|
* port: 21223, |
||||||
|
* name: 'service.example.com' |
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v0.1.27 |
||||||
|
*/ |
||||||
|
export function resolveSrv(hostname: string, callback: (err: NodeJS.ErrnoException | null, addresses: SrvRecord[]) => void): void; |
||||||
|
export namespace resolveSrv { |
||||||
|
function __promisify__(hostname: string): Promise<SrvRecord[]>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve text queries (`TXT` records) for the`hostname`. The `records` argument passed to the `callback` function is a |
||||||
|
* two-dimensional array of the text records available for `hostname` (e.g.`[ ['v=spf1 ip4:0.0.0.0 ', '~all' ] ]`). Each sub-array contains TXT chunks of |
||||||
|
* one record. Depending on the use case, these could be either joined together or |
||||||
|
* treated separately. |
||||||
|
* @since v0.1.27 |
||||||
|
*/ |
||||||
|
export function resolveTxt(hostname: string, callback: (err: NodeJS.ErrnoException | null, addresses: string[][]) => void): void; |
||||||
|
export namespace resolveTxt { |
||||||
|
function __promisify__(hostname: string): Promise<string[][]>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve all records (also known as `ANY` or `*` query). |
||||||
|
* The `ret` argument passed to the `callback` function will be an array containing |
||||||
|
* various types of records. Each object has a property `type` that indicates the |
||||||
|
* type of the current record. And depending on the `type`, additional properties |
||||||
|
* will be present on the object: |
||||||
|
* |
||||||
|
* <omitted> |
||||||
|
* |
||||||
|
* Here is an example of the `ret` object passed to the callback: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* [ { type: 'A', address: '127.0.0.1', ttl: 299 }, |
||||||
|
* { type: 'CNAME', value: 'example.com' }, |
||||||
|
* { type: 'MX', exchange: 'alt4.aspmx.l.example.com', priority: 50 }, |
||||||
|
* { type: 'NS', value: 'ns1.example.com' }, |
||||||
|
* { type: 'TXT', entries: [ 'v=spf1 include:_spf.example.com ~all' ] }, |
||||||
|
* { type: 'SOA', |
||||||
|
* nsname: 'ns1.example.com', |
||||||
|
* hostmaster: 'admin.example.com', |
||||||
|
* serial: 156696742, |
||||||
|
* refresh: 900, |
||||||
|
* retry: 900, |
||||||
|
* expire: 1800, |
||||||
|
* minttl: 60 } ] |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* DNS server operators may choose not to respond to `ANY`queries. It may be better to call individual methods like {@link resolve4},{@link resolveMx}, and so on. For more details, see [RFC |
||||||
|
* 8482](https://tools.ietf.org/html/rfc8482).
|
||||||
|
*/ |
||||||
|
export function resolveAny(hostname: string, callback: (err: NodeJS.ErrnoException | null, addresses: AnyRecord[]) => void): void; |
||||||
|
export namespace resolveAny { |
||||||
|
function __promisify__(hostname: string): Promise<AnyRecord[]>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Performs a reverse DNS query that resolves an IPv4 or IPv6 address to an |
||||||
|
* array of host names. |
||||||
|
* |
||||||
|
* On error, `err` is an `Error` object, where `err.code` is |
||||||
|
* one of the `DNS error codes`. |
||||||
|
* @since v0.1.16 |
||||||
|
*/ |
||||||
|
export function reverse(ip: string, callback: (err: NodeJS.ErrnoException | null, hostnames: string[]) => void): void; |
||||||
|
/** |
||||||
|
* Sets the IP address and port of servers to be used when performing DNS |
||||||
|
* resolution. The `servers` argument is an array of [RFC 5952](https://tools.ietf.org/html/rfc5952#section-6) formatted
|
||||||
|
* addresses. If the port is the IANA default DNS port (53) it can be omitted. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* dns.setServers([ |
||||||
|
* '4.4.4.4', |
||||||
|
* '[2001:4860:4860::8888]', |
||||||
|
* '4.4.4.4:1053', |
||||||
|
* '[2001:4860:4860::8888]:1053', |
||||||
|
* ]); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* An error will be thrown if an invalid address is provided. |
||||||
|
* |
||||||
|
* The `dns.setServers()` method must not be called while a DNS query is in |
||||||
|
* progress. |
||||||
|
* |
||||||
|
* The {@link setServers} method affects only {@link resolve},`dns.resolve*()` and {@link reverse} (and specifically _not_ {@link lookup}). |
||||||
|
* |
||||||
|
* This method works much like [resolve.conf](https://man7.org/linux/man-pages/man5/resolv.conf.5.html).
|
||||||
|
* That is, if attempting to resolve with the first server provided results in a`NOTFOUND` error, the `resolve()` method will _not_ attempt to resolve with |
||||||
|
* subsequent servers provided. Fallback DNS servers will only be used if the |
||||||
|
* earlier ones time out or result in some other error. |
||||||
|
* @since v0.11.3 |
||||||
|
* @param servers array of `RFC 5952` formatted addresses |
||||||
|
*/ |
||||||
|
export function setServers(servers: ReadonlyArray<string>): void; |
||||||
|
/** |
||||||
|
* Returns an array of IP address strings, formatted according to [RFC 5952](https://tools.ietf.org/html/rfc5952#section-6),
|
||||||
|
* that are currently configured for DNS resolution. A string will include a port |
||||||
|
* section if a custom port is used. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* [ |
||||||
|
* '4.4.4.4', |
||||||
|
* '2001:4860:4860::8888', |
||||||
|
* '4.4.4.4:1053', |
||||||
|
* '[2001:4860:4860::8888]:1053', |
||||||
|
* ] |
||||||
|
* ``` |
||||||
|
* @since v0.11.3 |
||||||
|
*/ |
||||||
|
export function getServers(): string[]; |
||||||
|
/** |
||||||
|
* Set the default value of `verbatim` in {@link lookup} and `dnsPromises.lookup()`. The value could be: |
||||||
|
* |
||||||
|
* * `ipv4first`: sets default `verbatim` `false`. |
||||||
|
* * `verbatim`: sets default `verbatim` `true`. |
||||||
|
* |
||||||
|
* The default is `ipv4first` and {@link setDefaultResultOrder} have higher |
||||||
|
* priority than `--dns-result-order`. When using `worker threads`,{@link setDefaultResultOrder} from the main thread won't affect the default |
||||||
|
* dns orders in workers. |
||||||
|
* @since v16.4.0, v14.18.0 |
||||||
|
* @param order must be `'ipv4first'` or `'verbatim'`. |
||||||
|
*/ |
||||||
|
export function setDefaultResultOrder(order: 'ipv4first' | 'verbatim'): void; |
||||||
|
// Error codes
|
||||||
|
export const NODATA: string; |
||||||
|
export const FORMERR: string; |
||||||
|
export const SERVFAIL: string; |
||||||
|
export const NOTFOUND: string; |
||||||
|
export const NOTIMP: string; |
||||||
|
export const REFUSED: string; |
||||||
|
export const BADQUERY: string; |
||||||
|
export const BADNAME: string; |
||||||
|
export const BADFAMILY: string; |
||||||
|
export const BADRESP: string; |
||||||
|
export const CONNREFUSED: string; |
||||||
|
export const TIMEOUT: string; |
||||||
|
export const EOF: string; |
||||||
|
export const FILE: string; |
||||||
|
export const NOMEM: string; |
||||||
|
export const DESTRUCTION: string; |
||||||
|
export const BADSTR: string; |
||||||
|
export const BADFLAGS: string; |
||||||
|
export const NONAME: string; |
||||||
|
export const BADHINTS: string; |
||||||
|
export const NOTINITIALIZED: string; |
||||||
|
export const LOADIPHLPAPI: string; |
||||||
|
export const ADDRGETNETWORKPARAMS: string; |
||||||
|
export const CANCELLED: string; |
||||||
|
export interface ResolverOptions { |
||||||
|
timeout?: number | undefined; |
||||||
|
/** |
||||||
|
* @default 4 |
||||||
|
*/ |
||||||
|
tries?: number; |
||||||
|
} |
||||||
|
/** |
||||||
|
* An independent resolver for DNS requests. |
||||||
|
* |
||||||
|
* Creating a new resolver uses the default server settings. Setting |
||||||
|
* the servers used for a resolver using `resolver.setServers()` does not affect |
||||||
|
* other resolvers: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { Resolver } = require('dns'); |
||||||
|
* const resolver = new Resolver(); |
||||||
|
* resolver.setServers(['4.4.4.4']); |
||||||
|
* |
||||||
|
* // This request will use the server at 4.4.4.4, independent of global settings.
|
||||||
|
* resolver.resolve4('example.org', (err, addresses) => { |
||||||
|
* // ...
|
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* The following methods from the `dns` module are available: |
||||||
|
* |
||||||
|
* * `resolver.getServers()` |
||||||
|
* * `resolver.resolve()` |
||||||
|
* * `resolver.resolve4()` |
||||||
|
* * `resolver.resolve6()` |
||||||
|
* * `resolver.resolveAny()` |
||||||
|
* * `resolver.resolveCaa()` |
||||||
|
* * `resolver.resolveCname()` |
||||||
|
* * `resolver.resolveMx()` |
||||||
|
* * `resolver.resolveNaptr()` |
||||||
|
* * `resolver.resolveNs()` |
||||||
|
* * `resolver.resolvePtr()` |
||||||
|
* * `resolver.resolveSoa()` |
||||||
|
* * `resolver.resolveSrv()` |
||||||
|
* * `resolver.resolveTxt()` |
||||||
|
* * `resolver.reverse()` |
||||||
|
* * `resolver.setServers()` |
||||||
|
* @since v8.3.0 |
||||||
|
*/ |
||||||
|
export class Resolver { |
||||||
|
constructor(options?: ResolverOptions); |
||||||
|
/** |
||||||
|
* Cancel all outstanding DNS queries made by this resolver. The corresponding |
||||||
|
* callbacks will be called with an error with code `ECANCELLED`. |
||||||
|
* @since v8.3.0 |
||||||
|
*/ |
||||||
|
cancel(): void; |
||||||
|
getServers: typeof getServers; |
||||||
|
resolve: typeof resolve; |
||||||
|
resolve4: typeof resolve4; |
||||||
|
resolve6: typeof resolve6; |
||||||
|
resolveAny: typeof resolveAny; |
||||||
|
resolveCname: typeof resolveCname; |
||||||
|
resolveMx: typeof resolveMx; |
||||||
|
resolveNaptr: typeof resolveNaptr; |
||||||
|
resolveNs: typeof resolveNs; |
||||||
|
resolvePtr: typeof resolvePtr; |
||||||
|
resolveSoa: typeof resolveSoa; |
||||||
|
resolveSrv: typeof resolveSrv; |
||||||
|
resolveTxt: typeof resolveTxt; |
||||||
|
reverse: typeof reverse; |
||||||
|
/** |
||||||
|
* The resolver instance will send its requests from the specified IP address. |
||||||
|
* This allows programs to specify outbound interfaces when used on multi-homed |
||||||
|
* systems. |
||||||
|
* |
||||||
|
* If a v4 or v6 address is not specified, it is set to the default, and the |
||||||
|
* operating system will choose a local address automatically. |
||||||
|
* |
||||||
|
* The resolver will use the v4 local address when making requests to IPv4 DNS |
||||||
|
* servers, and the v6 local address when making requests to IPv6 DNS servers. |
||||||
|
* The `rrtype` of resolution requests has no impact on the local address used. |
||||||
|
* @since v15.1.0, v14.17.0 |
||||||
|
* @param [ipv4='0.0.0.0'] A string representation of an IPv4 address. |
||||||
|
* @param [ipv6='::0'] A string representation of an IPv6 address. |
||||||
|
*/ |
||||||
|
setLocalAddress(ipv4?: string, ipv6?: string): void; |
||||||
|
setServers: typeof setServers; |
||||||
|
} |
||||||
|
export { dnsPromises as promises }; |
||||||
|
} |
||||||
|
declare module 'node:dns' { |
||||||
|
export * from 'dns'; |
||||||
|
} |
@ -0,0 +1,370 @@ |
|||||||
|
/** |
||||||
|
* The `dns.promises` API provides an alternative set of asynchronous DNS methods |
||||||
|
* that return `Promise` objects rather than using callbacks. The API is accessible |
||||||
|
* via `require('dns').promises` or `require('dns/promises')`. |
||||||
|
* @since v10.6.0 |
||||||
|
*/ |
||||||
|
declare module 'dns/promises' { |
||||||
|
import { |
||||||
|
LookupAddress, |
||||||
|
LookupOneOptions, |
||||||
|
LookupAllOptions, |
||||||
|
LookupOptions, |
||||||
|
AnyRecord, |
||||||
|
CaaRecord, |
||||||
|
MxRecord, |
||||||
|
NaptrRecord, |
||||||
|
SoaRecord, |
||||||
|
SrvRecord, |
||||||
|
ResolveWithTtlOptions, |
||||||
|
RecordWithTtl, |
||||||
|
ResolveOptions, |
||||||
|
ResolverOptions, |
||||||
|
} from 'node:dns'; |
||||||
|
/** |
||||||
|
* Returns an array of IP address strings, formatted according to [RFC 5952](https://tools.ietf.org/html/rfc5952#section-6),
|
||||||
|
* that are currently configured for DNS resolution. A string will include a port |
||||||
|
* section if a custom port is used. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* [ |
||||||
|
* '4.4.4.4', |
||||||
|
* '2001:4860:4860::8888', |
||||||
|
* '4.4.4.4:1053', |
||||||
|
* '[2001:4860:4860::8888]:1053', |
||||||
|
* ] |
||||||
|
* ``` |
||||||
|
* @since v10.6.0 |
||||||
|
*/ |
||||||
|
function getServers(): string[]; |
||||||
|
/** |
||||||
|
* Resolves a host name (e.g. `'nodejs.org'`) into the first found A (IPv4) or |
||||||
|
* AAAA (IPv6) record. All `option` properties are optional. If `options` is an |
||||||
|
* integer, then it must be `4` or `6` – if `options` is not provided, then IPv4 |
||||||
|
* and IPv6 addresses are both returned if found. |
||||||
|
* |
||||||
|
* With the `all` option set to `true`, the `Promise` is resolved with `addresses`being an array of objects with the properties `address` and `family`. |
||||||
|
* |
||||||
|
* On error, the `Promise` is rejected with an `Error` object, where `err.code`is the error code. |
||||||
|
* Keep in mind that `err.code` will be set to `'ENOTFOUND'` not only when |
||||||
|
* the host name does not exist but also when the lookup fails in other ways |
||||||
|
* such as no available file descriptors. |
||||||
|
* |
||||||
|
* `dnsPromises.lookup()` does not necessarily have anything to do with the DNS |
||||||
|
* protocol. The implementation uses an operating system facility that can |
||||||
|
* associate names with addresses, and vice versa. This implementation can have |
||||||
|
* subtle but important consequences on the behavior of any Node.js program. Please |
||||||
|
* take some time to consult the `Implementation considerations section` before |
||||||
|
* using `dnsPromises.lookup()`. |
||||||
|
* |
||||||
|
* Example usage: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const dns = require('dns'); |
||||||
|
* const dnsPromises = dns.promises; |
||||||
|
* const options = { |
||||||
|
* family: 6, |
||||||
|
* hints: dns.ADDRCONFIG | dns.V4MAPPED, |
||||||
|
* }; |
||||||
|
* |
||||||
|
* dnsPromises.lookup('example.com', options).then((result) => { |
||||||
|
* console.log('address: %j family: IPv%s', result.address, result.family); |
||||||
|
* // address: "2606:2800:220:1:248:1893:25c8:1946" family: IPv6
|
||||||
|
* }); |
||||||
|
* |
||||||
|
* // When options.all is true, the result will be an Array.
|
||||||
|
* options.all = true; |
||||||
|
* dnsPromises.lookup('example.com', options).then((result) => { |
||||||
|
* console.log('addresses: %j', result); |
||||||
|
* // addresses: [{"address":"2606:2800:220:1:248:1893:25c8:1946","family":6}]
|
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* @since v10.6.0 |
||||||
|
*/ |
||||||
|
function lookup(hostname: string, family: number): Promise<LookupAddress>; |
||||||
|
function lookup(hostname: string, options: LookupOneOptions): Promise<LookupAddress>; |
||||||
|
function lookup(hostname: string, options: LookupAllOptions): Promise<LookupAddress[]>; |
||||||
|
function lookup(hostname: string, options: LookupOptions): Promise<LookupAddress | LookupAddress[]>; |
||||||
|
function lookup(hostname: string): Promise<LookupAddress>; |
||||||
|
/** |
||||||
|
* Resolves the given `address` and `port` into a host name and service using |
||||||
|
* the operating system's underlying `getnameinfo` implementation. |
||||||
|
* |
||||||
|
* If `address` is not a valid IP address, a `TypeError` will be thrown. |
||||||
|
* The `port` will be coerced to a number. If it is not a legal port, a `TypeError`will be thrown. |
||||||
|
* |
||||||
|
* On error, the `Promise` is rejected with an `Error` object, where `err.code`is the error code. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const dnsPromises = require('dns').promises; |
||||||
|
* dnsPromises.lookupService('127.0.0.1', 22).then((result) => { |
||||||
|
* console.log(result.hostname, result.service); |
||||||
|
* // Prints: localhost ssh
|
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* @since v10.6.0 |
||||||
|
*/ |
||||||
|
function lookupService( |
||||||
|
address: string, |
||||||
|
port: number |
||||||
|
): Promise<{ |
||||||
|
hostname: string; |
||||||
|
service: string; |
||||||
|
}>; |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve a host name (e.g. `'nodejs.org'`) into an array |
||||||
|
* of the resource records. When successful, the `Promise` is resolved with an |
||||||
|
* array of resource records. The type and structure of individual results vary |
||||||
|
* based on `rrtype`: |
||||||
|
* |
||||||
|
* <omitted> |
||||||
|
* |
||||||
|
* On error, the `Promise` is rejected with an `Error` object, where `err.code`is one of the `DNS error codes`. |
||||||
|
* @since v10.6.0 |
||||||
|
* @param hostname Host name to resolve. |
||||||
|
* @param [rrtype='A'] Resource record type. |
||||||
|
*/ |
||||||
|
function resolve(hostname: string): Promise<string[]>; |
||||||
|
function resolve(hostname: string, rrtype: 'A'): Promise<string[]>; |
||||||
|
function resolve(hostname: string, rrtype: 'AAAA'): Promise<string[]>; |
||||||
|
function resolve(hostname: string, rrtype: 'ANY'): Promise<AnyRecord[]>; |
||||||
|
function resolve(hostname: string, rrtype: 'CAA'): Promise<CaaRecord[]>; |
||||||
|
function resolve(hostname: string, rrtype: 'CNAME'): Promise<string[]>; |
||||||
|
function resolve(hostname: string, rrtype: 'MX'): Promise<MxRecord[]>; |
||||||
|
function resolve(hostname: string, rrtype: 'NAPTR'): Promise<NaptrRecord[]>; |
||||||
|
function resolve(hostname: string, rrtype: 'NS'): Promise<string[]>; |
||||||
|
function resolve(hostname: string, rrtype: 'PTR'): Promise<string[]>; |
||||||
|
function resolve(hostname: string, rrtype: 'SOA'): Promise<SoaRecord>; |
||||||
|
function resolve(hostname: string, rrtype: 'SRV'): Promise<SrvRecord[]>; |
||||||
|
function resolve(hostname: string, rrtype: 'TXT'): Promise<string[][]>; |
||||||
|
function resolve(hostname: string, rrtype: string): Promise<string[] | MxRecord[] | NaptrRecord[] | SoaRecord | SrvRecord[] | string[][] | AnyRecord[]>; |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve IPv4 addresses (`A` records) for the`hostname`. On success, the `Promise` is resolved with an array of IPv4 |
||||||
|
* addresses (e.g. `['74.125.79.104', '74.125.79.105', '74.125.79.106']`). |
||||||
|
* @since v10.6.0 |
||||||
|
* @param hostname Host name to resolve. |
||||||
|
*/ |
||||||
|
function resolve4(hostname: string): Promise<string[]>; |
||||||
|
function resolve4(hostname: string, options: ResolveWithTtlOptions): Promise<RecordWithTtl[]>; |
||||||
|
function resolve4(hostname: string, options: ResolveOptions): Promise<string[] | RecordWithTtl[]>; |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve IPv6 addresses (`AAAA` records) for the`hostname`. On success, the `Promise` is resolved with an array of IPv6 |
||||||
|
* addresses. |
||||||
|
* @since v10.6.0 |
||||||
|
* @param hostname Host name to resolve. |
||||||
|
*/ |
||||||
|
function resolve6(hostname: string): Promise<string[]>; |
||||||
|
function resolve6(hostname: string, options: ResolveWithTtlOptions): Promise<RecordWithTtl[]>; |
||||||
|
function resolve6(hostname: string, options: ResolveOptions): Promise<string[] | RecordWithTtl[]>; |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve all records (also known as `ANY` or `*` query). |
||||||
|
* On success, the `Promise` is resolved with an array containing various types of |
||||||
|
* records. Each object has a property `type` that indicates the type of the |
||||||
|
* current record. And depending on the `type`, additional properties will be |
||||||
|
* present on the object: |
||||||
|
* |
||||||
|
* <omitted> |
||||||
|
* |
||||||
|
* Here is an example of the result object: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* [ { type: 'A', address: '127.0.0.1', ttl: 299 }, |
||||||
|
* { type: 'CNAME', value: 'example.com' }, |
||||||
|
* { type: 'MX', exchange: 'alt4.aspmx.l.example.com', priority: 50 }, |
||||||
|
* { type: 'NS', value: 'ns1.example.com' }, |
||||||
|
* { type: 'TXT', entries: [ 'v=spf1 include:_spf.example.com ~all' ] }, |
||||||
|
* { type: 'SOA', |
||||||
|
* nsname: 'ns1.example.com', |
||||||
|
* hostmaster: 'admin.example.com', |
||||||
|
* serial: 156696742, |
||||||
|
* refresh: 900, |
||||||
|
* retry: 900, |
||||||
|
* expire: 1800, |
||||||
|
* minttl: 60 } ] |
||||||
|
* ``` |
||||||
|
* @since v10.6.0 |
||||||
|
*/ |
||||||
|
function resolveAny(hostname: string): Promise<AnyRecord[]>; |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve `CAA` records for the `hostname`. On success, |
||||||
|
* the `Promise` is resolved with an array of objects containing available |
||||||
|
* certification authority authorization records available for the `hostname`(e.g. `[{critical: 0, iodef: 'mailto:pki@example.com'},{critical: 128, issue: 'pki.example.com'}]`). |
||||||
|
* @since v15.0.0, v14.17.0 |
||||||
|
*/ |
||||||
|
function resolveCaa(hostname: string): Promise<CaaRecord[]>; |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve `CNAME` records for the `hostname`. On success, |
||||||
|
* the `Promise` is resolved with an array of canonical name records available for |
||||||
|
* the `hostname` (e.g. `['bar.example.com']`). |
||||||
|
* @since v10.6.0 |
||||||
|
*/ |
||||||
|
function resolveCname(hostname: string): Promise<string[]>; |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve mail exchange records (`MX` records) for the`hostname`. On success, the `Promise` is resolved with an array of objects |
||||||
|
* containing both a `priority` and `exchange` property (e.g.`[{priority: 10, exchange: 'mx.example.com'}, ...]`). |
||||||
|
* @since v10.6.0 |
||||||
|
*/ |
||||||
|
function resolveMx(hostname: string): Promise<MxRecord[]>; |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve regular expression based records (`NAPTR`records) for the `hostname`. On success, the `Promise` is resolved with an array |
||||||
|
* of objects with the following properties: |
||||||
|
* |
||||||
|
* * `flags` |
||||||
|
* * `service` |
||||||
|
* * `regexp` |
||||||
|
* * `replacement` |
||||||
|
* * `order` |
||||||
|
* * `preference` |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* { |
||||||
|
* flags: 's', |
||||||
|
* service: 'SIP+D2U', |
||||||
|
* regexp: '', |
||||||
|
* replacement: '_sip._udp.example.com', |
||||||
|
* order: 30, |
||||||
|
* preference: 100 |
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v10.6.0 |
||||||
|
*/ |
||||||
|
function resolveNaptr(hostname: string): Promise<NaptrRecord[]>; |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve name server records (`NS` records) for the`hostname`. On success, the `Promise` is resolved with an array of name server |
||||||
|
* records available for `hostname` (e.g.`['ns1.example.com', 'ns2.example.com']`). |
||||||
|
* @since v10.6.0 |
||||||
|
*/ |
||||||
|
function resolveNs(hostname: string): Promise<string[]>; |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve pointer records (`PTR` records) for the`hostname`. On success, the `Promise` is resolved with an array of strings |
||||||
|
* containing the reply records. |
||||||
|
* @since v10.6.0 |
||||||
|
*/ |
||||||
|
function resolvePtr(hostname: string): Promise<string[]>; |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve a start of authority record (`SOA` record) for |
||||||
|
* the `hostname`. On success, the `Promise` is resolved with an object with the |
||||||
|
* following properties: |
||||||
|
* |
||||||
|
* * `nsname` |
||||||
|
* * `hostmaster` |
||||||
|
* * `serial` |
||||||
|
* * `refresh` |
||||||
|
* * `retry` |
||||||
|
* * `expire` |
||||||
|
* * `minttl` |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* { |
||||||
|
* nsname: 'ns.example.com', |
||||||
|
* hostmaster: 'root.example.com', |
||||||
|
* serial: 2013101809, |
||||||
|
* refresh: 10000, |
||||||
|
* retry: 2400, |
||||||
|
* expire: 604800, |
||||||
|
* minttl: 3600 |
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v10.6.0 |
||||||
|
*/ |
||||||
|
function resolveSoa(hostname: string): Promise<SoaRecord>; |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve service records (`SRV` records) for the`hostname`. On success, the `Promise` is resolved with an array of objects with |
||||||
|
* the following properties: |
||||||
|
* |
||||||
|
* * `priority` |
||||||
|
* * `weight` |
||||||
|
* * `port` |
||||||
|
* * `name` |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* { |
||||||
|
* priority: 10, |
||||||
|
* weight: 5, |
||||||
|
* port: 21223, |
||||||
|
* name: 'service.example.com' |
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v10.6.0 |
||||||
|
*/ |
||||||
|
function resolveSrv(hostname: string): Promise<SrvRecord[]>; |
||||||
|
/** |
||||||
|
* Uses the DNS protocol to resolve text queries (`TXT` records) for the`hostname`. On success, the `Promise` is resolved with a two-dimensional array |
||||||
|
* of the text records available for `hostname` (e.g.`[ ['v=spf1 ip4:0.0.0.0 ', '~all' ] ]`). Each sub-array contains TXT chunks of |
||||||
|
* one record. Depending on the use case, these could be either joined together or |
||||||
|
* treated separately. |
||||||
|
* @since v10.6.0 |
||||||
|
*/ |
||||||
|
function resolveTxt(hostname: string): Promise<string[][]>; |
||||||
|
/** |
||||||
|
* Performs a reverse DNS query that resolves an IPv4 or IPv6 address to an |
||||||
|
* array of host names. |
||||||
|
* |
||||||
|
* On error, the `Promise` is rejected with an `Error` object, where `err.code`is one of the `DNS error codes`. |
||||||
|
* @since v10.6.0 |
||||||
|
*/ |
||||||
|
function reverse(ip: string): Promise<string[]>; |
||||||
|
/** |
||||||
|
* Sets the IP address and port of servers to be used when performing DNS |
||||||
|
* resolution. The `servers` argument is an array of [RFC 5952](https://tools.ietf.org/html/rfc5952#section-6) formatted
|
||||||
|
* addresses. If the port is the IANA default DNS port (53) it can be omitted. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* dnsPromises.setServers([ |
||||||
|
* '4.4.4.4', |
||||||
|
* '[2001:4860:4860::8888]', |
||||||
|
* '4.4.4.4:1053', |
||||||
|
* '[2001:4860:4860::8888]:1053', |
||||||
|
* ]); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* An error will be thrown if an invalid address is provided. |
||||||
|
* |
||||||
|
* The `dnsPromises.setServers()` method must not be called while a DNS query is in |
||||||
|
* progress. |
||||||
|
* |
||||||
|
* This method works much like [resolve.conf](https://man7.org/linux/man-pages/man5/resolv.conf.5.html).
|
||||||
|
* That is, if attempting to resolve with the first server provided results in a`NOTFOUND` error, the `resolve()` method will _not_ attempt to resolve with |
||||||
|
* subsequent servers provided. Fallback DNS servers will only be used if the |
||||||
|
* earlier ones time out or result in some other error. |
||||||
|
* @since v10.6.0 |
||||||
|
* @param servers array of `RFC 5952` formatted addresses |
||||||
|
*/ |
||||||
|
function setServers(servers: ReadonlyArray<string>): void; |
||||||
|
/** |
||||||
|
* Set the default value of `verbatim` in `dns.lookup()` and `dnsPromises.lookup()`. The value could be: |
||||||
|
* |
||||||
|
* * `ipv4first`: sets default `verbatim` `false`. |
||||||
|
* * `verbatim`: sets default `verbatim` `true`. |
||||||
|
* |
||||||
|
* The default is `ipv4first` and `dnsPromises.setDefaultResultOrder()` have |
||||||
|
* higher priority than `--dns-result-order`. When using `worker threads`,`dnsPromises.setDefaultResultOrder()` from the main thread won't affect the |
||||||
|
* default dns orders in workers. |
||||||
|
* @since v16.4.0, v14.18.0 |
||||||
|
* @param order must be `'ipv4first'` or `'verbatim'`. |
||||||
|
*/ |
||||||
|
function setDefaultResultOrder(order: 'ipv4first' | 'verbatim'): void; |
||||||
|
class Resolver { |
||||||
|
constructor(options?: ResolverOptions); |
||||||
|
cancel(): void; |
||||||
|
getServers: typeof getServers; |
||||||
|
resolve: typeof resolve; |
||||||
|
resolve4: typeof resolve4; |
||||||
|
resolve6: typeof resolve6; |
||||||
|
resolveAny: typeof resolveAny; |
||||||
|
resolveCname: typeof resolveCname; |
||||||
|
resolveMx: typeof resolveMx; |
||||||
|
resolveNaptr: typeof resolveNaptr; |
||||||
|
resolveNs: typeof resolveNs; |
||||||
|
resolvePtr: typeof resolvePtr; |
||||||
|
resolveSoa: typeof resolveSoa; |
||||||
|
resolveSrv: typeof resolveSrv; |
||||||
|
resolveTxt: typeof resolveTxt; |
||||||
|
reverse: typeof reverse; |
||||||
|
setLocalAddress(ipv4?: string, ipv6?: string): void; |
||||||
|
setServers: typeof setServers; |
||||||
|
} |
||||||
|
} |
||||||
|
declare module 'node:dns/promises' { |
||||||
|
export * from 'dns/promises'; |
||||||
|
} |
@ -0,0 +1,170 @@ |
|||||||
|
/** |
||||||
|
* **This module is pending deprecation.** Once a replacement API has been |
||||||
|
* finalized, this module will be fully deprecated. Most developers should |
||||||
|
* **not** have cause to use this module. Users who absolutely must have |
||||||
|
* the functionality that domains provide may rely on it for the time being |
||||||
|
* but should expect to have to migrate to a different solution |
||||||
|
* in the future. |
||||||
|
* |
||||||
|
* Domains provide a way to handle multiple different IO operations as a |
||||||
|
* single group. If any of the event emitters or callbacks registered to a |
||||||
|
* domain emit an `'error'` event, or throw an error, then the domain object |
||||||
|
* will be notified, rather than losing the context of the error in the`process.on('uncaughtException')` handler, or causing the program to |
||||||
|
* exit immediately with an error code. |
||||||
|
* @deprecated Since v1.4.2 - Deprecated |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/domain.js)
|
||||||
|
*/ |
||||||
|
declare module 'domain' { |
||||||
|
import EventEmitter = require('node:events'); |
||||||
|
/** |
||||||
|
* The `Domain` class encapsulates the functionality of routing errors and |
||||||
|
* uncaught exceptions to the active `Domain` object. |
||||||
|
* |
||||||
|
* To handle the errors that it catches, listen to its `'error'` event. |
||||||
|
*/ |
||||||
|
class Domain extends EventEmitter { |
||||||
|
/** |
||||||
|
* An array of timers and event emitters that have been explicitly added |
||||||
|
* to the domain. |
||||||
|
*/ |
||||||
|
members: Array<EventEmitter | NodeJS.Timer>; |
||||||
|
/** |
||||||
|
* The `enter()` method is plumbing used by the `run()`, `bind()`, and`intercept()` methods to set the active domain. It sets `domain.active` and`process.domain` to the domain, and implicitly |
||||||
|
* pushes the domain onto the domain |
||||||
|
* stack managed by the domain module (see {@link exit} for details on the |
||||||
|
* domain stack). The call to `enter()` delimits the beginning of a chain of |
||||||
|
* asynchronous calls and I/O operations bound to a domain. |
||||||
|
* |
||||||
|
* Calling `enter()` changes only the active domain, and does not alter the domain |
||||||
|
* itself. `enter()` and `exit()` can be called an arbitrary number of times on a |
||||||
|
* single domain. |
||||||
|
*/ |
||||||
|
enter(): void; |
||||||
|
/** |
||||||
|
* The `exit()` method exits the current domain, popping it off the domain stack. |
||||||
|
* Any time execution is going to switch to the context of a different chain of |
||||||
|
* asynchronous calls, it's important to ensure that the current domain is exited. |
||||||
|
* The call to `exit()` delimits either the end of or an interruption to the chain |
||||||
|
* of asynchronous calls and I/O operations bound to a domain. |
||||||
|
* |
||||||
|
* If there are multiple, nested domains bound to the current execution context,`exit()` will exit any domains nested within this domain. |
||||||
|
* |
||||||
|
* Calling `exit()` changes only the active domain, and does not alter the domain |
||||||
|
* itself. `enter()` and `exit()` can be called an arbitrary number of times on a |
||||||
|
* single domain. |
||||||
|
*/ |
||||||
|
exit(): void; |
||||||
|
/** |
||||||
|
* Run the supplied function in the context of the domain, implicitly |
||||||
|
* binding all event emitters, timers, and lowlevel requests that are |
||||||
|
* created in that context. Optionally, arguments can be passed to |
||||||
|
* the function. |
||||||
|
* |
||||||
|
* This is the most basic way to use a domain. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const domain = require('domain'); |
||||||
|
* const fs = require('fs'); |
||||||
|
* const d = domain.create(); |
||||||
|
* d.on('error', (er) => { |
||||||
|
* console.error('Caught error!', er); |
||||||
|
* }); |
||||||
|
* d.run(() => { |
||||||
|
* process.nextTick(() => { |
||||||
|
* setTimeout(() => { // Simulating some various async stuff
|
||||||
|
* fs.open('non-existent file', 'r', (er, fd) => { |
||||||
|
* if (er) throw er; |
||||||
|
* // proceed...
|
||||||
|
* }); |
||||||
|
* }, 100); |
||||||
|
* }); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* In this example, the `d.on('error')` handler will be triggered, rather |
||||||
|
* than crashing the program. |
||||||
|
*/ |
||||||
|
run<T>(fn: (...args: any[]) => T, ...args: any[]): T; |
||||||
|
/** |
||||||
|
* Explicitly adds an emitter to the domain. If any event handlers called by |
||||||
|
* the emitter throw an error, or if the emitter emits an `'error'` event, it |
||||||
|
* will be routed to the domain's `'error'` event, just like with implicit
|
||||||
|
* binding. |
||||||
|
* |
||||||
|
* This also works with timers that are returned from `setInterval()` and `setTimeout()`. If their callback function throws, it will be caught by |
||||||
|
* the domain `'error'` handler. |
||||||
|
* |
||||||
|
* If the Timer or `EventEmitter` was already bound to a domain, it is removed |
||||||
|
* from that one, and bound to this one instead. |
||||||
|
* @param emitter emitter or timer to be added to the domain |
||||||
|
*/ |
||||||
|
add(emitter: EventEmitter | NodeJS.Timer): void; |
||||||
|
/** |
||||||
|
* The opposite of {@link add}. Removes domain handling from the |
||||||
|
* specified emitter. |
||||||
|
* @param emitter emitter or timer to be removed from the domain |
||||||
|
*/ |
||||||
|
remove(emitter: EventEmitter | NodeJS.Timer): void; |
||||||
|
/** |
||||||
|
* The returned function will be a wrapper around the supplied callback |
||||||
|
* function. When the returned function is called, any errors that are |
||||||
|
* thrown will be routed to the domain's `'error'` event.
|
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const d = domain.create(); |
||||||
|
* |
||||||
|
* function readSomeFile(filename, cb) { |
||||||
|
* fs.readFile(filename, 'utf8', d.bind((er, data) => { |
||||||
|
* // If this throws, it will also be passed to the domain.
|
||||||
|
* return cb(er, data ? JSON.parse(data) : null); |
||||||
|
* })); |
||||||
|
* } |
||||||
|
* |
||||||
|
* d.on('error', (er) => { |
||||||
|
* // An error occurred somewhere. If we throw it now, it will crash the program
|
||||||
|
* // with the normal line number and stack message.
|
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* @param callback The callback function |
||||||
|
* @return The bound function |
||||||
|
*/ |
||||||
|
bind<T extends Function>(callback: T): T; |
||||||
|
/** |
||||||
|
* This method is almost identical to {@link bind}. However, in |
||||||
|
* addition to catching thrown errors, it will also intercept `Error` objects sent as the first argument to the function. |
||||||
|
* |
||||||
|
* In this way, the common `if (err) return callback(err);` pattern can be replaced |
||||||
|
* with a single error handler in a single place. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const d = domain.create(); |
||||||
|
* |
||||||
|
* function readSomeFile(filename, cb) { |
||||||
|
* fs.readFile(filename, 'utf8', d.intercept((data) => { |
||||||
|
* // Note, the first argument is never passed to the
|
||||||
|
* // callback since it is assumed to be the 'Error' argument
|
||||||
|
* // and thus intercepted by the domain.
|
||||||
|
* |
||||||
|
* // If this throws, it will also be passed to the domain
|
||||||
|
* // so the error-handling logic can be moved to the 'error'
|
||||||
|
* // event on the domain instead of being repeated throughout
|
||||||
|
* // the program.
|
||||||
|
* return cb(null, JSON.parse(data)); |
||||||
|
* })); |
||||||
|
* } |
||||||
|
* |
||||||
|
* d.on('error', (er) => { |
||||||
|
* // An error occurred somewhere. If we throw it now, it will crash the program
|
||||||
|
* // with the normal line number and stack message.
|
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* @param callback The callback function |
||||||
|
* @return The intercepted function |
||||||
|
*/ |
||||||
|
intercept<T extends Function>(callback: T): T; |
||||||
|
} |
||||||
|
function create(): Domain; |
||||||
|
} |
||||||
|
declare module 'node:domain' { |
||||||
|
export * from 'domain'; |
||||||
|
} |
@ -0,0 +1,641 @@ |
|||||||
|
/** |
||||||
|
* Much of the Node.js core API is built around an idiomatic asynchronous |
||||||
|
* event-driven architecture in which certain kinds of objects (called "emitters") |
||||||
|
* emit named events that cause `Function` objects ("listeners") to be called. |
||||||
|
* |
||||||
|
* For instance: a `net.Server` object emits an event each time a peer |
||||||
|
* connects to it; a `fs.ReadStream` emits an event when the file is opened; |
||||||
|
* a `stream` emits an event whenever data is available to be read. |
||||||
|
* |
||||||
|
* All objects that emit events are instances of the `EventEmitter` class. These |
||||||
|
* objects expose an `eventEmitter.on()` function that allows one or more |
||||||
|
* functions to be attached to named events emitted by the object. Typically, |
||||||
|
* event names are camel-cased strings but any valid JavaScript property key |
||||||
|
* can be used. |
||||||
|
* |
||||||
|
* When the `EventEmitter` object emits an event, all of the functions attached |
||||||
|
* to that specific event are called _synchronously_. Any values returned by the |
||||||
|
* called listeners are _ignored_ and discarded. |
||||||
|
* |
||||||
|
* The following example shows a simple `EventEmitter` instance with a single |
||||||
|
* listener. The `eventEmitter.on()` method is used to register listeners, while |
||||||
|
* the `eventEmitter.emit()` method is used to trigger the event. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const EventEmitter = require('events'); |
||||||
|
* |
||||||
|
* class MyEmitter extends EventEmitter {} |
||||||
|
* |
||||||
|
* const myEmitter = new MyEmitter(); |
||||||
|
* myEmitter.on('event', () => { |
||||||
|
* console.log('an event occurred!'); |
||||||
|
* }); |
||||||
|
* myEmitter.emit('event'); |
||||||
|
* ``` |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/events.js)
|
||||||
|
*/ |
||||||
|
declare module 'events' { |
||||||
|
interface EventEmitterOptions { |
||||||
|
/** |
||||||
|
* Enables automatic capturing of promise rejection. |
||||||
|
*/ |
||||||
|
captureRejections?: boolean | undefined; |
||||||
|
} |
||||||
|
interface NodeEventTarget { |
||||||
|
once(eventName: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
} |
||||||
|
interface DOMEventTarget { |
||||||
|
addEventListener( |
||||||
|
eventName: string, |
||||||
|
listener: (...args: any[]) => void, |
||||||
|
opts?: { |
||||||
|
once: boolean; |
||||||
|
} |
||||||
|
): any; |
||||||
|
} |
||||||
|
interface StaticEventEmitterOptions { |
||||||
|
signal?: AbortSignal | undefined; |
||||||
|
} |
||||||
|
interface EventEmitter extends NodeJS.EventEmitter {} |
||||||
|
/** |
||||||
|
* The `EventEmitter` class is defined and exposed by the `events` module: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const EventEmitter = require('events'); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* All `EventEmitter`s emit the event `'newListener'` when new listeners are |
||||||
|
* added and `'removeListener'` when existing listeners are removed. |
||||||
|
* |
||||||
|
* It supports the following option: |
||||||
|
* @since v0.1.26 |
||||||
|
*/ |
||||||
|
class EventEmitter { |
||||||
|
constructor(options?: EventEmitterOptions); |
||||||
|
/** |
||||||
|
* Creates a `Promise` that is fulfilled when the `EventEmitter` emits the given |
||||||
|
* event or that is rejected if the `EventEmitter` emits `'error'` while waiting. |
||||||
|
* The `Promise` will resolve with an array of all the arguments emitted to the |
||||||
|
* given event. |
||||||
|
* |
||||||
|
* This method is intentionally generic and works with the web platform [EventTarget](https://dom.spec.whatwg.org/#interface-eventtarget) interface, which has no special`'error'` event
|
||||||
|
* semantics and does not listen to the `'error'` event. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { once, EventEmitter } = require('events'); |
||||||
|
* |
||||||
|
* async function run() { |
||||||
|
* const ee = new EventEmitter(); |
||||||
|
* |
||||||
|
* process.nextTick(() => { |
||||||
|
* ee.emit('myevent', 42); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* const [value] = await once(ee, 'myevent'); |
||||||
|
* console.log(value); |
||||||
|
* |
||||||
|
* const err = new Error('kaboom'); |
||||||
|
* process.nextTick(() => { |
||||||
|
* ee.emit('error', err); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* try { |
||||||
|
* await once(ee, 'myevent'); |
||||||
|
* } catch (err) { |
||||||
|
* console.log('error happened', err); |
||||||
|
* } |
||||||
|
* } |
||||||
|
* |
||||||
|
* run(); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* The special handling of the `'error'` event is only used when `events.once()`is used to wait for another event. If `events.once()` is used to wait for the |
||||||
|
* '`error'` event itself, then it is treated as any other kind of event without
|
||||||
|
* special handling: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { EventEmitter, once } = require('events'); |
||||||
|
* |
||||||
|
* const ee = new EventEmitter(); |
||||||
|
* |
||||||
|
* once(ee, 'error') |
||||||
|
* .then(([err]) => console.log('ok', err.message)) |
||||||
|
* .catch((err) => console.log('error', err.message)); |
||||||
|
* |
||||||
|
* ee.emit('error', new Error('boom')); |
||||||
|
* |
||||||
|
* // Prints: ok boom
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* An `AbortSignal` can be used to cancel waiting for the event: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { EventEmitter, once } = require('events'); |
||||||
|
* |
||||||
|
* const ee = new EventEmitter(); |
||||||
|
* const ac = new AbortController(); |
||||||
|
* |
||||||
|
* async function foo(emitter, event, signal) { |
||||||
|
* try { |
||||||
|
* await once(emitter, event, { signal }); |
||||||
|
* console.log('event emitted!'); |
||||||
|
* } catch (error) { |
||||||
|
* if (error.name === 'AbortError') { |
||||||
|
* console.error('Waiting for the event was canceled!'); |
||||||
|
* } else { |
||||||
|
* console.error('There was an error', error.message); |
||||||
|
* } |
||||||
|
* } |
||||||
|
* } |
||||||
|
* |
||||||
|
* foo(ee, 'foo', ac.signal); |
||||||
|
* ac.abort(); // Abort waiting for the event
|
||||||
|
* ee.emit('foo'); // Prints: Waiting for the event was canceled!
|
||||||
|
* ``` |
||||||
|
* @since v11.13.0, v10.16.0 |
||||||
|
*/ |
||||||
|
static once(emitter: NodeEventTarget, eventName: string | symbol, options?: StaticEventEmitterOptions): Promise<any[]>; |
||||||
|
static once(emitter: DOMEventTarget, eventName: string, options?: StaticEventEmitterOptions): Promise<any[]>; |
||||||
|
/** |
||||||
|
* ```js
|
||||||
|
* const { on, EventEmitter } = require('events'); |
||||||
|
* |
||||||
|
* (async () => { |
||||||
|
* const ee = new EventEmitter(); |
||||||
|
* |
||||||
|
* // Emit later on
|
||||||
|
* process.nextTick(() => { |
||||||
|
* ee.emit('foo', 'bar'); |
||||||
|
* ee.emit('foo', 42); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* for await (const event of on(ee, 'foo')) { |
||||||
|
* // The execution of this inner block is synchronous and it
|
||||||
|
* // processes one event at a time (even with await). Do not use
|
||||||
|
* // if concurrent execution is required.
|
||||||
|
* console.log(event); // prints ['bar'] [42]
|
||||||
|
* } |
||||||
|
* // Unreachable here
|
||||||
|
* })(); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Returns an `AsyncIterator` that iterates `eventName` events. It will throw |
||||||
|
* if the `EventEmitter` emits `'error'`. It removes all listeners when |
||||||
|
* exiting the loop. The `value` returned by each iteration is an array |
||||||
|
* composed of the emitted event arguments. |
||||||
|
* |
||||||
|
* An `AbortSignal` can be used to cancel waiting on events: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { on, EventEmitter } = require('events'); |
||||||
|
* const ac = new AbortController(); |
||||||
|
* |
||||||
|
* (async () => { |
||||||
|
* const ee = new EventEmitter(); |
||||||
|
* |
||||||
|
* // Emit later on
|
||||||
|
* process.nextTick(() => { |
||||||
|
* ee.emit('foo', 'bar'); |
||||||
|
* ee.emit('foo', 42); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* for await (const event of on(ee, 'foo', { signal: ac.signal })) { |
||||||
|
* // The execution of this inner block is synchronous and it
|
||||||
|
* // processes one event at a time (even with await). Do not use
|
||||||
|
* // if concurrent execution is required.
|
||||||
|
* console.log(event); // prints ['bar'] [42]
|
||||||
|
* } |
||||||
|
* // Unreachable here
|
||||||
|
* })(); |
||||||
|
* |
||||||
|
* process.nextTick(() => ac.abort()); |
||||||
|
* ``` |
||||||
|
* @since v13.6.0, v12.16.0 |
||||||
|
* @param eventName The name of the event being listened for |
||||||
|
* @return that iterates `eventName` events emitted by the `emitter` |
||||||
|
*/ |
||||||
|
static on(emitter: NodeJS.EventEmitter, eventName: string, options?: StaticEventEmitterOptions): AsyncIterableIterator<any>; |
||||||
|
/** |
||||||
|
* A class method that returns the number of listeners for the given `eventName`registered on the given `emitter`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { EventEmitter, listenerCount } = require('events'); |
||||||
|
* const myEmitter = new EventEmitter(); |
||||||
|
* myEmitter.on('event', () => {}); |
||||||
|
* myEmitter.on('event', () => {}); |
||||||
|
* console.log(listenerCount(myEmitter, 'event')); |
||||||
|
* // Prints: 2
|
||||||
|
* ``` |
||||||
|
* @since v0.9.12 |
||||||
|
* @deprecated Since v3.2.0 - Use `listenerCount` instead. |
||||||
|
* @param emitter The emitter to query |
||||||
|
* @param eventName The event name |
||||||
|
*/ |
||||||
|
static listenerCount(emitter: NodeJS.EventEmitter, eventName: string | symbol): number; |
||||||
|
/** |
||||||
|
* Returns a copy of the array of listeners for the event named `eventName`. |
||||||
|
* |
||||||
|
* For `EventEmitter`s this behaves exactly the same as calling `.listeners` on |
||||||
|
* the emitter. |
||||||
|
* |
||||||
|
* For `EventTarget`s this is the only way to get the event listeners for the |
||||||
|
* event target. This is useful for debugging and diagnostic purposes. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { getEventListeners, EventEmitter } = require('events'); |
||||||
|
* |
||||||
|
* { |
||||||
|
* const ee = new EventEmitter(); |
||||||
|
* const listener = () => console.log('Events are fun'); |
||||||
|
* ee.on('foo', listener); |
||||||
|
* getEventListeners(ee, 'foo'); // [listener]
|
||||||
|
* } |
||||||
|
* { |
||||||
|
* const et = new EventTarget(); |
||||||
|
* const listener = () => console.log('Events are fun'); |
||||||
|
* et.addEventListener('foo', listener); |
||||||
|
* getEventListeners(et, 'foo'); // [listener]
|
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v15.2.0, v14.17.0 |
||||||
|
*/ |
||||||
|
static getEventListeners(emitter: DOMEventTarget | NodeJS.EventEmitter, name: string | symbol): Function[]; |
||||||
|
/** |
||||||
|
* ```js
|
||||||
|
* const { |
||||||
|
* setMaxListeners, |
||||||
|
* EventEmitter |
||||||
|
* } = require('events'); |
||||||
|
* |
||||||
|
* const target = new EventTarget(); |
||||||
|
* const emitter = new EventEmitter(); |
||||||
|
* |
||||||
|
* setMaxListeners(5, target, emitter); |
||||||
|
* ``` |
||||||
|
* @since v15.4.0 |
||||||
|
* @param n A non-negative number. The maximum number of listeners per `EventTarget` event. |
||||||
|
* @param eventsTargets Zero or more {EventTarget} or {EventEmitter} instances. If none are specified, `n` is set as the default max for all newly created {EventTarget} and {EventEmitter} |
||||||
|
* objects. |
||||||
|
*/ |
||||||
|
static setMaxListeners(n?: number, ...eventTargets: Array<DOMEventTarget | NodeJS.EventEmitter>): void; |
||||||
|
/** |
||||||
|
* This symbol shall be used to install a listener for only monitoring `'error'` |
||||||
|
* events. Listeners installed using this symbol are called before the regular |
||||||
|
* `'error'` listeners are called. |
||||||
|
* |
||||||
|
* Installing a listener using this symbol does not change the behavior once an |
||||||
|
* `'error'` event is emitted, therefore the process will still crash if no |
||||||
|
* regular `'error'` listener is installed. |
||||||
|
*/ |
||||||
|
static readonly errorMonitor: unique symbol; |
||||||
|
static readonly captureRejectionSymbol: unique symbol; |
||||||
|
/** |
||||||
|
* Sets or gets the default captureRejection value for all emitters. |
||||||
|
*/ |
||||||
|
// TODO: These should be described using static getter/setter pairs:
|
||||||
|
static captureRejections: boolean; |
||||||
|
static defaultMaxListeners: number; |
||||||
|
} |
||||||
|
import internal = require('node:events'); |
||||||
|
namespace EventEmitter { |
||||||
|
// Should just be `export { EventEmitter }`, but that doesn't work in TypeScript 3.4
|
||||||
|
export { internal as EventEmitter }; |
||||||
|
export interface Abortable { |
||||||
|
/** |
||||||
|
* When provided the corresponding `AbortController` can be used to cancel an asynchronous action. |
||||||
|
*/ |
||||||
|
signal?: AbortSignal | undefined; |
||||||
|
} |
||||||
|
} |
||||||
|
global { |
||||||
|
namespace NodeJS { |
||||||
|
interface EventEmitter { |
||||||
|
/** |
||||||
|
* Alias for `emitter.on(eventName, listener)`. |
||||||
|
* @since v0.1.26 |
||||||
|
*/ |
||||||
|
addListener(eventName: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
/** |
||||||
|
* Adds the `listener` function to the end of the listeners array for the |
||||||
|
* event named `eventName`. No checks are made to see if the `listener` has |
||||||
|
* already been added. Multiple calls passing the same combination of `eventName`and `listener` will result in the `listener` being added, and called, multiple |
||||||
|
* times. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* server.on('connection', (stream) => { |
||||||
|
* console.log('someone connected!'); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Returns a reference to the `EventEmitter`, so that calls can be chained. |
||||||
|
* |
||||||
|
* By default, event listeners are invoked in the order they are added. The`emitter.prependListener()` method can be used as an alternative to add the |
||||||
|
* event listener to the beginning of the listeners array. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const myEE = new EventEmitter(); |
||||||
|
* myEE.on('foo', () => console.log('a')); |
||||||
|
* myEE.prependListener('foo', () => console.log('b')); |
||||||
|
* myEE.emit('foo'); |
||||||
|
* // Prints:
|
||||||
|
* // b
|
||||||
|
* // a
|
||||||
|
* ``` |
||||||
|
* @since v0.1.101 |
||||||
|
* @param eventName The name of the event. |
||||||
|
* @param listener The callback function |
||||||
|
*/ |
||||||
|
on(eventName: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
/** |
||||||
|
* Adds a **one-time**`listener` function for the event named `eventName`. The |
||||||
|
* next time `eventName` is triggered, this listener is removed and then invoked. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* server.once('connection', (stream) => { |
||||||
|
* console.log('Ah, we have our first user!'); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Returns a reference to the `EventEmitter`, so that calls can be chained. |
||||||
|
* |
||||||
|
* By default, event listeners are invoked in the order they are added. The`emitter.prependOnceListener()` method can be used as an alternative to add the |
||||||
|
* event listener to the beginning of the listeners array. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const myEE = new EventEmitter(); |
||||||
|
* myEE.once('foo', () => console.log('a')); |
||||||
|
* myEE.prependOnceListener('foo', () => console.log('b')); |
||||||
|
* myEE.emit('foo'); |
||||||
|
* // Prints:
|
||||||
|
* // b
|
||||||
|
* // a
|
||||||
|
* ``` |
||||||
|
* @since v0.3.0 |
||||||
|
* @param eventName The name of the event. |
||||||
|
* @param listener The callback function |
||||||
|
*/ |
||||||
|
once(eventName: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
/** |
||||||
|
* Removes the specified `listener` from the listener array for the event named`eventName`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const callback = (stream) => { |
||||||
|
* console.log('someone connected!'); |
||||||
|
* }; |
||||||
|
* server.on('connection', callback); |
||||||
|
* // ...
|
||||||
|
* server.removeListener('connection', callback); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* `removeListener()` will remove, at most, one instance of a listener from the |
||||||
|
* listener array. If any single listener has been added multiple times to the |
||||||
|
* listener array for the specified `eventName`, then `removeListener()` must be |
||||||
|
* called multiple times to remove each instance. |
||||||
|
* |
||||||
|
* Once an event is emitted, all listeners attached to it at the |
||||||
|
* time of emitting are called in order. This implies that any`removeListener()` or `removeAllListeners()` calls _after_ emitting and _before_ the last listener finishes execution |
||||||
|
* will not remove them from`emit()` in progress. Subsequent events behave as expected. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const myEmitter = new MyEmitter(); |
||||||
|
* |
||||||
|
* const callbackA = () => { |
||||||
|
* console.log('A'); |
||||||
|
* myEmitter.removeListener('event', callbackB); |
||||||
|
* }; |
||||||
|
* |
||||||
|
* const callbackB = () => { |
||||||
|
* console.log('B'); |
||||||
|
* }; |
||||||
|
* |
||||||
|
* myEmitter.on('event', callbackA); |
||||||
|
* |
||||||
|
* myEmitter.on('event', callbackB); |
||||||
|
* |
||||||
|
* // callbackA removes listener callbackB but it will still be called.
|
||||||
|
* // Internal listener array at time of emit [callbackA, callbackB]
|
||||||
|
* myEmitter.emit('event'); |
||||||
|
* // Prints:
|
||||||
|
* // A
|
||||||
|
* // B
|
||||||
|
* |
||||||
|
* // callbackB is now removed.
|
||||||
|
* // Internal listener array [callbackA]
|
||||||
|
* myEmitter.emit('event'); |
||||||
|
* // Prints:
|
||||||
|
* // A
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Because listeners are managed using an internal array, calling this will |
||||||
|
* change the position indices of any listener registered _after_ the listener |
||||||
|
* being removed. This will not impact the order in which listeners are called, |
||||||
|
* but it means that any copies of the listener array as returned by |
||||||
|
* the `emitter.listeners()` method will need to be recreated. |
||||||
|
* |
||||||
|
* When a single function has been added as a handler multiple times for a single |
||||||
|
* event (as in the example below), `removeListener()` will remove the most |
||||||
|
* recently added instance. In the example the `once('ping')`listener is removed: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const ee = new EventEmitter(); |
||||||
|
* |
||||||
|
* function pong() { |
||||||
|
* console.log('pong'); |
||||||
|
* } |
||||||
|
* |
||||||
|
* ee.on('ping', pong); |
||||||
|
* ee.once('ping', pong); |
||||||
|
* ee.removeListener('ping', pong); |
||||||
|
* |
||||||
|
* ee.emit('ping'); |
||||||
|
* ee.emit('ping'); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Returns a reference to the `EventEmitter`, so that calls can be chained. |
||||||
|
* @since v0.1.26 |
||||||
|
*/ |
||||||
|
removeListener(eventName: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
/** |
||||||
|
* Alias for `emitter.removeListener()`. |
||||||
|
* @since v10.0.0 |
||||||
|
*/ |
||||||
|
off(eventName: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
/** |
||||||
|
* Removes all listeners, or those of the specified `eventName`. |
||||||
|
* |
||||||
|
* It is bad practice to remove listeners added elsewhere in the code, |
||||||
|
* particularly when the `EventEmitter` instance was created by some other |
||||||
|
* component or module (e.g. sockets or file streams). |
||||||
|
* |
||||||
|
* Returns a reference to the `EventEmitter`, so that calls can be chained. |
||||||
|
* @since v0.1.26 |
||||||
|
*/ |
||||||
|
removeAllListeners(event?: string | symbol): this; |
||||||
|
/** |
||||||
|
* By default `EventEmitter`s will print a warning if more than `10` listeners are |
||||||
|
* added for a particular event. This is a useful default that helps finding |
||||||
|
* memory leaks. The `emitter.setMaxListeners()` method allows the limit to be |
||||||
|
* modified for this specific `EventEmitter` instance. The value can be set to`Infinity` (or `0`) to indicate an unlimited number of listeners. |
||||||
|
* |
||||||
|
* Returns a reference to the `EventEmitter`, so that calls can be chained. |
||||||
|
* @since v0.3.5 |
||||||
|
*/ |
||||||
|
setMaxListeners(n: number): this; |
||||||
|
/** |
||||||
|
* Returns the current max listener value for the `EventEmitter` which is either |
||||||
|
* set by `emitter.setMaxListeners(n)` or defaults to {@link defaultMaxListeners}. |
||||||
|
* @since v1.0.0 |
||||||
|
*/ |
||||||
|
getMaxListeners(): number; |
||||||
|
/** |
||||||
|
* Returns a copy of the array of listeners for the event named `eventName`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* server.on('connection', (stream) => { |
||||||
|
* console.log('someone connected!'); |
||||||
|
* }); |
||||||
|
* console.log(util.inspect(server.listeners('connection'))); |
||||||
|
* // Prints: [ [Function] ]
|
||||||
|
* ``` |
||||||
|
* @since v0.1.26 |
||||||
|
*/ |
||||||
|
listeners(eventName: string | symbol): Function[]; |
||||||
|
/** |
||||||
|
* Returns a copy of the array of listeners for the event named `eventName`, |
||||||
|
* including any wrappers (such as those created by `.once()`). |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const emitter = new EventEmitter(); |
||||||
|
* emitter.once('log', () => console.log('log once')); |
||||||
|
* |
||||||
|
* // Returns a new Array with a function `onceWrapper` which has a property
|
||||||
|
* // `listener` which contains the original listener bound above
|
||||||
|
* const listeners = emitter.rawListeners('log'); |
||||||
|
* const logFnWrapper = listeners[0]; |
||||||
|
* |
||||||
|
* // Logs "log once" to the console and does not unbind the `once` event
|
||||||
|
* logFnWrapper.listener(); |
||||||
|
* |
||||||
|
* // Logs "log once" to the console and removes the listener
|
||||||
|
* logFnWrapper(); |
||||||
|
* |
||||||
|
* emitter.on('log', () => console.log('log persistently')); |
||||||
|
* // Will return a new Array with a single function bound by `.on()` above
|
||||||
|
* const newListeners = emitter.rawListeners('log'); |
||||||
|
* |
||||||
|
* // Logs "log persistently" twice
|
||||||
|
* newListeners[0](); |
||||||
|
* emitter.emit('log'); |
||||||
|
* ``` |
||||||
|
* @since v9.4.0 |
||||||
|
*/ |
||||||
|
rawListeners(eventName: string | symbol): Function[]; |
||||||
|
/** |
||||||
|
* Synchronously calls each of the listeners registered for the event named`eventName`, in the order they were registered, passing the supplied arguments |
||||||
|
* to each. |
||||||
|
* |
||||||
|
* Returns `true` if the event had listeners, `false` otherwise. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const EventEmitter = require('events'); |
||||||
|
* const myEmitter = new EventEmitter(); |
||||||
|
* |
||||||
|
* // First listener
|
||||||
|
* myEmitter.on('event', function firstListener() { |
||||||
|
* console.log('Helloooo! first listener'); |
||||||
|
* }); |
||||||
|
* // Second listener
|
||||||
|
* myEmitter.on('event', function secondListener(arg1, arg2) { |
||||||
|
* console.log(`event with parameters ${arg1}, ${arg2} in second listener`); |
||||||
|
* }); |
||||||
|
* // Third listener
|
||||||
|
* myEmitter.on('event', function thirdListener(...args) { |
||||||
|
* const parameters = args.join(', '); |
||||||
|
* console.log(`event with parameters ${parameters} in third listener`); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* console.log(myEmitter.listeners('event')); |
||||||
|
* |
||||||
|
* myEmitter.emit('event', 1, 2, 3, 4, 5); |
||||||
|
* |
||||||
|
* // Prints:
|
||||||
|
* // [
|
||||||
|
* // [Function: firstListener],
|
||||||
|
* // [Function: secondListener],
|
||||||
|
* // [Function: thirdListener]
|
||||||
|
* // ]
|
||||||
|
* // Helloooo! first listener
|
||||||
|
* // event with parameters 1, 2 in second listener
|
||||||
|
* // event with parameters 1, 2, 3, 4, 5 in third listener
|
||||||
|
* ``` |
||||||
|
* @since v0.1.26 |
||||||
|
*/ |
||||||
|
emit(eventName: string | symbol, ...args: any[]): boolean; |
||||||
|
/** |
||||||
|
* Returns the number of listeners listening to the event named `eventName`. |
||||||
|
* @since v3.2.0 |
||||||
|
* @param eventName The name of the event being listened for |
||||||
|
*/ |
||||||
|
listenerCount(eventName: string | symbol): number; |
||||||
|
/** |
||||||
|
* Adds the `listener` function to the _beginning_ of the listeners array for the |
||||||
|
* event named `eventName`. No checks are made to see if the `listener` has |
||||||
|
* already been added. Multiple calls passing the same combination of `eventName`and `listener` will result in the `listener` being added, and called, multiple |
||||||
|
* times. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* server.prependListener('connection', (stream) => { |
||||||
|
* console.log('someone connected!'); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Returns a reference to the `EventEmitter`, so that calls can be chained. |
||||||
|
* @since v6.0.0 |
||||||
|
* @param eventName The name of the event. |
||||||
|
* @param listener The callback function |
||||||
|
*/ |
||||||
|
prependListener(eventName: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
/** |
||||||
|
* Adds a **one-time**`listener` function for the event named `eventName` to the _beginning_ of the listeners array. The next time `eventName` is triggered, this |
||||||
|
* listener is removed, and then invoked. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* server.prependOnceListener('connection', (stream) => { |
||||||
|
* console.log('Ah, we have our first user!'); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Returns a reference to the `EventEmitter`, so that calls can be chained. |
||||||
|
* @since v6.0.0 |
||||||
|
* @param eventName The name of the event. |
||||||
|
* @param listener The callback function |
||||||
|
*/ |
||||||
|
prependOnceListener(eventName: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
/** |
||||||
|
* Returns an array listing the events for which the emitter has registered |
||||||
|
* listeners. The values in the array are strings or `Symbol`s. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const EventEmitter = require('events'); |
||||||
|
* const myEE = new EventEmitter(); |
||||||
|
* myEE.on('foo', () => {}); |
||||||
|
* myEE.on('bar', () => {}); |
||||||
|
* |
||||||
|
* const sym = Symbol('symbol'); |
||||||
|
* myEE.on(sym, () => {}); |
||||||
|
* |
||||||
|
* console.log(myEE.eventNames()); |
||||||
|
* // Prints: [ 'foo', 'bar', Symbol(symbol) ]
|
||||||
|
* ``` |
||||||
|
* @since v6.0.0 |
||||||
|
*/ |
||||||
|
eventNames(): Array<string | symbol>; |
||||||
|
} |
||||||
|
} |
||||||
|
} |
||||||
|
export = EventEmitter; |
||||||
|
} |
||||||
|
declare module 'node:events' { |
||||||
|
import events = require('events'); |
||||||
|
export = events; |
||||||
|
} |
File diff suppressed because it is too large
Load Diff
File diff suppressed because it is too large
Load Diff
@ -0,0 +1,294 @@ |
|||||||
|
// Declare "static" methods in Error
|
||||||
|
interface ErrorConstructor { |
||||||
|
/** Create .stack property on a target object */ |
||||||
|
captureStackTrace(targetObject: object, constructorOpt?: Function): void; |
||||||
|
|
||||||
|
/** |
||||||
|
* Optional override for formatting stack traces |
||||||
|
* |
||||||
|
* @see https://v8.dev/docs/stack-trace-api#customizing-stack-traces
|
||||||
|
*/ |
||||||
|
prepareStackTrace?: ((err: Error, stackTraces: NodeJS.CallSite[]) => any) | undefined; |
||||||
|
|
||||||
|
stackTraceLimit: number; |
||||||
|
} |
||||||
|
|
||||||
|
/*-----------------------------------------------* |
||||||
|
* * |
||||||
|
* GLOBAL * |
||||||
|
* * |
||||||
|
------------------------------------------------*/ |
||||||
|
|
||||||
|
// For backwards compability
|
||||||
|
interface NodeRequire extends NodeJS.Require { } |
||||||
|
interface RequireResolve extends NodeJS.RequireResolve { } |
||||||
|
interface NodeModule extends NodeJS.Module { } |
||||||
|
|
||||||
|
declare var process: NodeJS.Process; |
||||||
|
declare var console: Console; |
||||||
|
|
||||||
|
declare var __filename: string; |
||||||
|
declare var __dirname: string; |
||||||
|
|
||||||
|
declare var require: NodeRequire; |
||||||
|
declare var module: NodeModule; |
||||||
|
|
||||||
|
// Same as module.exports
|
||||||
|
declare var exports: any; |
||||||
|
|
||||||
|
/** |
||||||
|
* Only available if `--expose-gc` is passed to the process. |
||||||
|
*/ |
||||||
|
declare var gc: undefined | (() => void); |
||||||
|
|
||||||
|
//#region borrowed
|
||||||
|
// from https://github.com/microsoft/TypeScript/blob/38da7c600c83e7b31193a62495239a0fe478cb67/lib/lib.webworker.d.ts#L633 until moved to separate lib
|
||||||
|
/** A controller object that allows you to abort one or more DOM requests as and when desired. */ |
||||||
|
interface AbortController { |
||||||
|
/** |
||||||
|
* Returns the AbortSignal object associated with this object. |
||||||
|
*/ |
||||||
|
|
||||||
|
readonly signal: AbortSignal; |
||||||
|
/** |
||||||
|
* Invoking this method will set this object's AbortSignal's aborted flag and signal to any observers that the associated activity is to be aborted. |
||||||
|
*/ |
||||||
|
abort(): void; |
||||||
|
} |
||||||
|
|
||||||
|
/** A signal object that allows you to communicate with a DOM request (such as a Fetch) and abort it if required via an AbortController object. */ |
||||||
|
interface AbortSignal { |
||||||
|
/** |
||||||
|
* Returns true if this AbortSignal's AbortController has signaled to abort, and false otherwise. |
||||||
|
*/ |
||||||
|
readonly aborted: boolean; |
||||||
|
} |
||||||
|
|
||||||
|
declare var AbortController: { |
||||||
|
prototype: AbortController; |
||||||
|
new(): AbortController; |
||||||
|
}; |
||||||
|
|
||||||
|
declare var AbortSignal: { |
||||||
|
prototype: AbortSignal; |
||||||
|
new(): AbortSignal; |
||||||
|
// TODO: Add abort() static
|
||||||
|
}; |
||||||
|
//#endregion borrowed
|
||||||
|
|
||||||
|
//#region ArrayLike.at()
|
||||||
|
interface RelativeIndexable<T> { |
||||||
|
/** |
||||||
|
* Takes an integer value and returns the item at that index, |
||||||
|
* allowing for positive and negative integers. |
||||||
|
* Negative integers count back from the last item in the array. |
||||||
|
*/ |
||||||
|
at(index: number): T | undefined; |
||||||
|
} |
||||||
|
interface String extends RelativeIndexable<string> {} |
||||||
|
interface Array<T> extends RelativeIndexable<T> {} |
||||||
|
interface Int8Array extends RelativeIndexable<number> {} |
||||||
|
interface Uint8Array extends RelativeIndexable<number> {} |
||||||
|
interface Uint8ClampedArray extends RelativeIndexable<number> {} |
||||||
|
interface Int16Array extends RelativeIndexable<number> {} |
||||||
|
interface Uint16Array extends RelativeIndexable<number> {} |
||||||
|
interface Int32Array extends RelativeIndexable<number> {} |
||||||
|
interface Uint32Array extends RelativeIndexable<number> {} |
||||||
|
interface Float32Array extends RelativeIndexable<number> {} |
||||||
|
interface Float64Array extends RelativeIndexable<number> {} |
||||||
|
interface BigInt64Array extends RelativeIndexable<bigint> {} |
||||||
|
interface BigUint64Array extends RelativeIndexable<bigint> {} |
||||||
|
//#endregion ArrayLike.at() end
|
||||||
|
|
||||||
|
/** |
||||||
|
* @since v17.0.0 |
||||||
|
* |
||||||
|
* Creates a deep clone of an object. |
||||||
|
*/ |
||||||
|
declare function structuredClone<T>( |
||||||
|
value: T, |
||||||
|
transfer?: { transfer: ReadonlyArray<import('worker_threads').TransferListItem> }, |
||||||
|
): T; |
||||||
|
|
||||||
|
/*----------------------------------------------* |
||||||
|
* * |
||||||
|
* GLOBAL INTERFACES * |
||||||
|
* * |
||||||
|
*-----------------------------------------------*/ |
||||||
|
declare namespace NodeJS { |
||||||
|
interface CallSite { |
||||||
|
/** |
||||||
|
* Value of "this" |
||||||
|
*/ |
||||||
|
getThis(): unknown; |
||||||
|
|
||||||
|
/** |
||||||
|
* Type of "this" as a string. |
||||||
|
* This is the name of the function stored in the constructor field of |
||||||
|
* "this", if available. Otherwise the object's [[Class]] internal |
||||||
|
* property. |
||||||
|
*/ |
||||||
|
getTypeName(): string | null; |
||||||
|
|
||||||
|
/** |
||||||
|
* Current function |
||||||
|
*/ |
||||||
|
getFunction(): Function | undefined; |
||||||
|
|
||||||
|
/** |
||||||
|
* Name of the current function, typically its name property. |
||||||
|
* If a name property is not available an attempt will be made to try |
||||||
|
* to infer a name from the function's context. |
||||||
|
*/ |
||||||
|
getFunctionName(): string | null; |
||||||
|
|
||||||
|
/** |
||||||
|
* Name of the property [of "this" or one of its prototypes] that holds |
||||||
|
* the current function |
||||||
|
*/ |
||||||
|
getMethodName(): string | null; |
||||||
|
|
||||||
|
/** |
||||||
|
* Name of the script [if this function was defined in a script] |
||||||
|
*/ |
||||||
|
getFileName(): string | null; |
||||||
|
|
||||||
|
/** |
||||||
|
* Current line number [if this function was defined in a script] |
||||||
|
*/ |
||||||
|
getLineNumber(): number | null; |
||||||
|
|
||||||
|
/** |
||||||
|
* Current column number [if this function was defined in a script] |
||||||
|
*/ |
||||||
|
getColumnNumber(): number | null; |
||||||
|
|
||||||
|
/** |
||||||
|
* A call site object representing the location where eval was called |
||||||
|
* [if this function was created using a call to eval] |
||||||
|
*/ |
||||||
|
getEvalOrigin(): string | undefined; |
||||||
|
|
||||||
|
/** |
||||||
|
* Is this a toplevel invocation, that is, is "this" the global object? |
||||||
|
*/ |
||||||
|
isToplevel(): boolean; |
||||||
|
|
||||||
|
/** |
||||||
|
* Does this call take place in code defined by a call to eval? |
||||||
|
*/ |
||||||
|
isEval(): boolean; |
||||||
|
|
||||||
|
/** |
||||||
|
* Is this call in native V8 code? |
||||||
|
*/ |
||||||
|
isNative(): boolean; |
||||||
|
|
||||||
|
/** |
||||||
|
* Is this a constructor call? |
||||||
|
*/ |
||||||
|
isConstructor(): boolean; |
||||||
|
} |
||||||
|
|
||||||
|
interface ErrnoException extends Error { |
||||||
|
errno?: number | undefined; |
||||||
|
code?: string | undefined; |
||||||
|
path?: string | undefined; |
||||||
|
syscall?: string | undefined; |
||||||
|
} |
||||||
|
|
||||||
|
interface ReadableStream extends EventEmitter { |
||||||
|
readable: boolean; |
||||||
|
read(size?: number): string | Buffer; |
||||||
|
setEncoding(encoding: BufferEncoding): this; |
||||||
|
pause(): this; |
||||||
|
resume(): this; |
||||||
|
isPaused(): boolean; |
||||||
|
pipe<T extends WritableStream>(destination: T, options?: { end?: boolean | undefined; }): T; |
||||||
|
unpipe(destination?: WritableStream): this; |
||||||
|
unshift(chunk: string | Uint8Array, encoding?: BufferEncoding): void; |
||||||
|
wrap(oldStream: ReadableStream): this; |
||||||
|
[Symbol.asyncIterator](): AsyncIterableIterator<string | Buffer>; |
||||||
|
} |
||||||
|
|
||||||
|
interface WritableStream extends EventEmitter { |
||||||
|
writable: boolean; |
||||||
|
write(buffer: Uint8Array | string, cb?: (err?: Error | null) => void): boolean; |
||||||
|
write(str: string, encoding?: BufferEncoding, cb?: (err?: Error | null) => void): boolean; |
||||||
|
end(cb?: () => void): this; |
||||||
|
end(data: string | Uint8Array, cb?: () => void): this; |
||||||
|
end(str: string, encoding?: BufferEncoding, cb?: () => void): this; |
||||||
|
} |
||||||
|
|
||||||
|
interface ReadWriteStream extends ReadableStream, WritableStream { } |
||||||
|
|
||||||
|
interface RefCounted { |
||||||
|
ref(): this; |
||||||
|
unref(): this; |
||||||
|
} |
||||||
|
|
||||||
|
type TypedArray = |
||||||
|
| Uint8Array |
||||||
|
| Uint8ClampedArray |
||||||
|
| Uint16Array |
||||||
|
| Uint32Array |
||||||
|
| Int8Array |
||||||
|
| Int16Array |
||||||
|
| Int32Array |
||||||
|
| BigUint64Array |
||||||
|
| BigInt64Array |
||||||
|
| Float32Array |
||||||
|
| Float64Array; |
||||||
|
type ArrayBufferView = TypedArray | DataView; |
||||||
|
|
||||||
|
interface Require { |
||||||
|
(id: string): any; |
||||||
|
resolve: RequireResolve; |
||||||
|
cache: Dict<NodeModule>; |
||||||
|
/** |
||||||
|
* @deprecated |
||||||
|
*/ |
||||||
|
extensions: RequireExtensions; |
||||||
|
main: Module | undefined; |
||||||
|
} |
||||||
|
|
||||||
|
interface RequireResolve { |
||||||
|
(id: string, options?: { paths?: string[] | undefined; }): string; |
||||||
|
paths(request: string): string[] | null; |
||||||
|
} |
||||||
|
|
||||||
|
interface RequireExtensions extends Dict<(m: Module, filename: string) => any> { |
||||||
|
'.js': (m: Module, filename: string) => any; |
||||||
|
'.json': (m: Module, filename: string) => any; |
||||||
|
'.node': (m: Module, filename: string) => any; |
||||||
|
} |
||||||
|
interface Module { |
||||||
|
/** |
||||||
|
* `true` if the module is running during the Node.js preload |
||||||
|
*/ |
||||||
|
isPreloading: boolean; |
||||||
|
exports: any; |
||||||
|
require: Require; |
||||||
|
id: string; |
||||||
|
filename: string; |
||||||
|
loaded: boolean; |
||||||
|
/** @deprecated since v14.6.0 Please use `require.main` and `module.children` instead. */ |
||||||
|
parent: Module | null | undefined; |
||||||
|
children: Module[]; |
||||||
|
/** |
||||||
|
* @since v11.14.0 |
||||||
|
* |
||||||
|
* The directory name of the module. This is usually the same as the path.dirname() of the module.id.
|
||||||
|
*/ |
||||||
|
path: string; |
||||||
|
paths: string[]; |
||||||
|
} |
||||||
|
|
||||||
|
interface Dict<T> { |
||||||
|
[key: string]: T | undefined; |
||||||
|
} |
||||||
|
|
||||||
|
interface ReadOnlyDict<T> { |
||||||
|
readonly [key: string]: T | undefined; |
||||||
|
} |
||||||
|
} |
@ -0,0 +1 @@ |
|||||||
|
declare var global: typeof globalThis; |
File diff suppressed because it is too large
Load Diff
File diff suppressed because it is too large
Load Diff
@ -0,0 +1,401 @@ |
|||||||
|
/** |
||||||
|
* HTTPS is the HTTP protocol over TLS/SSL. In Node.js this is implemented as a |
||||||
|
* separate module.
|
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/https.js)
|
||||||
|
*/ |
||||||
|
declare module 'https' { |
||||||
|
import { Duplex } from 'node:stream'; |
||||||
|
import * as tls from 'node:tls'; |
||||||
|
import * as http from 'node:http'; |
||||||
|
import { URL } from 'node:url'; |
||||||
|
type ServerOptions = tls.SecureContextOptions & tls.TlsOptions & http.ServerOptions; |
||||||
|
type RequestOptions = http.RequestOptions & |
||||||
|
tls.SecureContextOptions & { |
||||||
|
rejectUnauthorized?: boolean | undefined; // Defaults to true
|
||||||
|
servername?: string | undefined; // SNI TLS Extension
|
||||||
|
}; |
||||||
|
interface AgentOptions extends http.AgentOptions, tls.ConnectionOptions { |
||||||
|
rejectUnauthorized?: boolean | undefined; |
||||||
|
maxCachedSessions?: number | undefined; |
||||||
|
} |
||||||
|
/** |
||||||
|
* An `Agent` object for HTTPS similar to `http.Agent`. See {@link request} for more information. |
||||||
|
* @since v0.4.5 |
||||||
|
*/ |
||||||
|
class Agent extends http.Agent { |
||||||
|
constructor(options?: AgentOptions); |
||||||
|
options: AgentOptions; |
||||||
|
} |
||||||
|
interface Server extends http.Server {} |
||||||
|
/** |
||||||
|
* See `http.Server` for more information. |
||||||
|
* @since v0.3.4 |
||||||
|
*/ |
||||||
|
class Server extends tls.Server { |
||||||
|
constructor(requestListener?: http.RequestListener); |
||||||
|
constructor(options: ServerOptions, requestListener?: http.RequestListener); |
||||||
|
/** |
||||||
|
* Closes all connections connected to this server. |
||||||
|
* @since v18.2.0 |
||||||
|
*/ |
||||||
|
closeAllConnections(): void; |
||||||
|
/** |
||||||
|
* Closes all connections connected to this server which are not sending a request or waiting for a response. |
||||||
|
* @since v18.2.0 |
||||||
|
*/ |
||||||
|
closeIdleConnections(): void; |
||||||
|
addListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
addListener(event: 'keylog', listener: (line: Buffer, tlsSocket: tls.TLSSocket) => void): this; |
||||||
|
addListener(event: 'newSession', listener: (sessionId: Buffer, sessionData: Buffer, callback: (err: Error, resp: Buffer) => void) => void): this; |
||||||
|
addListener(event: 'OCSPRequest', listener: (certificate: Buffer, issuer: Buffer, callback: (err: Error | null, resp: Buffer) => void) => void): this; |
||||||
|
addListener(event: 'resumeSession', listener: (sessionId: Buffer, callback: (err: Error, sessionData: Buffer) => void) => void): this; |
||||||
|
addListener(event: 'secureConnection', listener: (tlsSocket: tls.TLSSocket) => void): this; |
||||||
|
addListener(event: 'tlsClientError', listener: (err: Error, tlsSocket: tls.TLSSocket) => void): this; |
||||||
|
addListener(event: 'close', listener: () => void): this; |
||||||
|
addListener(event: 'connection', listener: (socket: Duplex) => void): this; |
||||||
|
addListener(event: 'error', listener: (err: Error) => void): this; |
||||||
|
addListener(event: 'listening', listener: () => void): this; |
||||||
|
addListener(event: 'checkContinue', listener: http.RequestListener): this; |
||||||
|
addListener(event: 'checkExpectation', listener: http.RequestListener): this; |
||||||
|
addListener(event: 'clientError', listener: (err: Error, socket: Duplex) => void): this; |
||||||
|
addListener(event: 'connect', listener: (req: http.IncomingMessage, socket: Duplex, head: Buffer) => void): this; |
||||||
|
addListener(event: 'request', listener: http.RequestListener): this; |
||||||
|
addListener(event: 'upgrade', listener: (req: http.IncomingMessage, socket: Duplex, head: Buffer) => void): this; |
||||||
|
emit(event: string, ...args: any[]): boolean; |
||||||
|
emit(event: 'keylog', line: Buffer, tlsSocket: tls.TLSSocket): boolean; |
||||||
|
emit(event: 'newSession', sessionId: Buffer, sessionData: Buffer, callback: (err: Error, resp: Buffer) => void): boolean; |
||||||
|
emit(event: 'OCSPRequest', certificate: Buffer, issuer: Buffer, callback: (err: Error | null, resp: Buffer) => void): boolean; |
||||||
|
emit(event: 'resumeSession', sessionId: Buffer, callback: (err: Error, sessionData: Buffer) => void): boolean; |
||||||
|
emit(event: 'secureConnection', tlsSocket: tls.TLSSocket): boolean; |
||||||
|
emit(event: 'tlsClientError', err: Error, tlsSocket: tls.TLSSocket): boolean; |
||||||
|
emit(event: 'close'): boolean; |
||||||
|
emit(event: 'connection', socket: Duplex): boolean; |
||||||
|
emit(event: 'error', err: Error): boolean; |
||||||
|
emit(event: 'listening'): boolean; |
||||||
|
emit(event: 'checkContinue', req: http.IncomingMessage, res: http.ServerResponse): boolean; |
||||||
|
emit(event: 'checkExpectation', req: http.IncomingMessage, res: http.ServerResponse): boolean; |
||||||
|
emit(event: 'clientError', err: Error, socket: Duplex): boolean; |
||||||
|
emit(event: 'connect', req: http.IncomingMessage, socket: Duplex, head: Buffer): boolean; |
||||||
|
emit(event: 'request', req: http.IncomingMessage, res: http.ServerResponse): boolean; |
||||||
|
emit(event: 'upgrade', req: http.IncomingMessage, socket: Duplex, head: Buffer): boolean; |
||||||
|
on(event: string, listener: (...args: any[]) => void): this; |
||||||
|
on(event: 'keylog', listener: (line: Buffer, tlsSocket: tls.TLSSocket) => void): this; |
||||||
|
on(event: 'newSession', listener: (sessionId: Buffer, sessionData: Buffer, callback: (err: Error, resp: Buffer) => void) => void): this; |
||||||
|
on(event: 'OCSPRequest', listener: (certificate: Buffer, issuer: Buffer, callback: (err: Error | null, resp: Buffer) => void) => void): this; |
||||||
|
on(event: 'resumeSession', listener: (sessionId: Buffer, callback: (err: Error, sessionData: Buffer) => void) => void): this; |
||||||
|
on(event: 'secureConnection', listener: (tlsSocket: tls.TLSSocket) => void): this; |
||||||
|
on(event: 'tlsClientError', listener: (err: Error, tlsSocket: tls.TLSSocket) => void): this; |
||||||
|
on(event: 'close', listener: () => void): this; |
||||||
|
on(event: 'connection', listener: (socket: Duplex) => void): this; |
||||||
|
on(event: 'error', listener: (err: Error) => void): this; |
||||||
|
on(event: 'listening', listener: () => void): this; |
||||||
|
on(event: 'checkContinue', listener: http.RequestListener): this; |
||||||
|
on(event: 'checkExpectation', listener: http.RequestListener): this; |
||||||
|
on(event: 'clientError', listener: (err: Error, socket: Duplex) => void): this; |
||||||
|
on(event: 'connect', listener: (req: http.IncomingMessage, socket: Duplex, head: Buffer) => void): this; |
||||||
|
on(event: 'request', listener: http.RequestListener): this; |
||||||
|
on(event: 'upgrade', listener: (req: http.IncomingMessage, socket: Duplex, head: Buffer) => void): this; |
||||||
|
once(event: string, listener: (...args: any[]) => void): this; |
||||||
|
once(event: 'keylog', listener: (line: Buffer, tlsSocket: tls.TLSSocket) => void): this; |
||||||
|
once(event: 'newSession', listener: (sessionId: Buffer, sessionData: Buffer, callback: (err: Error, resp: Buffer) => void) => void): this; |
||||||
|
once(event: 'OCSPRequest', listener: (certificate: Buffer, issuer: Buffer, callback: (err: Error | null, resp: Buffer) => void) => void): this; |
||||||
|
once(event: 'resumeSession', listener: (sessionId: Buffer, callback: (err: Error, sessionData: Buffer) => void) => void): this; |
||||||
|
once(event: 'secureConnection', listener: (tlsSocket: tls.TLSSocket) => void): this; |
||||||
|
once(event: 'tlsClientError', listener: (err: Error, tlsSocket: tls.TLSSocket) => void): this; |
||||||
|
once(event: 'close', listener: () => void): this; |
||||||
|
once(event: 'connection', listener: (socket: Duplex) => void): this; |
||||||
|
once(event: 'error', listener: (err: Error) => void): this; |
||||||
|
once(event: 'listening', listener: () => void): this; |
||||||
|
once(event: 'checkContinue', listener: http.RequestListener): this; |
||||||
|
once(event: 'checkExpectation', listener: http.RequestListener): this; |
||||||
|
once(event: 'clientError', listener: (err: Error, socket: Duplex) => void): this; |
||||||
|
once(event: 'connect', listener: (req: http.IncomingMessage, socket: Duplex, head: Buffer) => void): this; |
||||||
|
once(event: 'request', listener: http.RequestListener): this; |
||||||
|
once(event: 'upgrade', listener: (req: http.IncomingMessage, socket: Duplex, head: Buffer) => void): this; |
||||||
|
prependListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
prependListener(event: 'keylog', listener: (line: Buffer, tlsSocket: tls.TLSSocket) => void): this; |
||||||
|
prependListener(event: 'newSession', listener: (sessionId: Buffer, sessionData: Buffer, callback: (err: Error, resp: Buffer) => void) => void): this; |
||||||
|
prependListener(event: 'OCSPRequest', listener: (certificate: Buffer, issuer: Buffer, callback: (err: Error | null, resp: Buffer) => void) => void): this; |
||||||
|
prependListener(event: 'resumeSession', listener: (sessionId: Buffer, callback: (err: Error, sessionData: Buffer) => void) => void): this; |
||||||
|
prependListener(event: 'secureConnection', listener: (tlsSocket: tls.TLSSocket) => void): this; |
||||||
|
prependListener(event: 'tlsClientError', listener: (err: Error, tlsSocket: tls.TLSSocket) => void): this; |
||||||
|
prependListener(event: 'close', listener: () => void): this; |
||||||
|
prependListener(event: 'connection', listener: (socket: Duplex) => void): this; |
||||||
|
prependListener(event: 'error', listener: (err: Error) => void): this; |
||||||
|
prependListener(event: 'listening', listener: () => void): this; |
||||||
|
prependListener(event: 'checkContinue', listener: http.RequestListener): this; |
||||||
|
prependListener(event: 'checkExpectation', listener: http.RequestListener): this; |
||||||
|
prependListener(event: 'clientError', listener: (err: Error, socket: Duplex) => void): this; |
||||||
|
prependListener(event: 'connect', listener: (req: http.IncomingMessage, socket: Duplex, head: Buffer) => void): this; |
||||||
|
prependListener(event: 'request', listener: http.RequestListener): this; |
||||||
|
prependListener(event: 'upgrade', listener: (req: http.IncomingMessage, socket: Duplex, head: Buffer) => void): this; |
||||||
|
prependOnceListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
prependOnceListener(event: 'keylog', listener: (line: Buffer, tlsSocket: tls.TLSSocket) => void): this; |
||||||
|
prependOnceListener(event: 'newSession', listener: (sessionId: Buffer, sessionData: Buffer, callback: (err: Error, resp: Buffer) => void) => void): this; |
||||||
|
prependOnceListener(event: 'OCSPRequest', listener: (certificate: Buffer, issuer: Buffer, callback: (err: Error | null, resp: Buffer) => void) => void): this; |
||||||
|
prependOnceListener(event: 'resumeSession', listener: (sessionId: Buffer, callback: (err: Error, sessionData: Buffer) => void) => void): this; |
||||||
|
prependOnceListener(event: 'secureConnection', listener: (tlsSocket: tls.TLSSocket) => void): this; |
||||||
|
prependOnceListener(event: 'tlsClientError', listener: (err: Error, tlsSocket: tls.TLSSocket) => void): this; |
||||||
|
prependOnceListener(event: 'close', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'connection', listener: (socket: Duplex) => void): this; |
||||||
|
prependOnceListener(event: 'error', listener: (err: Error) => void): this; |
||||||
|
prependOnceListener(event: 'listening', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'checkContinue', listener: http.RequestListener): this; |
||||||
|
prependOnceListener(event: 'checkExpectation', listener: http.RequestListener): this; |
||||||
|
prependOnceListener(event: 'clientError', listener: (err: Error, socket: Duplex) => void): this; |
||||||
|
prependOnceListener(event: 'connect', listener: (req: http.IncomingMessage, socket: Duplex, head: Buffer) => void): this; |
||||||
|
prependOnceListener(event: 'request', listener: http.RequestListener): this; |
||||||
|
prependOnceListener(event: 'upgrade', listener: (req: http.IncomingMessage, socket: Duplex, head: Buffer) => void): this; |
||||||
|
} |
||||||
|
/** |
||||||
|
* ```js
|
||||||
|
* // curl -k https://localhost:8000/
|
||||||
|
* const https = require('https'); |
||||||
|
* const fs = require('fs'); |
||||||
|
* |
||||||
|
* const options = { |
||||||
|
* key: fs.readFileSync('test/fixtures/keys/agent2-key.pem'), |
||||||
|
* cert: fs.readFileSync('test/fixtures/keys/agent2-cert.pem') |
||||||
|
* }; |
||||||
|
* |
||||||
|
* https.createServer(options, (req, res) => { |
||||||
|
* res.writeHead(200); |
||||||
|
* res.end('hello world\n'); |
||||||
|
* }).listen(8000); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Or |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const https = require('https'); |
||||||
|
* const fs = require('fs'); |
||||||
|
* |
||||||
|
* const options = { |
||||||
|
* pfx: fs.readFileSync('test/fixtures/test_cert.pfx'), |
||||||
|
* passphrase: 'sample' |
||||||
|
* }; |
||||||
|
* |
||||||
|
* https.createServer(options, (req, res) => { |
||||||
|
* res.writeHead(200); |
||||||
|
* res.end('hello world\n'); |
||||||
|
* }).listen(8000); |
||||||
|
* ``` |
||||||
|
* @since v0.3.4 |
||||||
|
* @param options Accepts `options` from `createServer`, `createSecureContext` and `createServer`. |
||||||
|
* @param requestListener A listener to be added to the `'request'` event. |
||||||
|
*/ |
||||||
|
function createServer(requestListener?: http.RequestListener): Server; |
||||||
|
function createServer(options: ServerOptions, requestListener?: http.RequestListener): Server; |
||||||
|
/** |
||||||
|
* Makes a request to a secure web server. |
||||||
|
* |
||||||
|
* The following additional `options` from `tls.connect()` are also accepted:`ca`, `cert`, `ciphers`, `clientCertEngine`, `crl`, `dhparam`, `ecdhCurve`,`honorCipherOrder`, `key`, `passphrase`, |
||||||
|
* `pfx`, `rejectUnauthorized`,`secureOptions`, `secureProtocol`, `servername`, `sessionIdContext`,`highWaterMark`. |
||||||
|
* |
||||||
|
* `options` can be an object, a string, or a `URL` object. If `options` is a |
||||||
|
* string, it is automatically parsed with `new URL()`. If it is a `URL` object, it will be automatically converted to an ordinary `options` object. |
||||||
|
* |
||||||
|
* `https.request()` returns an instance of the `http.ClientRequest` class. The `ClientRequest` instance is a writable stream. If one needs to |
||||||
|
* upload a file with a POST request, then write to the `ClientRequest` object. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const https = require('https'); |
||||||
|
* |
||||||
|
* const options = { |
||||||
|
* hostname: 'encrypted.google.com', |
||||||
|
* port: 443, |
||||||
|
* path: '/', |
||||||
|
* method: 'GET' |
||||||
|
* }; |
||||||
|
* |
||||||
|
* const req = https.request(options, (res) => { |
||||||
|
* console.log('statusCode:', res.statusCode); |
||||||
|
* console.log('headers:', res.headers); |
||||||
|
* |
||||||
|
* res.on('data', (d) => { |
||||||
|
* process.stdout.write(d); |
||||||
|
* }); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* req.on('error', (e) => { |
||||||
|
* console.error(e); |
||||||
|
* }); |
||||||
|
* req.end(); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Example using options from `tls.connect()`: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const options = { |
||||||
|
* hostname: 'encrypted.google.com', |
||||||
|
* port: 443, |
||||||
|
* path: '/', |
||||||
|
* method: 'GET', |
||||||
|
* key: fs.readFileSync('test/fixtures/keys/agent2-key.pem'), |
||||||
|
* cert: fs.readFileSync('test/fixtures/keys/agent2-cert.pem') |
||||||
|
* }; |
||||||
|
* options.agent = new https.Agent(options); |
||||||
|
* |
||||||
|
* const req = https.request(options, (res) => { |
||||||
|
* // ...
|
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Alternatively, opt out of connection pooling by not using an `Agent`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const options = { |
||||||
|
* hostname: 'encrypted.google.com', |
||||||
|
* port: 443, |
||||||
|
* path: '/', |
||||||
|
* method: 'GET', |
||||||
|
* key: fs.readFileSync('test/fixtures/keys/agent2-key.pem'), |
||||||
|
* cert: fs.readFileSync('test/fixtures/keys/agent2-cert.pem'), |
||||||
|
* agent: false |
||||||
|
* }; |
||||||
|
* |
||||||
|
* const req = https.request(options, (res) => { |
||||||
|
* // ...
|
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Example using a `URL` as `options`: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const options = new URL('https://abc:xyz@example.com'); |
||||||
|
* |
||||||
|
* const req = https.request(options, (res) => { |
||||||
|
* // ...
|
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Example pinning on certificate fingerprint, or the public key (similar to`pin-sha256`): |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const tls = require('tls'); |
||||||
|
* const https = require('https'); |
||||||
|
* const crypto = require('crypto'); |
||||||
|
* |
||||||
|
* function sha256(s) { |
||||||
|
* return crypto.createHash('sha256').update(s).digest('base64'); |
||||||
|
* } |
||||||
|
* const options = { |
||||||
|
* hostname: 'github.com', |
||||||
|
* port: 443, |
||||||
|
* path: '/', |
||||||
|
* method: 'GET', |
||||||
|
* checkServerIdentity: function(host, cert) { |
||||||
|
* // Make sure the certificate is issued to the host we are connected to
|
||||||
|
* const err = tls.checkServerIdentity(host, cert); |
||||||
|
* if (err) { |
||||||
|
* return err; |
||||||
|
* } |
||||||
|
* |
||||||
|
* // Pin the public key, similar to HPKP pin-sha25 pinning
|
||||||
|
* const pubkey256 = 'pL1+qb9HTMRZJmuC/bB/ZI9d302BYrrqiVuRyW+DGrU='; |
||||||
|
* if (sha256(cert.pubkey) !== pubkey256) { |
||||||
|
* const msg = 'Certificate verification error: ' + |
||||||
|
* `The public key of '${cert.subject.CN}' ` + |
||||||
|
* 'does not match our pinned fingerprint'; |
||||||
|
* return new Error(msg); |
||||||
|
* } |
||||||
|
* |
||||||
|
* // Pin the exact certificate, rather than the pub key
|
||||||
|
* const cert256 = '25:FE:39:32:D9:63:8C:8A:FC:A1:9A:29:87:' + |
||||||
|
* 'D8:3E:4C:1D:98:DB:71:E4:1A:48:03:98:EA:22:6A:BD:8B:93:16'; |
||||||
|
* if (cert.fingerprint256 !== cert256) { |
||||||
|
* const msg = 'Certificate verification error: ' + |
||||||
|
* `The certificate of '${cert.subject.CN}' ` + |
||||||
|
* 'does not match our pinned fingerprint'; |
||||||
|
* return new Error(msg); |
||||||
|
* } |
||||||
|
* |
||||||
|
* // This loop is informational only.
|
||||||
|
* // Print the certificate and public key fingerprints of all certs in the
|
||||||
|
* // chain. Its common to pin the public key of the issuer on the public
|
||||||
|
* // internet, while pinning the public key of the service in sensitive
|
||||||
|
* // environments.
|
||||||
|
* do { |
||||||
|
* console.log('Subject Common Name:', cert.subject.CN); |
||||||
|
* console.log(' Certificate SHA256 fingerprint:', cert.fingerprint256); |
||||||
|
* |
||||||
|
* hash = crypto.createHash('sha256'); |
||||||
|
* console.log(' Public key ping-sha256:', sha256(cert.pubkey)); |
||||||
|
* |
||||||
|
* lastprint256 = cert.fingerprint256; |
||||||
|
* cert = cert.issuerCertificate; |
||||||
|
* } while (cert.fingerprint256 !== lastprint256); |
||||||
|
* |
||||||
|
* }, |
||||||
|
* }; |
||||||
|
* |
||||||
|
* options.agent = new https.Agent(options); |
||||||
|
* const req = https.request(options, (res) => { |
||||||
|
* console.log('All OK. Server matched our pinned cert or public key'); |
||||||
|
* console.log('statusCode:', res.statusCode); |
||||||
|
* // Print the HPKP values
|
||||||
|
* console.log('headers:', res.headers['public-key-pins']); |
||||||
|
* |
||||||
|
* res.on('data', (d) => {}); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* req.on('error', (e) => { |
||||||
|
* console.error(e.message); |
||||||
|
* }); |
||||||
|
* req.end(); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Outputs for example: |
||||||
|
* |
||||||
|
* ```text
|
||||||
|
* Subject Common Name: github.com |
||||||
|
* Certificate SHA256 fingerprint: 25:FE:39:32:D9:63:8C:8A:FC:A1:9A:29:87:D8:3E:4C:1D:98:DB:71:E4:1A:48:03:98:EA:22:6A:BD:8B:93:16 |
||||||
|
* Public key ping-sha256: pL1+qb9HTMRZJmuC/bB/ZI9d302BYrrqiVuRyW+DGrU= |
||||||
|
* Subject Common Name: DigiCert SHA2 Extended Validation Server CA |
||||||
|
* Certificate SHA256 fingerprint: 40:3E:06:2A:26:53:05:91:13:28:5B:AF:80:A0:D4:AE:42:2C:84:8C:9F:78:FA:D0:1F:C9:4B:C5:B8:7F:EF:1A |
||||||
|
* Public key ping-sha256: RRM1dGqnDFsCJXBTHky16vi1obOlCgFFn/yOhI/y+ho= |
||||||
|
* Subject Common Name: DigiCert High Assurance EV Root CA |
||||||
|
* Certificate SHA256 fingerprint: 74:31:E5:F4:C3:C1:CE:46:90:77:4F:0B:61:E0:54:40:88:3B:A9:A0:1E:D0:0B:A6:AB:D7:80:6E:D3:B1:18:CF |
||||||
|
* Public key ping-sha256: WoiWRyIOVNa9ihaBciRSC7XHjliYS9VwUGOIud4PB18= |
||||||
|
* All OK. Server matched our pinned cert or public key |
||||||
|
* statusCode: 200 |
||||||
|
* headers: max-age=0; pin-sha256="WoiWRyIOVNa9ihaBciRSC7XHjliYS9VwUGOIud4PB18="; pin-sha256="RRM1dGqnDFsCJXBTHky16vi1obOlCgFFn/yOhI/y+ho="; |
||||||
|
* pin-sha256="k2v657xBsOVe1PQRwOsHsw3bsGT2VzIqz5K+59sNQws="; pin-sha256="K87oWBWM9UZfyddvDfoxL+8lpNyoUB2ptGtn0fv6G2Q="; pin-sha256="IQBnNBEiFuhj+8x6X8XLgh01V9Ic5/V3IRQLNFFc7v4="; |
||||||
|
* pin-sha256="iie1VXtL7HzAMF+/PVPR9xzT80kQxdZeJ+zduCB3uj0="; pin-sha256="LvRiGEjRqfzurezaWuj8Wie2gyHMrW5Q06LspMnox7A="; includeSubDomains |
||||||
|
* ``` |
||||||
|
* @since v0.3.6 |
||||||
|
* @param options Accepts all `options` from `request`, with some differences in default values: |
||||||
|
*/ |
||||||
|
function request(options: RequestOptions | string | URL, callback?: (res: http.IncomingMessage) => void): http.ClientRequest; |
||||||
|
function request(url: string | URL, options: RequestOptions, callback?: (res: http.IncomingMessage) => void): http.ClientRequest; |
||||||
|
/** |
||||||
|
* Like `http.get()` but for HTTPS. |
||||||
|
* |
||||||
|
* `options` can be an object, a string, or a `URL` object. If `options` is a |
||||||
|
* string, it is automatically parsed with `new URL()`. If it is a `URL` object, it will be automatically converted to an ordinary `options` object. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const https = require('https'); |
||||||
|
* |
||||||
|
* https.get('https://encrypted.google.com/', (res) => { |
||||||
|
* console.log('statusCode:', res.statusCode); |
||||||
|
* console.log('headers:', res.headers); |
||||||
|
* |
||||||
|
* res.on('data', (d) => { |
||||||
|
* process.stdout.write(d); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* }).on('error', (e) => { |
||||||
|
* console.error(e); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* @since v0.3.6 |
||||||
|
* @param options Accepts the same `options` as {@link request}, with the `method` always set to `GET`. |
||||||
|
*/ |
||||||
|
function get(options: RequestOptions | string | URL, callback?: (res: http.IncomingMessage) => void): http.ClientRequest; |
||||||
|
function get(url: string | URL, options: RequestOptions, callback?: (res: http.IncomingMessage) => void): http.ClientRequest; |
||||||
|
let globalAgent: Agent; |
||||||
|
} |
||||||
|
declare module 'node:https' { |
||||||
|
export * from 'https'; |
||||||
|
} |
@ -0,0 +1,132 @@ |
|||||||
|
// Type definitions for non-npm package Node.js 18.7
|
||||||
|
// Project: https://nodejs.org/
|
||||||
|
// Definitions by: Microsoft TypeScript <https://github.com/Microsoft>
|
||||||
|
// DefinitelyTyped <https://github.com/DefinitelyTyped>
|
||||||
|
// Alberto Schiabel <https://github.com/jkomyno>
|
||||||
|
// Alvis HT Tang <https://github.com/alvis>
|
||||||
|
// Andrew Makarov <https://github.com/r3nya>
|
||||||
|
// Benjamin Toueg <https://github.com/btoueg>
|
||||||
|
// Chigozirim C. <https://github.com/smac89>
|
||||||
|
// David Junger <https://github.com/touffy>
|
||||||
|
// Deividas Bakanas <https://github.com/DeividasBakanas>
|
||||||
|
// Eugene Y. Q. Shen <https://github.com/eyqs>
|
||||||
|
// Hannes Magnusson <https://github.com/Hannes-Magnusson-CK>
|
||||||
|
// Huw <https://github.com/hoo29>
|
||||||
|
// Kelvin Jin <https://github.com/kjin>
|
||||||
|
// Klaus Meinhardt <https://github.com/ajafff>
|
||||||
|
// Lishude <https://github.com/islishude>
|
||||||
|
// Mariusz Wiktorczyk <https://github.com/mwiktorczyk>
|
||||||
|
// Mohsen Azimi <https://github.com/mohsen1>
|
||||||
|
// Nicolas Even <https://github.com/n-e>
|
||||||
|
// Nikita Galkin <https://github.com/galkin>
|
||||||
|
// Parambir Singh <https://github.com/parambirs>
|
||||||
|
// Sebastian Silbermann <https://github.com/eps1lon>
|
||||||
|
// Simon Schick <https://github.com/SimonSchick>
|
||||||
|
// Thomas den Hollander <https://github.com/ThomasdenH>
|
||||||
|
// Wilco Bakker <https://github.com/WilcoBakker>
|
||||||
|
// wwwy3y3 <https://github.com/wwwy3y3>
|
||||||
|
// Samuel Ainsworth <https://github.com/samuela>
|
||||||
|
// Kyle Uehlein <https://github.com/kuehlein>
|
||||||
|
// Thanik Bhongbhibhat <https://github.com/bhongy>
|
||||||
|
// Marcin Kopacz <https://github.com/chyzwar>
|
||||||
|
// Trivikram Kamat <https://github.com/trivikr>
|
||||||
|
// Junxiao Shi <https://github.com/yoursunny>
|
||||||
|
// Ilia Baryshnikov <https://github.com/qwelias>
|
||||||
|
// ExE Boss <https://github.com/ExE-Boss>
|
||||||
|
// Piotr Błażejewicz <https://github.com/peterblazejewicz>
|
||||||
|
// Anna Henningsen <https://github.com/addaleax>
|
||||||
|
// Victor Perin <https://github.com/victorperin>
|
||||||
|
// Yongsheng Zhang <https://github.com/ZYSzys>
|
||||||
|
// NodeJS Contributors <https://github.com/NodeJS>
|
||||||
|
// Linus Unnebäck <https://github.com/LinusU>
|
||||||
|
// wafuwafu13 <https://github.com/wafuwafu13>
|
||||||
|
// Matteo Collina <https://github.com/mcollina>
|
||||||
|
// Definitions: https://github.com/DefinitelyTyped/DefinitelyTyped
|
||||||
|
|
||||||
|
/** |
||||||
|
* License for programmatically and manually incorporated |
||||||
|
* documentation aka. `JSDoc` from https://github.com/nodejs/node/tree/master/doc
|
||||||
|
* |
||||||
|
* Copyright Node.js contributors. All rights reserved. |
||||||
|
* Permission is hereby granted, free of charge, to any person obtaining a copy |
||||||
|
* of this software and associated documentation files (the "Software"), to |
||||||
|
* deal in the Software without restriction, including without limitation the |
||||||
|
* rights to use, copy, modify, merge, publish, distribute, sublicense, and/or |
||||||
|
* sell copies of the Software, and to permit persons to whom the Software is |
||||||
|
* furnished to do so, subject to the following conditions: |
||||||
|
* |
||||||
|
* The above copyright notice and this permission notice shall be included in |
||||||
|
* all copies or substantial portions of the Software. |
||||||
|
* |
||||||
|
* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR |
||||||
|
* IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, |
||||||
|
* FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE |
||||||
|
* AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER |
||||||
|
* LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING |
||||||
|
* FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS |
||||||
|
* IN THE SOFTWARE. |
||||||
|
*/ |
||||||
|
|
||||||
|
// NOTE: These definitions support NodeJS and TypeScript 3.7+.
|
||||||
|
|
||||||
|
// Reference required types from the default lib:
|
||||||
|
/// <reference lib="es2020" />
|
||||||
|
/// <reference lib="esnext.asynciterable" />
|
||||||
|
/// <reference lib="esnext.intl" />
|
||||||
|
/// <reference lib="esnext.bigint" />
|
||||||
|
|
||||||
|
// Base definitions for all NodeJS modules that are not specific to any version of TypeScript:
|
||||||
|
/// <reference path="assert.d.ts" />
|
||||||
|
/// <reference path="assert/strict.d.ts" />
|
||||||
|
/// <reference path="globals.d.ts" />
|
||||||
|
/// <reference path="async_hooks.d.ts" />
|
||||||
|
/// <reference path="buffer.d.ts" />
|
||||||
|
/// <reference path="child_process.d.ts" />
|
||||||
|
/// <reference path="cluster.d.ts" />
|
||||||
|
/// <reference path="console.d.ts" />
|
||||||
|
/// <reference path="constants.d.ts" />
|
||||||
|
/// <reference path="crypto.d.ts" />
|
||||||
|
/// <reference path="dgram.d.ts" />
|
||||||
|
/// <reference path="diagnostics_channel.d.ts" />
|
||||||
|
/// <reference path="dns.d.ts" />
|
||||||
|
/// <reference path="dns/promises.d.ts" />
|
||||||
|
/// <reference path="dns/promises.d.ts" />
|
||||||
|
/// <reference path="domain.d.ts" />
|
||||||
|
/// <reference path="events.d.ts" />
|
||||||
|
/// <reference path="fs.d.ts" />
|
||||||
|
/// <reference path="fs/promises.d.ts" />
|
||||||
|
/// <reference path="http.d.ts" />
|
||||||
|
/// <reference path="http2.d.ts" />
|
||||||
|
/// <reference path="https.d.ts" />
|
||||||
|
/// <reference path="inspector.d.ts" />
|
||||||
|
/// <reference path="module.d.ts" />
|
||||||
|
/// <reference path="net.d.ts" />
|
||||||
|
/// <reference path="os.d.ts" />
|
||||||
|
/// <reference path="path.d.ts" />
|
||||||
|
/// <reference path="perf_hooks.d.ts" />
|
||||||
|
/// <reference path="process.d.ts" />
|
||||||
|
/// <reference path="punycode.d.ts" />
|
||||||
|
/// <reference path="querystring.d.ts" />
|
||||||
|
/// <reference path="readline.d.ts" />
|
||||||
|
/// <reference path="readline/promises.d.ts" />
|
||||||
|
/// <reference path="repl.d.ts" />
|
||||||
|
/// <reference path="stream.d.ts" />
|
||||||
|
/// <reference path="stream/promises.d.ts" />
|
||||||
|
/// <reference path="stream/consumers.d.ts" />
|
||||||
|
/// <reference path="stream/web.d.ts" />
|
||||||
|
/// <reference path="string_decoder.d.ts" />
|
||||||
|
/// <reference path="test.d.ts" />
|
||||||
|
/// <reference path="timers.d.ts" />
|
||||||
|
/// <reference path="timers/promises.d.ts" />
|
||||||
|
/// <reference path="tls.d.ts" />
|
||||||
|
/// <reference path="trace_events.d.ts" />
|
||||||
|
/// <reference path="tty.d.ts" />
|
||||||
|
/// <reference path="url.d.ts" />
|
||||||
|
/// <reference path="util.d.ts" />
|
||||||
|
/// <reference path="v8.d.ts" />
|
||||||
|
/// <reference path="vm.d.ts" />
|
||||||
|
/// <reference path="wasi.d.ts" />
|
||||||
|
/// <reference path="worker_threads.d.ts" />
|
||||||
|
/// <reference path="zlib.d.ts" />
|
||||||
|
|
||||||
|
/// <reference path="globals.global.d.ts" />
|
File diff suppressed because it is too large
Load Diff
@ -0,0 +1,114 @@ |
|||||||
|
/** |
||||||
|
* @since v0.3.7 |
||||||
|
*/ |
||||||
|
declare module 'module' { |
||||||
|
import { URL } from 'node:url'; |
||||||
|
namespace Module { |
||||||
|
/** |
||||||
|
* The `module.syncBuiltinESMExports()` method updates all the live bindings for |
||||||
|
* builtin `ES Modules` to match the properties of the `CommonJS` exports. It |
||||||
|
* does not add or remove exported names from the `ES Modules`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const fs = require('fs'); |
||||||
|
* const assert = require('assert'); |
||||||
|
* const { syncBuiltinESMExports } = require('module'); |
||||||
|
* |
||||||
|
* fs.readFile = newAPI; |
||||||
|
* |
||||||
|
* delete fs.readFileSync; |
||||||
|
* |
||||||
|
* function newAPI() { |
||||||
|
* // ...
|
||||||
|
* } |
||||||
|
* |
||||||
|
* fs.newAPI = newAPI; |
||||||
|
* |
||||||
|
* syncBuiltinESMExports(); |
||||||
|
* |
||||||
|
* import('fs').then((esmFS) => { |
||||||
|
* // It syncs the existing readFile property with the new value
|
||||||
|
* assert.strictEqual(esmFS.readFile, newAPI); |
||||||
|
* // readFileSync has been deleted from the required fs
|
||||||
|
* assert.strictEqual('readFileSync' in fs, false); |
||||||
|
* // syncBuiltinESMExports() does not remove readFileSync from esmFS
|
||||||
|
* assert.strictEqual('readFileSync' in esmFS, true); |
||||||
|
* // syncBuiltinESMExports() does not add names
|
||||||
|
* assert.strictEqual(esmFS.newAPI, undefined); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* @since v12.12.0 |
||||||
|
*/ |
||||||
|
function syncBuiltinESMExports(): void; |
||||||
|
/** |
||||||
|
* `path` is the resolved path for the file for which a corresponding source map |
||||||
|
* should be fetched. |
||||||
|
* @since v13.7.0, v12.17.0 |
||||||
|
*/ |
||||||
|
function findSourceMap(path: string, error?: Error): SourceMap; |
||||||
|
interface SourceMapPayload { |
||||||
|
file: string; |
||||||
|
version: number; |
||||||
|
sources: string[]; |
||||||
|
sourcesContent: string[]; |
||||||
|
names: string[]; |
||||||
|
mappings: string; |
||||||
|
sourceRoot: string; |
||||||
|
} |
||||||
|
interface SourceMapping { |
||||||
|
generatedLine: number; |
||||||
|
generatedColumn: number; |
||||||
|
originalSource: string; |
||||||
|
originalLine: number; |
||||||
|
originalColumn: number; |
||||||
|
} |
||||||
|
/** |
||||||
|
* @since v13.7.0, v12.17.0 |
||||||
|
*/ |
||||||
|
class SourceMap { |
||||||
|
/** |
||||||
|
* Getter for the payload used to construct the `SourceMap` instance. |
||||||
|
*/ |
||||||
|
readonly payload: SourceMapPayload; |
||||||
|
constructor(payload: SourceMapPayload); |
||||||
|
/** |
||||||
|
* Given a line number and column number in the generated source file, returns |
||||||
|
* an object representing the position in the original file. The object returned |
||||||
|
* consists of the following keys: |
||||||
|
*/ |
||||||
|
findEntry(line: number, column: number): SourceMapping; |
||||||
|
} |
||||||
|
} |
||||||
|
interface Module extends NodeModule {} |
||||||
|
class Module { |
||||||
|
static runMain(): void; |
||||||
|
static wrap(code: string): string; |
||||||
|
static createRequire(path: string | URL): NodeRequire; |
||||||
|
static builtinModules: string[]; |
||||||
|
static Module: typeof Module; |
||||||
|
constructor(id: string, parent?: Module); |
||||||
|
} |
||||||
|
global { |
||||||
|
interface ImportMeta { |
||||||
|
url: string; |
||||||
|
/** |
||||||
|
* @experimental |
||||||
|
* This feature is only available with the `--experimental-import-meta-resolve` |
||||||
|
* command flag enabled. |
||||||
|
* |
||||||
|
* Provides a module-relative resolution function scoped to each module, returning |
||||||
|
* the URL string. |
||||||
|
* |
||||||
|
* @param specified The module specifier to resolve relative to `parent`. |
||||||
|
* @param parent The absolute parent module URL to resolve from. If none |
||||||
|
* is specified, the value of `import.meta.url` is used as the default. |
||||||
|
*/ |
||||||
|
resolve?(specified: string, parent?: string | URL): Promise<string>; |
||||||
|
} |
||||||
|
} |
||||||
|
export = Module; |
||||||
|
} |
||||||
|
declare module 'node:module' { |
||||||
|
import module = require('module'); |
||||||
|
export = module; |
||||||
|
} |
@ -0,0 +1,816 @@ |
|||||||
|
/** |
||||||
|
* > Stability: 2 - Stable |
||||||
|
* |
||||||
|
* The `net` module provides an asynchronous network API for creating stream-based |
||||||
|
* TCP or `IPC` servers ({@link createServer}) and clients |
||||||
|
* ({@link createConnection}). |
||||||
|
* |
||||||
|
* It can be accessed using: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const net = require('net'); |
||||||
|
* ``` |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/net.js)
|
||||||
|
*/ |
||||||
|
declare module 'net' { |
||||||
|
import * as stream from 'node:stream'; |
||||||
|
import { Abortable, EventEmitter } from 'node:events'; |
||||||
|
import * as dns from 'node:dns'; |
||||||
|
type LookupFunction = (hostname: string, options: dns.LookupOneOptions, callback: (err: NodeJS.ErrnoException | null, address: string, family: number) => void) => void; |
||||||
|
interface AddressInfo { |
||||||
|
address: string; |
||||||
|
family: string; |
||||||
|
port: number; |
||||||
|
} |
||||||
|
interface SocketConstructorOpts { |
||||||
|
fd?: number | undefined; |
||||||
|
allowHalfOpen?: boolean | undefined; |
||||||
|
readable?: boolean | undefined; |
||||||
|
writable?: boolean | undefined; |
||||||
|
signal?: AbortSignal; |
||||||
|
} |
||||||
|
interface OnReadOpts { |
||||||
|
buffer: Uint8Array | (() => Uint8Array); |
||||||
|
/** |
||||||
|
* This function is called for every chunk of incoming data. |
||||||
|
* Two arguments are passed to it: the number of bytes written to buffer and a reference to buffer. |
||||||
|
* Return false from this function to implicitly pause() the socket. |
||||||
|
*/ |
||||||
|
callback(bytesWritten: number, buf: Uint8Array): boolean; |
||||||
|
} |
||||||
|
interface ConnectOpts { |
||||||
|
/** |
||||||
|
* If specified, incoming data is stored in a single buffer and passed to the supplied callback when data arrives on the socket. |
||||||
|
* Note: this will cause the streaming functionality to not provide any data, however events like 'error', 'end', and 'close' will |
||||||
|
* still be emitted as normal and methods like pause() and resume() will also behave as expected. |
||||||
|
*/ |
||||||
|
onread?: OnReadOpts | undefined; |
||||||
|
} |
||||||
|
interface TcpSocketConnectOpts extends ConnectOpts { |
||||||
|
port: number; |
||||||
|
host?: string | undefined; |
||||||
|
localAddress?: string | undefined; |
||||||
|
localPort?: number | undefined; |
||||||
|
hints?: number | undefined; |
||||||
|
family?: number | undefined; |
||||||
|
lookup?: LookupFunction | undefined; |
||||||
|
} |
||||||
|
interface IpcSocketConnectOpts extends ConnectOpts { |
||||||
|
path: string; |
||||||
|
} |
||||||
|
type SocketConnectOpts = TcpSocketConnectOpts | IpcSocketConnectOpts; |
||||||
|
type SocketReadyState = 'opening' | 'open' | 'readOnly' | 'writeOnly' | 'closed'; |
||||||
|
/** |
||||||
|
* This class is an abstraction of a TCP socket or a streaming `IPC` endpoint |
||||||
|
* (uses named pipes on Windows, and Unix domain sockets otherwise). It is also |
||||||
|
* an `EventEmitter`. |
||||||
|
* |
||||||
|
* A `net.Socket` can be created by the user and used directly to interact with |
||||||
|
* a server. For example, it is returned by {@link createConnection}, |
||||||
|
* so the user can use it to talk to the server. |
||||||
|
* |
||||||
|
* It can also be created by Node.js and passed to the user when a connection |
||||||
|
* is received. For example, it is passed to the listeners of a `'connection'` event emitted on a {@link Server}, so the user can use |
||||||
|
* it to interact with the client. |
||||||
|
* @since v0.3.4 |
||||||
|
*/ |
||||||
|
class Socket extends stream.Duplex { |
||||||
|
constructor(options?: SocketConstructorOpts); |
||||||
|
/** |
||||||
|
* Sends data on the socket. The second parameter specifies the encoding in the |
||||||
|
* case of a string. It defaults to UTF8 encoding. |
||||||
|
* |
||||||
|
* Returns `true` if the entire data was flushed successfully to the kernel |
||||||
|
* buffer. Returns `false` if all or part of the data was queued in user memory.`'drain'` will be emitted when the buffer is again free. |
||||||
|
* |
||||||
|
* The optional `callback` parameter will be executed when the data is finally |
||||||
|
* written out, which may not be immediately. |
||||||
|
* |
||||||
|
* See `Writable` stream `write()` method for more |
||||||
|
* information. |
||||||
|
* @since v0.1.90 |
||||||
|
* @param [encoding='utf8'] Only used when data is `string`. |
||||||
|
*/ |
||||||
|
write(buffer: Uint8Array | string, cb?: (err?: Error) => void): boolean; |
||||||
|
write(str: Uint8Array | string, encoding?: BufferEncoding, cb?: (err?: Error) => void): boolean; |
||||||
|
/** |
||||||
|
* Initiate a connection on a given socket. |
||||||
|
* |
||||||
|
* Possible signatures: |
||||||
|
* |
||||||
|
* * `socket.connect(options[, connectListener])` |
||||||
|
* * `socket.connect(path[, connectListener])` for `IPC` connections. |
||||||
|
* * `socket.connect(port[, host][, connectListener])` for TCP connections. |
||||||
|
* * Returns: `net.Socket` The socket itself. |
||||||
|
* |
||||||
|
* This function is asynchronous. When the connection is established, the `'connect'` event will be emitted. If there is a problem connecting, |
||||||
|
* instead of a `'connect'` event, an `'error'` event will be emitted with |
||||||
|
* the error passed to the `'error'` listener. |
||||||
|
* The last parameter `connectListener`, if supplied, will be added as a listener |
||||||
|
* for the `'connect'` event **once**. |
||||||
|
* |
||||||
|
* This function should only be used for reconnecting a socket after`'close'` has been emitted or otherwise it may lead to undefined |
||||||
|
* behavior. |
||||||
|
*/ |
||||||
|
connect(options: SocketConnectOpts, connectionListener?: () => void): this; |
||||||
|
connect(port: number, host: string, connectionListener?: () => void): this; |
||||||
|
connect(port: number, connectionListener?: () => void): this; |
||||||
|
connect(path: string, connectionListener?: () => void): this; |
||||||
|
/** |
||||||
|
* Set the encoding for the socket as a `Readable Stream`. See `readable.setEncoding()` for more information. |
||||||
|
* @since v0.1.90 |
||||||
|
* @return The socket itself. |
||||||
|
*/ |
||||||
|
setEncoding(encoding?: BufferEncoding): this; |
||||||
|
/** |
||||||
|
* Pauses the reading of data. That is, `'data'` events will not be emitted. |
||||||
|
* Useful to throttle back an upload. |
||||||
|
* @return The socket itself. |
||||||
|
*/ |
||||||
|
pause(): this; |
||||||
|
/** |
||||||
|
* Resumes reading after a call to `socket.pause()`. |
||||||
|
* @return The socket itself. |
||||||
|
*/ |
||||||
|
resume(): this; |
||||||
|
/** |
||||||
|
* Sets the socket to timeout after `timeout` milliseconds of inactivity on |
||||||
|
* the socket. By default `net.Socket` do not have a timeout. |
||||||
|
* |
||||||
|
* When an idle timeout is triggered the socket will receive a `'timeout'` event but the connection will not be severed. The user must manually call `socket.end()` or `socket.destroy()` to |
||||||
|
* end the connection. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* socket.setTimeout(3000); |
||||||
|
* socket.on('timeout', () => { |
||||||
|
* console.log('socket timeout'); |
||||||
|
* socket.end(); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* If `timeout` is 0, then the existing idle timeout is disabled. |
||||||
|
* |
||||||
|
* The optional `callback` parameter will be added as a one-time listener for the `'timeout'` event. |
||||||
|
* @since v0.1.90 |
||||||
|
* @return The socket itself. |
||||||
|
*/ |
||||||
|
setTimeout(timeout: number, callback?: () => void): this; |
||||||
|
/** |
||||||
|
* Enable/disable the use of Nagle's algorithm. |
||||||
|
* |
||||||
|
* When a TCP connection is created, it will have Nagle's algorithm enabled. |
||||||
|
* |
||||||
|
* Nagle's algorithm delays data before it is sent via the network. It attempts |
||||||
|
* to optimize throughput at the expense of latency. |
||||||
|
* |
||||||
|
* Passing `true` for `noDelay` or not passing an argument will disable Nagle's |
||||||
|
* algorithm for the socket. Passing `false` for `noDelay` will enable Nagle's |
||||||
|
* algorithm. |
||||||
|
* @since v0.1.90 |
||||||
|
* @param [noDelay=true] |
||||||
|
* @return The socket itself. |
||||||
|
*/ |
||||||
|
setNoDelay(noDelay?: boolean): this; |
||||||
|
/** |
||||||
|
* Enable/disable keep-alive functionality, and optionally set the initial |
||||||
|
* delay before the first keepalive probe is sent on an idle socket. |
||||||
|
* |
||||||
|
* Set `initialDelay` (in milliseconds) to set the delay between the last |
||||||
|
* data packet received and the first keepalive probe. Setting `0` for`initialDelay` will leave the value unchanged from the default |
||||||
|
* (or previous) setting. |
||||||
|
* |
||||||
|
* Enabling the keep-alive functionality will set the following socket options: |
||||||
|
* |
||||||
|
* * `SO_KEEPALIVE=1` |
||||||
|
* * `TCP_KEEPIDLE=initialDelay` |
||||||
|
* * `TCP_KEEPCNT=10` |
||||||
|
* * `TCP_KEEPINTVL=1` |
||||||
|
* @since v0.1.92 |
||||||
|
* @param [enable=false] |
||||||
|
* @param [initialDelay=0] |
||||||
|
* @return The socket itself. |
||||||
|
*/ |
||||||
|
setKeepAlive(enable?: boolean, initialDelay?: number): this; |
||||||
|
/** |
||||||
|
* Returns the bound `address`, the address `family` name and `port` of the |
||||||
|
* socket as reported by the operating system:`{ port: 12346, family: 'IPv4', address: '127.0.0.1' }` |
||||||
|
* @since v0.1.90 |
||||||
|
*/ |
||||||
|
address(): AddressInfo | {}; |
||||||
|
/** |
||||||
|
* Calling `unref()` on a socket will allow the program to exit if this is the only |
||||||
|
* active socket in the event system. If the socket is already `unref`ed calling`unref()` again will have no effect. |
||||||
|
* @since v0.9.1 |
||||||
|
* @return The socket itself. |
||||||
|
*/ |
||||||
|
unref(): this; |
||||||
|
/** |
||||||
|
* Opposite of `unref()`, calling `ref()` on a previously `unref`ed socket will _not_ let the program exit if it's the only socket left (the default behavior). |
||||||
|
* If the socket is `ref`ed calling `ref` again will have no effect. |
||||||
|
* @since v0.9.1 |
||||||
|
* @return The socket itself. |
||||||
|
*/ |
||||||
|
ref(): this; |
||||||
|
/** |
||||||
|
* This property shows the number of characters buffered for writing. The buffer |
||||||
|
* may contain strings whose length after encoding is not yet known. So this number |
||||||
|
* is only an approximation of the number of bytes in the buffer. |
||||||
|
* |
||||||
|
* `net.Socket` has the property that `socket.write()` always works. This is to |
||||||
|
* help users get up and running quickly. The computer cannot always keep up |
||||||
|
* with the amount of data that is written to a socket. The network connection |
||||||
|
* simply might be too slow. Node.js will internally queue up the data written to a |
||||||
|
* socket and send it out over the wire when it is possible. |
||||||
|
* |
||||||
|
* The consequence of this internal buffering is that memory may grow. |
||||||
|
* Users who experience large or growing `bufferSize` should attempt to |
||||||
|
* "throttle" the data flows in their program with `socket.pause()` and `socket.resume()`. |
||||||
|
* @since v0.3.8 |
||||||
|
* @deprecated Since v14.6.0 - Use `writableLength` instead. |
||||||
|
*/ |
||||||
|
readonly bufferSize: number; |
||||||
|
/** |
||||||
|
* The amount of received bytes. |
||||||
|
* @since v0.5.3 |
||||||
|
*/ |
||||||
|
readonly bytesRead: number; |
||||||
|
/** |
||||||
|
* The amount of bytes sent. |
||||||
|
* @since v0.5.3 |
||||||
|
*/ |
||||||
|
readonly bytesWritten: number; |
||||||
|
/** |
||||||
|
* If `true`,`socket.connect(options[, connectListener])` was |
||||||
|
* called and has not yet finished. It will stay `true` until the socket becomes |
||||||
|
* connected, then it is set to `false` and the `'connect'` event is emitted. Note |
||||||
|
* that the `socket.connect(options[, connectListener])` callback is a listener for the `'connect'` event. |
||||||
|
* @since v6.1.0 |
||||||
|
*/ |
||||||
|
readonly connecting: boolean; |
||||||
|
/** |
||||||
|
* See `writable.destroyed` for further details. |
||||||
|
*/ |
||||||
|
readonly destroyed: boolean; |
||||||
|
/** |
||||||
|
* The string representation of the local IP address the remote client is |
||||||
|
* connecting on. For example, in a server listening on `'0.0.0.0'`, if a client |
||||||
|
* connects on `'192.168.1.1'`, the value of `socket.localAddress` would be`'192.168.1.1'`. |
||||||
|
* @since v0.9.6 |
||||||
|
*/ |
||||||
|
readonly localAddress?: string; |
||||||
|
/** |
||||||
|
* The numeric representation of the local port. For example, `80` or `21`. |
||||||
|
* @since v0.9.6 |
||||||
|
*/ |
||||||
|
readonly localPort?: number; |
||||||
|
/** |
||||||
|
* This property represents the state of the connection as a string. |
||||||
|
* @see {https://nodejs.org/api/net.html#socketreadystate}
|
||||||
|
* @since v0.5.0 |
||||||
|
*/ |
||||||
|
readonly readyState: SocketReadyState; |
||||||
|
/** |
||||||
|
* The string representation of the remote IP address. For example,`'74.125.127.100'` or `'2001:4860:a005::68'`. Value may be `undefined` if |
||||||
|
* the socket is destroyed (for example, if the client disconnected). |
||||||
|
* @since v0.5.10 |
||||||
|
*/ |
||||||
|
readonly remoteAddress?: string | undefined; |
||||||
|
/** |
||||||
|
* The string representation of the remote IP family. `'IPv4'` or `'IPv6'`. |
||||||
|
* @since v0.11.14 |
||||||
|
*/ |
||||||
|
readonly remoteFamily?: string | undefined; |
||||||
|
/** |
||||||
|
* The numeric representation of the remote port. For example, `80` or `21`. |
||||||
|
* @since v0.5.10 |
||||||
|
*/ |
||||||
|
readonly remotePort?: number | undefined; |
||||||
|
/** |
||||||
|
* The socket timeout in milliseconds as set by socket.setTimeout(). It is undefined if a timeout has not been set. |
||||||
|
* @since v10.7.0 |
||||||
|
*/ |
||||||
|
readonly timeout?: number | undefined; |
||||||
|
/** |
||||||
|
* Half-closes the socket. i.e., it sends a FIN packet. It is possible the |
||||||
|
* server will still send some data. |
||||||
|
* |
||||||
|
* See `writable.end()` for further details. |
||||||
|
* @since v0.1.90 |
||||||
|
* @param [encoding='utf8'] Only used when data is `string`. |
||||||
|
* @param callback Optional callback for when the socket is finished. |
||||||
|
* @return The socket itself. |
||||||
|
*/ |
||||||
|
end(callback?: () => void): this; |
||||||
|
end(buffer: Uint8Array | string, callback?: () => void): this; |
||||||
|
end(str: Uint8Array | string, encoding?: BufferEncoding, callback?: () => void): this; |
||||||
|
/** |
||||||
|
* events.EventEmitter |
||||||
|
* 1. close |
||||||
|
* 2. connect |
||||||
|
* 3. data |
||||||
|
* 4. drain |
||||||
|
* 5. end |
||||||
|
* 6. error |
||||||
|
* 7. lookup |
||||||
|
* 8. timeout |
||||||
|
*/ |
||||||
|
addListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
addListener(event: 'close', listener: (hadError: boolean) => void): this; |
||||||
|
addListener(event: 'connect', listener: () => void): this; |
||||||
|
addListener(event: 'data', listener: (data: Buffer) => void): this; |
||||||
|
addListener(event: 'drain', listener: () => void): this; |
||||||
|
addListener(event: 'end', listener: () => void): this; |
||||||
|
addListener(event: 'error', listener: (err: Error) => void): this; |
||||||
|
addListener(event: 'lookup', listener: (err: Error, address: string, family: string | number, host: string) => void): this; |
||||||
|
addListener(event: 'ready', listener: () => void): this; |
||||||
|
addListener(event: 'timeout', listener: () => void): this; |
||||||
|
emit(event: string | symbol, ...args: any[]): boolean; |
||||||
|
emit(event: 'close', hadError: boolean): boolean; |
||||||
|
emit(event: 'connect'): boolean; |
||||||
|
emit(event: 'data', data: Buffer): boolean; |
||||||
|
emit(event: 'drain'): boolean; |
||||||
|
emit(event: 'end'): boolean; |
||||||
|
emit(event: 'error', err: Error): boolean; |
||||||
|
emit(event: 'lookup', err: Error, address: string, family: string | number, host: string): boolean; |
||||||
|
emit(event: 'ready'): boolean; |
||||||
|
emit(event: 'timeout'): boolean; |
||||||
|
on(event: string, listener: (...args: any[]) => void): this; |
||||||
|
on(event: 'close', listener: (hadError: boolean) => void): this; |
||||||
|
on(event: 'connect', listener: () => void): this; |
||||||
|
on(event: 'data', listener: (data: Buffer) => void): this; |
||||||
|
on(event: 'drain', listener: () => void): this; |
||||||
|
on(event: 'end', listener: () => void): this; |
||||||
|
on(event: 'error', listener: (err: Error) => void): this; |
||||||
|
on(event: 'lookup', listener: (err: Error, address: string, family: string | number, host: string) => void): this; |
||||||
|
on(event: 'ready', listener: () => void): this; |
||||||
|
on(event: 'timeout', listener: () => void): this; |
||||||
|
once(event: string, listener: (...args: any[]) => void): this; |
||||||
|
once(event: 'close', listener: (hadError: boolean) => void): this; |
||||||
|
once(event: 'connect', listener: () => void): this; |
||||||
|
once(event: 'data', listener: (data: Buffer) => void): this; |
||||||
|
once(event: 'drain', listener: () => void): this; |
||||||
|
once(event: 'end', listener: () => void): this; |
||||||
|
once(event: 'error', listener: (err: Error) => void): this; |
||||||
|
once(event: 'lookup', listener: (err: Error, address: string, family: string | number, host: string) => void): this; |
||||||
|
once(event: 'ready', listener: () => void): this; |
||||||
|
once(event: 'timeout', listener: () => void): this; |
||||||
|
prependListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
prependListener(event: 'close', listener: (hadError: boolean) => void): this; |
||||||
|
prependListener(event: 'connect', listener: () => void): this; |
||||||
|
prependListener(event: 'data', listener: (data: Buffer) => void): this; |
||||||
|
prependListener(event: 'drain', listener: () => void): this; |
||||||
|
prependListener(event: 'end', listener: () => void): this; |
||||||
|
prependListener(event: 'error', listener: (err: Error) => void): this; |
||||||
|
prependListener(event: 'lookup', listener: (err: Error, address: string, family: string | number, host: string) => void): this; |
||||||
|
prependListener(event: 'ready', listener: () => void): this; |
||||||
|
prependListener(event: 'timeout', listener: () => void): this; |
||||||
|
prependOnceListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
prependOnceListener(event: 'close', listener: (hadError: boolean) => void): this; |
||||||
|
prependOnceListener(event: 'connect', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'data', listener: (data: Buffer) => void): this; |
||||||
|
prependOnceListener(event: 'drain', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'end', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'error', listener: (err: Error) => void): this; |
||||||
|
prependOnceListener(event: 'lookup', listener: (err: Error, address: string, family: string | number, host: string) => void): this; |
||||||
|
prependOnceListener(event: 'ready', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'timeout', listener: () => void): this; |
||||||
|
} |
||||||
|
interface ListenOptions extends Abortable { |
||||||
|
port?: number | undefined; |
||||||
|
host?: string | undefined; |
||||||
|
backlog?: number | undefined; |
||||||
|
path?: string | undefined; |
||||||
|
exclusive?: boolean | undefined; |
||||||
|
readableAll?: boolean | undefined; |
||||||
|
writableAll?: boolean | undefined; |
||||||
|
/** |
||||||
|
* @default false |
||||||
|
*/ |
||||||
|
ipv6Only?: boolean | undefined; |
||||||
|
} |
||||||
|
interface ServerOpts { |
||||||
|
/** |
||||||
|
* Indicates whether half-opened TCP connections are allowed. |
||||||
|
* @default false |
||||||
|
*/ |
||||||
|
allowHalfOpen?: boolean | undefined; |
||||||
|
/** |
||||||
|
* Indicates whether the socket should be paused on incoming connections. |
||||||
|
* @default false |
||||||
|
*/ |
||||||
|
pauseOnConnect?: boolean | undefined; |
||||||
|
} |
||||||
|
/** |
||||||
|
* This class is used to create a TCP or `IPC` server. |
||||||
|
* @since v0.1.90 |
||||||
|
*/ |
||||||
|
class Server extends EventEmitter { |
||||||
|
constructor(connectionListener?: (socket: Socket) => void); |
||||||
|
constructor(options?: ServerOpts, connectionListener?: (socket: Socket) => void); |
||||||
|
/** |
||||||
|
* Start a server listening for connections. A `net.Server` can be a TCP or |
||||||
|
* an `IPC` server depending on what it listens to. |
||||||
|
* |
||||||
|
* Possible signatures: |
||||||
|
* |
||||||
|
* * `server.listen(handle[, backlog][, callback])` |
||||||
|
* * `server.listen(options[, callback])` |
||||||
|
* * `server.listen(path[, backlog][, callback])` for `IPC` servers |
||||||
|
* * `server.listen([port[, host[, backlog]]][, callback])` for TCP servers |
||||||
|
* |
||||||
|
* This function is asynchronous. When the server starts listening, the `'listening'` event will be emitted. The last parameter `callback`will be added as a listener for the `'listening'` |
||||||
|
* event. |
||||||
|
* |
||||||
|
* All `listen()` methods can take a `backlog` parameter to specify the maximum |
||||||
|
* length of the queue of pending connections. The actual length will be determined |
||||||
|
* by the OS through sysctl settings such as `tcp_max_syn_backlog` and `somaxconn`on Linux. The default value of this parameter is 511 (not 512). |
||||||
|
* |
||||||
|
* All {@link Socket} are set to `SO_REUSEADDR` (see [`socket(7)`](https://man7.org/linux/man-pages/man7/socket.7.html) for
|
||||||
|
* details). |
||||||
|
* |
||||||
|
* The `server.listen()` method can be called again if and only if there was an |
||||||
|
* error during the first `server.listen()` call or `server.close()` has been |
||||||
|
* called. Otherwise, an `ERR_SERVER_ALREADY_LISTEN` error will be thrown. |
||||||
|
* |
||||||
|
* One of the most common errors raised when listening is `EADDRINUSE`. |
||||||
|
* This happens when another server is already listening on the requested`port`/`path`/`handle`. One way to handle this would be to retry |
||||||
|
* after a certain amount of time: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* server.on('error', (e) => { |
||||||
|
* if (e.code === 'EADDRINUSE') { |
||||||
|
* console.log('Address in use, retrying...'); |
||||||
|
* setTimeout(() => { |
||||||
|
* server.close(); |
||||||
|
* server.listen(PORT, HOST); |
||||||
|
* }, 1000); |
||||||
|
* } |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
*/ |
||||||
|
listen(port?: number, hostname?: string, backlog?: number, listeningListener?: () => void): this; |
||||||
|
listen(port?: number, hostname?: string, listeningListener?: () => void): this; |
||||||
|
listen(port?: number, backlog?: number, listeningListener?: () => void): this; |
||||||
|
listen(port?: number, listeningListener?: () => void): this; |
||||||
|
listen(path: string, backlog?: number, listeningListener?: () => void): this; |
||||||
|
listen(path: string, listeningListener?: () => void): this; |
||||||
|
listen(options: ListenOptions, listeningListener?: () => void): this; |
||||||
|
listen(handle: any, backlog?: number, listeningListener?: () => void): this; |
||||||
|
listen(handle: any, listeningListener?: () => void): this; |
||||||
|
/** |
||||||
|
* Stops the server from accepting new connections and keeps existing |
||||||
|
* connections. This function is asynchronous, the server is finally closed |
||||||
|
* when all connections are ended and the server emits a `'close'` event. |
||||||
|
* The optional `callback` will be called once the `'close'` event occurs. Unlike |
||||||
|
* that event, it will be called with an `Error` as its only argument if the server |
||||||
|
* was not open when it was closed. |
||||||
|
* @since v0.1.90 |
||||||
|
* @param callback Called when the server is closed. |
||||||
|
*/ |
||||||
|
close(callback?: (err?: Error) => void): this; |
||||||
|
/** |
||||||
|
* Returns the bound `address`, the address `family` name, and `port` of the server |
||||||
|
* as reported by the operating system if listening on an IP socket |
||||||
|
* (useful to find which port was assigned when getting an OS-assigned address):`{ port: 12346, family: 'IPv4', address: '127.0.0.1' }`. |
||||||
|
* |
||||||
|
* For a server listening on a pipe or Unix domain socket, the name is returned |
||||||
|
* as a string. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const server = net.createServer((socket) => { |
||||||
|
* socket.end('goodbye\n'); |
||||||
|
* }).on('error', (err) => { |
||||||
|
* // Handle errors here.
|
||||||
|
* throw err; |
||||||
|
* }); |
||||||
|
* |
||||||
|
* // Grab an arbitrary unused port.
|
||||||
|
* server.listen(() => { |
||||||
|
* console.log('opened server on', server.address()); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* `server.address()` returns `null` before the `'listening'` event has been |
||||||
|
* emitted or after calling `server.close()`. |
||||||
|
* @since v0.1.90 |
||||||
|
*/ |
||||||
|
address(): AddressInfo | string | null; |
||||||
|
/** |
||||||
|
* Asynchronously get the number of concurrent connections on the server. Works |
||||||
|
* when sockets were sent to forks. |
||||||
|
* |
||||||
|
* Callback should take two arguments `err` and `count`. |
||||||
|
* @since v0.9.7 |
||||||
|
*/ |
||||||
|
getConnections(cb: (error: Error | null, count: number) => void): void; |
||||||
|
/** |
||||||
|
* Opposite of `unref()`, calling `ref()` on a previously `unref`ed server will _not_ let the program exit if it's the only server left (the default behavior). |
||||||
|
* If the server is `ref`ed calling `ref()` again will have no effect. |
||||||
|
* @since v0.9.1 |
||||||
|
*/ |
||||||
|
ref(): this; |
||||||
|
/** |
||||||
|
* Calling `unref()` on a server will allow the program to exit if this is the only |
||||||
|
* active server in the event system. If the server is already `unref`ed calling`unref()` again will have no effect. |
||||||
|
* @since v0.9.1 |
||||||
|
*/ |
||||||
|
unref(): this; |
||||||
|
/** |
||||||
|
* Set this property to reject connections when the server's connection count gets |
||||||
|
* high. |
||||||
|
* |
||||||
|
* It is not recommended to use this option once a socket has been sent to a child |
||||||
|
* with `child_process.fork()`. |
||||||
|
* @since v0.2.0 |
||||||
|
*/ |
||||||
|
maxConnections: number; |
||||||
|
connections: number; |
||||||
|
/** |
||||||
|
* Indicates whether or not the server is listening for connections. |
||||||
|
* @since v5.7.0 |
||||||
|
*/ |
||||||
|
listening: boolean; |
||||||
|
/** |
||||||
|
* events.EventEmitter |
||||||
|
* 1. close |
||||||
|
* 2. connection |
||||||
|
* 3. error |
||||||
|
* 4. listening |
||||||
|
*/ |
||||||
|
addListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
addListener(event: 'close', listener: () => void): this; |
||||||
|
addListener(event: 'connection', listener: (socket: Socket) => void): this; |
||||||
|
addListener(event: 'error', listener: (err: Error) => void): this; |
||||||
|
addListener(event: 'listening', listener: () => void): this; |
||||||
|
emit(event: string | symbol, ...args: any[]): boolean; |
||||||
|
emit(event: 'close'): boolean; |
||||||
|
emit(event: 'connection', socket: Socket): boolean; |
||||||
|
emit(event: 'error', err: Error): boolean; |
||||||
|
emit(event: 'listening'): boolean; |
||||||
|
on(event: string, listener: (...args: any[]) => void): this; |
||||||
|
on(event: 'close', listener: () => void): this; |
||||||
|
on(event: 'connection', listener: (socket: Socket) => void): this; |
||||||
|
on(event: 'error', listener: (err: Error) => void): this; |
||||||
|
on(event: 'listening', listener: () => void): this; |
||||||
|
once(event: string, listener: (...args: any[]) => void): this; |
||||||
|
once(event: 'close', listener: () => void): this; |
||||||
|
once(event: 'connection', listener: (socket: Socket) => void): this; |
||||||
|
once(event: 'error', listener: (err: Error) => void): this; |
||||||
|
once(event: 'listening', listener: () => void): this; |
||||||
|
prependListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
prependListener(event: 'close', listener: () => void): this; |
||||||
|
prependListener(event: 'connection', listener: (socket: Socket) => void): this; |
||||||
|
prependListener(event: 'error', listener: (err: Error) => void): this; |
||||||
|
prependListener(event: 'listening', listener: () => void): this; |
||||||
|
prependOnceListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
prependOnceListener(event: 'close', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'connection', listener: (socket: Socket) => void): this; |
||||||
|
prependOnceListener(event: 'error', listener: (err: Error) => void): this; |
||||||
|
prependOnceListener(event: 'listening', listener: () => void): this; |
||||||
|
} |
||||||
|
type IPVersion = 'ipv4' | 'ipv6'; |
||||||
|
/** |
||||||
|
* The `BlockList` object can be used with some network APIs to specify rules for |
||||||
|
* disabling inbound or outbound access to specific IP addresses, IP ranges, or |
||||||
|
* IP subnets. |
||||||
|
* @since v15.0.0, v14.18.0 |
||||||
|
*/ |
||||||
|
class BlockList { |
||||||
|
/** |
||||||
|
* Adds a rule to block the given IP address. |
||||||
|
* @since v15.0.0, v14.18.0 |
||||||
|
* @param address An IPv4 or IPv6 address. |
||||||
|
* @param [type='ipv4'] Either `'ipv4'` or `'ipv6'`. |
||||||
|
*/ |
||||||
|
addAddress(address: string, type?: IPVersion): void; |
||||||
|
addAddress(address: SocketAddress): void; |
||||||
|
/** |
||||||
|
* Adds a rule to block a range of IP addresses from `start` (inclusive) to`end` (inclusive). |
||||||
|
* @since v15.0.0, v14.18.0 |
||||||
|
* @param start The starting IPv4 or IPv6 address in the range. |
||||||
|
* @param end The ending IPv4 or IPv6 address in the range. |
||||||
|
* @param [type='ipv4'] Either `'ipv4'` or `'ipv6'`. |
||||||
|
*/ |
||||||
|
addRange(start: string, end: string, type?: IPVersion): void; |
||||||
|
addRange(start: SocketAddress, end: SocketAddress): void; |
||||||
|
/** |
||||||
|
* Adds a rule to block a range of IP addresses specified as a subnet mask. |
||||||
|
* @since v15.0.0, v14.18.0 |
||||||
|
* @param net The network IPv4 or IPv6 address. |
||||||
|
* @param prefix The number of CIDR prefix bits. For IPv4, this must be a value between `0` and `32`. For IPv6, this must be between `0` and `128`. |
||||||
|
* @param [type='ipv4'] Either `'ipv4'` or `'ipv6'`. |
||||||
|
*/ |
||||||
|
addSubnet(net: SocketAddress, prefix: number): void; |
||||||
|
addSubnet(net: string, prefix: number, type?: IPVersion): void; |
||||||
|
/** |
||||||
|
* Returns `true` if the given IP address matches any of the rules added to the`BlockList`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const blockList = new net.BlockList(); |
||||||
|
* blockList.addAddress('123.123.123.123'); |
||||||
|
* blockList.addRange('10.0.0.1', '10.0.0.10'); |
||||||
|
* blockList.addSubnet('8592:757c:efae:4e45::', 64, 'ipv6'); |
||||||
|
* |
||||||
|
* console.log(blockList.check('123.123.123.123')); // Prints: true
|
||||||
|
* console.log(blockList.check('10.0.0.3')); // Prints: true
|
||||||
|
* console.log(blockList.check('222.111.111.222')); // Prints: false
|
||||||
|
* |
||||||
|
* // IPv6 notation for IPv4 addresses works:
|
||||||
|
* console.log(blockList.check('::ffff:7b7b:7b7b', 'ipv6')); // Prints: true
|
||||||
|
* console.log(blockList.check('::ffff:123.123.123.123', 'ipv6')); // Prints: true
|
||||||
|
* ``` |
||||||
|
* @since v15.0.0, v14.18.0 |
||||||
|
* @param address The IP address to check |
||||||
|
* @param [type='ipv4'] Either `'ipv4'` or `'ipv6'`. |
||||||
|
*/ |
||||||
|
check(address: SocketAddress): boolean; |
||||||
|
check(address: string, type?: IPVersion): boolean; |
||||||
|
} |
||||||
|
interface TcpNetConnectOpts extends TcpSocketConnectOpts, SocketConstructorOpts { |
||||||
|
timeout?: number | undefined; |
||||||
|
} |
||||||
|
interface IpcNetConnectOpts extends IpcSocketConnectOpts, SocketConstructorOpts { |
||||||
|
timeout?: number | undefined; |
||||||
|
} |
||||||
|
type NetConnectOpts = TcpNetConnectOpts | IpcNetConnectOpts; |
||||||
|
/** |
||||||
|
* Creates a new TCP or `IPC` server. |
||||||
|
* |
||||||
|
* If `allowHalfOpen` is set to `true`, when the other end of the socket |
||||||
|
* signals the end of transmission, the server will only send back the end of |
||||||
|
* transmission when `socket.end()` is explicitly called. For example, in the |
||||||
|
* context of TCP, when a FIN packed is received, a FIN packed is sent |
||||||
|
* back only when `socket.end()` is explicitly called. Until then the |
||||||
|
* connection is half-closed (non-readable but still writable). See `'end'` event and [RFC 1122](https://tools.ietf.org/html/rfc1122) (section 4.2.2.13) for more information.
|
||||||
|
* |
||||||
|
* If `pauseOnConnect` is set to `true`, then the socket associated with each |
||||||
|
* incoming connection will be paused, and no data will be read from its handle. |
||||||
|
* This allows connections to be passed between processes without any data being |
||||||
|
* read by the original process. To begin reading data from a paused socket, call `socket.resume()`. |
||||||
|
* |
||||||
|
* The server can be a TCP server or an `IPC` server, depending on what it `listen()` to. |
||||||
|
* |
||||||
|
* Here is an example of a TCP echo server which listens for connections |
||||||
|
* on port 8124: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const net = require('net'); |
||||||
|
* const server = net.createServer((c) => { |
||||||
|
* // 'connection' listener.
|
||||||
|
* console.log('client connected'); |
||||||
|
* c.on('end', () => { |
||||||
|
* console.log('client disconnected'); |
||||||
|
* }); |
||||||
|
* c.write('hello\r\n'); |
||||||
|
* c.pipe(c); |
||||||
|
* }); |
||||||
|
* server.on('error', (err) => { |
||||||
|
* throw err; |
||||||
|
* }); |
||||||
|
* server.listen(8124, () => { |
||||||
|
* console.log('server bound'); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Test this by using `telnet`: |
||||||
|
* |
||||||
|
* ```console
|
||||||
|
* $ telnet localhost 8124 |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* To listen on the socket `/tmp/echo.sock`: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* server.listen('/tmp/echo.sock', () => { |
||||||
|
* console.log('server bound'); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Use `nc` to connect to a Unix domain socket server: |
||||||
|
* |
||||||
|
* ```console
|
||||||
|
* $ nc -U /tmp/echo.sock |
||||||
|
* ``` |
||||||
|
* @since v0.5.0 |
||||||
|
* @param connectionListener Automatically set as a listener for the {@link 'connection'} event. |
||||||
|
*/ |
||||||
|
function createServer(connectionListener?: (socket: Socket) => void): Server; |
||||||
|
function createServer(options?: ServerOpts, connectionListener?: (socket: Socket) => void): Server; |
||||||
|
/** |
||||||
|
* Aliases to {@link createConnection}. |
||||||
|
* |
||||||
|
* Possible signatures: |
||||||
|
* |
||||||
|
* * {@link connect} |
||||||
|
* * {@link connect} for `IPC` connections. |
||||||
|
* * {@link connect} for TCP connections. |
||||||
|
*/ |
||||||
|
function connect(options: NetConnectOpts, connectionListener?: () => void): Socket; |
||||||
|
function connect(port: number, host?: string, connectionListener?: () => void): Socket; |
||||||
|
function connect(path: string, connectionListener?: () => void): Socket; |
||||||
|
/** |
||||||
|
* A factory function, which creates a new {@link Socket}, |
||||||
|
* immediately initiates connection with `socket.connect()`, |
||||||
|
* then returns the `net.Socket` that starts the connection. |
||||||
|
* |
||||||
|
* When the connection is established, a `'connect'` event will be emitted |
||||||
|
* on the returned socket. The last parameter `connectListener`, if supplied, |
||||||
|
* will be added as a listener for the `'connect'` event **once**. |
||||||
|
* |
||||||
|
* Possible signatures: |
||||||
|
* |
||||||
|
* * {@link createConnection} |
||||||
|
* * {@link createConnection} for `IPC` connections. |
||||||
|
* * {@link createConnection} for TCP connections. |
||||||
|
* |
||||||
|
* The {@link connect} function is an alias to this function. |
||||||
|
*/ |
||||||
|
function createConnection(options: NetConnectOpts, connectionListener?: () => void): Socket; |
||||||
|
function createConnection(port: number, host?: string, connectionListener?: () => void): Socket; |
||||||
|
function createConnection(path: string, connectionListener?: () => void): Socket; |
||||||
|
/** |
||||||
|
* Returns `6` if `input` is an IPv6 address. Returns `4` if `input` is an IPv4 |
||||||
|
* address in [dot-decimal notation](https://en.wikipedia.org/wiki/Dot-decimal_notation) with no leading zeroes. Otherwise, returns`0`.
|
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* net.isIP('::1'); // returns 6
|
||||||
|
* net.isIP('127.0.0.1'); // returns 4
|
||||||
|
* net.isIP('127.000.000.001'); // returns 0
|
||||||
|
* net.isIP('127.0.0.1/24'); // returns 0
|
||||||
|
* net.isIP('fhqwhgads'); // returns 0
|
||||||
|
* ``` |
||||||
|
* @since v0.3.0 |
||||||
|
*/ |
||||||
|
function isIP(input: string): number; |
||||||
|
/** |
||||||
|
* Returns `true` if `input` is an IPv4 address in [dot-decimal notation](https://en.wikipedia.org/wiki/Dot-decimal_notation) with no
|
||||||
|
* leading zeroes. Otherwise, returns `false`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* net.isIPv4('127.0.0.1'); // returns true
|
||||||
|
* net.isIPv4('127.000.000.001'); // returns false
|
||||||
|
* net.isIPv4('127.0.0.1/24'); // returns false
|
||||||
|
* net.isIPv4('fhqwhgads'); // returns false
|
||||||
|
* ``` |
||||||
|
* @since v0.3.0 |
||||||
|
*/ |
||||||
|
function isIPv4(input: string): boolean; |
||||||
|
/** |
||||||
|
* Returns `true` if `input` is an IPv6 address. Otherwise, returns `false`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* net.isIPv6('::1'); // returns true
|
||||||
|
* net.isIPv6('fhqwhgads'); // returns false
|
||||||
|
* ``` |
||||||
|
* @since v0.3.0 |
||||||
|
*/ |
||||||
|
function isIPv6(input: string): boolean; |
||||||
|
interface SocketAddressInitOptions { |
||||||
|
/** |
||||||
|
* The network address as either an IPv4 or IPv6 string. |
||||||
|
* @default 127.0.0.1 |
||||||
|
*/ |
||||||
|
address?: string | undefined; |
||||||
|
/** |
||||||
|
* @default `'ipv4'` |
||||||
|
*/ |
||||||
|
family?: IPVersion | undefined; |
||||||
|
/** |
||||||
|
* An IPv6 flow-label used only if `family` is `'ipv6'`. |
||||||
|
* @default 0 |
||||||
|
*/ |
||||||
|
flowlabel?: number | undefined; |
||||||
|
/** |
||||||
|
* An IP port. |
||||||
|
* @default 0 |
||||||
|
*/ |
||||||
|
port?: number | undefined; |
||||||
|
} |
||||||
|
/** |
||||||
|
* @since v15.14.0, v14.18.0 |
||||||
|
*/ |
||||||
|
class SocketAddress { |
||||||
|
constructor(options: SocketAddressInitOptions); |
||||||
|
/** |
||||||
|
* Either \`'ipv4'\` or \`'ipv6'\`.
|
||||||
|
* @since v15.14.0, v14.18.0 |
||||||
|
*/ |
||||||
|
readonly address: string; |
||||||
|
/** |
||||||
|
* Either \`'ipv4'\` or \`'ipv6'\`.
|
||||||
|
* @since v15.14.0, v14.18.0 |
||||||
|
*/ |
||||||
|
readonly family: IPVersion; |
||||||
|
/** |
||||||
|
* @since v15.14.0, v14.18.0 |
||||||
|
*/ |
||||||
|
readonly port: number; |
||||||
|
/** |
||||||
|
* @since v15.14.0, v14.18.0 |
||||||
|
*/ |
||||||
|
readonly flowlabel: number; |
||||||
|
} |
||||||
|
} |
||||||
|
declare module 'node:net' { |
||||||
|
export * from 'net'; |
||||||
|
} |
@ -0,0 +1,456 @@ |
|||||||
|
/** |
||||||
|
* The `os` module provides operating system-related utility methods and |
||||||
|
* properties. It can be accessed using: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const os = require('os'); |
||||||
|
* ``` |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/os.js)
|
||||||
|
*/ |
||||||
|
declare module 'os' { |
||||||
|
interface CpuInfo { |
||||||
|
model: string; |
||||||
|
speed: number; |
||||||
|
times: { |
||||||
|
user: number; |
||||||
|
nice: number; |
||||||
|
sys: number; |
||||||
|
idle: number; |
||||||
|
irq: number; |
||||||
|
}; |
||||||
|
} |
||||||
|
interface NetworkInterfaceBase { |
||||||
|
address: string; |
||||||
|
netmask: string; |
||||||
|
mac: string; |
||||||
|
internal: boolean; |
||||||
|
cidr: string | null; |
||||||
|
} |
||||||
|
interface NetworkInterfaceInfoIPv4 extends NetworkInterfaceBase { |
||||||
|
family: 'IPv4'; |
||||||
|
} |
||||||
|
interface NetworkInterfaceInfoIPv6 extends NetworkInterfaceBase { |
||||||
|
family: 'IPv6'; |
||||||
|
scopeid: number; |
||||||
|
} |
||||||
|
interface UserInfo<T> { |
||||||
|
username: T; |
||||||
|
uid: number; |
||||||
|
gid: number; |
||||||
|
shell: T; |
||||||
|
homedir: T; |
||||||
|
} |
||||||
|
type NetworkInterfaceInfo = NetworkInterfaceInfoIPv4 | NetworkInterfaceInfoIPv6; |
||||||
|
/** |
||||||
|
* Returns the host name of the operating system as a string. |
||||||
|
* @since v0.3.3 |
||||||
|
*/ |
||||||
|
function hostname(): string; |
||||||
|
/** |
||||||
|
* Returns an array containing the 1, 5, and 15 minute load averages. |
||||||
|
* |
||||||
|
* The load average is a measure of system activity calculated by the operating |
||||||
|
* system and expressed as a fractional number. |
||||||
|
* |
||||||
|
* The load average is a Unix-specific concept. On Windows, the return value is |
||||||
|
* always `[0, 0, 0]`. |
||||||
|
* @since v0.3.3 |
||||||
|
*/ |
||||||
|
function loadavg(): number[]; |
||||||
|
/** |
||||||
|
* Returns the system uptime in number of seconds. |
||||||
|
* @since v0.3.3 |
||||||
|
*/ |
||||||
|
function uptime(): number; |
||||||
|
/** |
||||||
|
* Returns the amount of free system memory in bytes as an integer. |
||||||
|
* @since v0.3.3 |
||||||
|
*/ |
||||||
|
function freemem(): number; |
||||||
|
/** |
||||||
|
* Returns the total amount of system memory in bytes as an integer. |
||||||
|
* @since v0.3.3 |
||||||
|
*/ |
||||||
|
function totalmem(): number; |
||||||
|
/** |
||||||
|
* Returns an array of objects containing information about each logical CPU core. |
||||||
|
* |
||||||
|
* The properties included on each object include: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* [ |
||||||
|
* { |
||||||
|
* model: 'Intel(R) Core(TM) i7 CPU 860 @ 2.80GHz', |
||||||
|
* speed: 2926, |
||||||
|
* times: { |
||||||
|
* user: 252020, |
||||||
|
* nice: 0, |
||||||
|
* sys: 30340, |
||||||
|
* idle: 1070356870, |
||||||
|
* irq: 0 |
||||||
|
* } |
||||||
|
* }, |
||||||
|
* { |
||||||
|
* model: 'Intel(R) Core(TM) i7 CPU 860 @ 2.80GHz', |
||||||
|
* speed: 2926, |
||||||
|
* times: { |
||||||
|
* user: 306960, |
||||||
|
* nice: 0, |
||||||
|
* sys: 26980, |
||||||
|
* idle: 1071569080, |
||||||
|
* irq: 0 |
||||||
|
* } |
||||||
|
* }, |
||||||
|
* { |
||||||
|
* model: 'Intel(R) Core(TM) i7 CPU 860 @ 2.80GHz', |
||||||
|
* speed: 2926, |
||||||
|
* times: { |
||||||
|
* user: 248450, |
||||||
|
* nice: 0, |
||||||
|
* sys: 21750, |
||||||
|
* idle: 1070919370, |
||||||
|
* irq: 0 |
||||||
|
* } |
||||||
|
* }, |
||||||
|
* { |
||||||
|
* model: 'Intel(R) Core(TM) i7 CPU 860 @ 2.80GHz', |
||||||
|
* speed: 2926, |
||||||
|
* times: { |
||||||
|
* user: 256880, |
||||||
|
* nice: 0, |
||||||
|
* sys: 19430, |
||||||
|
* idle: 1070905480, |
||||||
|
* irq: 20 |
||||||
|
* } |
||||||
|
* }, |
||||||
|
* ] |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* `nice` values are POSIX-only. On Windows, the `nice` values of all processors |
||||||
|
* are always 0. |
||||||
|
* @since v0.3.3 |
||||||
|
*/ |
||||||
|
function cpus(): CpuInfo[]; |
||||||
|
/** |
||||||
|
* Returns the operating system name as returned by [`uname(3)`](https://linux.die.net/man/3/uname). For example, it
|
||||||
|
* returns `'Linux'` on Linux, `'Darwin'` on macOS, and `'Windows_NT'` on Windows. |
||||||
|
* |
||||||
|
* See [https://en.wikipedia.org/wiki/Uname#Examples](https://en.wikipedia.org/wiki/Uname#Examples) for additional information
|
||||||
|
* about the output of running [`uname(3)`](https://linux.die.net/man/3/uname) on various operating systems.
|
||||||
|
* @since v0.3.3 |
||||||
|
*/ |
||||||
|
function type(): string; |
||||||
|
/** |
||||||
|
* Returns the operating system as a string. |
||||||
|
* |
||||||
|
* On POSIX systems, the operating system release is determined by calling [`uname(3)`](https://linux.die.net/man/3/uname). On Windows, `GetVersionExW()` is used. See
|
||||||
|
* [https://en.wikipedia.org/wiki/Uname#Examples](https://en.wikipedia.org/wiki/Uname#Examples) for more information.
|
||||||
|
* @since v0.3.3 |
||||||
|
*/ |
||||||
|
function release(): string; |
||||||
|
/** |
||||||
|
* Returns an object containing network interfaces that have been assigned a |
||||||
|
* network address. |
||||||
|
* |
||||||
|
* Each key on the returned object identifies a network interface. The associated |
||||||
|
* value is an array of objects that each describe an assigned network address. |
||||||
|
* |
||||||
|
* The properties available on the assigned network address object include: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* { |
||||||
|
* lo: [ |
||||||
|
* { |
||||||
|
* address: '127.0.0.1', |
||||||
|
* netmask: '255.0.0.0', |
||||||
|
* family: 'IPv4', |
||||||
|
* mac: '00:00:00:00:00:00', |
||||||
|
* internal: true, |
||||||
|
* cidr: '127.0.0.1/8' |
||||||
|
* }, |
||||||
|
* { |
||||||
|
* address: '::1', |
||||||
|
* netmask: 'ffff:ffff:ffff:ffff:ffff:ffff:ffff:ffff', |
||||||
|
* family: 'IPv6', |
||||||
|
* mac: '00:00:00:00:00:00', |
||||||
|
* scopeid: 0, |
||||||
|
* internal: true, |
||||||
|
* cidr: '::1/128' |
||||||
|
* } |
||||||
|
* ], |
||||||
|
* eth0: [ |
||||||
|
* { |
||||||
|
* address: '192.168.1.108', |
||||||
|
* netmask: '255.255.255.0', |
||||||
|
* family: 'IPv4', |
||||||
|
* mac: '01:02:03:0a:0b:0c', |
||||||
|
* internal: false, |
||||||
|
* cidr: '192.168.1.108/24' |
||||||
|
* }, |
||||||
|
* { |
||||||
|
* address: 'fe80::a00:27ff:fe4e:66a1', |
||||||
|
* netmask: 'ffff:ffff:ffff:ffff::', |
||||||
|
* family: 'IPv6', |
||||||
|
* mac: '01:02:03:0a:0b:0c', |
||||||
|
* scopeid: 1, |
||||||
|
* internal: false, |
||||||
|
* cidr: 'fe80::a00:27ff:fe4e:66a1/64' |
||||||
|
* } |
||||||
|
* ] |
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v0.6.0 |
||||||
|
*/ |
||||||
|
function networkInterfaces(): NodeJS.Dict<NetworkInterfaceInfo[]>; |
||||||
|
/** |
||||||
|
* Returns the string path of the current user's home directory. |
||||||
|
* |
||||||
|
* On POSIX, it uses the `$HOME` environment variable if defined. Otherwise it |
||||||
|
* uses the [effective UID](https://en.wikipedia.org/wiki/User_identifier#Effective_user_ID) to look up the user's home directory.
|
||||||
|
* |
||||||
|
* On Windows, it uses the `USERPROFILE` environment variable if defined. |
||||||
|
* Otherwise it uses the path to the profile directory of the current user. |
||||||
|
* @since v2.3.0 |
||||||
|
*/ |
||||||
|
function homedir(): string; |
||||||
|
/** |
||||||
|
* Returns information about the currently effective user. On POSIX platforms, |
||||||
|
* this is typically a subset of the password file. The returned object includes |
||||||
|
* the `username`, `uid`, `gid`, `shell`, and `homedir`. On Windows, the `uid` and`gid` fields are `-1`, and `shell` is `null`. |
||||||
|
* |
||||||
|
* The value of `homedir` returned by `os.userInfo()` is provided by the operating |
||||||
|
* system. This differs from the result of `os.homedir()`, which queries |
||||||
|
* environment variables for the home directory before falling back to the |
||||||
|
* operating system response. |
||||||
|
* |
||||||
|
* Throws a `SystemError` if a user has no `username` or `homedir`. |
||||||
|
* @since v6.0.0 |
||||||
|
*/ |
||||||
|
function userInfo(options: { encoding: 'buffer' }): UserInfo<Buffer>; |
||||||
|
function userInfo(options?: { encoding: BufferEncoding }): UserInfo<string>; |
||||||
|
type SignalConstants = { |
||||||
|
[key in NodeJS.Signals]: number; |
||||||
|
}; |
||||||
|
namespace constants { |
||||||
|
const UV_UDP_REUSEADDR: number; |
||||||
|
namespace signals {} |
||||||
|
const signals: SignalConstants; |
||||||
|
namespace errno { |
||||||
|
const E2BIG: number; |
||||||
|
const EACCES: number; |
||||||
|
const EADDRINUSE: number; |
||||||
|
const EADDRNOTAVAIL: number; |
||||||
|
const EAFNOSUPPORT: number; |
||||||
|
const EAGAIN: number; |
||||||
|
const EALREADY: number; |
||||||
|
const EBADF: number; |
||||||
|
const EBADMSG: number; |
||||||
|
const EBUSY: number; |
||||||
|
const ECANCELED: number; |
||||||
|
const ECHILD: number; |
||||||
|
const ECONNABORTED: number; |
||||||
|
const ECONNREFUSED: number; |
||||||
|
const ECONNRESET: number; |
||||||
|
const EDEADLK: number; |
||||||
|
const EDESTADDRREQ: number; |
||||||
|
const EDOM: number; |
||||||
|
const EDQUOT: number; |
||||||
|
const EEXIST: number; |
||||||
|
const EFAULT: number; |
||||||
|
const EFBIG: number; |
||||||
|
const EHOSTUNREACH: number; |
||||||
|
const EIDRM: number; |
||||||
|
const EILSEQ: number; |
||||||
|
const EINPROGRESS: number; |
||||||
|
const EINTR: number; |
||||||
|
const EINVAL: number; |
||||||
|
const EIO: number; |
||||||
|
const EISCONN: number; |
||||||
|
const EISDIR: number; |
||||||
|
const ELOOP: number; |
||||||
|
const EMFILE: number; |
||||||
|
const EMLINK: number; |
||||||
|
const EMSGSIZE: number; |
||||||
|
const EMULTIHOP: number; |
||||||
|
const ENAMETOOLONG: number; |
||||||
|
const ENETDOWN: number; |
||||||
|
const ENETRESET: number; |
||||||
|
const ENETUNREACH: number; |
||||||
|
const ENFILE: number; |
||||||
|
const ENOBUFS: number; |
||||||
|
const ENODATA: number; |
||||||
|
const ENODEV: number; |
||||||
|
const ENOENT: number; |
||||||
|
const ENOEXEC: number; |
||||||
|
const ENOLCK: number; |
||||||
|
const ENOLINK: number; |
||||||
|
const ENOMEM: number; |
||||||
|
const ENOMSG: number; |
||||||
|
const ENOPROTOOPT: number; |
||||||
|
const ENOSPC: number; |
||||||
|
const ENOSR: number; |
||||||
|
const ENOSTR: number; |
||||||
|
const ENOSYS: number; |
||||||
|
const ENOTCONN: number; |
||||||
|
const ENOTDIR: number; |
||||||
|
const ENOTEMPTY: number; |
||||||
|
const ENOTSOCK: number; |
||||||
|
const ENOTSUP: number; |
||||||
|
const ENOTTY: number; |
||||||
|
const ENXIO: number; |
||||||
|
const EOPNOTSUPP: number; |
||||||
|
const EOVERFLOW: number; |
||||||
|
const EPERM: number; |
||||||
|
const EPIPE: number; |
||||||
|
const EPROTO: number; |
||||||
|
const EPROTONOSUPPORT: number; |
||||||
|
const EPROTOTYPE: number; |
||||||
|
const ERANGE: number; |
||||||
|
const EROFS: number; |
||||||
|
const ESPIPE: number; |
||||||
|
const ESRCH: number; |
||||||
|
const ESTALE: number; |
||||||
|
const ETIME: number; |
||||||
|
const ETIMEDOUT: number; |
||||||
|
const ETXTBSY: number; |
||||||
|
const EWOULDBLOCK: number; |
||||||
|
const EXDEV: number; |
||||||
|
const WSAEINTR: number; |
||||||
|
const WSAEBADF: number; |
||||||
|
const WSAEACCES: number; |
||||||
|
const WSAEFAULT: number; |
||||||
|
const WSAEINVAL: number; |
||||||
|
const WSAEMFILE: number; |
||||||
|
const WSAEWOULDBLOCK: number; |
||||||
|
const WSAEINPROGRESS: number; |
||||||
|
const WSAEALREADY: number; |
||||||
|
const WSAENOTSOCK: number; |
||||||
|
const WSAEDESTADDRREQ: number; |
||||||
|
const WSAEMSGSIZE: number; |
||||||
|
const WSAEPROTOTYPE: number; |
||||||
|
const WSAENOPROTOOPT: number; |
||||||
|
const WSAEPROTONOSUPPORT: number; |
||||||
|
const WSAESOCKTNOSUPPORT: number; |
||||||
|
const WSAEOPNOTSUPP: number; |
||||||
|
const WSAEPFNOSUPPORT: number; |
||||||
|
const WSAEAFNOSUPPORT: number; |
||||||
|
const WSAEADDRINUSE: number; |
||||||
|
const WSAEADDRNOTAVAIL: number; |
||||||
|
const WSAENETDOWN: number; |
||||||
|
const WSAENETUNREACH: number; |
||||||
|
const WSAENETRESET: number; |
||||||
|
const WSAECONNABORTED: number; |
||||||
|
const WSAECONNRESET: number; |
||||||
|
const WSAENOBUFS: number; |
||||||
|
const WSAEISCONN: number; |
||||||
|
const WSAENOTCONN: number; |
||||||
|
const WSAESHUTDOWN: number; |
||||||
|
const WSAETOOMANYREFS: number; |
||||||
|
const WSAETIMEDOUT: number; |
||||||
|
const WSAECONNREFUSED: number; |
||||||
|
const WSAELOOP: number; |
||||||
|
const WSAENAMETOOLONG: number; |
||||||
|
const WSAEHOSTDOWN: number; |
||||||
|
const WSAEHOSTUNREACH: number; |
||||||
|
const WSAENOTEMPTY: number; |
||||||
|
const WSAEPROCLIM: number; |
||||||
|
const WSAEUSERS: number; |
||||||
|
const WSAEDQUOT: number; |
||||||
|
const WSAESTALE: number; |
||||||
|
const WSAEREMOTE: number; |
||||||
|
const WSASYSNOTREADY: number; |
||||||
|
const WSAVERNOTSUPPORTED: number; |
||||||
|
const WSANOTINITIALISED: number; |
||||||
|
const WSAEDISCON: number; |
||||||
|
const WSAENOMORE: number; |
||||||
|
const WSAECANCELLED: number; |
||||||
|
const WSAEINVALIDPROCTABLE: number; |
||||||
|
const WSAEINVALIDPROVIDER: number; |
||||||
|
const WSAEPROVIDERFAILEDINIT: number; |
||||||
|
const WSASYSCALLFAILURE: number; |
||||||
|
const WSASERVICE_NOT_FOUND: number; |
||||||
|
const WSATYPE_NOT_FOUND: number; |
||||||
|
const WSA_E_NO_MORE: number; |
||||||
|
const WSA_E_CANCELLED: number; |
||||||
|
const WSAEREFUSED: number; |
||||||
|
} |
||||||
|
namespace priority { |
||||||
|
const PRIORITY_LOW: number; |
||||||
|
const PRIORITY_BELOW_NORMAL: number; |
||||||
|
const PRIORITY_NORMAL: number; |
||||||
|
const PRIORITY_ABOVE_NORMAL: number; |
||||||
|
const PRIORITY_HIGH: number; |
||||||
|
const PRIORITY_HIGHEST: number; |
||||||
|
} |
||||||
|
} |
||||||
|
const devNull: string; |
||||||
|
const EOL: string; |
||||||
|
/** |
||||||
|
* Returns the operating system CPU architecture for which the Node.js binary was |
||||||
|
* compiled. Possible values are `'arm'`, `'arm64'`, `'ia32'`, `'mips'`,`'mipsel'`, `'ppc'`, `'ppc64'`, `'s390'`, `'s390x'`, and `'x64'`. |
||||||
|
* |
||||||
|
* The return value is equivalent to `process.arch`. |
||||||
|
* @since v0.5.0 |
||||||
|
*/ |
||||||
|
function arch(): string; |
||||||
|
/** |
||||||
|
* Returns a string identifying the kernel version. |
||||||
|
* |
||||||
|
* On POSIX systems, the operating system release is determined by calling [`uname(3)`](https://linux.die.net/man/3/uname). On Windows, `RtlGetVersion()` is used, and if it is not
|
||||||
|
* available, `GetVersionExW()` will be used. See [https://en.wikipedia.org/wiki/Uname#Examples](https://en.wikipedia.org/wiki/Uname#Examples) for more information.
|
||||||
|
* @since v13.11.0, v12.17.0 |
||||||
|
*/ |
||||||
|
function version(): string; |
||||||
|
/** |
||||||
|
* Returns a string identifying the operating system platform for which |
||||||
|
* the Node.js binary was compiled. The value is set at compile time. |
||||||
|
* Possible values are `'aix'`, `'darwin'`, `'freebsd'`,`'linux'`,`'openbsd'`, `'sunos'`, and `'win32'`. |
||||||
|
* |
||||||
|
* The return value is equivalent to `process.platform`. |
||||||
|
* |
||||||
|
* The value `'android'` may also be returned if Node.js is built on the Android |
||||||
|
* operating system. [Android support is experimental](https://github.com/nodejs/node/blob/HEAD/BUILDING.md#androidandroid-based-devices-eg-firefox-os).
|
||||||
|
* @since v0.5.0 |
||||||
|
*/ |
||||||
|
function platform(): NodeJS.Platform; |
||||||
|
/** |
||||||
|
* Returns the operating system's default directory for temporary files as a |
||||||
|
* string. |
||||||
|
* @since v0.9.9 |
||||||
|
*/ |
||||||
|
function tmpdir(): string; |
||||||
|
/** |
||||||
|
* Returns a string identifying the endianness of the CPU for which the Node.js |
||||||
|
* binary was compiled. |
||||||
|
* |
||||||
|
* Possible values are `'BE'` for big endian and `'LE'` for little endian. |
||||||
|
* @since v0.9.4 |
||||||
|
*/ |
||||||
|
function endianness(): 'BE' | 'LE'; |
||||||
|
/** |
||||||
|
* Returns the scheduling priority for the process specified by `pid`. If `pid` is |
||||||
|
* not provided or is `0`, the priority of the current process is returned. |
||||||
|
* @since v10.10.0 |
||||||
|
* @param [pid=0] The process ID to retrieve scheduling priority for. |
||||||
|
*/ |
||||||
|
function getPriority(pid?: number): number; |
||||||
|
/** |
||||||
|
* Attempts to set the scheduling priority for the process specified by `pid`. If`pid` is not provided or is `0`, the process ID of the current process is used. |
||||||
|
* |
||||||
|
* The `priority` input must be an integer between `-20` (high priority) and `19`(low priority). Due to differences between Unix priority levels and Windows |
||||||
|
* priority classes, `priority` is mapped to one of six priority constants in`os.constants.priority`. When retrieving a process priority level, this range |
||||||
|
* mapping may cause the return value to be slightly different on Windows. To avoid |
||||||
|
* confusion, set `priority` to one of the priority constants. |
||||||
|
* |
||||||
|
* On Windows, setting priority to `PRIORITY_HIGHEST` requires elevated user |
||||||
|
* privileges. Otherwise the set priority will be silently reduced to`PRIORITY_HIGH`. |
||||||
|
* @since v10.10.0 |
||||||
|
* @param [pid=0] The process ID to set scheduling priority for. |
||||||
|
* @param priority The scheduling priority to assign to the process. |
||||||
|
*/ |
||||||
|
function setPriority(priority: number): void; |
||||||
|
function setPriority(pid: number, priority: number): void; |
||||||
|
} |
||||||
|
declare module 'node:os' { |
||||||
|
export * from 'os'; |
||||||
|
} |
@ -0,0 +1,225 @@ |
|||||||
|
{ |
||||||
|
"name": "@types/node", |
||||||
|
"version": "18.7.5", |
||||||
|
"description": "TypeScript definitions for Node.js", |
||||||
|
"homepage": "https://github.com/DefinitelyTyped/DefinitelyTyped/tree/master/types/node", |
||||||
|
"license": "MIT", |
||||||
|
"contributors": [ |
||||||
|
{ |
||||||
|
"name": "Microsoft TypeScript", |
||||||
|
"url": "https://github.com/Microsoft", |
||||||
|
"githubUsername": "Microsoft" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "DefinitelyTyped", |
||||||
|
"url": "https://github.com/DefinitelyTyped", |
||||||
|
"githubUsername": "DefinitelyTyped" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Alberto Schiabel", |
||||||
|
"url": "https://github.com/jkomyno", |
||||||
|
"githubUsername": "jkomyno" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Alvis HT Tang", |
||||||
|
"url": "https://github.com/alvis", |
||||||
|
"githubUsername": "alvis" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Andrew Makarov", |
||||||
|
"url": "https://github.com/r3nya", |
||||||
|
"githubUsername": "r3nya" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Benjamin Toueg", |
||||||
|
"url": "https://github.com/btoueg", |
||||||
|
"githubUsername": "btoueg" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Chigozirim C.", |
||||||
|
"url": "https://github.com/smac89", |
||||||
|
"githubUsername": "smac89" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "David Junger", |
||||||
|
"url": "https://github.com/touffy", |
||||||
|
"githubUsername": "touffy" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Deividas Bakanas", |
||||||
|
"url": "https://github.com/DeividasBakanas", |
||||||
|
"githubUsername": "DeividasBakanas" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Eugene Y. Q. Shen", |
||||||
|
"url": "https://github.com/eyqs", |
||||||
|
"githubUsername": "eyqs" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Hannes Magnusson", |
||||||
|
"url": "https://github.com/Hannes-Magnusson-CK", |
||||||
|
"githubUsername": "Hannes-Magnusson-CK" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Huw", |
||||||
|
"url": "https://github.com/hoo29", |
||||||
|
"githubUsername": "hoo29" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Kelvin Jin", |
||||||
|
"url": "https://github.com/kjin", |
||||||
|
"githubUsername": "kjin" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Klaus Meinhardt", |
||||||
|
"url": "https://github.com/ajafff", |
||||||
|
"githubUsername": "ajafff" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Lishude", |
||||||
|
"url": "https://github.com/islishude", |
||||||
|
"githubUsername": "islishude" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Mariusz Wiktorczyk", |
||||||
|
"url": "https://github.com/mwiktorczyk", |
||||||
|
"githubUsername": "mwiktorczyk" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Mohsen Azimi", |
||||||
|
"url": "https://github.com/mohsen1", |
||||||
|
"githubUsername": "mohsen1" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Nicolas Even", |
||||||
|
"url": "https://github.com/n-e", |
||||||
|
"githubUsername": "n-e" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Nikita Galkin", |
||||||
|
"url": "https://github.com/galkin", |
||||||
|
"githubUsername": "galkin" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Parambir Singh", |
||||||
|
"url": "https://github.com/parambirs", |
||||||
|
"githubUsername": "parambirs" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Sebastian Silbermann", |
||||||
|
"url": "https://github.com/eps1lon", |
||||||
|
"githubUsername": "eps1lon" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Simon Schick", |
||||||
|
"url": "https://github.com/SimonSchick", |
||||||
|
"githubUsername": "SimonSchick" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Thomas den Hollander", |
||||||
|
"url": "https://github.com/ThomasdenH", |
||||||
|
"githubUsername": "ThomasdenH" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Wilco Bakker", |
||||||
|
"url": "https://github.com/WilcoBakker", |
||||||
|
"githubUsername": "WilcoBakker" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "wwwy3y3", |
||||||
|
"url": "https://github.com/wwwy3y3", |
||||||
|
"githubUsername": "wwwy3y3" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Samuel Ainsworth", |
||||||
|
"url": "https://github.com/samuela", |
||||||
|
"githubUsername": "samuela" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Kyle Uehlein", |
||||||
|
"url": "https://github.com/kuehlein", |
||||||
|
"githubUsername": "kuehlein" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Thanik Bhongbhibhat", |
||||||
|
"url": "https://github.com/bhongy", |
||||||
|
"githubUsername": "bhongy" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Marcin Kopacz", |
||||||
|
"url": "https://github.com/chyzwar", |
||||||
|
"githubUsername": "chyzwar" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Trivikram Kamat", |
||||||
|
"url": "https://github.com/trivikr", |
||||||
|
"githubUsername": "trivikr" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Junxiao Shi", |
||||||
|
"url": "https://github.com/yoursunny", |
||||||
|
"githubUsername": "yoursunny" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Ilia Baryshnikov", |
||||||
|
"url": "https://github.com/qwelias", |
||||||
|
"githubUsername": "qwelias" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "ExE Boss", |
||||||
|
"url": "https://github.com/ExE-Boss", |
||||||
|
"githubUsername": "ExE-Boss" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Piotr Błażejewicz", |
||||||
|
"url": "https://github.com/peterblazejewicz", |
||||||
|
"githubUsername": "peterblazejewicz" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Anna Henningsen", |
||||||
|
"url": "https://github.com/addaleax", |
||||||
|
"githubUsername": "addaleax" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Victor Perin", |
||||||
|
"url": "https://github.com/victorperin", |
||||||
|
"githubUsername": "victorperin" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Yongsheng Zhang", |
||||||
|
"url": "https://github.com/ZYSzys", |
||||||
|
"githubUsername": "ZYSzys" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "NodeJS Contributors", |
||||||
|
"url": "https://github.com/NodeJS", |
||||||
|
"githubUsername": "NodeJS" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Linus Unnebäck", |
||||||
|
"url": "https://github.com/LinusU", |
||||||
|
"githubUsername": "LinusU" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "wafuwafu13", |
||||||
|
"url": "https://github.com/wafuwafu13", |
||||||
|
"githubUsername": "wafuwafu13" |
||||||
|
}, |
||||||
|
{ |
||||||
|
"name": "Matteo Collina", |
||||||
|
"url": "https://github.com/mcollina", |
||||||
|
"githubUsername": "mcollina" |
||||||
|
} |
||||||
|
], |
||||||
|
"main": "", |
||||||
|
"types": "index.d.ts", |
||||||
|
"repository": { |
||||||
|
"type": "git", |
||||||
|
"url": "https://github.com/DefinitelyTyped/DefinitelyTyped.git", |
||||||
|
"directory": "types/node" |
||||||
|
}, |
||||||
|
"scripts": {}, |
||||||
|
"dependencies": {}, |
||||||
|
"typesPublisherContentHash": "b3d2ce548d64952af2585c97148879dfa054b7a7ea087a095c93ddd158dbb37b", |
||||||
|
"typeScriptVersion": "4.0" |
||||||
|
} |
@ -0,0 +1,191 @@ |
|||||||
|
declare module 'path/posix' { |
||||||
|
import path = require('path'); |
||||||
|
export = path; |
||||||
|
} |
||||||
|
declare module 'path/win32' { |
||||||
|
import path = require('path'); |
||||||
|
export = path; |
||||||
|
} |
||||||
|
/** |
||||||
|
* The `path` module provides utilities for working with file and directory paths. |
||||||
|
* It can be accessed using: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const path = require('path'); |
||||||
|
* ``` |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/path.js)
|
||||||
|
*/ |
||||||
|
declare module 'path' { |
||||||
|
namespace path { |
||||||
|
/** |
||||||
|
* A parsed path object generated by path.parse() or consumed by path.format(). |
||||||
|
*/ |
||||||
|
interface ParsedPath { |
||||||
|
/** |
||||||
|
* The root of the path such as '/' or 'c:\' |
||||||
|
*/ |
||||||
|
root: string; |
||||||
|
/** |
||||||
|
* The full directory path such as '/home/user/dir' or 'c:\path\dir' |
||||||
|
*/ |
||||||
|
dir: string; |
||||||
|
/** |
||||||
|
* The file name including extension (if any) such as 'index.html' |
||||||
|
*/ |
||||||
|
base: string; |
||||||
|
/** |
||||||
|
* The file extension (if any) such as '.html' |
||||||
|
*/ |
||||||
|
ext: string; |
||||||
|
/** |
||||||
|
* The file name without extension (if any) such as 'index' |
||||||
|
*/ |
||||||
|
name: string; |
||||||
|
} |
||||||
|
interface FormatInputPathObject { |
||||||
|
/** |
||||||
|
* The root of the path such as '/' or 'c:\' |
||||||
|
*/ |
||||||
|
root?: string | undefined; |
||||||
|
/** |
||||||
|
* The full directory path such as '/home/user/dir' or 'c:\path\dir' |
||||||
|
*/ |
||||||
|
dir?: string | undefined; |
||||||
|
/** |
||||||
|
* The file name including extension (if any) such as 'index.html' |
||||||
|
*/ |
||||||
|
base?: string | undefined; |
||||||
|
/** |
||||||
|
* The file extension (if any) such as '.html' |
||||||
|
*/ |
||||||
|
ext?: string | undefined; |
||||||
|
/** |
||||||
|
* The file name without extension (if any) such as 'index' |
||||||
|
*/ |
||||||
|
name?: string | undefined; |
||||||
|
} |
||||||
|
interface PlatformPath { |
||||||
|
/** |
||||||
|
* Normalize a string path, reducing '..' and '.' parts. |
||||||
|
* When multiple slashes are found, they're replaced by a single one; when the path contains a trailing slash, it is preserved. On Windows backslashes are used. |
||||||
|
* |
||||||
|
* @param path string path to normalize. |
||||||
|
* @throws {TypeError} if `path` is not a string. |
||||||
|
*/ |
||||||
|
normalize(path: string): string; |
||||||
|
/** |
||||||
|
* Join all arguments together and normalize the resulting path. |
||||||
|
* |
||||||
|
* @param paths paths to join. |
||||||
|
* @throws {TypeError} if any of the path segments is not a string. |
||||||
|
*/ |
||||||
|
join(...paths: string[]): string; |
||||||
|
/** |
||||||
|
* The right-most parameter is considered {to}. Other parameters are considered an array of {from}. |
||||||
|
* |
||||||
|
* Starting from leftmost {from} parameter, resolves {to} to an absolute path. |
||||||
|
* |
||||||
|
* If {to} isn't already absolute, {from} arguments are prepended in right to left order, |
||||||
|
* until an absolute path is found. If after using all {from} paths still no absolute path is found, |
||||||
|
* the current working directory is used as well. The resulting path is normalized, |
||||||
|
* and trailing slashes are removed unless the path gets resolved to the root directory. |
||||||
|
* |
||||||
|
* @param paths A sequence of paths or path segments. |
||||||
|
* @throws {TypeError} if any of the arguments is not a string. |
||||||
|
*/ |
||||||
|
resolve(...paths: string[]): string; |
||||||
|
/** |
||||||
|
* Determines whether {path} is an absolute path. An absolute path will always resolve to the same location, regardless of the working directory. |
||||||
|
* |
||||||
|
* If the given {path} is a zero-length string, `false` will be returned. |
||||||
|
* |
||||||
|
* @param path path to test. |
||||||
|
* @throws {TypeError} if `path` is not a string. |
||||||
|
*/ |
||||||
|
isAbsolute(path: string): boolean; |
||||||
|
/** |
||||||
|
* Solve the relative path from {from} to {to} based on the current working directory. |
||||||
|
* At times we have two absolute paths, and we need to derive the relative path from one to the other. This is actually the reverse transform of path.resolve. |
||||||
|
* |
||||||
|
* @throws {TypeError} if either `from` or `to` is not a string. |
||||||
|
*/ |
||||||
|
relative(from: string, to: string): string; |
||||||
|
/** |
||||||
|
* Return the directory name of a path. Similar to the Unix dirname command. |
||||||
|
* |
||||||
|
* @param path the path to evaluate. |
||||||
|
* @throws {TypeError} if `path` is not a string. |
||||||
|
*/ |
||||||
|
dirname(path: string): string; |
||||||
|
/** |
||||||
|
* Return the last portion of a path. Similar to the Unix basename command. |
||||||
|
* Often used to extract the file name from a fully qualified path. |
||||||
|
* |
||||||
|
* @param path the path to evaluate. |
||||||
|
* @param ext optionally, an extension to remove from the result. |
||||||
|
* @throws {TypeError} if `path` is not a string or if `ext` is given and is not a string. |
||||||
|
*/ |
||||||
|
basename(path: string, ext?: string): string; |
||||||
|
/** |
||||||
|
* Return the extension of the path, from the last '.' to end of string in the last portion of the path. |
||||||
|
* If there is no '.' in the last portion of the path or the first character of it is '.', then it returns an empty string. |
||||||
|
* |
||||||
|
* @param path the path to evaluate. |
||||||
|
* @throws {TypeError} if `path` is not a string. |
||||||
|
*/ |
||||||
|
extname(path: string): string; |
||||||
|
/** |
||||||
|
* The platform-specific file separator. '\\' or '/'. |
||||||
|
*/ |
||||||
|
readonly sep: string; |
||||||
|
/** |
||||||
|
* The platform-specific file delimiter. ';' or ':'. |
||||||
|
*/ |
||||||
|
readonly delimiter: string; |
||||||
|
/** |
||||||
|
* Returns an object from a path string - the opposite of format(). |
||||||
|
* |
||||||
|
* @param path path to evaluate. |
||||||
|
* @throws {TypeError} if `path` is not a string. |
||||||
|
*/ |
||||||
|
parse(path: string): ParsedPath; |
||||||
|
/** |
||||||
|
* Returns a path string from an object - the opposite of parse(). |
||||||
|
* |
||||||
|
* @param pathObject path to evaluate. |
||||||
|
*/ |
||||||
|
format(pathObject: FormatInputPathObject): string; |
||||||
|
/** |
||||||
|
* On Windows systems only, returns an equivalent namespace-prefixed path for the given path. |
||||||
|
* If path is not a string, path will be returned without modifications. |
||||||
|
* This method is meaningful only on Windows system. |
||||||
|
* On POSIX systems, the method is non-operational and always returns path without modifications. |
||||||
|
*/ |
||||||
|
toNamespacedPath(path: string): string; |
||||||
|
/** |
||||||
|
* Posix specific pathing. |
||||||
|
* Same as parent object on posix. |
||||||
|
*/ |
||||||
|
readonly posix: PlatformPath; |
||||||
|
/** |
||||||
|
* Windows specific pathing. |
||||||
|
* Same as parent object on windows |
||||||
|
*/ |
||||||
|
readonly win32: PlatformPath; |
||||||
|
} |
||||||
|
} |
||||||
|
const path: path.PlatformPath; |
||||||
|
export = path; |
||||||
|
} |
||||||
|
declare module 'node:path' { |
||||||
|
import path = require('path'); |
||||||
|
export = path; |
||||||
|
} |
||||||
|
declare module 'node:path/posix' { |
||||||
|
import path = require('path/posix'); |
||||||
|
export = path; |
||||||
|
} |
||||||
|
declare module 'node:path/win32' { |
||||||
|
import path = require('path/win32'); |
||||||
|
export = path; |
||||||
|
} |
@ -0,0 +1,610 @@ |
|||||||
|
/** |
||||||
|
* This module provides an implementation of a subset of the W3C [Web Performance APIs](https://w3c.github.io/perf-timing-primer/) as well as additional APIs for
|
||||||
|
* Node.js-specific performance measurements. |
||||||
|
* |
||||||
|
* Node.js supports the following [Web Performance APIs](https://w3c.github.io/perf-timing-primer/):
|
||||||
|
* |
||||||
|
* * [High Resolution Time](https://www.w3.org/TR/hr-time-2)
|
||||||
|
* * [Performance Timeline](https://w3c.github.io/performance-timeline/)
|
||||||
|
* * [User Timing](https://www.w3.org/TR/user-timing/)
|
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { PerformanceObserver, performance } = require('perf_hooks'); |
||||||
|
* |
||||||
|
* const obs = new PerformanceObserver((items) => { |
||||||
|
* console.log(items.getEntries()[0].duration); |
||||||
|
* performance.clearMarks(); |
||||||
|
* }); |
||||||
|
* obs.observe({ type: 'measure' }); |
||||||
|
* performance.measure('Start to Now'); |
||||||
|
* |
||||||
|
* performance.mark('A'); |
||||||
|
* doSomeLongRunningProcess(() => { |
||||||
|
* performance.measure('A to Now', 'A'); |
||||||
|
* |
||||||
|
* performance.mark('B'); |
||||||
|
* performance.measure('A to B', 'A', 'B'); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/perf_hooks.js)
|
||||||
|
*/ |
||||||
|
declare module 'perf_hooks' { |
||||||
|
import { AsyncResource } from 'node:async_hooks'; |
||||||
|
type EntryType = 'node' | 'mark' | 'measure' | 'gc' | 'function' | 'http2' | 'http'; |
||||||
|
interface NodeGCPerformanceDetail { |
||||||
|
/** |
||||||
|
* When `performanceEntry.entryType` is equal to 'gc', `the performance.kind` property identifies |
||||||
|
* the type of garbage collection operation that occurred. |
||||||
|
* See perf_hooks.constants for valid values. |
||||||
|
*/ |
||||||
|
readonly kind?: number | undefined; |
||||||
|
/** |
||||||
|
* When `performanceEntry.entryType` is equal to 'gc', the `performance.flags` |
||||||
|
* property contains additional information about garbage collection operation. |
||||||
|
* See perf_hooks.constants for valid values. |
||||||
|
*/ |
||||||
|
readonly flags?: number | undefined; |
||||||
|
} |
||||||
|
/** |
||||||
|
* @since v8.5.0 |
||||||
|
*/ |
||||||
|
class PerformanceEntry { |
||||||
|
protected constructor(); |
||||||
|
/** |
||||||
|
* The total number of milliseconds elapsed for this entry. This value will not |
||||||
|
* be meaningful for all Performance Entry types. |
||||||
|
* @since v8.5.0 |
||||||
|
*/ |
||||||
|
readonly duration: number; |
||||||
|
/** |
||||||
|
* The name of the performance entry. |
||||||
|
* @since v8.5.0 |
||||||
|
*/ |
||||||
|
readonly name: string; |
||||||
|
/** |
||||||
|
* The high resolution millisecond timestamp marking the starting time of the |
||||||
|
* Performance Entry. |
||||||
|
* @since v8.5.0 |
||||||
|
*/ |
||||||
|
readonly startTime: number; |
||||||
|
/** |
||||||
|
* The type of the performance entry. It may be one of: |
||||||
|
* |
||||||
|
* * `'node'` (Node.js only) |
||||||
|
* * `'mark'` (available on the Web) |
||||||
|
* * `'measure'` (available on the Web) |
||||||
|
* * `'gc'` (Node.js only) |
||||||
|
* * `'function'` (Node.js only) |
||||||
|
* * `'http2'` (Node.js only) |
||||||
|
* * `'http'` (Node.js only) |
||||||
|
* @since v8.5.0 |
||||||
|
*/ |
||||||
|
readonly entryType: EntryType; |
||||||
|
/** |
||||||
|
* Additional detail specific to the `entryType`. |
||||||
|
* @since v16.0.0 |
||||||
|
*/ |
||||||
|
readonly detail?: NodeGCPerformanceDetail | unknown | undefined; // TODO: Narrow this based on entry type.
|
||||||
|
toJSON(): any; |
||||||
|
} |
||||||
|
class PerformanceMark extends PerformanceEntry { |
||||||
|
readonly duration: 0; |
||||||
|
readonly entryType: 'mark'; |
||||||
|
} |
||||||
|
class PerformanceMeasure extends PerformanceEntry { |
||||||
|
readonly entryType: 'measure'; |
||||||
|
} |
||||||
|
/** |
||||||
|
* _This property is an extension by Node.js. It is not available in Web browsers._ |
||||||
|
* |
||||||
|
* Provides timing details for Node.js itself. The constructor of this class |
||||||
|
* is not exposed to users. |
||||||
|
* @since v8.5.0 |
||||||
|
*/ |
||||||
|
class PerformanceNodeTiming extends PerformanceEntry { |
||||||
|
/** |
||||||
|
* The high resolution millisecond timestamp at which the Node.js process |
||||||
|
* completed bootstrapping. If bootstrapping has not yet finished, the property |
||||||
|
* has the value of -1. |
||||||
|
* @since v8.5.0 |
||||||
|
*/ |
||||||
|
readonly bootstrapComplete: number; |
||||||
|
/** |
||||||
|
* The high resolution millisecond timestamp at which the Node.js environment was |
||||||
|
* initialized. |
||||||
|
* @since v8.5.0 |
||||||
|
*/ |
||||||
|
readonly environment: number; |
||||||
|
/** |
||||||
|
* The high resolution millisecond timestamp of the amount of time the event loop |
||||||
|
* has been idle within the event loop's event provider (e.g. `epoll_wait`). This |
||||||
|
* does not take CPU usage into consideration. If the event loop has not yet |
||||||
|
* started (e.g., in the first tick of the main script), the property has the |
||||||
|
* value of 0. |
||||||
|
* @since v14.10.0, v12.19.0 |
||||||
|
*/ |
||||||
|
readonly idleTime: number; |
||||||
|
/** |
||||||
|
* The high resolution millisecond timestamp at which the Node.js event loop |
||||||
|
* exited. If the event loop has not yet exited, the property has the value of -1\. |
||||||
|
* It can only have a value of not -1 in a handler of the `'exit'` event. |
||||||
|
* @since v8.5.0 |
||||||
|
*/ |
||||||
|
readonly loopExit: number; |
||||||
|
/** |
||||||
|
* The high resolution millisecond timestamp at which the Node.js event loop |
||||||
|
* started. If the event loop has not yet started (e.g., in the first tick of the |
||||||
|
* main script), the property has the value of -1. |
||||||
|
* @since v8.5.0 |
||||||
|
*/ |
||||||
|
readonly loopStart: number; |
||||||
|
/** |
||||||
|
* The high resolution millisecond timestamp at which the V8 platform was |
||||||
|
* initialized. |
||||||
|
* @since v8.5.0 |
||||||
|
*/ |
||||||
|
readonly v8Start: number; |
||||||
|
} |
||||||
|
interface EventLoopUtilization { |
||||||
|
idle: number; |
||||||
|
active: number; |
||||||
|
utilization: number; |
||||||
|
} |
||||||
|
/** |
||||||
|
* @param util1 The result of a previous call to eventLoopUtilization() |
||||||
|
* @param util2 The result of a previous call to eventLoopUtilization() prior to util1 |
||||||
|
*/ |
||||||
|
type EventLoopUtilityFunction = (util1?: EventLoopUtilization, util2?: EventLoopUtilization) => EventLoopUtilization; |
||||||
|
interface MarkOptions { |
||||||
|
/** |
||||||
|
* Additional optional detail to include with the mark. |
||||||
|
*/ |
||||||
|
detail?: unknown | undefined; |
||||||
|
/** |
||||||
|
* An optional timestamp to be used as the mark time. |
||||||
|
* @default `performance.now()`. |
||||||
|
*/ |
||||||
|
startTime?: number | undefined; |
||||||
|
} |
||||||
|
interface MeasureOptions { |
||||||
|
/** |
||||||
|
* Additional optional detail to include with the mark. |
||||||
|
*/ |
||||||
|
detail?: unknown | undefined; |
||||||
|
/** |
||||||
|
* Duration between start and end times. |
||||||
|
*/ |
||||||
|
duration?: number | undefined; |
||||||
|
/** |
||||||
|
* Timestamp to be used as the end time, or a string identifying a previously recorded mark. |
||||||
|
*/ |
||||||
|
end?: number | string | undefined; |
||||||
|
/** |
||||||
|
* Timestamp to be used as the start time, or a string identifying a previously recorded mark. |
||||||
|
*/ |
||||||
|
start?: number | string | undefined; |
||||||
|
} |
||||||
|
interface TimerifyOptions { |
||||||
|
/** |
||||||
|
* A histogram object created using |
||||||
|
* `perf_hooks.createHistogram()` that will record runtime durations in |
||||||
|
* nanoseconds. |
||||||
|
*/ |
||||||
|
histogram?: RecordableHistogram | undefined; |
||||||
|
} |
||||||
|
interface Performance { |
||||||
|
/** |
||||||
|
* If name is not provided, removes all PerformanceMark objects from the Performance Timeline. |
||||||
|
* If name is provided, removes only the named mark. |
||||||
|
* @param name |
||||||
|
*/ |
||||||
|
clearMarks(name?: string): void; |
||||||
|
/** |
||||||
|
* If name is not provided, removes all PerformanceMeasure objects from the Performance Timeline. |
||||||
|
* If name is provided, removes only the named measure. |
||||||
|
* @param name |
||||||
|
* @since v16.7.0 |
||||||
|
*/ |
||||||
|
clearMeasures(name?: string): void; |
||||||
|
/** |
||||||
|
* Returns a list of `PerformanceEntry` objects in chronological order with respect to `performanceEntry.startTime`. |
||||||
|
* If you are only interested in performance entries of certain types or that have certain names, see |
||||||
|
* `performance.getEntriesByType()` and `performance.getEntriesByName()`. |
||||||
|
* @since v16.7.0 |
||||||
|
*/ |
||||||
|
getEntries(): PerformanceEntry[]; |
||||||
|
/** |
||||||
|
* Returns a list of `PerformanceEntry` objects in chronological order with respect to `performanceEntry.startTime` |
||||||
|
* whose `performanceEntry.name` is equal to `name`, and optionally, whose `performanceEntry.entryType` is equal to `type`. |
||||||
|
* @param name |
||||||
|
* @param type |
||||||
|
* @since v16.7.0 |
||||||
|
*/ |
||||||
|
getEntriesByName(name: string, type?: EntryType): PerformanceEntry[]; |
||||||
|
/** |
||||||
|
* Returns a list of `PerformanceEntry` objects in chronological order with respect to `performanceEntry.startTime` |
||||||
|
* whose `performanceEntry.entryType` is equal to `type`. |
||||||
|
* @param type |
||||||
|
* @since v16.7.0 |
||||||
|
*/ |
||||||
|
getEntriesByType(type: EntryType): PerformanceEntry[]; |
||||||
|
/** |
||||||
|
* Creates a new PerformanceMark entry in the Performance Timeline. |
||||||
|
* A PerformanceMark is a subclass of PerformanceEntry whose performanceEntry.entryType is always 'mark', |
||||||
|
* and whose performanceEntry.duration is always 0. |
||||||
|
* Performance marks are used to mark specific significant moments in the Performance Timeline. |
||||||
|
* @param name |
||||||
|
* @return The PerformanceMark entry that was created |
||||||
|
*/ |
||||||
|
mark(name?: string, options?: MarkOptions): PerformanceMark; |
||||||
|
/** |
||||||
|
* Creates a new PerformanceMeasure entry in the Performance Timeline. |
||||||
|
* A PerformanceMeasure is a subclass of PerformanceEntry whose performanceEntry.entryType is always 'measure', |
||||||
|
* and whose performanceEntry.duration measures the number of milliseconds elapsed since startMark and endMark. |
||||||
|
* |
||||||
|
* The startMark argument may identify any existing PerformanceMark in the the Performance Timeline, or may identify |
||||||
|
* any of the timestamp properties provided by the PerformanceNodeTiming class. If the named startMark does not exist, |
||||||
|
* then startMark is set to timeOrigin by default. |
||||||
|
* |
||||||
|
* The endMark argument must identify any existing PerformanceMark in the the Performance Timeline or any of the timestamp |
||||||
|
* properties provided by the PerformanceNodeTiming class. If the named endMark does not exist, an error will be thrown. |
||||||
|
* @param name |
||||||
|
* @param startMark |
||||||
|
* @param endMark |
||||||
|
* @return The PerformanceMeasure entry that was created |
||||||
|
*/ |
||||||
|
measure(name: string, startMark?: string, endMark?: string): PerformanceMeasure; |
||||||
|
measure(name: string, options: MeasureOptions): PerformanceMeasure; |
||||||
|
/** |
||||||
|
* An instance of the PerformanceNodeTiming class that provides performance metrics for specific Node.js operational milestones. |
||||||
|
*/ |
||||||
|
readonly nodeTiming: PerformanceNodeTiming; |
||||||
|
/** |
||||||
|
* @return the current high resolution millisecond timestamp |
||||||
|
*/ |
||||||
|
now(): number; |
||||||
|
/** |
||||||
|
* The timeOrigin specifies the high resolution millisecond timestamp from which all performance metric durations are measured. |
||||||
|
*/ |
||||||
|
readonly timeOrigin: number; |
||||||
|
/** |
||||||
|
* Wraps a function within a new function that measures the running time of the wrapped function. |
||||||
|
* A PerformanceObserver must be subscribed to the 'function' event type in order for the timing details to be accessed. |
||||||
|
* @param fn |
||||||
|
*/ |
||||||
|
timerify<T extends (...params: any[]) => any>(fn: T, options?: TimerifyOptions): T; |
||||||
|
/** |
||||||
|
* eventLoopUtilization is similar to CPU utilization except that it is calculated using high precision wall-clock time. |
||||||
|
* It represents the percentage of time the event loop has spent outside the event loop's event provider (e.g. epoll_wait). |
||||||
|
* No other CPU idle time is taken into consideration. |
||||||
|
*/ |
||||||
|
eventLoopUtilization: EventLoopUtilityFunction; |
||||||
|
} |
||||||
|
interface PerformanceObserverEntryList { |
||||||
|
/** |
||||||
|
* Returns a list of `PerformanceEntry` objects in chronological order |
||||||
|
* with respect to `performanceEntry.startTime`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { |
||||||
|
* performance, |
||||||
|
* PerformanceObserver |
||||||
|
* } = require('perf_hooks'); |
||||||
|
* |
||||||
|
* const obs = new PerformanceObserver((perfObserverList, observer) => { |
||||||
|
* console.log(perfObserverList.getEntries()); |
||||||
|
* |
||||||
|
* * [ |
||||||
|
* * PerformanceEntry { |
||||||
|
* * name: 'test', |
||||||
|
* * entryType: 'mark', |
||||||
|
* * startTime: 81.465639, |
||||||
|
* * duration: 0 |
||||||
|
* * }, |
||||||
|
* * PerformanceEntry { |
||||||
|
* * name: 'meow', |
||||||
|
* * entryType: 'mark', |
||||||
|
* * startTime: 81.860064, |
||||||
|
* * duration: 0 |
||||||
|
* * } |
||||||
|
* * ] |
||||||
|
* |
||||||
|
* |
||||||
|
* performance.clearMarks(); |
||||||
|
* performance.clearMeasures(); |
||||||
|
* observer.disconnect(); |
||||||
|
* }); |
||||||
|
* obs.observe({ type: 'mark' }); |
||||||
|
* |
||||||
|
* performance.mark('test'); |
||||||
|
* performance.mark('meow'); |
||||||
|
* ``` |
||||||
|
* @since v8.5.0 |
||||||
|
*/ |
||||||
|
getEntries(): PerformanceEntry[]; |
||||||
|
/** |
||||||
|
* Returns a list of `PerformanceEntry` objects in chronological order |
||||||
|
* with respect to `performanceEntry.startTime` whose `performanceEntry.name` is |
||||||
|
* equal to `name`, and optionally, whose `performanceEntry.entryType` is equal to`type`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { |
||||||
|
* performance, |
||||||
|
* PerformanceObserver |
||||||
|
* } = require('perf_hooks'); |
||||||
|
* |
||||||
|
* const obs = new PerformanceObserver((perfObserverList, observer) => { |
||||||
|
* console.log(perfObserverList.getEntriesByName('meow')); |
||||||
|
* |
||||||
|
* * [ |
||||||
|
* * PerformanceEntry { |
||||||
|
* * name: 'meow', |
||||||
|
* * entryType: 'mark', |
||||||
|
* * startTime: 98.545991, |
||||||
|
* * duration: 0 |
||||||
|
* * } |
||||||
|
* * ] |
||||||
|
* |
||||||
|
* console.log(perfObserverList.getEntriesByName('nope')); // []
|
||||||
|
* |
||||||
|
* console.log(perfObserverList.getEntriesByName('test', 'mark')); |
||||||
|
* |
||||||
|
* * [ |
||||||
|
* * PerformanceEntry { |
||||||
|
* * name: 'test', |
||||||
|
* * entryType: 'mark', |
||||||
|
* * startTime: 63.518931, |
||||||
|
* * duration: 0 |
||||||
|
* * } |
||||||
|
* * ] |
||||||
|
* |
||||||
|
* console.log(perfObserverList.getEntriesByName('test', 'measure')); // []
|
||||||
|
* |
||||||
|
* performance.clearMarks(); |
||||||
|
* performance.clearMeasures(); |
||||||
|
* observer.disconnect(); |
||||||
|
* }); |
||||||
|
* obs.observe({ entryTypes: ['mark', 'measure'] }); |
||||||
|
* |
||||||
|
* performance.mark('test'); |
||||||
|
* performance.mark('meow'); |
||||||
|
* ``` |
||||||
|
* @since v8.5.0 |
||||||
|
*/ |
||||||
|
getEntriesByName(name: string, type?: EntryType): PerformanceEntry[]; |
||||||
|
/** |
||||||
|
* Returns a list of `PerformanceEntry` objects in chronological order |
||||||
|
* with respect to `performanceEntry.startTime` whose `performanceEntry.entryType`is equal to `type`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { |
||||||
|
* performance, |
||||||
|
* PerformanceObserver |
||||||
|
* } = require('perf_hooks'); |
||||||
|
* |
||||||
|
* const obs = new PerformanceObserver((perfObserverList, observer) => { |
||||||
|
* console.log(perfObserverList.getEntriesByType('mark')); |
||||||
|
* |
||||||
|
* * [ |
||||||
|
* * PerformanceEntry { |
||||||
|
* * name: 'test', |
||||||
|
* * entryType: 'mark', |
||||||
|
* * startTime: 55.897834, |
||||||
|
* * duration: 0 |
||||||
|
* * }, |
||||||
|
* * PerformanceEntry { |
||||||
|
* * name: 'meow', |
||||||
|
* * entryType: 'mark', |
||||||
|
* * startTime: 56.350146, |
||||||
|
* * duration: 0 |
||||||
|
* * } |
||||||
|
* * ] |
||||||
|
* |
||||||
|
* performance.clearMarks(); |
||||||
|
* performance.clearMeasures(); |
||||||
|
* observer.disconnect(); |
||||||
|
* }); |
||||||
|
* obs.observe({ type: 'mark' }); |
||||||
|
* |
||||||
|
* performance.mark('test'); |
||||||
|
* performance.mark('meow'); |
||||||
|
* ``` |
||||||
|
* @since v8.5.0 |
||||||
|
*/ |
||||||
|
getEntriesByType(type: EntryType): PerformanceEntry[]; |
||||||
|
} |
||||||
|
type PerformanceObserverCallback = (list: PerformanceObserverEntryList, observer: PerformanceObserver) => void; |
||||||
|
class PerformanceObserver extends AsyncResource { |
||||||
|
constructor(callback: PerformanceObserverCallback); |
||||||
|
/** |
||||||
|
* Disconnects the `PerformanceObserver` instance from all notifications. |
||||||
|
* @since v8.5.0 |
||||||
|
*/ |
||||||
|
disconnect(): void; |
||||||
|
/** |
||||||
|
* Subscribes the `PerformanceObserver` instance to notifications of new `PerformanceEntry` instances identified either by `options.entryTypes`or `options.type`: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { |
||||||
|
* performance, |
||||||
|
* PerformanceObserver |
||||||
|
* } = require('perf_hooks'); |
||||||
|
* |
||||||
|
* const obs = new PerformanceObserver((list, observer) => { |
||||||
|
* // Called once asynchronously. `list` contains three items.
|
||||||
|
* }); |
||||||
|
* obs.observe({ type: 'mark' }); |
||||||
|
* |
||||||
|
* for (let n = 0; n < 3; n++) |
||||||
|
* performance.mark(`test${n}`); |
||||||
|
* ``` |
||||||
|
* @since v8.5.0 |
||||||
|
*/ |
||||||
|
observe( |
||||||
|
options: |
||||||
|
| { |
||||||
|
entryTypes: ReadonlyArray<EntryType>; |
||||||
|
buffered?: boolean | undefined; |
||||||
|
} |
||||||
|
| { |
||||||
|
type: EntryType; |
||||||
|
buffered?: boolean | undefined; |
||||||
|
} |
||||||
|
): void; |
||||||
|
} |
||||||
|
namespace constants { |
||||||
|
const NODE_PERFORMANCE_GC_MAJOR: number; |
||||||
|
const NODE_PERFORMANCE_GC_MINOR: number; |
||||||
|
const NODE_PERFORMANCE_GC_INCREMENTAL: number; |
||||||
|
const NODE_PERFORMANCE_GC_WEAKCB: number; |
||||||
|
const NODE_PERFORMANCE_GC_FLAGS_NO: number; |
||||||
|
const NODE_PERFORMANCE_GC_FLAGS_CONSTRUCT_RETAINED: number; |
||||||
|
const NODE_PERFORMANCE_GC_FLAGS_FORCED: number; |
||||||
|
const NODE_PERFORMANCE_GC_FLAGS_SYNCHRONOUS_PHANTOM_PROCESSING: number; |
||||||
|
const NODE_PERFORMANCE_GC_FLAGS_ALL_AVAILABLE_GARBAGE: number; |
||||||
|
const NODE_PERFORMANCE_GC_FLAGS_ALL_EXTERNAL_MEMORY: number; |
||||||
|
const NODE_PERFORMANCE_GC_FLAGS_SCHEDULE_IDLE: number; |
||||||
|
} |
||||||
|
const performance: Performance; |
||||||
|
interface EventLoopMonitorOptions { |
||||||
|
/** |
||||||
|
* The sampling rate in milliseconds. |
||||||
|
* Must be greater than zero. |
||||||
|
* @default 10 |
||||||
|
*/ |
||||||
|
resolution?: number | undefined; |
||||||
|
} |
||||||
|
interface Histogram { |
||||||
|
/** |
||||||
|
* Returns a `Map` object detailing the accumulated percentile distribution. |
||||||
|
* @since v11.10.0 |
||||||
|
*/ |
||||||
|
readonly percentiles: Map<number, number>; |
||||||
|
/** |
||||||
|
* The number of times the event loop delay exceeded the maximum 1 hour event |
||||||
|
* loop delay threshold. |
||||||
|
* @since v11.10.0 |
||||||
|
*/ |
||||||
|
readonly exceeds: number; |
||||||
|
/** |
||||||
|
* The minimum recorded event loop delay. |
||||||
|
* @since v11.10.0 |
||||||
|
*/ |
||||||
|
readonly min: number; |
||||||
|
/** |
||||||
|
* The maximum recorded event loop delay. |
||||||
|
* @since v11.10.0 |
||||||
|
*/ |
||||||
|
readonly max: number; |
||||||
|
/** |
||||||
|
* The mean of the recorded event loop delays. |
||||||
|
* @since v11.10.0 |
||||||
|
*/ |
||||||
|
readonly mean: number; |
||||||
|
/** |
||||||
|
* The standard deviation of the recorded event loop delays. |
||||||
|
* @since v11.10.0 |
||||||
|
*/ |
||||||
|
readonly stddev: number; |
||||||
|
/** |
||||||
|
* Resets the collected histogram data. |
||||||
|
* @since v11.10.0 |
||||||
|
*/ |
||||||
|
reset(): void; |
||||||
|
/** |
||||||
|
* Returns the value at the given percentile. |
||||||
|
* @since v11.10.0 |
||||||
|
* @param percentile A percentile value in the range (0, 100]. |
||||||
|
*/ |
||||||
|
percentile(percentile: number): number; |
||||||
|
} |
||||||
|
interface IntervalHistogram extends Histogram { |
||||||
|
/** |
||||||
|
* Enables the update interval timer. Returns `true` if the timer was |
||||||
|
* started, `false` if it was already started. |
||||||
|
* @since v11.10.0 |
||||||
|
*/ |
||||||
|
enable(): boolean; |
||||||
|
/** |
||||||
|
* Disables the update interval timer. Returns `true` if the timer was |
||||||
|
* stopped, `false` if it was already stopped. |
||||||
|
* @since v11.10.0 |
||||||
|
*/ |
||||||
|
disable(): boolean; |
||||||
|
} |
||||||
|
interface RecordableHistogram extends Histogram { |
||||||
|
/** |
||||||
|
* @since v15.9.0, v14.18.0 |
||||||
|
* @param val The amount to record in the histogram. |
||||||
|
*/ |
||||||
|
record(val: number | bigint): void; |
||||||
|
/** |
||||||
|
* Calculates the amount of time (in nanoseconds) that has passed since the |
||||||
|
* previous call to `recordDelta()` and records that amount in the histogram. |
||||||
|
* |
||||||
|
* ## Examples |
||||||
|
* @since v15.9.0, v14.18.0 |
||||||
|
*/ |
||||||
|
recordDelta(): void; |
||||||
|
/** |
||||||
|
* Adds the values from other to this histogram. |
||||||
|
* @since v17.4.0, v16.14.0 |
||||||
|
* @param other Recordable Histogram to combine with |
||||||
|
*/ |
||||||
|
add(other: RecordableHistogram): void; |
||||||
|
} |
||||||
|
/** |
||||||
|
* _This property is an extension by Node.js. It is not available in Web browsers._ |
||||||
|
* |
||||||
|
* Creates an `IntervalHistogram` object that samples and reports the event loop |
||||||
|
* delay over time. The delays will be reported in nanoseconds. |
||||||
|
* |
||||||
|
* Using a timer to detect approximate event loop delay works because the |
||||||
|
* execution of timers is tied specifically to the lifecycle of the libuv |
||||||
|
* event loop. That is, a delay in the loop will cause a delay in the execution |
||||||
|
* of the timer, and those delays are specifically what this API is intended to |
||||||
|
* detect. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { monitorEventLoopDelay } = require('perf_hooks'); |
||||||
|
* const h = monitorEventLoopDelay({ resolution: 20 }); |
||||||
|
* h.enable(); |
||||||
|
* // Do something.
|
||||||
|
* h.disable(); |
||||||
|
* console.log(h.min); |
||||||
|
* console.log(h.max); |
||||||
|
* console.log(h.mean); |
||||||
|
* console.log(h.stddev); |
||||||
|
* console.log(h.percentiles); |
||||||
|
* console.log(h.percentile(50)); |
||||||
|
* console.log(h.percentile(99)); |
||||||
|
* ``` |
||||||
|
* @since v11.10.0 |
||||||
|
*/ |
||||||
|
function monitorEventLoopDelay(options?: EventLoopMonitorOptions): IntervalHistogram; |
||||||
|
interface CreateHistogramOptions { |
||||||
|
/** |
||||||
|
* The minimum recordable value. Must be an integer value greater than 0. |
||||||
|
* @default 1 |
||||||
|
*/ |
||||||
|
min?: number | bigint | undefined; |
||||||
|
/** |
||||||
|
* The maximum recordable value. Must be an integer value greater than min. |
||||||
|
* @default Number.MAX_SAFE_INTEGER |
||||||
|
*/ |
||||||
|
max?: number | bigint | undefined; |
||||||
|
/** |
||||||
|
* The number of accuracy digits. Must be a number between 1 and 5. |
||||||
|
* @default 3 |
||||||
|
*/ |
||||||
|
figures?: number | undefined; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Returns a `RecordableHistogram`. |
||||||
|
* @since v15.9.0, v14.18.0 |
||||||
|
*/ |
||||||
|
function createHistogram(options?: CreateHistogramOptions): RecordableHistogram; |
||||||
|
} |
||||||
|
declare module 'node:perf_hooks' { |
||||||
|
export * from 'perf_hooks'; |
||||||
|
} |
File diff suppressed because it is too large
Load Diff
@ -0,0 +1,117 @@ |
|||||||
|
/** |
||||||
|
* **The version of the punycode module bundled in Node.js is being deprecated.**In a future major version of Node.js this module will be removed. Users |
||||||
|
* currently depending on the `punycode` module should switch to using the |
||||||
|
* userland-provided [Punycode.js](https://github.com/bestiejs/punycode.js) module instead. For punycode-based URL
|
||||||
|
* encoding, see `url.domainToASCII` or, more generally, the `WHATWG URL API`. |
||||||
|
* |
||||||
|
* The `punycode` module is a bundled version of the [Punycode.js](https://github.com/bestiejs/punycode.js) module. It
|
||||||
|
* can be accessed using: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const punycode = require('punycode'); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* [Punycode](https://tools.ietf.org/html/rfc3492) is a character encoding scheme defined by RFC 3492 that is
|
||||||
|
* primarily intended for use in Internationalized Domain Names. Because host |
||||||
|
* names in URLs are limited to ASCII characters only, Domain Names that contain |
||||||
|
* non-ASCII characters must be converted into ASCII using the Punycode scheme. |
||||||
|
* For instance, the Japanese character that translates into the English word,`'example'` is `'例'`. The Internationalized Domain Name, `'例.com'` (equivalent |
||||||
|
* to `'example.com'`) is represented by Punycode as the ASCII string`'xn--fsq.com'`. |
||||||
|
* |
||||||
|
* The `punycode` module provides a simple implementation of the Punycode standard. |
||||||
|
* |
||||||
|
* The `punycode` module is a third-party dependency used by Node.js and |
||||||
|
* made available to developers as a convenience. Fixes or other modifications to |
||||||
|
* the module must be directed to the [Punycode.js](https://github.com/bestiejs/punycode.js) project.
|
||||||
|
* @deprecated Since v7.0.0 - Deprecated |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/punycode.js)
|
||||||
|
*/ |
||||||
|
declare module 'punycode' { |
||||||
|
/** |
||||||
|
* The `punycode.decode()` method converts a [Punycode](https://tools.ietf.org/html/rfc3492) string of ASCII-only
|
||||||
|
* characters to the equivalent string of Unicode codepoints. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* punycode.decode('maana-pta'); // 'mañana'
|
||||||
|
* punycode.decode('--dqo34k'); // '☃-⌘'
|
||||||
|
* ``` |
||||||
|
* @since v0.5.1 |
||||||
|
*/ |
||||||
|
function decode(string: string): string; |
||||||
|
/** |
||||||
|
* The `punycode.encode()` method converts a string of Unicode codepoints to a [Punycode](https://tools.ietf.org/html/rfc3492) string of ASCII-only characters.
|
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* punycode.encode('mañana'); // 'maana-pta'
|
||||||
|
* punycode.encode('☃-⌘'); // '--dqo34k'
|
||||||
|
* ``` |
||||||
|
* @since v0.5.1 |
||||||
|
*/ |
||||||
|
function encode(string: string): string; |
||||||
|
/** |
||||||
|
* The `punycode.toUnicode()` method converts a string representing a domain name |
||||||
|
* containing [Punycode](https://tools.ietf.org/html/rfc3492) encoded characters into Unicode. Only the [Punycode](https://tools.ietf.org/html/rfc3492) encoded parts of the domain name are be
|
||||||
|
* converted. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* // decode domain names
|
||||||
|
* punycode.toUnicode('xn--maana-pta.com'); // 'mañana.com'
|
||||||
|
* punycode.toUnicode('xn----dqo34k.com'); // '☃-⌘.com'
|
||||||
|
* punycode.toUnicode('example.com'); // 'example.com'
|
||||||
|
* ``` |
||||||
|
* @since v0.6.1 |
||||||
|
*/ |
||||||
|
function toUnicode(domain: string): string; |
||||||
|
/** |
||||||
|
* The `punycode.toASCII()` method converts a Unicode string representing an |
||||||
|
* Internationalized Domain Name to [Punycode](https://tools.ietf.org/html/rfc3492). Only the non-ASCII parts of the
|
||||||
|
* domain name will be converted. Calling `punycode.toASCII()` on a string that |
||||||
|
* already only contains ASCII characters will have no effect. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* // encode domain names
|
||||||
|
* punycode.toASCII('mañana.com'); // 'xn--maana-pta.com'
|
||||||
|
* punycode.toASCII('☃-⌘.com'); // 'xn----dqo34k.com'
|
||||||
|
* punycode.toASCII('example.com'); // 'example.com'
|
||||||
|
* ``` |
||||||
|
* @since v0.6.1 |
||||||
|
*/ |
||||||
|
function toASCII(domain: string): string; |
||||||
|
/** |
||||||
|
* @deprecated since v7.0.0 |
||||||
|
* The version of the punycode module bundled in Node.js is being deprecated. |
||||||
|
* In a future major version of Node.js this module will be removed. |
||||||
|
* Users currently depending on the punycode module should switch to using |
||||||
|
* the userland-provided Punycode.js module instead.
|
||||||
|
*/ |
||||||
|
const ucs2: ucs2; |
||||||
|
interface ucs2 { |
||||||
|
/** |
||||||
|
* @deprecated since v7.0.0 |
||||||
|
* The version of the punycode module bundled in Node.js is being deprecated. |
||||||
|
* In a future major version of Node.js this module will be removed. |
||||||
|
* Users currently depending on the punycode module should switch to using |
||||||
|
* the userland-provided Punycode.js module instead.
|
||||||
|
*/ |
||||||
|
decode(string: string): number[]; |
||||||
|
/** |
||||||
|
* @deprecated since v7.0.0 |
||||||
|
* The version of the punycode module bundled in Node.js is being deprecated. |
||||||
|
* In a future major version of Node.js this module will be removed. |
||||||
|
* Users currently depending on the punycode module should switch to using |
||||||
|
* the userland-provided Punycode.js module instead.
|
||||||
|
*/ |
||||||
|
encode(codePoints: ReadonlyArray<number>): string; |
||||||
|
} |
||||||
|
/** |
||||||
|
* @deprecated since v7.0.0 |
||||||
|
* The version of the punycode module bundled in Node.js is being deprecated. |
||||||
|
* In a future major version of Node.js this module will be removed. |
||||||
|
* Users currently depending on the punycode module should switch to using |
||||||
|
* the userland-provided Punycode.js module instead.
|
||||||
|
*/ |
||||||
|
const version: string; |
||||||
|
} |
||||||
|
declare module 'node:punycode' { |
||||||
|
export * from 'punycode'; |
||||||
|
} |
@ -0,0 +1,131 @@ |
|||||||
|
/** |
||||||
|
* The `querystring` module provides utilities for parsing and formatting URL |
||||||
|
* query strings. It can be accessed using: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const querystring = require('querystring'); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* The `querystring` API is considered Legacy. While it is still maintained, |
||||||
|
* new code should use the `URLSearchParams` API instead. |
||||||
|
* @deprecated Legacy |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/querystring.js)
|
||||||
|
*/ |
||||||
|
declare module 'querystring' { |
||||||
|
interface StringifyOptions { |
||||||
|
encodeURIComponent?: ((str: string) => string) | undefined; |
||||||
|
} |
||||||
|
interface ParseOptions { |
||||||
|
maxKeys?: number | undefined; |
||||||
|
decodeURIComponent?: ((str: string) => string) | undefined; |
||||||
|
} |
||||||
|
interface ParsedUrlQuery extends NodeJS.Dict<string | string[]> {} |
||||||
|
interface ParsedUrlQueryInput extends NodeJS.Dict<string | number | boolean | ReadonlyArray<string> | ReadonlyArray<number> | ReadonlyArray<boolean> | null> {} |
||||||
|
/** |
||||||
|
* The `querystring.stringify()` method produces a URL query string from a |
||||||
|
* given `obj` by iterating through the object's "own properties". |
||||||
|
* |
||||||
|
* It serializes the following types of values passed in `obj`:[string](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Data_structures#String_type) |
|
||||||
|
* [number](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Data_structures#Number_type) |
|
||||||
|
* [bigint](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/BigInt) |
|
||||||
|
* [boolean](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Data_structures#Boolean_type) |
|
||||||
|
* [string\[\]](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Data_structures#String_type) |
|
||||||
|
* [number\[\]](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Data_structures#Number_type) |
|
||||||
|
* [bigint\[\]](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/BigInt) |
|
||||||
|
* [boolean\[\]](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Data_structures#Boolean_type) The numeric values must be finite. Any other input values will be coerced to
|
||||||
|
* empty strings. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* querystring.stringify({ foo: 'bar', baz: ['qux', 'quux'], corge: '' }); |
||||||
|
* // Returns 'foo=bar&baz=qux&baz=quux&corge='
|
||||||
|
* |
||||||
|
* querystring.stringify({ foo: 'bar', baz: 'qux' }, ';', ':'); |
||||||
|
* // Returns 'foo:bar;baz:qux'
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* By default, characters requiring percent-encoding within the query string will |
||||||
|
* be encoded as UTF-8\. If an alternative encoding is required, then an alternative`encodeURIComponent` option will need to be specified: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* // Assuming gbkEncodeURIComponent function already exists,
|
||||||
|
* |
||||||
|
* querystring.stringify({ w: '中文', foo: 'bar' }, null, null, |
||||||
|
* { encodeURIComponent: gbkEncodeURIComponent }); |
||||||
|
* ``` |
||||||
|
* @since v0.1.25 |
||||||
|
* @param obj The object to serialize into a URL query string |
||||||
|
* @param [sep='&'] The substring used to delimit key and value pairs in the query string. |
||||||
|
* @param [eq='='] . The substring used to delimit keys and values in the query string. |
||||||
|
*/ |
||||||
|
function stringify(obj?: ParsedUrlQueryInput, sep?: string, eq?: string, options?: StringifyOptions): string; |
||||||
|
/** |
||||||
|
* The `querystring.parse()` method parses a URL query string (`str`) into a |
||||||
|
* collection of key and value pairs. |
||||||
|
* |
||||||
|
* For example, the query string `'foo=bar&abc=xyz&abc=123'` is parsed into: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* { |
||||||
|
* foo: 'bar', |
||||||
|
* abc: ['xyz', '123'] |
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* The object returned by the `querystring.parse()` method _does not_prototypically inherit from the JavaScript `Object`. This means that typical`Object` methods such as `obj.toString()`, |
||||||
|
* `obj.hasOwnProperty()`, and others |
||||||
|
* are not defined and _will not work_. |
||||||
|
* |
||||||
|
* By default, percent-encoded characters within the query string will be assumed |
||||||
|
* to use UTF-8 encoding. If an alternative character encoding is used, then an |
||||||
|
* alternative `decodeURIComponent` option will need to be specified: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* // Assuming gbkDecodeURIComponent function already exists...
|
||||||
|
* |
||||||
|
* querystring.parse('w=%D6%D0%CE%C4&foo=bar', null, null, |
||||||
|
* { decodeURIComponent: gbkDecodeURIComponent }); |
||||||
|
* ``` |
||||||
|
* @since v0.1.25 |
||||||
|
* @param str The URL query string to parse |
||||||
|
* @param [sep='&'] The substring used to delimit key and value pairs in the query string. |
||||||
|
* @param [eq='='] . The substring used to delimit keys and values in the query string. |
||||||
|
*/ |
||||||
|
function parse(str: string, sep?: string, eq?: string, options?: ParseOptions): ParsedUrlQuery; |
||||||
|
/** |
||||||
|
* The querystring.encode() function is an alias for querystring.stringify(). |
||||||
|
*/ |
||||||
|
const encode: typeof stringify; |
||||||
|
/** |
||||||
|
* The querystring.decode() function is an alias for querystring.parse(). |
||||||
|
*/ |
||||||
|
const decode: typeof parse; |
||||||
|
/** |
||||||
|
* The `querystring.escape()` method performs URL percent-encoding on the given`str` in a manner that is optimized for the specific requirements of URL |
||||||
|
* query strings. |
||||||
|
* |
||||||
|
* The `querystring.escape()` method is used by `querystring.stringify()` and is |
||||||
|
* generally not expected to be used directly. It is exported primarily to allow |
||||||
|
* application code to provide a replacement percent-encoding implementation if |
||||||
|
* necessary by assigning `querystring.escape` to an alternative function. |
||||||
|
* @since v0.1.25 |
||||||
|
*/ |
||||||
|
function escape(str: string): string; |
||||||
|
/** |
||||||
|
* The `querystring.unescape()` method performs decoding of URL percent-encoded |
||||||
|
* characters on the given `str`. |
||||||
|
* |
||||||
|
* The `querystring.unescape()` method is used by `querystring.parse()` and is |
||||||
|
* generally not expected to be used directly. It is exported primarily to allow |
||||||
|
* application code to provide a replacement decoding implementation if |
||||||
|
* necessary by assigning `querystring.unescape` to an alternative function. |
||||||
|
* |
||||||
|
* By default, the `querystring.unescape()` method will attempt to use the |
||||||
|
* JavaScript built-in `decodeURIComponent()` method to decode. If that fails, |
||||||
|
* a safer equivalent that does not throw on malformed URLs will be used. |
||||||
|
* @since v0.1.25 |
||||||
|
*/ |
||||||
|
function unescape(str: string): string; |
||||||
|
} |
||||||
|
declare module 'node:querystring' { |
||||||
|
export * from 'querystring'; |
||||||
|
} |
@ -0,0 +1,653 @@ |
|||||||
|
/** |
||||||
|
* The `readline` module provides an interface for reading data from a `Readable` stream (such as `process.stdin`) one line at a time. |
||||||
|
* |
||||||
|
* To use the promise-based APIs: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import * as readline from 'node:readline/promises'; |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* To use the callback and sync APIs: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import * as readline from 'node:readline'; |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* The following simple example illustrates the basic use of the `readline` module.
|
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import * as readline from 'node:readline/promises'; |
||||||
|
* import { stdin as input, stdout as output } from 'node:process'; |
||||||
|
* |
||||||
|
* const rl = readline.createInterface({ input, output }); |
||||||
|
* |
||||||
|
* const answer = await rl.question('What do you think of Node.js? '); |
||||||
|
* |
||||||
|
* console.log(`Thank you for your valuable feedback: ${answer}`); |
||||||
|
* |
||||||
|
* rl.close(); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Once this code is invoked, the Node.js application will not terminate until the`readline.Interface` is closed because the interface waits for data to be |
||||||
|
* received on the `input` stream. |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/readline.js)
|
||||||
|
*/ |
||||||
|
declare module 'readline' { |
||||||
|
import { Abortable, EventEmitter } from 'node:events'; |
||||||
|
import * as promises from 'node:readline/promises'; |
||||||
|
|
||||||
|
export { promises }; |
||||||
|
export interface Key { |
||||||
|
sequence?: string | undefined; |
||||||
|
name?: string | undefined; |
||||||
|
ctrl?: boolean | undefined; |
||||||
|
meta?: boolean | undefined; |
||||||
|
shift?: boolean | undefined; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Instances of the `readline.Interface` class are constructed using the`readline.createInterface()` method. Every instance is associated with a |
||||||
|
* single `input` `Readable` stream and a single `output` `Writable` stream. |
||||||
|
* The `output` stream is used to print prompts for user input that arrives on, |
||||||
|
* and is read from, the `input` stream. |
||||||
|
* @since v0.1.104 |
||||||
|
*/ |
||||||
|
export class Interface extends EventEmitter { |
||||||
|
readonly terminal: boolean; |
||||||
|
/** |
||||||
|
* The current input data being processed by node. |
||||||
|
* |
||||||
|
* This can be used when collecting input from a TTY stream to retrieve the |
||||||
|
* current value that has been processed thus far, prior to the `line` event |
||||||
|
* being emitted. Once the `line` event has been emitted, this property will |
||||||
|
* be an empty string. |
||||||
|
* |
||||||
|
* Be aware that modifying the value during the instance runtime may have |
||||||
|
* unintended consequences if `rl.cursor` is not also controlled. |
||||||
|
* |
||||||
|
* **If not using a TTY stream for input, use the `'line'` event.** |
||||||
|
* |
||||||
|
* One possible use case would be as follows: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const values = ['lorem ipsum', 'dolor sit amet']; |
||||||
|
* const rl = readline.createInterface(process.stdin); |
||||||
|
* const showResults = debounce(() => { |
||||||
|
* console.log( |
||||||
|
* '\n', |
||||||
|
* values.filter((val) => val.startsWith(rl.line)).join(' ') |
||||||
|
* ); |
||||||
|
* }, 300); |
||||||
|
* process.stdin.on('keypress', (c, k) => { |
||||||
|
* showResults(); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* @since v0.1.98 |
||||||
|
*/ |
||||||
|
readonly line: string; |
||||||
|
/** |
||||||
|
* The cursor position relative to `rl.line`. |
||||||
|
* |
||||||
|
* This will track where the current cursor lands in the input string, when |
||||||
|
* reading input from a TTY stream. The position of cursor determines the |
||||||
|
* portion of the input string that will be modified as input is processed, |
||||||
|
* as well as the column where the terminal caret will be rendered. |
||||||
|
* @since v0.1.98 |
||||||
|
*/ |
||||||
|
readonly cursor: number; |
||||||
|
/** |
||||||
|
* NOTE: According to the documentation: |
||||||
|
* |
||||||
|
* > Instances of the `readline.Interface` class are constructed using the |
||||||
|
* > `readline.createInterface()` method. |
||||||
|
* |
||||||
|
* @see https://nodejs.org/dist/latest-v10.x/docs/api/readline.html#readline_class_interface
|
||||||
|
*/ |
||||||
|
protected constructor(input: NodeJS.ReadableStream, output?: NodeJS.WritableStream, completer?: Completer | AsyncCompleter, terminal?: boolean); |
||||||
|
/** |
||||||
|
* NOTE: According to the documentation: |
||||||
|
* |
||||||
|
* > Instances of the `readline.Interface` class are constructed using the |
||||||
|
* > `readline.createInterface()` method. |
||||||
|
* |
||||||
|
* @see https://nodejs.org/dist/latest-v10.x/docs/api/readline.html#readline_class_interface
|
||||||
|
*/ |
||||||
|
protected constructor(options: ReadLineOptions); |
||||||
|
/** |
||||||
|
* The `rl.getPrompt()` method returns the current prompt used by `rl.prompt()`. |
||||||
|
* @since v15.3.0 |
||||||
|
* @return the current prompt string |
||||||
|
*/ |
||||||
|
getPrompt(): string; |
||||||
|
/** |
||||||
|
* The `rl.setPrompt()` method sets the prompt that will be written to `output`whenever `rl.prompt()` is called. |
||||||
|
* @since v0.1.98 |
||||||
|
*/ |
||||||
|
setPrompt(prompt: string): void; |
||||||
|
/** |
||||||
|
* The `rl.prompt()` method writes the `readline.Interface` instances configured`prompt` to a new line in `output` in order to provide a user with a new |
||||||
|
* location at which to provide input. |
||||||
|
* |
||||||
|
* When called, `rl.prompt()` will resume the `input` stream if it has been |
||||||
|
* paused. |
||||||
|
* |
||||||
|
* If the `readline.Interface` was created with `output` set to `null` or`undefined` the prompt is not written. |
||||||
|
* @since v0.1.98 |
||||||
|
* @param preserveCursor If `true`, prevents the cursor placement from being reset to `0`. |
||||||
|
*/ |
||||||
|
prompt(preserveCursor?: boolean): void; |
||||||
|
/** |
||||||
|
* The `rl.question()` method displays the `query` by writing it to the `output`, |
||||||
|
* waits for user input to be provided on `input`, then invokes the `callback`function passing the provided input as the first argument. |
||||||
|
* |
||||||
|
* When called, `rl.question()` will resume the `input` stream if it has been |
||||||
|
* paused. |
||||||
|
* |
||||||
|
* If the `readline.Interface` was created with `output` set to `null` or`undefined` the `query` is not written. |
||||||
|
* |
||||||
|
* The `callback` function passed to `rl.question()` does not follow the typical |
||||||
|
* pattern of accepting an `Error` object or `null` as the first argument. |
||||||
|
* The `callback` is called with the provided answer as the only argument. |
||||||
|
* |
||||||
|
* Example usage: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* rl.question('What is your favorite food? ', (answer) => { |
||||||
|
* console.log(`Oh, so your favorite food is ${answer}`); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Using an `AbortController` to cancel a question. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const ac = new AbortController(); |
||||||
|
* const signal = ac.signal; |
||||||
|
* |
||||||
|
* rl.question('What is your favorite food? ', { signal }, (answer) => { |
||||||
|
* console.log(`Oh, so your favorite food is ${answer}`); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* signal.addEventListener('abort', () => { |
||||||
|
* console.log('The food question timed out'); |
||||||
|
* }, { once: true }); |
||||||
|
* |
||||||
|
* setTimeout(() => ac.abort(), 10000); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* If this method is invoked as it's util.promisify()ed version, it returns a |
||||||
|
* Promise that fulfills with the answer. If the question is canceled using |
||||||
|
* an `AbortController` it will reject with an `AbortError`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const util = require('util'); |
||||||
|
* const question = util.promisify(rl.question).bind(rl); |
||||||
|
* |
||||||
|
* async function questionExample() { |
||||||
|
* try { |
||||||
|
* const answer = await question('What is you favorite food? '); |
||||||
|
* console.log(`Oh, so your favorite food is ${answer}`); |
||||||
|
* } catch (err) { |
||||||
|
* console.error('Question rejected', err); |
||||||
|
* } |
||||||
|
* } |
||||||
|
* questionExample(); |
||||||
|
* ``` |
||||||
|
* @since v0.3.3 |
||||||
|
* @param query A statement or query to write to `output`, prepended to the prompt. |
||||||
|
* @param callback A callback function that is invoked with the user's input in response to the `query`. |
||||||
|
*/ |
||||||
|
question(query: string, callback: (answer: string) => void): void; |
||||||
|
question(query: string, options: Abortable, callback: (answer: string) => void): void; |
||||||
|
/** |
||||||
|
* The `rl.pause()` method pauses the `input` stream, allowing it to be resumed |
||||||
|
* later if necessary. |
||||||
|
* |
||||||
|
* Calling `rl.pause()` does not immediately pause other events (including`'line'`) from being emitted by the `readline.Interface` instance. |
||||||
|
* @since v0.3.4 |
||||||
|
*/ |
||||||
|
pause(): this; |
||||||
|
/** |
||||||
|
* The `rl.resume()` method resumes the `input` stream if it has been paused. |
||||||
|
* @since v0.3.4 |
||||||
|
*/ |
||||||
|
resume(): this; |
||||||
|
/** |
||||||
|
* The `rl.close()` method closes the `readline.Interface` instance and |
||||||
|
* relinquishes control over the `input` and `output` streams. When called, |
||||||
|
* the `'close'` event will be emitted. |
||||||
|
* |
||||||
|
* Calling `rl.close()` does not immediately stop other events (including `'line'`) |
||||||
|
* from being emitted by the `readline.Interface` instance. |
||||||
|
* @since v0.1.98 |
||||||
|
*/ |
||||||
|
close(): void; |
||||||
|
/** |
||||||
|
* The `rl.write()` method will write either `data` or a key sequence identified |
||||||
|
* by `key` to the `output`. The `key` argument is supported only if `output` is |
||||||
|
* a `TTY` text terminal. See `TTY keybindings` for a list of key |
||||||
|
* combinations. |
||||||
|
* |
||||||
|
* If `key` is specified, `data` is ignored. |
||||||
|
* |
||||||
|
* When called, `rl.write()` will resume the `input` stream if it has been |
||||||
|
* paused. |
||||||
|
* |
||||||
|
* If the `readline.Interface` was created with `output` set to `null` or`undefined` the `data` and `key` are not written. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* rl.write('Delete this!'); |
||||||
|
* // Simulate Ctrl+U to delete the line written previously
|
||||||
|
* rl.write(null, { ctrl: true, name: 'u' }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* The `rl.write()` method will write the data to the `readline` `Interface`'s`input`_as if it were provided by the user_. |
||||||
|
* @since v0.1.98 |
||||||
|
*/ |
||||||
|
write(data: string | Buffer, key?: Key): void; |
||||||
|
write(data: undefined | null | string | Buffer, key: Key): void; |
||||||
|
/** |
||||||
|
* Returns the real position of the cursor in relation to the input |
||||||
|
* prompt + string. Long input (wrapping) strings, as well as multiple |
||||||
|
* line prompts are included in the calculations. |
||||||
|
* @since v13.5.0, v12.16.0 |
||||||
|
*/ |
||||||
|
getCursorPos(): CursorPos; |
||||||
|
/** |
||||||
|
* events.EventEmitter |
||||||
|
* 1. close |
||||||
|
* 2. line |
||||||
|
* 3. pause |
||||||
|
* 4. resume |
||||||
|
* 5. SIGCONT |
||||||
|
* 6. SIGINT |
||||||
|
* 7. SIGTSTP |
||||||
|
* 8. history |
||||||
|
*/ |
||||||
|
addListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
addListener(event: 'close', listener: () => void): this; |
||||||
|
addListener(event: 'line', listener: (input: string) => void): this; |
||||||
|
addListener(event: 'pause', listener: () => void): this; |
||||||
|
addListener(event: 'resume', listener: () => void): this; |
||||||
|
addListener(event: 'SIGCONT', listener: () => void): this; |
||||||
|
addListener(event: 'SIGINT', listener: () => void): this; |
||||||
|
addListener(event: 'SIGTSTP', listener: () => void): this; |
||||||
|
addListener(event: 'history', listener: (history: string[]) => void): this; |
||||||
|
emit(event: string | symbol, ...args: any[]): boolean; |
||||||
|
emit(event: 'close'): boolean; |
||||||
|
emit(event: 'line', input: string): boolean; |
||||||
|
emit(event: 'pause'): boolean; |
||||||
|
emit(event: 'resume'): boolean; |
||||||
|
emit(event: 'SIGCONT'): boolean; |
||||||
|
emit(event: 'SIGINT'): boolean; |
||||||
|
emit(event: 'SIGTSTP'): boolean; |
||||||
|
emit(event: 'history', history: string[]): boolean; |
||||||
|
on(event: string, listener: (...args: any[]) => void): this; |
||||||
|
on(event: 'close', listener: () => void): this; |
||||||
|
on(event: 'line', listener: (input: string) => void): this; |
||||||
|
on(event: 'pause', listener: () => void): this; |
||||||
|
on(event: 'resume', listener: () => void): this; |
||||||
|
on(event: 'SIGCONT', listener: () => void): this; |
||||||
|
on(event: 'SIGINT', listener: () => void): this; |
||||||
|
on(event: 'SIGTSTP', listener: () => void): this; |
||||||
|
on(event: 'history', listener: (history: string[]) => void): this; |
||||||
|
once(event: string, listener: (...args: any[]) => void): this; |
||||||
|
once(event: 'close', listener: () => void): this; |
||||||
|
once(event: 'line', listener: (input: string) => void): this; |
||||||
|
once(event: 'pause', listener: () => void): this; |
||||||
|
once(event: 'resume', listener: () => void): this; |
||||||
|
once(event: 'SIGCONT', listener: () => void): this; |
||||||
|
once(event: 'SIGINT', listener: () => void): this; |
||||||
|
once(event: 'SIGTSTP', listener: () => void): this; |
||||||
|
once(event: 'history', listener: (history: string[]) => void): this; |
||||||
|
prependListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
prependListener(event: 'close', listener: () => void): this; |
||||||
|
prependListener(event: 'line', listener: (input: string) => void): this; |
||||||
|
prependListener(event: 'pause', listener: () => void): this; |
||||||
|
prependListener(event: 'resume', listener: () => void): this; |
||||||
|
prependListener(event: 'SIGCONT', listener: () => void): this; |
||||||
|
prependListener(event: 'SIGINT', listener: () => void): this; |
||||||
|
prependListener(event: 'SIGTSTP', listener: () => void): this; |
||||||
|
prependListener(event: 'history', listener: (history: string[]) => void): this; |
||||||
|
prependOnceListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
prependOnceListener(event: 'close', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'line', listener: (input: string) => void): this; |
||||||
|
prependOnceListener(event: 'pause', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'resume', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'SIGCONT', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'SIGINT', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'SIGTSTP', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'history', listener: (history: string[]) => void): this; |
||||||
|
[Symbol.asyncIterator](): AsyncIterableIterator<string>; |
||||||
|
} |
||||||
|
export type ReadLine = Interface; // type forwarded for backwards compatibility
|
||||||
|
export type Completer = (line: string) => CompleterResult; |
||||||
|
export type AsyncCompleter = (line: string, callback: (err?: null | Error, result?: CompleterResult) => void) => void; |
||||||
|
export type CompleterResult = [string[], string]; |
||||||
|
export interface ReadLineOptions { |
||||||
|
input: NodeJS.ReadableStream; |
||||||
|
output?: NodeJS.WritableStream | undefined; |
||||||
|
completer?: Completer | AsyncCompleter | undefined; |
||||||
|
terminal?: boolean | undefined; |
||||||
|
/** |
||||||
|
* Initial list of history lines. This option makes sense |
||||||
|
* only if `terminal` is set to `true` by the user or by an internal `output` |
||||||
|
* check, otherwise the history caching mechanism is not initialized at all. |
||||||
|
* @default [] |
||||||
|
*/ |
||||||
|
history?: string[] | undefined; |
||||||
|
historySize?: number | undefined; |
||||||
|
prompt?: string | undefined; |
||||||
|
crlfDelay?: number | undefined; |
||||||
|
/** |
||||||
|
* If `true`, when a new input line added |
||||||
|
* to the history list duplicates an older one, this removes the older line |
||||||
|
* from the list. |
||||||
|
* @default false |
||||||
|
*/ |
||||||
|
removeHistoryDuplicates?: boolean | undefined; |
||||||
|
escapeCodeTimeout?: number | undefined; |
||||||
|
tabSize?: number | undefined; |
||||||
|
} |
||||||
|
/** |
||||||
|
* The `readline.createInterface()` method creates a new `readline.Interface`instance. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const readline = require('readline'); |
||||||
|
* const rl = readline.createInterface({ |
||||||
|
* input: process.stdin, |
||||||
|
* output: process.stdout |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Once the `readline.Interface` instance is created, the most common case is to |
||||||
|
* listen for the `'line'` event: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* rl.on('line', (line) => { |
||||||
|
* console.log(`Received: ${line}`); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* If `terminal` is `true` for this instance then the `output` stream will get |
||||||
|
* the best compatibility if it defines an `output.columns` property and emits |
||||||
|
* a `'resize'` event on the `output` if or when the columns ever change |
||||||
|
* (`process.stdout` does this automatically when it is a TTY). |
||||||
|
* |
||||||
|
* When creating a `readline.Interface` using `stdin` as input, the program |
||||||
|
* will not terminate until it receives `EOF` (Ctrl+D on |
||||||
|
* Linux/macOS, Ctrl+Z followed by Return on |
||||||
|
* Windows). |
||||||
|
* If you want your application to exit without waiting for user input, you can `unref()` the standard input stream: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* process.stdin.unref(); |
||||||
|
* ``` |
||||||
|
* @since v0.1.98 |
||||||
|
*/ |
||||||
|
export function createInterface(input: NodeJS.ReadableStream, output?: NodeJS.WritableStream, completer?: Completer | AsyncCompleter, terminal?: boolean): Interface; |
||||||
|
export function createInterface(options: ReadLineOptions): Interface; |
||||||
|
/** |
||||||
|
* The `readline.emitKeypressEvents()` method causes the given `Readable` stream to begin emitting `'keypress'` events corresponding to received input. |
||||||
|
* |
||||||
|
* Optionally, `interface` specifies a `readline.Interface` instance for which |
||||||
|
* autocompletion is disabled when copy-pasted input is detected. |
||||||
|
* |
||||||
|
* If the `stream` is a `TTY`, then it must be in raw mode. |
||||||
|
* |
||||||
|
* This is automatically called by any readline instance on its `input` if the`input` is a terminal. Closing the `readline` instance does not stop |
||||||
|
* the `input` from emitting `'keypress'` events. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* readline.emitKeypressEvents(process.stdin); |
||||||
|
* if (process.stdin.isTTY) |
||||||
|
* process.stdin.setRawMode(true); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* ## Example: Tiny CLI |
||||||
|
* |
||||||
|
* The following example illustrates the use of `readline.Interface` class to |
||||||
|
* implement a small command-line interface: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const readline = require('readline'); |
||||||
|
* const rl = readline.createInterface({ |
||||||
|
* input: process.stdin, |
||||||
|
* output: process.stdout, |
||||||
|
* prompt: 'OHAI> ' |
||||||
|
* }); |
||||||
|
* |
||||||
|
* rl.prompt(); |
||||||
|
* |
||||||
|
* rl.on('line', (line) => { |
||||||
|
* switch (line.trim()) { |
||||||
|
* case 'hello': |
||||||
|
* console.log('world!'); |
||||||
|
* break; |
||||||
|
* default: |
||||||
|
* console.log(`Say what? I might have heard '${line.trim()}'`); |
||||||
|
* break; |
||||||
|
* } |
||||||
|
* rl.prompt(); |
||||||
|
* }).on('close', () => { |
||||||
|
* console.log('Have a great day!'); |
||||||
|
* process.exit(0); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* ## Example: Read file stream line-by-Line |
||||||
|
* |
||||||
|
* A common use case for `readline` is to consume an input file one line at a |
||||||
|
* time. The easiest way to do so is leveraging the `fs.ReadStream` API as |
||||||
|
* well as a `for await...of` loop: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const fs = require('fs'); |
||||||
|
* const readline = require('readline'); |
||||||
|
* |
||||||
|
* async function processLineByLine() { |
||||||
|
* const fileStream = fs.createReadStream('input.txt'); |
||||||
|
* |
||||||
|
* const rl = readline.createInterface({ |
||||||
|
* input: fileStream, |
||||||
|
* crlfDelay: Infinity |
||||||
|
* }); |
||||||
|
* // Note: we use the crlfDelay option to recognize all instances of CR LF
|
||||||
|
* // ('\r\n') in input.txt as a single line break.
|
||||||
|
* |
||||||
|
* for await (const line of rl) { |
||||||
|
* // Each line in input.txt will be successively available here as `line`.
|
||||||
|
* console.log(`Line from file: ${line}`); |
||||||
|
* } |
||||||
|
* } |
||||||
|
* |
||||||
|
* processLineByLine(); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Alternatively, one could use the `'line'` event: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const fs = require('fs'); |
||||||
|
* const readline = require('readline'); |
||||||
|
* |
||||||
|
* const rl = readline.createInterface({ |
||||||
|
* input: fs.createReadStream('sample.txt'), |
||||||
|
* crlfDelay: Infinity |
||||||
|
* }); |
||||||
|
* |
||||||
|
* rl.on('line', (line) => { |
||||||
|
* console.log(`Line from file: ${line}`); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Currently, `for await...of` loop can be a bit slower. If `async` / `await`flow and speed are both essential, a mixed approach can be applied: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { once } = require('events'); |
||||||
|
* const { createReadStream } = require('fs'); |
||||||
|
* const { createInterface } = require('readline'); |
||||||
|
* |
||||||
|
* (async function processLineByLine() { |
||||||
|
* try { |
||||||
|
* const rl = createInterface({ |
||||||
|
* input: createReadStream('big-file.txt'), |
||||||
|
* crlfDelay: Infinity |
||||||
|
* }); |
||||||
|
* |
||||||
|
* rl.on('line', (line) => { |
||||||
|
* // Process the line.
|
||||||
|
* }); |
||||||
|
* |
||||||
|
* await once(rl, 'close'); |
||||||
|
* |
||||||
|
* console.log('File processed.'); |
||||||
|
* } catch (err) { |
||||||
|
* console.error(err); |
||||||
|
* } |
||||||
|
* })(); |
||||||
|
* ``` |
||||||
|
* @since v0.7.7 |
||||||
|
*/ |
||||||
|
export function emitKeypressEvents(stream: NodeJS.ReadableStream, readlineInterface?: Interface): void; |
||||||
|
export type Direction = -1 | 0 | 1; |
||||||
|
export interface CursorPos { |
||||||
|
rows: number; |
||||||
|
cols: number; |
||||||
|
} |
||||||
|
/** |
||||||
|
* The `readline.clearLine()` method clears current line of given `TTY` stream |
||||||
|
* in a specified direction identified by `dir`. |
||||||
|
* @since v0.7.7 |
||||||
|
* @param callback Invoked once the operation completes. |
||||||
|
* @return `false` if `stream` wishes for the calling code to wait for the `'drain'` event to be emitted before continuing to write additional data; otherwise `true`. |
||||||
|
*/ |
||||||
|
export function clearLine(stream: NodeJS.WritableStream, dir: Direction, callback?: () => void): boolean; |
||||||
|
/** |
||||||
|
* The `readline.clearScreenDown()` method clears the given `TTY` stream from |
||||||
|
* the current position of the cursor down. |
||||||
|
* @since v0.7.7 |
||||||
|
* @param callback Invoked once the operation completes. |
||||||
|
* @return `false` if `stream` wishes for the calling code to wait for the `'drain'` event to be emitted before continuing to write additional data; otherwise `true`. |
||||||
|
*/ |
||||||
|
export function clearScreenDown(stream: NodeJS.WritableStream, callback?: () => void): boolean; |
||||||
|
/** |
||||||
|
* The `readline.cursorTo()` method moves cursor to the specified position in a |
||||||
|
* given `TTY` `stream`. |
||||||
|
* @since v0.7.7 |
||||||
|
* @param callback Invoked once the operation completes. |
||||||
|
* @return `false` if `stream` wishes for the calling code to wait for the `'drain'` event to be emitted before continuing to write additional data; otherwise `true`. |
||||||
|
*/ |
||||||
|
export function cursorTo(stream: NodeJS.WritableStream, x: number, y?: number, callback?: () => void): boolean; |
||||||
|
/** |
||||||
|
* The `readline.moveCursor()` method moves the cursor _relative_ to its current |
||||||
|
* position in a given `TTY` `stream`. |
||||||
|
* |
||||||
|
* ## Example: Tiny CLI |
||||||
|
* |
||||||
|
* The following example illustrates the use of `readline.Interface` class to |
||||||
|
* implement a small command-line interface: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const readline = require('readline'); |
||||||
|
* const rl = readline.createInterface({ |
||||||
|
* input: process.stdin, |
||||||
|
* output: process.stdout, |
||||||
|
* prompt: 'OHAI> ' |
||||||
|
* }); |
||||||
|
* |
||||||
|
* rl.prompt(); |
||||||
|
* |
||||||
|
* rl.on('line', (line) => { |
||||||
|
* switch (line.trim()) { |
||||||
|
* case 'hello': |
||||||
|
* console.log('world!'); |
||||||
|
* break; |
||||||
|
* default: |
||||||
|
* console.log(`Say what? I might have heard '${line.trim()}'`); |
||||||
|
* break; |
||||||
|
* } |
||||||
|
* rl.prompt(); |
||||||
|
* }).on('close', () => { |
||||||
|
* console.log('Have a great day!'); |
||||||
|
* process.exit(0); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* ## Example: Read file stream line-by-Line |
||||||
|
* |
||||||
|
* A common use case for `readline` is to consume an input file one line at a |
||||||
|
* time. The easiest way to do so is leveraging the `fs.ReadStream` API as |
||||||
|
* well as a `for await...of` loop: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const fs = require('fs'); |
||||||
|
* const readline = require('readline'); |
||||||
|
* |
||||||
|
* async function processLineByLine() { |
||||||
|
* const fileStream = fs.createReadStream('input.txt'); |
||||||
|
* |
||||||
|
* const rl = readline.createInterface({ |
||||||
|
* input: fileStream, |
||||||
|
* crlfDelay: Infinity |
||||||
|
* }); |
||||||
|
* // Note: we use the crlfDelay option to recognize all instances of CR LF
|
||||||
|
* // ('\r\n') in input.txt as a single line break.
|
||||||
|
* |
||||||
|
* for await (const line of rl) { |
||||||
|
* // Each line in input.txt will be successively available here as `line`.
|
||||||
|
* console.log(`Line from file: ${line}`); |
||||||
|
* } |
||||||
|
* } |
||||||
|
* |
||||||
|
* processLineByLine(); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Alternatively, one could use the `'line'` event: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const fs = require('fs'); |
||||||
|
* const readline = require('readline'); |
||||||
|
* |
||||||
|
* const rl = readline.createInterface({ |
||||||
|
* input: fs.createReadStream('sample.txt'), |
||||||
|
* crlfDelay: Infinity |
||||||
|
* }); |
||||||
|
* |
||||||
|
* rl.on('line', (line) => { |
||||||
|
* console.log(`Line from file: ${line}`); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Currently, `for await...of` loop can be a bit slower. If `async` / `await`flow and speed are both essential, a mixed approach can be applied: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { once } = require('events'); |
||||||
|
* const { createReadStream } = require('fs'); |
||||||
|
* const { createInterface } = require('readline'); |
||||||
|
* |
||||||
|
* (async function processLineByLine() { |
||||||
|
* try { |
||||||
|
* const rl = createInterface({ |
||||||
|
* input: createReadStream('big-file.txt'), |
||||||
|
* crlfDelay: Infinity |
||||||
|
* }); |
||||||
|
* |
||||||
|
* rl.on('line', (line) => { |
||||||
|
* // Process the line.
|
||||||
|
* }); |
||||||
|
* |
||||||
|
* await once(rl, 'close'); |
||||||
|
* |
||||||
|
* console.log('File processed.'); |
||||||
|
* } catch (err) { |
||||||
|
* console.error(err); |
||||||
|
* } |
||||||
|
* })(); |
||||||
|
* ``` |
||||||
|
* @since v0.7.7 |
||||||
|
* @param callback Invoked once the operation completes. |
||||||
|
* @return `false` if `stream` wishes for the calling code to wait for the `'drain'` event to be emitted before continuing to write additional data; otherwise `true`. |
||||||
|
*/ |
||||||
|
export function moveCursor(stream: NodeJS.WritableStream, dx: number, dy: number, callback?: () => void): boolean; |
||||||
|
} |
||||||
|
declare module 'node:readline' { |
||||||
|
export * from 'readline'; |
||||||
|
} |
@ -0,0 +1,143 @@ |
|||||||
|
/** |
||||||
|
* The `readline/promise` module provides an API for reading lines of input from a Readable stream one line at a time. |
||||||
|
* |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/readline/promises.js)
|
||||||
|
* @since v17.0.0 |
||||||
|
*/ |
||||||
|
declare module 'readline/promises' { |
||||||
|
import { Interface as _Interface, ReadLineOptions, Completer, AsyncCompleter, Direction } from 'node:readline'; |
||||||
|
import { Abortable } from 'node:events'; |
||||||
|
|
||||||
|
class Interface extends _Interface { |
||||||
|
/** |
||||||
|
* The rl.question() method displays the query by writing it to the output, waits for user input to be provided on input, |
||||||
|
* then invokes the callback function passing the provided input as the first argument. |
||||||
|
* |
||||||
|
* When called, rl.question() will resume the input stream if it has been paused. |
||||||
|
* |
||||||
|
* If the readlinePromises.Interface was created with output set to null or undefined the query is not written. |
||||||
|
* |
||||||
|
* If the question is called after rl.close(), it returns a rejected promise. |
||||||
|
* |
||||||
|
* Example usage: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const answer = await rl.question('What is your favorite food? '); |
||||||
|
* console.log(`Oh, so your favorite food is ${answer}`); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Using an AbortSignal to cancel a question. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const signal = AbortSignal.timeout(10_000); |
||||||
|
* |
||||||
|
* signal.addEventListener('abort', () => { |
||||||
|
* console.log('The food question timed out'); |
||||||
|
* }, { once: true }); |
||||||
|
* |
||||||
|
* const answer = await rl.question('What is your favorite food? ', { signal }); |
||||||
|
* console.log(`Oh, so your favorite food is ${answer}`); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* @since v17.0.0 |
||||||
|
* @param query A statement or query to write to output, prepended to the prompt. |
||||||
|
*/ |
||||||
|
question(query: string): Promise<string>; |
||||||
|
question(query: string, options: Abortable): Promise<string>; |
||||||
|
} |
||||||
|
|
||||||
|
class Readline { |
||||||
|
/** |
||||||
|
* @param stream A TTY stream. |
||||||
|
*/ |
||||||
|
constructor(stream: NodeJS.WritableStream, options?: { autoCommit?: boolean }); |
||||||
|
/** |
||||||
|
* The `rl.clearLine()` method adds to the internal list of pending action an action that clears current line of the associated `stream` in a specified direction identified by `dir`. |
||||||
|
* Call `rl.commit()` to see the effect of this method, unless `autoCommit: true` was passed to the constructor. |
||||||
|
*/ |
||||||
|
clearLine(dir: Direction): this; |
||||||
|
/** |
||||||
|
* The `rl.clearScreenDown()` method adds to the internal list of pending action an action that clears the associated `stream` from the current position of the cursor down. |
||||||
|
* Call `rl.commit()` to see the effect of this method, unless `autoCommit: true` was passed to the constructor. |
||||||
|
*/ |
||||||
|
clearScreenDown(): this; |
||||||
|
/** |
||||||
|
* The `rl.commit()` method sends all the pending actions to the associated `stream` and clears the internal list of pending actions. |
||||||
|
*/ |
||||||
|
commit(): Promise<void>; |
||||||
|
/** |
||||||
|
* The `rl.cursorTo()` method adds to the internal list of pending action an action that moves cursor to the specified position in the associated `stream`. |
||||||
|
* Call `rl.commit()` to see the effect of this method, unless `autoCommit: true` was passed to the constructor. |
||||||
|
*/ |
||||||
|
cursorTo(x: number, y?: number): this; |
||||||
|
/** |
||||||
|
* The `rl.moveCursor()` method adds to the internal list of pending action an action that moves the cursor relative to its current position in the associated `stream`. |
||||||
|
* Call `rl.commit()` to see the effect of this method, unless autoCommit: true was passed to the constructor. |
||||||
|
*/ |
||||||
|
moveCursor(dx: number, dy: number): this; |
||||||
|
/** |
||||||
|
* The `rl.rollback()` method clears the internal list of pending actions without sending it to the associated `stream`. |
||||||
|
*/ |
||||||
|
rollback(): this; |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* The `readlinePromises.createInterface()` method creates a new `readlinePromises.Interface` instance. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const readlinePromises = require('node:readline/promises'); |
||||||
|
* const rl = readlinePromises.createInterface({ |
||||||
|
* input: process.stdin, |
||||||
|
* output: process.stdout |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Once the `readlinePromises.Interface` instance is created, the most common case is to listen for the `'line'` event: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* rl.on('line', (line) => { |
||||||
|
* console.log(`Received: ${line}`); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* If `terminal` is `true` for this instance then the `output` stream will get the best compatibility if it defines an `output.columns` property, |
||||||
|
* and emits a `'resize'` event on the `output`, if or when the columns ever change (`process.stdout` does this automatically when it is a TTY). |
||||||
|
* |
||||||
|
* ## Use of the `completer` function |
||||||
|
* |
||||||
|
* The `completer` function takes the current line entered by the user as an argument, and returns an `Array` with 2 entries: |
||||||
|
* |
||||||
|
* - An Array with matching entries for the completion. |
||||||
|
* - The substring that was used for the matching. |
||||||
|
* |
||||||
|
* For instance: `[[substr1, substr2, ...], originalsubstring]`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* function completer(line) { |
||||||
|
* const completions = '.help .error .exit .quit .q'.split(' '); |
||||||
|
* const hits = completions.filter((c) => c.startsWith(line)); |
||||||
|
* // Show all completions if none found
|
||||||
|
* return [hits.length ? hits : completions, line]; |
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* The `completer` function can also returns a `Promise`, or be asynchronous: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* async function completer(linePartial) { |
||||||
|
* await someAsyncWork(); |
||||||
|
* return [['123'], linePartial]; |
||||||
|
* } |
||||||
|
* ``` |
||||||
|
*/ |
||||||
|
function createInterface( |
||||||
|
input: NodeJS.ReadableStream, |
||||||
|
output?: NodeJS.WritableStream, |
||||||
|
completer?: Completer | AsyncCompleter, |
||||||
|
terminal?: boolean, |
||||||
|
): Interface; |
||||||
|
function createInterface(options: ReadLineOptions): Interface; |
||||||
|
} |
||||||
|
declare module 'node:readline/promises' { |
||||||
|
export * from 'readline/promises'; |
||||||
|
} |
@ -0,0 +1,424 @@ |
|||||||
|
/** |
||||||
|
* The `repl` module provides a Read-Eval-Print-Loop (REPL) implementation that |
||||||
|
* is available both as a standalone program or includible in other applications. |
||||||
|
* It can be accessed using: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const repl = require('repl'); |
||||||
|
* ``` |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/repl.js)
|
||||||
|
*/ |
||||||
|
declare module 'repl' { |
||||||
|
import { Interface, Completer, AsyncCompleter } from 'node:readline'; |
||||||
|
import { Context } from 'node:vm'; |
||||||
|
import { InspectOptions } from 'node:util'; |
||||||
|
interface ReplOptions { |
||||||
|
/** |
||||||
|
* The input prompt to display. |
||||||
|
* @default "> " |
||||||
|
*/ |
||||||
|
prompt?: string | undefined; |
||||||
|
/** |
||||||
|
* The `Readable` stream from which REPL input will be read. |
||||||
|
* @default process.stdin |
||||||
|
*/ |
||||||
|
input?: NodeJS.ReadableStream | undefined; |
||||||
|
/** |
||||||
|
* The `Writable` stream to which REPL output will be written. |
||||||
|
* @default process.stdout |
||||||
|
*/ |
||||||
|
output?: NodeJS.WritableStream | undefined; |
||||||
|
/** |
||||||
|
* If `true`, specifies that the output should be treated as a TTY terminal, and have |
||||||
|
* ANSI/VT100 escape codes written to it. |
||||||
|
* Default: checking the value of the `isTTY` property on the output stream upon |
||||||
|
* instantiation. |
||||||
|
*/ |
||||||
|
terminal?: boolean | undefined; |
||||||
|
/** |
||||||
|
* The function to be used when evaluating each given line of input. |
||||||
|
* Default: an async wrapper for the JavaScript `eval()` function. An `eval` function can |
||||||
|
* error with `repl.Recoverable` to indicate the input was incomplete and prompt for |
||||||
|
* additional lines. |
||||||
|
* |
||||||
|
* @see https://nodejs.org/dist/latest-v10.x/docs/api/repl.html#repl_default_evaluation
|
||||||
|
* @see https://nodejs.org/dist/latest-v10.x/docs/api/repl.html#repl_custom_evaluation_functions
|
||||||
|
*/ |
||||||
|
eval?: REPLEval | undefined; |
||||||
|
/** |
||||||
|
* Defines if the repl prints output previews or not. |
||||||
|
* @default `true` Always `false` in case `terminal` is falsy. |
||||||
|
*/ |
||||||
|
preview?: boolean | undefined; |
||||||
|
/** |
||||||
|
* If `true`, specifies that the default `writer` function should include ANSI color |
||||||
|
* styling to REPL output. If a custom `writer` function is provided then this has no |
||||||
|
* effect. |
||||||
|
* Default: the REPL instance's `terminal` value. |
||||||
|
*/ |
||||||
|
useColors?: boolean | undefined; |
||||||
|
/** |
||||||
|
* If `true`, specifies that the default evaluation function will use the JavaScript |
||||||
|
* `global` as the context as opposed to creating a new separate context for the REPL |
||||||
|
* instance. The node CLI REPL sets this value to `true`. |
||||||
|
* Default: `false`. |
||||||
|
*/ |
||||||
|
useGlobal?: boolean | undefined; |
||||||
|
/** |
||||||
|
* If `true`, specifies that the default writer will not output the return value of a |
||||||
|
* command if it evaluates to `undefined`. |
||||||
|
* Default: `false`. |
||||||
|
*/ |
||||||
|
ignoreUndefined?: boolean | undefined; |
||||||
|
/** |
||||||
|
* The function to invoke to format the output of each command before writing to `output`. |
||||||
|
* Default: a wrapper for `util.inspect`. |
||||||
|
* |
||||||
|
* @see https://nodejs.org/dist/latest-v10.x/docs/api/repl.html#repl_customizing_repl_output
|
||||||
|
*/ |
||||||
|
writer?: REPLWriter | undefined; |
||||||
|
/** |
||||||
|
* An optional function used for custom Tab auto completion. |
||||||
|
* |
||||||
|
* @see https://nodejs.org/dist/latest-v11.x/docs/api/readline.html#readline_use_of_the_completer_function
|
||||||
|
*/ |
||||||
|
completer?: Completer | AsyncCompleter | undefined; |
||||||
|
/** |
||||||
|
* A flag that specifies whether the default evaluator executes all JavaScript commands in |
||||||
|
* strict mode or default (sloppy) mode. |
||||||
|
* Accepted values are: |
||||||
|
* - `repl.REPL_MODE_SLOPPY` - evaluates expressions in sloppy mode. |
||||||
|
* - `repl.REPL_MODE_STRICT` - evaluates expressions in strict mode. This is equivalent to |
||||||
|
* prefacing every repl statement with `'use strict'`. |
||||||
|
*/ |
||||||
|
replMode?: typeof REPL_MODE_SLOPPY | typeof REPL_MODE_STRICT | undefined; |
||||||
|
/** |
||||||
|
* Stop evaluating the current piece of code when `SIGINT` is received, i.e. `Ctrl+C` is |
||||||
|
* pressed. This cannot be used together with a custom `eval` function. |
||||||
|
* Default: `false`. |
||||||
|
*/ |
||||||
|
breakEvalOnSigint?: boolean | undefined; |
||||||
|
} |
||||||
|
type REPLEval = (this: REPLServer, evalCmd: string, context: Context, file: string, cb: (err: Error | null, result: any) => void) => void; |
||||||
|
type REPLWriter = (this: REPLServer, obj: any) => string; |
||||||
|
/** |
||||||
|
* This is the default "writer" value, if none is passed in the REPL options, |
||||||
|
* and it can be overridden by custom print functions. |
||||||
|
*/ |
||||||
|
const writer: REPLWriter & { |
||||||
|
options: InspectOptions; |
||||||
|
}; |
||||||
|
type REPLCommandAction = (this: REPLServer, text: string) => void; |
||||||
|
interface REPLCommand { |
||||||
|
/** |
||||||
|
* Help text to be displayed when `.help` is entered. |
||||||
|
*/ |
||||||
|
help?: string | undefined; |
||||||
|
/** |
||||||
|
* The function to execute, optionally accepting a single string argument. |
||||||
|
*/ |
||||||
|
action: REPLCommandAction; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Instances of `repl.REPLServer` are created using the {@link start} method |
||||||
|
* or directly using the JavaScript `new` keyword. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const repl = require('repl'); |
||||||
|
* |
||||||
|
* const options = { useColors: true }; |
||||||
|
* |
||||||
|
* const firstInstance = repl.start(options); |
||||||
|
* const secondInstance = new repl.REPLServer(options); |
||||||
|
* ``` |
||||||
|
* @since v0.1.91 |
||||||
|
*/ |
||||||
|
class REPLServer extends Interface { |
||||||
|
/** |
||||||
|
* The `vm.Context` provided to the `eval` function to be used for JavaScript |
||||||
|
* evaluation. |
||||||
|
*/ |
||||||
|
readonly context: Context; |
||||||
|
/** |
||||||
|
* @deprecated since v14.3.0 - Use `input` instead. |
||||||
|
*/ |
||||||
|
readonly inputStream: NodeJS.ReadableStream; |
||||||
|
/** |
||||||
|
* @deprecated since v14.3.0 - Use `output` instead. |
||||||
|
*/ |
||||||
|
readonly outputStream: NodeJS.WritableStream; |
||||||
|
/** |
||||||
|
* The `Readable` stream from which REPL input will be read. |
||||||
|
*/ |
||||||
|
readonly input: NodeJS.ReadableStream; |
||||||
|
/** |
||||||
|
* The `Writable` stream to which REPL output will be written. |
||||||
|
*/ |
||||||
|
readonly output: NodeJS.WritableStream; |
||||||
|
/** |
||||||
|
* The commands registered via `replServer.defineCommand()`. |
||||||
|
*/ |
||||||
|
readonly commands: NodeJS.ReadOnlyDict<REPLCommand>; |
||||||
|
/** |
||||||
|
* A value indicating whether the REPL is currently in "editor mode". |
||||||
|
* |
||||||
|
* @see https://nodejs.org/dist/latest-v10.x/docs/api/repl.html#repl_commands_and_special_keys
|
||||||
|
*/ |
||||||
|
readonly editorMode: boolean; |
||||||
|
/** |
||||||
|
* A value indicating whether the `_` variable has been assigned. |
||||||
|
* |
||||||
|
* @see https://nodejs.org/dist/latest-v10.x/docs/api/repl.html#repl_assignment_of_the_underscore_variable
|
||||||
|
*/ |
||||||
|
readonly underscoreAssigned: boolean; |
||||||
|
/** |
||||||
|
* The last evaluation result from the REPL (assigned to the `_` variable inside of the REPL). |
||||||
|
* |
||||||
|
* @see https://nodejs.org/dist/latest-v10.x/docs/api/repl.html#repl_assignment_of_the_underscore_variable
|
||||||
|
*/ |
||||||
|
readonly last: any; |
||||||
|
/** |
||||||
|
* A value indicating whether the `_error` variable has been assigned. |
||||||
|
* |
||||||
|
* @since v9.8.0 |
||||||
|
* @see https://nodejs.org/dist/latest-v10.x/docs/api/repl.html#repl_assignment_of_the_underscore_variable
|
||||||
|
*/ |
||||||
|
readonly underscoreErrAssigned: boolean; |
||||||
|
/** |
||||||
|
* The last error raised inside the REPL (assigned to the `_error` variable inside of the REPL). |
||||||
|
* |
||||||
|
* @since v9.8.0 |
||||||
|
* @see https://nodejs.org/dist/latest-v10.x/docs/api/repl.html#repl_assignment_of_the_underscore_variable
|
||||||
|
*/ |
||||||
|
readonly lastError: any; |
||||||
|
/** |
||||||
|
* Specified in the REPL options, this is the function to be used when evaluating each |
||||||
|
* given line of input. If not specified in the REPL options, this is an async wrapper |
||||||
|
* for the JavaScript `eval()` function. |
||||||
|
*/ |
||||||
|
readonly eval: REPLEval; |
||||||
|
/** |
||||||
|
* Specified in the REPL options, this is a value indicating whether the default |
||||||
|
* `writer` function should include ANSI color styling to REPL output. |
||||||
|
*/ |
||||||
|
readonly useColors: boolean; |
||||||
|
/** |
||||||
|
* Specified in the REPL options, this is a value indicating whether the default `eval` |
||||||
|
* function will use the JavaScript `global` as the context as opposed to creating a new |
||||||
|
* separate context for the REPL instance. |
||||||
|
*/ |
||||||
|
readonly useGlobal: boolean; |
||||||
|
/** |
||||||
|
* Specified in the REPL options, this is a value indicating whether the default `writer` |
||||||
|
* function should output the result of a command if it evaluates to `undefined`. |
||||||
|
*/ |
||||||
|
readonly ignoreUndefined: boolean; |
||||||
|
/** |
||||||
|
* Specified in the REPL options, this is the function to invoke to format the output of |
||||||
|
* each command before writing to `outputStream`. If not specified in the REPL options, |
||||||
|
* this will be a wrapper for `util.inspect`. |
||||||
|
*/ |
||||||
|
readonly writer: REPLWriter; |
||||||
|
/** |
||||||
|
* Specified in the REPL options, this is the function to use for custom Tab auto-completion. |
||||||
|
*/ |
||||||
|
readonly completer: Completer | AsyncCompleter; |
||||||
|
/** |
||||||
|
* Specified in the REPL options, this is a flag that specifies whether the default `eval` |
||||||
|
* function should execute all JavaScript commands in strict mode or default (sloppy) mode. |
||||||
|
* Possible values are: |
||||||
|
* - `repl.REPL_MODE_SLOPPY` - evaluates expressions in sloppy mode. |
||||||
|
* - `repl.REPL_MODE_STRICT` - evaluates expressions in strict mode. This is equivalent to |
||||||
|
* prefacing every repl statement with `'use strict'`. |
||||||
|
*/ |
||||||
|
readonly replMode: typeof REPL_MODE_SLOPPY | typeof REPL_MODE_STRICT; |
||||||
|
/** |
||||||
|
* NOTE: According to the documentation: |
||||||
|
* |
||||||
|
* > Instances of `repl.REPLServer` are created using the `repl.start()` method and |
||||||
|
* > _should not_ be created directly using the JavaScript `new` keyword. |
||||||
|
* |
||||||
|
* `REPLServer` cannot be subclassed due to implementation specifics in NodeJS. |
||||||
|
* |
||||||
|
* @see https://nodejs.org/dist/latest-v10.x/docs/api/repl.html#repl_class_replserver
|
||||||
|
*/ |
||||||
|
private constructor(); |
||||||
|
/** |
||||||
|
* The `replServer.defineCommand()` method is used to add new `.`\-prefixed commands |
||||||
|
* to the REPL instance. Such commands are invoked by typing a `.` followed by the`keyword`. The `cmd` is either a `Function` or an `Object` with the following |
||||||
|
* properties: |
||||||
|
* |
||||||
|
* The following example shows two new commands added to the REPL instance: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const repl = require('repl'); |
||||||
|
* |
||||||
|
* const replServer = repl.start({ prompt: '> ' }); |
||||||
|
* replServer.defineCommand('sayhello', { |
||||||
|
* help: 'Say hello', |
||||||
|
* action(name) { |
||||||
|
* this.clearBufferedCommand(); |
||||||
|
* console.log(`Hello, ${name}!`); |
||||||
|
* this.displayPrompt(); |
||||||
|
* } |
||||||
|
* }); |
||||||
|
* replServer.defineCommand('saybye', function saybye() { |
||||||
|
* console.log('Goodbye!'); |
||||||
|
* this.close(); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* The new commands can then be used from within the REPL instance: |
||||||
|
* |
||||||
|
* ```console
|
||||||
|
* > .sayhello Node.js User |
||||||
|
* Hello, Node.js User! |
||||||
|
* > .saybye |
||||||
|
* Goodbye! |
||||||
|
* ``` |
||||||
|
* @since v0.3.0 |
||||||
|
* @param keyword The command keyword (_without_ a leading `.` character). |
||||||
|
* @param cmd The function to invoke when the command is processed. |
||||||
|
*/ |
||||||
|
defineCommand(keyword: string, cmd: REPLCommandAction | REPLCommand): void; |
||||||
|
/** |
||||||
|
* The `replServer.displayPrompt()` method readies the REPL instance for input |
||||||
|
* from the user, printing the configured `prompt` to a new line in the `output`and resuming the `input` to accept new input. |
||||||
|
* |
||||||
|
* When multi-line input is being entered, an ellipsis is printed rather than the |
||||||
|
* 'prompt'. |
||||||
|
* |
||||||
|
* When `preserveCursor` is `true`, the cursor placement will not be reset to `0`. |
||||||
|
* |
||||||
|
* The `replServer.displayPrompt` method is primarily intended to be called from |
||||||
|
* within the action function for commands registered using the`replServer.defineCommand()` method. |
||||||
|
* @since v0.1.91 |
||||||
|
*/ |
||||||
|
displayPrompt(preserveCursor?: boolean): void; |
||||||
|
/** |
||||||
|
* The `replServer.clearBufferedCommand()` method clears any command that has been |
||||||
|
* buffered but not yet executed. This method is primarily intended to be |
||||||
|
* called from within the action function for commands registered using the`replServer.defineCommand()` method. |
||||||
|
* @since v9.0.0 |
||||||
|
*/ |
||||||
|
clearBufferedCommand(): void; |
||||||
|
/** |
||||||
|
* Initializes a history log file for the REPL instance. When executing the |
||||||
|
* Node.js binary and using the command-line REPL, a history file is initialized |
||||||
|
* by default. However, this is not the case when creating a REPL |
||||||
|
* programmatically. Use this method to initialize a history log file when working |
||||||
|
* with REPL instances programmatically. |
||||||
|
* @since v11.10.0 |
||||||
|
* @param historyPath the path to the history file |
||||||
|
* @param callback called when history writes are ready or upon error |
||||||
|
*/ |
||||||
|
setupHistory(path: string, callback: (err: Error | null, repl: this) => void): void; |
||||||
|
/** |
||||||
|
* events.EventEmitter |
||||||
|
* 1. close - inherited from `readline.Interface` |
||||||
|
* 2. line - inherited from `readline.Interface` |
||||||
|
* 3. pause - inherited from `readline.Interface` |
||||||
|
* 4. resume - inherited from `readline.Interface` |
||||||
|
* 5. SIGCONT - inherited from `readline.Interface` |
||||||
|
* 6. SIGINT - inherited from `readline.Interface` |
||||||
|
* 7. SIGTSTP - inherited from `readline.Interface` |
||||||
|
* 8. exit |
||||||
|
* 9. reset |
||||||
|
*/ |
||||||
|
addListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
addListener(event: 'close', listener: () => void): this; |
||||||
|
addListener(event: 'line', listener: (input: string) => void): this; |
||||||
|
addListener(event: 'pause', listener: () => void): this; |
||||||
|
addListener(event: 'resume', listener: () => void): this; |
||||||
|
addListener(event: 'SIGCONT', listener: () => void): this; |
||||||
|
addListener(event: 'SIGINT', listener: () => void): this; |
||||||
|
addListener(event: 'SIGTSTP', listener: () => void): this; |
||||||
|
addListener(event: 'exit', listener: () => void): this; |
||||||
|
addListener(event: 'reset', listener: (context: Context) => void): this; |
||||||
|
emit(event: string | symbol, ...args: any[]): boolean; |
||||||
|
emit(event: 'close'): boolean; |
||||||
|
emit(event: 'line', input: string): boolean; |
||||||
|
emit(event: 'pause'): boolean; |
||||||
|
emit(event: 'resume'): boolean; |
||||||
|
emit(event: 'SIGCONT'): boolean; |
||||||
|
emit(event: 'SIGINT'): boolean; |
||||||
|
emit(event: 'SIGTSTP'): boolean; |
||||||
|
emit(event: 'exit'): boolean; |
||||||
|
emit(event: 'reset', context: Context): boolean; |
||||||
|
on(event: string, listener: (...args: any[]) => void): this; |
||||||
|
on(event: 'close', listener: () => void): this; |
||||||
|
on(event: 'line', listener: (input: string) => void): this; |
||||||
|
on(event: 'pause', listener: () => void): this; |
||||||
|
on(event: 'resume', listener: () => void): this; |
||||||
|
on(event: 'SIGCONT', listener: () => void): this; |
||||||
|
on(event: 'SIGINT', listener: () => void): this; |
||||||
|
on(event: 'SIGTSTP', listener: () => void): this; |
||||||
|
on(event: 'exit', listener: () => void): this; |
||||||
|
on(event: 'reset', listener: (context: Context) => void): this; |
||||||
|
once(event: string, listener: (...args: any[]) => void): this; |
||||||
|
once(event: 'close', listener: () => void): this; |
||||||
|
once(event: 'line', listener: (input: string) => void): this; |
||||||
|
once(event: 'pause', listener: () => void): this; |
||||||
|
once(event: 'resume', listener: () => void): this; |
||||||
|
once(event: 'SIGCONT', listener: () => void): this; |
||||||
|
once(event: 'SIGINT', listener: () => void): this; |
||||||
|
once(event: 'SIGTSTP', listener: () => void): this; |
||||||
|
once(event: 'exit', listener: () => void): this; |
||||||
|
once(event: 'reset', listener: (context: Context) => void): this; |
||||||
|
prependListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
prependListener(event: 'close', listener: () => void): this; |
||||||
|
prependListener(event: 'line', listener: (input: string) => void): this; |
||||||
|
prependListener(event: 'pause', listener: () => void): this; |
||||||
|
prependListener(event: 'resume', listener: () => void): this; |
||||||
|
prependListener(event: 'SIGCONT', listener: () => void): this; |
||||||
|
prependListener(event: 'SIGINT', listener: () => void): this; |
||||||
|
prependListener(event: 'SIGTSTP', listener: () => void): this; |
||||||
|
prependListener(event: 'exit', listener: () => void): this; |
||||||
|
prependListener(event: 'reset', listener: (context: Context) => void): this; |
||||||
|
prependOnceListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
prependOnceListener(event: 'close', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'line', listener: (input: string) => void): this; |
||||||
|
prependOnceListener(event: 'pause', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'resume', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'SIGCONT', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'SIGINT', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'SIGTSTP', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'exit', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'reset', listener: (context: Context) => void): this; |
||||||
|
} |
||||||
|
/** |
||||||
|
* A flag passed in the REPL options. Evaluates expressions in sloppy mode. |
||||||
|
*/ |
||||||
|
const REPL_MODE_SLOPPY: unique symbol; |
||||||
|
/** |
||||||
|
* A flag passed in the REPL options. Evaluates expressions in strict mode. |
||||||
|
* This is equivalent to prefacing every repl statement with `'use strict'`. |
||||||
|
*/ |
||||||
|
const REPL_MODE_STRICT: unique symbol; |
||||||
|
/** |
||||||
|
* The `repl.start()` method creates and starts a {@link REPLServer} instance. |
||||||
|
* |
||||||
|
* If `options` is a string, then it specifies the input prompt: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const repl = require('repl'); |
||||||
|
* |
||||||
|
* // a Unix style prompt
|
||||||
|
* repl.start('$ '); |
||||||
|
* ``` |
||||||
|
* @since v0.1.91 |
||||||
|
*/ |
||||||
|
function start(options?: string | ReplOptions): REPLServer; |
||||||
|
/** |
||||||
|
* Indicates a recoverable error that a `REPLServer` can use to support multi-line input. |
||||||
|
* |
||||||
|
* @see https://nodejs.org/dist/latest-v10.x/docs/api/repl.html#repl_recoverable_errors
|
||||||
|
*/ |
||||||
|
class Recoverable extends SyntaxError { |
||||||
|
err: Error; |
||||||
|
constructor(err: Error); |
||||||
|
} |
||||||
|
} |
||||||
|
declare module 'node:repl' { |
||||||
|
export * from 'repl'; |
||||||
|
} |
File diff suppressed because it is too large
Load Diff
@ -0,0 +1,24 @@ |
|||||||
|
// Duplicates of interface in lib.dom.ts.
|
||||||
|
// Duplicated here rather than referencing lib.dom.ts because doing so causes lib.dom.ts to be loaded for "test-all"
|
||||||
|
// Which in turn causes tests to pass that shouldn't pass.
|
||||||
|
//
|
||||||
|
// This interface is not, and should not be, exported.
|
||||||
|
interface Blob { |
||||||
|
readonly size: number; |
||||||
|
readonly type: string; |
||||||
|
arrayBuffer(): Promise<ArrayBuffer>; |
||||||
|
slice(start?: number, end?: number, contentType?: string): Blob; |
||||||
|
stream(): NodeJS.ReadableStream; |
||||||
|
text(): Promise<string>; |
||||||
|
} |
||||||
|
declare module 'stream/consumers' { |
||||||
|
import { Readable } from 'node:stream'; |
||||||
|
function buffer(stream: NodeJS.ReadableStream | Readable | AsyncIterator<any>): Promise<Buffer>; |
||||||
|
function text(stream: NodeJS.ReadableStream | Readable | AsyncIterator<any>): Promise<string>; |
||||||
|
function arrayBuffer(stream: NodeJS.ReadableStream | Readable | AsyncIterator<any>): Promise<ArrayBuffer>; |
||||||
|
function blob(stream: NodeJS.ReadableStream | Readable | AsyncIterator<any>): Promise<Blob>; |
||||||
|
function json(stream: NodeJS.ReadableStream | Readable | AsyncIterator<any>): Promise<unknown>; |
||||||
|
} |
||||||
|
declare module 'node:stream/consumers' { |
||||||
|
export * from 'stream/consumers'; |
||||||
|
} |
@ -0,0 +1,42 @@ |
|||||||
|
declare module 'stream/promises' { |
||||||
|
import { FinishedOptions, PipelineSource, PipelineTransform, PipelineDestination, PipelinePromise, PipelineOptions } from 'node:stream'; |
||||||
|
function finished(stream: NodeJS.ReadableStream | NodeJS.WritableStream | NodeJS.ReadWriteStream, options?: FinishedOptions): Promise<void>; |
||||||
|
function pipeline<A extends PipelineSource<any>, B extends PipelineDestination<A, any>>(source: A, destination: B, options?: PipelineOptions): PipelinePromise<B>; |
||||||
|
function pipeline<A extends PipelineSource<any>, T1 extends PipelineTransform<A, any>, B extends PipelineDestination<T1, any>>( |
||||||
|
source: A, |
||||||
|
transform1: T1, |
||||||
|
destination: B, |
||||||
|
options?: PipelineOptions |
||||||
|
): PipelinePromise<B>; |
||||||
|
function pipeline<A extends PipelineSource<any>, T1 extends PipelineTransform<A, any>, T2 extends PipelineTransform<T1, any>, B extends PipelineDestination<T2, any>>( |
||||||
|
source: A, |
||||||
|
transform1: T1, |
||||||
|
transform2: T2, |
||||||
|
destination: B, |
||||||
|
options?: PipelineOptions |
||||||
|
): PipelinePromise<B>; |
||||||
|
function pipeline< |
||||||
|
A extends PipelineSource<any>, |
||||||
|
T1 extends PipelineTransform<A, any>, |
||||||
|
T2 extends PipelineTransform<T1, any>, |
||||||
|
T3 extends PipelineTransform<T2, any>, |
||||||
|
B extends PipelineDestination<T3, any> |
||||||
|
>(source: A, transform1: T1, transform2: T2, transform3: T3, destination: B, options?: PipelineOptions): PipelinePromise<B>; |
||||||
|
function pipeline< |
||||||
|
A extends PipelineSource<any>, |
||||||
|
T1 extends PipelineTransform<A, any>, |
||||||
|
T2 extends PipelineTransform<T1, any>, |
||||||
|
T3 extends PipelineTransform<T2, any>, |
||||||
|
T4 extends PipelineTransform<T3, any>, |
||||||
|
B extends PipelineDestination<T4, any> |
||||||
|
>(source: A, transform1: T1, transform2: T2, transform3: T3, transform4: T4, destination: B, options?: PipelineOptions): PipelinePromise<B>; |
||||||
|
function pipeline(streams: ReadonlyArray<NodeJS.ReadableStream | NodeJS.WritableStream | NodeJS.ReadWriteStream>, options?: PipelineOptions): Promise<void>; |
||||||
|
function pipeline( |
||||||
|
stream1: NodeJS.ReadableStream, |
||||||
|
stream2: NodeJS.ReadWriteStream | NodeJS.WritableStream, |
||||||
|
...streams: Array<NodeJS.ReadWriteStream | NodeJS.WritableStream | PipelineOptions> |
||||||
|
): Promise<void>; |
||||||
|
} |
||||||
|
declare module 'node:stream/promises' { |
||||||
|
export * from 'stream/promises'; |
||||||
|
} |
@ -0,0 +1,330 @@ |
|||||||
|
declare module 'stream/web' { |
||||||
|
// stub module, pending copy&paste from .d.ts or manual impl
|
||||||
|
// copy from lib.dom.d.ts
|
||||||
|
interface ReadableWritablePair<R = any, W = any> { |
||||||
|
readable: ReadableStream<R>; |
||||||
|
/** |
||||||
|
* Provides a convenient, chainable way of piping this readable stream |
||||||
|
* through a transform stream (or any other { writable, readable } |
||||||
|
* pair). It simply pipes the stream into the writable side of the |
||||||
|
* supplied pair, and returns the readable side for further use. |
||||||
|
* |
||||||
|
* Piping a stream will lock it for the duration of the pipe, preventing |
||||||
|
* any other consumer from acquiring a reader. |
||||||
|
*/ |
||||||
|
writable: WritableStream<W>; |
||||||
|
} |
||||||
|
interface StreamPipeOptions { |
||||||
|
preventAbort?: boolean; |
||||||
|
preventCancel?: boolean; |
||||||
|
/** |
||||||
|
* Pipes this readable stream to a given writable stream destination. |
||||||
|
* The way in which the piping process behaves under various error |
||||||
|
* conditions can be customized with a number of passed options. It |
||||||
|
* returns a promise that fulfills when the piping process completes |
||||||
|
* successfully, or rejects if any errors were encountered. |
||||||
|
* |
||||||
|
* Piping a stream will lock it for the duration of the pipe, preventing |
||||||
|
* any other consumer from acquiring a reader. |
||||||
|
* |
||||||
|
* Errors and closures of the source and destination streams propagate |
||||||
|
* as follows: |
||||||
|
* |
||||||
|
* An error in this source readable stream will abort destination, |
||||||
|
* unless preventAbort is truthy. The returned promise will be rejected |
||||||
|
* with the source's error, or with any error that occurs during |
||||||
|
* aborting the destination. |
||||||
|
* |
||||||
|
* An error in destination will cancel this source readable stream, |
||||||
|
* unless preventCancel is truthy. The returned promise will be rejected |
||||||
|
* with the destination's error, or with any error that occurs during |
||||||
|
* canceling the source. |
||||||
|
* |
||||||
|
* When this source readable stream closes, destination will be closed, |
||||||
|
* unless preventClose is truthy. The returned promise will be fulfilled |
||||||
|
* once this process completes, unless an error is encountered while |
||||||
|
* closing the destination, in which case it will be rejected with that |
||||||
|
* error. |
||||||
|
* |
||||||
|
* If destination starts out closed or closing, this source readable |
||||||
|
* stream will be canceled, unless preventCancel is true. The returned |
||||||
|
* promise will be rejected with an error indicating piping to a closed |
||||||
|
* stream failed, or with any error that occurs during canceling the |
||||||
|
* source. |
||||||
|
* |
||||||
|
* The signal option can be set to an AbortSignal to allow aborting an |
||||||
|
* ongoing pipe operation via the corresponding AbortController. In this |
||||||
|
* case, this source readable stream will be canceled, and destination |
||||||
|
* aborted, unless the respective options preventCancel or preventAbort |
||||||
|
* are set. |
||||||
|
*/ |
||||||
|
preventClose?: boolean; |
||||||
|
signal?: AbortSignal; |
||||||
|
} |
||||||
|
interface ReadableStreamGenericReader { |
||||||
|
readonly closed: Promise<undefined>; |
||||||
|
cancel(reason?: any): Promise<void>; |
||||||
|
} |
||||||
|
interface ReadableStreamDefaultReadValueResult<T> { |
||||||
|
done: false; |
||||||
|
value: T; |
||||||
|
} |
||||||
|
interface ReadableStreamDefaultReadDoneResult { |
||||||
|
done: true; |
||||||
|
value?: undefined; |
||||||
|
} |
||||||
|
type ReadableStreamController<T> = ReadableStreamDefaultController<T>; |
||||||
|
type ReadableStreamDefaultReadResult<T> = ReadableStreamDefaultReadValueResult<T> | ReadableStreamDefaultReadDoneResult; |
||||||
|
interface ReadableByteStreamControllerCallback { |
||||||
|
(controller: ReadableByteStreamController): void | PromiseLike<void>; |
||||||
|
} |
||||||
|
interface UnderlyingSinkAbortCallback { |
||||||
|
(reason?: any): void | PromiseLike<void>; |
||||||
|
} |
||||||
|
interface UnderlyingSinkCloseCallback { |
||||||
|
(): void | PromiseLike<void>; |
||||||
|
} |
||||||
|
interface UnderlyingSinkStartCallback { |
||||||
|
(controller: WritableStreamDefaultController): any; |
||||||
|
} |
||||||
|
interface UnderlyingSinkWriteCallback<W> { |
||||||
|
(chunk: W, controller: WritableStreamDefaultController): void | PromiseLike<void>; |
||||||
|
} |
||||||
|
interface UnderlyingSourceCancelCallback { |
||||||
|
(reason?: any): void | PromiseLike<void>; |
||||||
|
} |
||||||
|
interface UnderlyingSourcePullCallback<R> { |
||||||
|
(controller: ReadableStreamController<R>): void | PromiseLike<void>; |
||||||
|
} |
||||||
|
interface UnderlyingSourceStartCallback<R> { |
||||||
|
(controller: ReadableStreamController<R>): any; |
||||||
|
} |
||||||
|
interface TransformerFlushCallback<O> { |
||||||
|
(controller: TransformStreamDefaultController<O>): void | PromiseLike<void>; |
||||||
|
} |
||||||
|
interface TransformerStartCallback<O> { |
||||||
|
(controller: TransformStreamDefaultController<O>): any; |
||||||
|
} |
||||||
|
interface TransformerTransformCallback<I, O> { |
||||||
|
(chunk: I, controller: TransformStreamDefaultController<O>): void | PromiseLike<void>; |
||||||
|
} |
||||||
|
interface UnderlyingByteSource { |
||||||
|
autoAllocateChunkSize?: number; |
||||||
|
cancel?: ReadableStreamErrorCallback; |
||||||
|
pull?: ReadableByteStreamControllerCallback; |
||||||
|
start?: ReadableByteStreamControllerCallback; |
||||||
|
type: 'bytes'; |
||||||
|
} |
||||||
|
interface UnderlyingSource<R = any> { |
||||||
|
cancel?: UnderlyingSourceCancelCallback; |
||||||
|
pull?: UnderlyingSourcePullCallback<R>; |
||||||
|
start?: UnderlyingSourceStartCallback<R>; |
||||||
|
type?: undefined; |
||||||
|
} |
||||||
|
interface UnderlyingSink<W = any> { |
||||||
|
abort?: UnderlyingSinkAbortCallback; |
||||||
|
close?: UnderlyingSinkCloseCallback; |
||||||
|
start?: UnderlyingSinkStartCallback; |
||||||
|
type?: undefined; |
||||||
|
write?: UnderlyingSinkWriteCallback<W>; |
||||||
|
} |
||||||
|
interface ReadableStreamErrorCallback { |
||||||
|
(reason: any): void | PromiseLike<void>; |
||||||
|
} |
||||||
|
/** This Streams API interface represents a readable stream of byte data. */ |
||||||
|
interface ReadableStream<R = any> { |
||||||
|
readonly locked: boolean; |
||||||
|
cancel(reason?: any): Promise<void>; |
||||||
|
getReader(): ReadableStreamDefaultReader<R>; |
||||||
|
pipeThrough<T>(transform: ReadableWritablePair<T, R>, options?: StreamPipeOptions): ReadableStream<T>; |
||||||
|
pipeTo(destination: WritableStream<R>, options?: StreamPipeOptions): Promise<void>; |
||||||
|
tee(): [ReadableStream<R>, ReadableStream<R>]; |
||||||
|
values(options?: { preventCancel?: boolean }): AsyncIterableIterator<R>; |
||||||
|
[Symbol.asyncIterator](): AsyncIterableIterator<R>; |
||||||
|
} |
||||||
|
const ReadableStream: { |
||||||
|
prototype: ReadableStream; |
||||||
|
new (underlyingSource: UnderlyingByteSource, strategy?: QueuingStrategy<Uint8Array>): ReadableStream<Uint8Array>; |
||||||
|
new <R = any>(underlyingSource?: UnderlyingSource<R>, strategy?: QueuingStrategy<R>): ReadableStream<R>; |
||||||
|
}; |
||||||
|
interface ReadableStreamDefaultReader<R = any> extends ReadableStreamGenericReader { |
||||||
|
read(): Promise<ReadableStreamDefaultReadResult<R>>; |
||||||
|
releaseLock(): void; |
||||||
|
} |
||||||
|
const ReadableStreamDefaultReader: { |
||||||
|
prototype: ReadableStreamDefaultReader; |
||||||
|
new <R = any>(stream: ReadableStream<R>): ReadableStreamDefaultReader<R>; |
||||||
|
}; |
||||||
|
const ReadableStreamBYOBReader: any; |
||||||
|
const ReadableStreamBYOBRequest: any; |
||||||
|
interface ReadableByteStreamController { |
||||||
|
readonly byobRequest: undefined; |
||||||
|
readonly desiredSize: number | null; |
||||||
|
close(): void; |
||||||
|
enqueue(chunk: ArrayBufferView): void; |
||||||
|
error(error?: any): void; |
||||||
|
} |
||||||
|
const ReadableByteStreamController: { |
||||||
|
prototype: ReadableByteStreamController; |
||||||
|
new (): ReadableByteStreamController; |
||||||
|
}; |
||||||
|
interface ReadableStreamDefaultController<R = any> { |
||||||
|
readonly desiredSize: number | null; |
||||||
|
close(): void; |
||||||
|
enqueue(chunk?: R): void; |
||||||
|
error(e?: any): void; |
||||||
|
} |
||||||
|
const ReadableStreamDefaultController: { |
||||||
|
prototype: ReadableStreamDefaultController; |
||||||
|
new (): ReadableStreamDefaultController; |
||||||
|
}; |
||||||
|
interface Transformer<I = any, O = any> { |
||||||
|
flush?: TransformerFlushCallback<O>; |
||||||
|
readableType?: undefined; |
||||||
|
start?: TransformerStartCallback<O>; |
||||||
|
transform?: TransformerTransformCallback<I, O>; |
||||||
|
writableType?: undefined; |
||||||
|
} |
||||||
|
interface TransformStream<I = any, O = any> { |
||||||
|
readonly readable: ReadableStream<O>; |
||||||
|
readonly writable: WritableStream<I>; |
||||||
|
} |
||||||
|
const TransformStream: { |
||||||
|
prototype: TransformStream; |
||||||
|
new <I = any, O = any>(transformer?: Transformer<I, O>, writableStrategy?: QueuingStrategy<I>, readableStrategy?: QueuingStrategy<O>): TransformStream<I, O>; |
||||||
|
}; |
||||||
|
interface TransformStreamDefaultController<O = any> { |
||||||
|
readonly desiredSize: number | null; |
||||||
|
enqueue(chunk?: O): void; |
||||||
|
error(reason?: any): void; |
||||||
|
terminate(): void; |
||||||
|
} |
||||||
|
const TransformStreamDefaultController: { |
||||||
|
prototype: TransformStreamDefaultController; |
||||||
|
new (): TransformStreamDefaultController; |
||||||
|
}; |
||||||
|
/** |
||||||
|
* This Streams API interface provides a standard abstraction for writing |
||||||
|
* streaming data to a destination, known as a sink. This object comes with |
||||||
|
* built-in back pressure and queuing. |
||||||
|
*/ |
||||||
|
interface WritableStream<W = any> { |
||||||
|
readonly locked: boolean; |
||||||
|
abort(reason?: any): Promise<void>; |
||||||
|
close(): Promise<void>; |
||||||
|
getWriter(): WritableStreamDefaultWriter<W>; |
||||||
|
} |
||||||
|
const WritableStream: { |
||||||
|
prototype: WritableStream; |
||||||
|
new <W = any>(underlyingSink?: UnderlyingSink<W>, strategy?: QueuingStrategy<W>): WritableStream<W>; |
||||||
|
}; |
||||||
|
/** |
||||||
|
* This Streams API interface is the object returned by |
||||||
|
* WritableStream.getWriter() and once created locks the < writer to the |
||||||
|
* WritableStream ensuring that no other streams can write to the underlying |
||||||
|
* sink. |
||||||
|
*/ |
||||||
|
interface WritableStreamDefaultWriter<W = any> { |
||||||
|
readonly closed: Promise<undefined>; |
||||||
|
readonly desiredSize: number | null; |
||||||
|
readonly ready: Promise<undefined>; |
||||||
|
abort(reason?: any): Promise<void>; |
||||||
|
close(): Promise<void>; |
||||||
|
releaseLock(): void; |
||||||
|
write(chunk?: W): Promise<void>; |
||||||
|
} |
||||||
|
const WritableStreamDefaultWriter: { |
||||||
|
prototype: WritableStreamDefaultWriter; |
||||||
|
new <W = any>(stream: WritableStream<W>): WritableStreamDefaultWriter<W>; |
||||||
|
}; |
||||||
|
/** |
||||||
|
* This Streams API interface represents a controller allowing control of a |
||||||
|
* WritableStream's state. When constructing a WritableStream, the |
||||||
|
* underlying sink is given a corresponding WritableStreamDefaultController |
||||||
|
* instance to manipulate. |
||||||
|
*/ |
||||||
|
interface WritableStreamDefaultController { |
||||||
|
error(e?: any): void; |
||||||
|
} |
||||||
|
const WritableStreamDefaultController: { |
||||||
|
prototype: WritableStreamDefaultController; |
||||||
|
new (): WritableStreamDefaultController; |
||||||
|
}; |
||||||
|
interface QueuingStrategy<T = any> { |
||||||
|
highWaterMark?: number; |
||||||
|
size?: QueuingStrategySize<T>; |
||||||
|
} |
||||||
|
interface QueuingStrategySize<T = any> { |
||||||
|
(chunk?: T): number; |
||||||
|
} |
||||||
|
interface QueuingStrategyInit { |
||||||
|
/** |
||||||
|
* Creates a new ByteLengthQueuingStrategy with the provided high water |
||||||
|
* mark. |
||||||
|
* |
||||||
|
* Note that the provided high water mark will not be validated ahead of |
||||||
|
* time. Instead, if it is negative, NaN, or not a number, the resulting |
||||||
|
* ByteLengthQueuingStrategy will cause the corresponding stream |
||||||
|
* constructor to throw. |
||||||
|
*/ |
||||||
|
highWaterMark: number; |
||||||
|
} |
||||||
|
/** |
||||||
|
* This Streams API interface provides a built-in byte length queuing |
||||||
|
* strategy that can be used when constructing streams. |
||||||
|
*/ |
||||||
|
interface ByteLengthQueuingStrategy extends QueuingStrategy<ArrayBufferView> { |
||||||
|
readonly highWaterMark: number; |
||||||
|
readonly size: QueuingStrategySize<ArrayBufferView>; |
||||||
|
} |
||||||
|
const ByteLengthQueuingStrategy: { |
||||||
|
prototype: ByteLengthQueuingStrategy; |
||||||
|
new (init: QueuingStrategyInit): ByteLengthQueuingStrategy; |
||||||
|
}; |
||||||
|
/** |
||||||
|
* This Streams API interface provides a built-in byte length queuing |
||||||
|
* strategy that can be used when constructing streams. |
||||||
|
*/ |
||||||
|
interface CountQueuingStrategy extends QueuingStrategy { |
||||||
|
readonly highWaterMark: number; |
||||||
|
readonly size: QueuingStrategySize; |
||||||
|
} |
||||||
|
const CountQueuingStrategy: { |
||||||
|
prototype: CountQueuingStrategy; |
||||||
|
new (init: QueuingStrategyInit): CountQueuingStrategy; |
||||||
|
}; |
||||||
|
interface TextEncoderStream { |
||||||
|
/** Returns "utf-8". */ |
||||||
|
readonly encoding: 'utf-8'; |
||||||
|
readonly readable: ReadableStream<Uint8Array>; |
||||||
|
readonly writable: WritableStream<string>; |
||||||
|
readonly [Symbol.toStringTag]: string; |
||||||
|
} |
||||||
|
const TextEncoderStream: { |
||||||
|
prototype: TextEncoderStream; |
||||||
|
new (): TextEncoderStream; |
||||||
|
}; |
||||||
|
interface TextDecoderOptions { |
||||||
|
fatal?: boolean; |
||||||
|
ignoreBOM?: boolean; |
||||||
|
} |
||||||
|
type BufferSource = ArrayBufferView | ArrayBuffer; |
||||||
|
interface TextDecoderStream { |
||||||
|
/** Returns encoding's name, lower cased. */ |
||||||
|
readonly encoding: string; |
||||||
|
/** Returns `true` if error mode is "fatal", and `false` otherwise. */ |
||||||
|
readonly fatal: boolean; |
||||||
|
/** Returns `true` if ignore BOM flag is set, and `false` otherwise. */ |
||||||
|
readonly ignoreBOM: boolean; |
||||||
|
readonly readable: ReadableStream<string>; |
||||||
|
readonly writable: WritableStream<BufferSource>; |
||||||
|
readonly [Symbol.toStringTag]: string; |
||||||
|
} |
||||||
|
const TextDecoderStream: { |
||||||
|
prototype: TextDecoderStream; |
||||||
|
new (label?: string, options?: TextDecoderOptions): TextDecoderStream; |
||||||
|
}; |
||||||
|
} |
||||||
|
declare module 'node:stream/web' { |
||||||
|
export * from 'stream/web'; |
||||||
|
} |
@ -0,0 +1,67 @@ |
|||||||
|
/** |
||||||
|
* The `string_decoder` module provides an API for decoding `Buffer` objects into |
||||||
|
* strings in a manner that preserves encoded multi-byte UTF-8 and UTF-16 |
||||||
|
* characters. It can be accessed using: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { StringDecoder } = require('string_decoder'); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* The following example shows the basic use of the `StringDecoder` class. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { StringDecoder } = require('string_decoder'); |
||||||
|
* const decoder = new StringDecoder('utf8'); |
||||||
|
* |
||||||
|
* const cent = Buffer.from([0xC2, 0xA2]); |
||||||
|
* console.log(decoder.write(cent)); |
||||||
|
* |
||||||
|
* const euro = Buffer.from([0xE2, 0x82, 0xAC]); |
||||||
|
* console.log(decoder.write(euro)); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* When a `Buffer` instance is written to the `StringDecoder` instance, an |
||||||
|
* internal buffer is used to ensure that the decoded string does not contain |
||||||
|
* any incomplete multibyte characters. These are held in the buffer until the |
||||||
|
* next call to `stringDecoder.write()` or until `stringDecoder.end()` is called. |
||||||
|
* |
||||||
|
* In the following example, the three UTF-8 encoded bytes of the European Euro |
||||||
|
* symbol (`€`) are written over three separate operations: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { StringDecoder } = require('string_decoder'); |
||||||
|
* const decoder = new StringDecoder('utf8'); |
||||||
|
* |
||||||
|
* decoder.write(Buffer.from([0xE2])); |
||||||
|
* decoder.write(Buffer.from([0x82])); |
||||||
|
* console.log(decoder.end(Buffer.from([0xAC]))); |
||||||
|
* ``` |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/string_decoder.js)
|
||||||
|
*/ |
||||||
|
declare module 'string_decoder' { |
||||||
|
class StringDecoder { |
||||||
|
constructor(encoding?: BufferEncoding); |
||||||
|
/** |
||||||
|
* Returns a decoded string, ensuring that any incomplete multibyte characters at |
||||||
|
* the end of the `Buffer`, or `TypedArray`, or `DataView` are omitted from the |
||||||
|
* returned string and stored in an internal buffer for the next call to`stringDecoder.write()` or `stringDecoder.end()`. |
||||||
|
* @since v0.1.99 |
||||||
|
* @param buffer A `Buffer`, or `TypedArray`, or `DataView` containing the bytes to decode. |
||||||
|
*/ |
||||||
|
write(buffer: Buffer): string; |
||||||
|
/** |
||||||
|
* Returns any remaining input stored in the internal buffer as a string. Bytes |
||||||
|
* representing incomplete UTF-8 and UTF-16 characters will be replaced with |
||||||
|
* substitution characters appropriate for the character encoding. |
||||||
|
* |
||||||
|
* If the `buffer` argument is provided, one final call to `stringDecoder.write()`is performed before returning the remaining input. |
||||||
|
* After `end()` is called, the `stringDecoder` object can be reused for new input. |
||||||
|
* @since v0.9.3 |
||||||
|
* @param buffer A `Buffer`, or `TypedArray`, or `DataView` containing the bytes to decode. |
||||||
|
*/ |
||||||
|
end(buffer?: Buffer): string; |
||||||
|
} |
||||||
|
} |
||||||
|
declare module 'node:string_decoder' { |
||||||
|
export * from 'string_decoder'; |
||||||
|
} |
@ -0,0 +1,176 @@ |
|||||||
|
/** |
||||||
|
* The `node:test` module provides a standalone testing module.
|
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/test.js)
|
||||||
|
*/ |
||||||
|
declare module 'node:test' { |
||||||
|
/** |
||||||
|
* The `test()` function is the value imported from the test module. Each invocation of this |
||||||
|
* function results in the creation of a test point in the TAP output. |
||||||
|
* |
||||||
|
* The {@link TestContext} object passed to the fn argument can be used to perform actions |
||||||
|
* related to the current test. Examples include skipping the test, adding additional TAP |
||||||
|
* diagnostic information, or creating subtests. |
||||||
|
* |
||||||
|
* `test()` returns a {@link Promise} that resolves once the test completes. The return value |
||||||
|
* can usually be discarded for top level tests. However, the return value from subtests should |
||||||
|
* be used to prevent the parent test from finishing first and cancelling the subtest as shown |
||||||
|
* in the following example. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* test('top level test', async (t) => { |
||||||
|
* // The setTimeout() in the following subtest would cause it to outlive its
|
||||||
|
* // parent test if 'await' is removed on the next line. Once the parent test
|
||||||
|
* // completes, it will cancel any outstanding subtests.
|
||||||
|
* await t.test('longer running subtest', async (t) => { |
||||||
|
* return new Promise((resolve, reject) => { |
||||||
|
* setTimeout(resolve, 1000); |
||||||
|
* }); |
||||||
|
* }); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* @since v18.0.0 |
||||||
|
* @param name The name of the test, which is displayed when reporting test results. |
||||||
|
* Default: The `name` property of fn, or `'<anonymous>'` if `fn` does not have a name. |
||||||
|
* @param options Configuration options for the test |
||||||
|
* @param fn The function under test. The first argument to this function is a |
||||||
|
* {@link TestContext} object. If the test uses callbacks, the callback function is |
||||||
|
* passed as the second argument. Default: A no-op function. |
||||||
|
* @returns A {@link Promise} resolved with `undefined` once the test completes. |
||||||
|
*/ |
||||||
|
function test(name?: string, fn?: TestFn): Promise<void>; |
||||||
|
function test(name?: string, options?: TestOptions, fn?: TestFn): Promise<void>; |
||||||
|
function test(options?: TestOptions, fn?: TestFn): Promise<void>; |
||||||
|
function test(fn?: TestFn): Promise<void>; |
||||||
|
|
||||||
|
/* |
||||||
|
* @since v18.6.0 |
||||||
|
* @param name The name of the suite, which is displayed when reporting suite results. |
||||||
|
* Default: The `name` property of fn, or `'<anonymous>'` if `fn` does not have a name. |
||||||
|
* @param options Configuration options for the suite |
||||||
|
* @param fn The function under suite. Default: A no-op function. |
||||||
|
*/ |
||||||
|
function describe(name?: string, options?: TestOptions, fn?: SuiteFn): void; |
||||||
|
function describe(name?: string, fn?: SuiteFn): void; |
||||||
|
function describe(options?: TestOptions, fn?: SuiteFn): void; |
||||||
|
function describe(fn?: SuiteFn): void; |
||||||
|
|
||||||
|
/* |
||||||
|
* @since v18.6.0 |
||||||
|
* @param name The name of the test, which is displayed when reporting test results. |
||||||
|
* Default: The `name` property of fn, or `'<anonymous>'` if `fn` does not have a name. |
||||||
|
* @param options Configuration options for the test |
||||||
|
* @param fn The function under test. If the test uses callbacks, the callback function is |
||||||
|
* passed as the second argument. Default: A no-op function. |
||||||
|
*/ |
||||||
|
function it(name?: string, options?: TestOptions, fn?: ItFn): void; |
||||||
|
function it(name?: string, fn?: ItFn): void; |
||||||
|
function it(options?: TestOptions, fn?: ItFn): void; |
||||||
|
function it(fn?: ItFn): void; |
||||||
|
|
||||||
|
/** |
||||||
|
* The type of a function under test. The first argument to this function is a |
||||||
|
* {@link TestContext} object. If the test uses callbacks, the callback function is passed as |
||||||
|
* the second argument. |
||||||
|
*/ |
||||||
|
type TestFn = (t: TestContext, done: (result?: any) => void) => any; |
||||||
|
|
||||||
|
/** |
||||||
|
* The type of a function under Suite. |
||||||
|
* If the test uses callbacks, the callback function is passed as an argument |
||||||
|
*/ |
||||||
|
type SuiteFn = (done: (result?: any) => void) => void; |
||||||
|
|
||||||
|
/** |
||||||
|
* The type of a function under test. |
||||||
|
* If the test uses callbacks, the callback function is passed as an argument |
||||||
|
*/ |
||||||
|
type ItFn = (done: (result?: any) => void) => any; |
||||||
|
|
||||||
|
/** |
||||||
|
* An instance of `TestContext` is passed to each test function in order to interact with the |
||||||
|
* test runner. However, the `TestContext` constructor is not exposed as part of the API. |
||||||
|
* @since v18.0.0 |
||||||
|
*/ |
||||||
|
interface TestContext { |
||||||
|
/** |
||||||
|
* This function is used to write TAP diagnostics to the output. Any diagnostic information is |
||||||
|
* included at the end of the test's results. This function does not return a value. |
||||||
|
* @param message Message to be displayed as a TAP diagnostic. |
||||||
|
* @since v18.0.0 |
||||||
|
*/ |
||||||
|
diagnostic(message: string): void; |
||||||
|
|
||||||
|
/** |
||||||
|
* If `shouldRunOnlyTests` is truthy, the test context will only run tests that have the `only` |
||||||
|
* option set. Otherwise, all tests are run. If Node.js was not started with the `--test-only` |
||||||
|
* command-line option, this function is a no-op. |
||||||
|
* @param shouldRunOnlyTests Whether or not to run `only` tests. |
||||||
|
* @since v18.0.0 |
||||||
|
*/ |
||||||
|
runOnly(shouldRunOnlyTests: boolean): void; |
||||||
|
|
||||||
|
/** |
||||||
|
* This function causes the test's output to indicate the test as skipped. If `message` is |
||||||
|
* provided, it is included in the TAP output. Calling `skip()` does not terminate execution of |
||||||
|
* the test function. This function does not return a value. |
||||||
|
* @param message Optional skip message to be displayed in TAP output. |
||||||
|
* @since v18.0.0 |
||||||
|
*/ |
||||||
|
skip(message?: string): void; |
||||||
|
|
||||||
|
/** |
||||||
|
* This function adds a `TODO` directive to the test's output. If `message` is provided, it is |
||||||
|
* included in the TAP output. Calling `todo()` does not terminate execution of the test |
||||||
|
* function. This function does not return a value. |
||||||
|
* @param message Optional `TODO` message to be displayed in TAP output. |
||||||
|
* @since v18.0.0 |
||||||
|
*/ |
||||||
|
todo(message?: string): void; |
||||||
|
|
||||||
|
/** |
||||||
|
* This function is used to create subtests under the current test. This function behaves in |
||||||
|
* the same fashion as the top level {@link test} function. |
||||||
|
* @since v18.0.0 |
||||||
|
* @param name The name of the test, which is displayed when reporting test results. |
||||||
|
* Default: The `name` property of fn, or `'<anonymous>'` if `fn` does not have a name. |
||||||
|
* @param options Configuration options for the test |
||||||
|
* @param fn The function under test. This first argument to this function is a |
||||||
|
* {@link TestContext} object. If the test uses callbacks, the callback function is |
||||||
|
* passed as the second argument. Default: A no-op function. |
||||||
|
* @returns A {@link Promise} resolved with `undefined` once the test completes. |
||||||
|
*/ |
||||||
|
test: typeof test; |
||||||
|
} |
||||||
|
|
||||||
|
interface TestOptions { |
||||||
|
/** |
||||||
|
* The number of tests that can be run at the same time. If unspecified, subtests inherit this |
||||||
|
* value from their parent. |
||||||
|
* @default 1 |
||||||
|
*/ |
||||||
|
concurrency?: number; |
||||||
|
|
||||||
|
/** |
||||||
|
* If truthy, and the test context is configured to run `only` tests, then this test will be |
||||||
|
* run. Otherwise, the test is skipped. |
||||||
|
* @default false |
||||||
|
*/ |
||||||
|
only?: boolean; |
||||||
|
|
||||||
|
/** |
||||||
|
* If truthy, the test is skipped. If a string is provided, that string is displayed in the |
||||||
|
* test results as the reason for skipping the test. |
||||||
|
* @default false |
||||||
|
*/ |
||||||
|
skip?: boolean | string; |
||||||
|
|
||||||
|
/** |
||||||
|
* If truthy, the test marked as `TODO`. If a string is provided, that string is displayed in |
||||||
|
* the test results as the reason why the test is `TODO`. |
||||||
|
* @default false |
||||||
|
*/ |
||||||
|
todo?: boolean | string; |
||||||
|
} |
||||||
|
|
||||||
|
export { test as default, test, describe, it }; |
||||||
|
} |
@ -0,0 +1,94 @@ |
|||||||
|
/** |
||||||
|
* The `timer` module exposes a global API for scheduling functions to |
||||||
|
* be called at some future period of time. Because the timer functions are |
||||||
|
* globals, there is no need to call `require('timers')` to use the API. |
||||||
|
* |
||||||
|
* The timer functions within Node.js implement a similar API as the timers API |
||||||
|
* provided by Web Browsers but use a different internal implementation that is |
||||||
|
* built around the Node.js [Event Loop](https://nodejs.org/en/docs/guides/event-loop-timers-and-nexttick/#setimmediate-vs-settimeout).
|
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/timers.js)
|
||||||
|
*/ |
||||||
|
declare module 'timers' { |
||||||
|
import { Abortable } from 'node:events'; |
||||||
|
import { setTimeout as setTimeoutPromise, setImmediate as setImmediatePromise, setInterval as setIntervalPromise } from 'node:timers/promises'; |
||||||
|
interface TimerOptions extends Abortable { |
||||||
|
/** |
||||||
|
* Set to `false` to indicate that the scheduled `Timeout` |
||||||
|
* should not require the Node.js event loop to remain active. |
||||||
|
* @default true |
||||||
|
*/ |
||||||
|
ref?: boolean | undefined; |
||||||
|
} |
||||||
|
let setTimeout: typeof global.setTimeout; |
||||||
|
let clearTimeout: typeof global.clearTimeout; |
||||||
|
let setInterval: typeof global.setInterval; |
||||||
|
let clearInterval: typeof global.clearInterval; |
||||||
|
let setImmediate: typeof global.setImmediate; |
||||||
|
let clearImmediate: typeof global.clearImmediate; |
||||||
|
global { |
||||||
|
namespace NodeJS { |
||||||
|
// compatibility with older typings
|
||||||
|
interface Timer extends RefCounted { |
||||||
|
hasRef(): boolean; |
||||||
|
refresh(): this; |
||||||
|
[Symbol.toPrimitive](): number; |
||||||
|
} |
||||||
|
interface Immediate extends RefCounted { |
||||||
|
/** |
||||||
|
* If true, the `Immediate` object will keep the Node.js event loop active. |
||||||
|
* @since v11.0.0 |
||||||
|
*/ |
||||||
|
hasRef(): boolean; |
||||||
|
_onImmediate: Function; // to distinguish it from the Timeout class
|
||||||
|
} |
||||||
|
interface Timeout extends Timer { |
||||||
|
/** |
||||||
|
* If true, the `Timeout` object will keep the Node.js event loop active. |
||||||
|
* @since v11.0.0 |
||||||
|
*/ |
||||||
|
hasRef(): boolean; |
||||||
|
/** |
||||||
|
* Sets the timer's start time to the current time, and reschedules the timer to |
||||||
|
* call its callback at the previously specified duration adjusted to the current |
||||||
|
* time. This is useful for refreshing a timer without allocating a new |
||||||
|
* JavaScript object. |
||||||
|
* |
||||||
|
* Using this on a timer that has already called its callback will reactivate the |
||||||
|
* timer. |
||||||
|
* @since v10.2.0 |
||||||
|
* @return a reference to `timeout` |
||||||
|
*/ |
||||||
|
refresh(): this; |
||||||
|
[Symbol.toPrimitive](): number; |
||||||
|
} |
||||||
|
} |
||||||
|
function setTimeout<TArgs extends any[]>(callback: (...args: TArgs) => void, ms?: number, ...args: TArgs): NodeJS.Timeout; |
||||||
|
// util.promisify no rest args compability
|
||||||
|
// tslint:disable-next-line void-return
|
||||||
|
function setTimeout(callback: (args: void) => void, ms?: number): NodeJS.Timeout; |
||||||
|
namespace setTimeout { |
||||||
|
const __promisify__: typeof setTimeoutPromise; |
||||||
|
} |
||||||
|
function clearTimeout(timeoutId: NodeJS.Timeout | string | number | undefined): void; |
||||||
|
function setInterval<TArgs extends any[]>(callback: (...args: TArgs) => void, ms?: number, ...args: TArgs): NodeJS.Timer; |
||||||
|
// util.promisify no rest args compability
|
||||||
|
// tslint:disable-next-line void-return
|
||||||
|
function setInterval(callback: (args: void) => void, ms?: number): NodeJS.Timer; |
||||||
|
namespace setInterval { |
||||||
|
const __promisify__: typeof setIntervalPromise; |
||||||
|
} |
||||||
|
function clearInterval(intervalId: NodeJS.Timeout | string | number | undefined): void; |
||||||
|
function setImmediate<TArgs extends any[]>(callback: (...args: TArgs) => void, ...args: TArgs): NodeJS.Immediate; |
||||||
|
// util.promisify no rest args compability
|
||||||
|
// tslint:disable-next-line void-return
|
||||||
|
function setImmediate(callback: (args: void) => void): NodeJS.Immediate; |
||||||
|
namespace setImmediate { |
||||||
|
const __promisify__: typeof setImmediatePromise; |
||||||
|
} |
||||||
|
function clearImmediate(immediateId: NodeJS.Immediate | undefined): void; |
||||||
|
function queueMicrotask(callback: () => void): void; |
||||||
|
} |
||||||
|
} |
||||||
|
declare module 'node:timers' { |
||||||
|
export * from 'timers'; |
||||||
|
} |
@ -0,0 +1,68 @@ |
|||||||
|
/** |
||||||
|
* The `timers/promises` API provides an alternative set of timer functions |
||||||
|
* that return `Promise` objects. The API is accessible via`require('timers/promises')`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import { |
||||||
|
* setTimeout, |
||||||
|
* setImmediate, |
||||||
|
* setInterval, |
||||||
|
* } from 'timers/promises'; |
||||||
|
* ``` |
||||||
|
* @since v15.0.0 |
||||||
|
*/ |
||||||
|
declare module 'timers/promises' { |
||||||
|
import { TimerOptions } from 'node:timers'; |
||||||
|
/** |
||||||
|
* ```js
|
||||||
|
* import { |
||||||
|
* setTimeout, |
||||||
|
* } from 'timers/promises'; |
||||||
|
* |
||||||
|
* const res = await setTimeout(100, 'result'); |
||||||
|
* |
||||||
|
* console.log(res); // Prints 'result'
|
||||||
|
* ``` |
||||||
|
* @since v15.0.0 |
||||||
|
* @param [delay=1] The number of milliseconds to wait before fulfilling the promise. |
||||||
|
* @param value A value with which the promise is fulfilled. |
||||||
|
*/ |
||||||
|
function setTimeout<T = void>(delay?: number, value?: T, options?: TimerOptions): Promise<T>; |
||||||
|
/** |
||||||
|
* ```js
|
||||||
|
* import { |
||||||
|
* setImmediate, |
||||||
|
* } from 'timers/promises'; |
||||||
|
* |
||||||
|
* const res = await setImmediate('result'); |
||||||
|
* |
||||||
|
* console.log(res); // Prints 'result'
|
||||||
|
* ``` |
||||||
|
* @since v15.0.0 |
||||||
|
* @param value A value with which the promise is fulfilled. |
||||||
|
*/ |
||||||
|
function setImmediate<T = void>(value?: T, options?: TimerOptions): Promise<T>; |
||||||
|
/** |
||||||
|
* Returns an async iterator that generates values in an interval of `delay` ms. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import { |
||||||
|
* setInterval, |
||||||
|
* } from 'timers/promises'; |
||||||
|
* |
||||||
|
* const interval = 100; |
||||||
|
* for await (const startTime of setInterval(interval, Date.now())) { |
||||||
|
* const now = Date.now(); |
||||||
|
* console.log(now); |
||||||
|
* if ((now - startTime) > 1000) |
||||||
|
* break; |
||||||
|
* } |
||||||
|
* console.log(Date.now()); |
||||||
|
* ``` |
||||||
|
* @since v15.9.0 |
||||||
|
*/ |
||||||
|
function setInterval<T = void>(delay?: number, value?: T, options?: TimerOptions): AsyncIterable<T>; |
||||||
|
} |
||||||
|
declare module 'node:timers/promises' { |
||||||
|
export * from 'timers/promises'; |
||||||
|
} |
File diff suppressed because it is too large
Load Diff
@ -0,0 +1,171 @@ |
|||||||
|
/** |
||||||
|
* The `trace_events` module provides a mechanism to centralize tracing information |
||||||
|
* generated by V8, Node.js core, and userspace code. |
||||||
|
* |
||||||
|
* Tracing can be enabled with the `--trace-event-categories` command-line flag |
||||||
|
* or by using the `trace_events` module. The `--trace-event-categories` flag |
||||||
|
* accepts a list of comma-separated category names. |
||||||
|
* |
||||||
|
* The available categories are: |
||||||
|
* |
||||||
|
* * `node`: An empty placeholder. |
||||||
|
* * `node.async_hooks`: Enables capture of detailed `async_hooks` trace data. |
||||||
|
* The `async_hooks` events have a unique `asyncId` and a special `triggerId` `triggerAsyncId` property. |
||||||
|
* * `node.bootstrap`: Enables capture of Node.js bootstrap milestones. |
||||||
|
* * `node.console`: Enables capture of `console.time()` and `console.count()`output. |
||||||
|
* * `node.dns.native`: Enables capture of trace data for DNS queries. |
||||||
|
* * `node.environment`: Enables capture of Node.js Environment milestones. |
||||||
|
* * `node.fs.sync`: Enables capture of trace data for file system sync methods. |
||||||
|
* * `node.perf`: Enables capture of `Performance API` measurements. |
||||||
|
* * `node.perf.usertiming`: Enables capture of only Performance API User Timing |
||||||
|
* measures and marks. |
||||||
|
* * `node.perf.timerify`: Enables capture of only Performance API timerify |
||||||
|
* measurements. |
||||||
|
* * `node.promises.rejections`: Enables capture of trace data tracking the number |
||||||
|
* of unhandled Promise rejections and handled-after-rejections. |
||||||
|
* * `node.vm.script`: Enables capture of trace data for the `vm` module's`runInNewContext()`, `runInContext()`, and `runInThisContext()` methods. |
||||||
|
* * `v8`: The `V8` events are GC, compiling, and execution related. |
||||||
|
* |
||||||
|
* By default the `node`, `node.async_hooks`, and `v8` categories are enabled. |
||||||
|
* |
||||||
|
* ```bash
|
||||||
|
* node --trace-event-categories v8,node,node.async_hooks server.js |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Prior versions of Node.js required the use of the `--trace-events-enabled`flag to enable trace events. This requirement has been removed. However, the`--trace-events-enabled` flag _may_ still be |
||||||
|
* used and will enable the`node`, `node.async_hooks`, and `v8` trace event categories by default. |
||||||
|
* |
||||||
|
* ```bash
|
||||||
|
* node --trace-events-enabled |
||||||
|
* |
||||||
|
* # is equivalent to |
||||||
|
* |
||||||
|
* node --trace-event-categories v8,node,node.async_hooks |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Alternatively, trace events may be enabled using the `trace_events` module: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const trace_events = require('trace_events'); |
||||||
|
* const tracing = trace_events.createTracing({ categories: ['node.perf'] }); |
||||||
|
* tracing.enable(); // Enable trace event capture for the 'node.perf' category
|
||||||
|
* |
||||||
|
* // do work
|
||||||
|
* |
||||||
|
* tracing.disable(); // Disable trace event capture for the 'node.perf' category
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Running Node.js with tracing enabled will produce log files that can be opened |
||||||
|
* in the [`chrome://tracing`](https://www.chromium.org/developers/how-tos/trace-event-profiling-tool) tab of Chrome.
|
||||||
|
* |
||||||
|
* The logging file is by default called `node_trace.${rotation}.log`, where`${rotation}` is an incrementing log-rotation id. The filepath pattern can |
||||||
|
* be specified with `--trace-event-file-pattern` that accepts a template |
||||||
|
* string that supports `${rotation}` and `${pid}`: |
||||||
|
* |
||||||
|
* ```bash
|
||||||
|
* node --trace-event-categories v8 --trace-event-file-pattern '${pid}-${rotation}.log' server.js |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* To guarantee that the log file is properly generated after signal events like`SIGINT`, `SIGTERM`, or `SIGBREAK`, make sure to have the appropriate handlers |
||||||
|
* in your code, such as: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* process.on('SIGINT', function onSigint() { |
||||||
|
* console.info('Received SIGINT.'); |
||||||
|
* process.exit(130); // Or applicable exit code depending on OS and signal
|
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* The tracing system uses the same time source |
||||||
|
* as the one used by `process.hrtime()`. |
||||||
|
* However the trace-event timestamps are expressed in microseconds, |
||||||
|
* unlike `process.hrtime()` which returns nanoseconds. |
||||||
|
* |
||||||
|
* The features from this module are not available in `Worker` threads. |
||||||
|
* @experimental |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/trace_events.js)
|
||||||
|
*/ |
||||||
|
declare module 'trace_events' { |
||||||
|
/** |
||||||
|
* The `Tracing` object is used to enable or disable tracing for sets of |
||||||
|
* categories. Instances are created using the |
||||||
|
* `trace_events.createTracing()` method. |
||||||
|
* |
||||||
|
* When created, the `Tracing` object is disabled. Calling the |
||||||
|
* `tracing.enable()` method adds the categories to the set of enabled trace |
||||||
|
* event categories. Calling `tracing.disable()` will remove the categories |
||||||
|
* from the set of enabled trace event categories. |
||||||
|
*/ |
||||||
|
interface Tracing { |
||||||
|
/** |
||||||
|
* A comma-separated list of the trace event categories covered by this |
||||||
|
* `Tracing` object. |
||||||
|
*/ |
||||||
|
readonly categories: string; |
||||||
|
/** |
||||||
|
* Disables this `Tracing` object. |
||||||
|
* |
||||||
|
* Only trace event categories _not_ covered by other enabled `Tracing` |
||||||
|
* objects and _not_ specified by the `--trace-event-categories` flag |
||||||
|
* will be disabled. |
||||||
|
*/ |
||||||
|
disable(): void; |
||||||
|
/** |
||||||
|
* Enables this `Tracing` object for the set of categories covered by |
||||||
|
* the `Tracing` object. |
||||||
|
*/ |
||||||
|
enable(): void; |
||||||
|
/** |
||||||
|
* `true` only if the `Tracing` object has been enabled. |
||||||
|
*/ |
||||||
|
readonly enabled: boolean; |
||||||
|
} |
||||||
|
interface CreateTracingOptions { |
||||||
|
/** |
||||||
|
* An array of trace category names. Values included in the array are |
||||||
|
* coerced to a string when possible. An error will be thrown if the |
||||||
|
* value cannot be coerced. |
||||||
|
*/ |
||||||
|
categories: string[]; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Creates and returns a `Tracing` object for the given set of `categories`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const trace_events = require('trace_events'); |
||||||
|
* const categories = ['node.perf', 'node.async_hooks']; |
||||||
|
* const tracing = trace_events.createTracing({ categories }); |
||||||
|
* tracing.enable(); |
||||||
|
* // do stuff
|
||||||
|
* tracing.disable(); |
||||||
|
* ``` |
||||||
|
* @since v10.0.0 |
||||||
|
* @return . |
||||||
|
*/ |
||||||
|
function createTracing(options: CreateTracingOptions): Tracing; |
||||||
|
/** |
||||||
|
* Returns a comma-separated list of all currently-enabled trace event |
||||||
|
* categories. The current set of enabled trace event categories is determined |
||||||
|
* by the _union_ of all currently-enabled `Tracing` objects and any categories |
||||||
|
* enabled using the `--trace-event-categories` flag. |
||||||
|
* |
||||||
|
* Given the file `test.js` below, the command`node --trace-event-categories node.perf test.js` will print`'node.async_hooks,node.perf'` to the console. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const trace_events = require('trace_events'); |
||||||
|
* const t1 = trace_events.createTracing({ categories: ['node.async_hooks'] }); |
||||||
|
* const t2 = trace_events.createTracing({ categories: ['node.perf'] }); |
||||||
|
* const t3 = trace_events.createTracing({ categories: ['v8'] }); |
||||||
|
* |
||||||
|
* t1.enable(); |
||||||
|
* t2.enable(); |
||||||
|
* |
||||||
|
* console.log(trace_events.getEnabledCategories()); |
||||||
|
* ``` |
||||||
|
* @since v10.0.0 |
||||||
|
*/ |
||||||
|
function getEnabledCategories(): string | undefined; |
||||||
|
} |
||||||
|
declare module 'node:trace_events' { |
||||||
|
export * from 'trace_events'; |
||||||
|
} |
@ -0,0 +1,206 @@ |
|||||||
|
/** |
||||||
|
* The `tty` module provides the `tty.ReadStream` and `tty.WriteStream` classes. |
||||||
|
* In most cases, it will not be necessary or possible to use this module directly.
|
||||||
|
* However, it can be accessed using: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const tty = require('tty'); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* When Node.js detects that it is being run with a text terminal ("TTY") |
||||||
|
* attached, `process.stdin` will, by default, be initialized as an instance of`tty.ReadStream` and both `process.stdout` and `process.stderr` will, by |
||||||
|
* default, be instances of `tty.WriteStream`. The preferred method of determining |
||||||
|
* whether Node.js is being run within a TTY context is to check that the value of |
||||||
|
* the `process.stdout.isTTY` property is `true`: |
||||||
|
* |
||||||
|
* ```console
|
||||||
|
* $ node -p -e "Boolean(process.stdout.isTTY)" |
||||||
|
* true |
||||||
|
* $ node -p -e "Boolean(process.stdout.isTTY)" | cat |
||||||
|
* false |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* In most cases, there should be little to no reason for an application to |
||||||
|
* manually create instances of the `tty.ReadStream` and `tty.WriteStream`classes. |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/tty.js)
|
||||||
|
*/ |
||||||
|
declare module 'tty' { |
||||||
|
import * as net from 'node:net'; |
||||||
|
/** |
||||||
|
* The `tty.isatty()` method returns `true` if the given `fd` is associated with |
||||||
|
* a TTY and `false` if it is not, including whenever `fd` is not a non-negative |
||||||
|
* integer. |
||||||
|
* @since v0.5.8 |
||||||
|
* @param fd A numeric file descriptor |
||||||
|
*/ |
||||||
|
function isatty(fd: number): boolean; |
||||||
|
/** |
||||||
|
* Represents the readable side of a TTY. In normal circumstances `process.stdin` will be the only `tty.ReadStream` instance in a Node.js |
||||||
|
* process and there should be no reason to create additional instances. |
||||||
|
* @since v0.5.8 |
||||||
|
*/ |
||||||
|
class ReadStream extends net.Socket { |
||||||
|
constructor(fd: number, options?: net.SocketConstructorOpts); |
||||||
|
/** |
||||||
|
* A `boolean` that is `true` if the TTY is currently configured to operate as a |
||||||
|
* raw device. Defaults to `false`. |
||||||
|
* @since v0.7.7 |
||||||
|
*/ |
||||||
|
isRaw: boolean; |
||||||
|
/** |
||||||
|
* Allows configuration of `tty.ReadStream` so that it operates as a raw device. |
||||||
|
* |
||||||
|
* When in raw mode, input is always available character-by-character, not |
||||||
|
* including modifiers. Additionally, all special processing of characters by the |
||||||
|
* terminal is disabled, including echoing input |
||||||
|
* characters. Ctrl+C will no longer cause a `SIGINT` when |
||||||
|
* in this mode. |
||||||
|
* @since v0.7.7 |
||||||
|
* @param mode If `true`, configures the `tty.ReadStream` to operate as a raw device. If `false`, configures the `tty.ReadStream` to operate in its default mode. The `readStream.isRaw` |
||||||
|
* property will be set to the resulting mode. |
||||||
|
* @return The read stream instance. |
||||||
|
*/ |
||||||
|
setRawMode(mode: boolean): this; |
||||||
|
/** |
||||||
|
* A `boolean` that is always `true` for `tty.ReadStream` instances. |
||||||
|
* @since v0.5.8 |
||||||
|
*/ |
||||||
|
isTTY: boolean; |
||||||
|
} |
||||||
|
/** |
||||||
|
* -1 - to the left from cursor |
||||||
|
* 0 - the entire line |
||||||
|
* 1 - to the right from cursor |
||||||
|
*/ |
||||||
|
type Direction = -1 | 0 | 1; |
||||||
|
/** |
||||||
|
* Represents the writable side of a TTY. In normal circumstances,`process.stdout` and `process.stderr` will be the only`tty.WriteStream` instances created for a Node.js process and there |
||||||
|
* should be no reason to create additional instances. |
||||||
|
* @since v0.5.8 |
||||||
|
*/ |
||||||
|
class WriteStream extends net.Socket { |
||||||
|
constructor(fd: number); |
||||||
|
addListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
addListener(event: 'resize', listener: () => void): this; |
||||||
|
emit(event: string | symbol, ...args: any[]): boolean; |
||||||
|
emit(event: 'resize'): boolean; |
||||||
|
on(event: string, listener: (...args: any[]) => void): this; |
||||||
|
on(event: 'resize', listener: () => void): this; |
||||||
|
once(event: string, listener: (...args: any[]) => void): this; |
||||||
|
once(event: 'resize', listener: () => void): this; |
||||||
|
prependListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
prependListener(event: 'resize', listener: () => void): this; |
||||||
|
prependOnceListener(event: string, listener: (...args: any[]) => void): this; |
||||||
|
prependOnceListener(event: 'resize', listener: () => void): this; |
||||||
|
/** |
||||||
|
* `writeStream.clearLine()` clears the current line of this `WriteStream` in a |
||||||
|
* direction identified by `dir`. |
||||||
|
* @since v0.7.7 |
||||||
|
* @param callback Invoked once the operation completes. |
||||||
|
* @return `false` if the stream wishes for the calling code to wait for the `'drain'` event to be emitted before continuing to write additional data; otherwise `true`. |
||||||
|
*/ |
||||||
|
clearLine(dir: Direction, callback?: () => void): boolean; |
||||||
|
/** |
||||||
|
* `writeStream.clearScreenDown()` clears this `WriteStream` from the current |
||||||
|
* cursor down. |
||||||
|
* @since v0.7.7 |
||||||
|
* @param callback Invoked once the operation completes. |
||||||
|
* @return `false` if the stream wishes for the calling code to wait for the `'drain'` event to be emitted before continuing to write additional data; otherwise `true`. |
||||||
|
*/ |
||||||
|
clearScreenDown(callback?: () => void): boolean; |
||||||
|
/** |
||||||
|
* `writeStream.cursorTo()` moves this `WriteStream`'s cursor to the specified |
||||||
|
* position. |
||||||
|
* @since v0.7.7 |
||||||
|
* @param callback Invoked once the operation completes. |
||||||
|
* @return `false` if the stream wishes for the calling code to wait for the `'drain'` event to be emitted before continuing to write additional data; otherwise `true`. |
||||||
|
*/ |
||||||
|
cursorTo(x: number, y?: number, callback?: () => void): boolean; |
||||||
|
cursorTo(x: number, callback: () => void): boolean; |
||||||
|
/** |
||||||
|
* `writeStream.moveCursor()` moves this `WriteStream`'s cursor _relative_ to its |
||||||
|
* current position. |
||||||
|
* @since v0.7.7 |
||||||
|
* @param callback Invoked once the operation completes. |
||||||
|
* @return `false` if the stream wishes for the calling code to wait for the `'drain'` event to be emitted before continuing to write additional data; otherwise `true`. |
||||||
|
*/ |
||||||
|
moveCursor(dx: number, dy: number, callback?: () => void): boolean; |
||||||
|
/** |
||||||
|
* Returns: |
||||||
|
* |
||||||
|
* * `1` for 2, |
||||||
|
* * `4` for 16, |
||||||
|
* * `8` for 256, |
||||||
|
* * `24` for 16,777,216 colors supported. |
||||||
|
* |
||||||
|
* Use this to determine what colors the terminal supports. Due to the nature of |
||||||
|
* colors in terminals it is possible to either have false positives or false |
||||||
|
* negatives. It depends on process information and the environment variables that |
||||||
|
* may lie about what terminal is used. |
||||||
|
* It is possible to pass in an `env` object to simulate the usage of a specific |
||||||
|
* terminal. This can be useful to check how specific environment settings behave. |
||||||
|
* |
||||||
|
* To enforce a specific color support, use one of the below environment settings. |
||||||
|
* |
||||||
|
* * 2 colors: `FORCE_COLOR = 0` (Disables colors) |
||||||
|
* * 16 colors: `FORCE_COLOR = 1` |
||||||
|
* * 256 colors: `FORCE_COLOR = 2` |
||||||
|
* * 16,777,216 colors: `FORCE_COLOR = 3` |
||||||
|
* |
||||||
|
* Disabling color support is also possible by using the `NO_COLOR` and`NODE_DISABLE_COLORS` environment variables. |
||||||
|
* @since v9.9.0 |
||||||
|
* @param [env=process.env] An object containing the environment variables to check. This enables simulating the usage of a specific terminal. |
||||||
|
*/ |
||||||
|
getColorDepth(env?: object): number; |
||||||
|
/** |
||||||
|
* Returns `true` if the `writeStream` supports at least as many colors as provided |
||||||
|
* in `count`. Minimum support is 2 (black and white). |
||||||
|
* |
||||||
|
* This has the same false positives and negatives as described in `writeStream.getColorDepth()`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* process.stdout.hasColors(); |
||||||
|
* // Returns true or false depending on if `stdout` supports at least 16 colors.
|
||||||
|
* process.stdout.hasColors(256); |
||||||
|
* // Returns true or false depending on if `stdout` supports at least 256 colors.
|
||||||
|
* process.stdout.hasColors({ TMUX: '1' }); |
||||||
|
* // Returns true.
|
||||||
|
* process.stdout.hasColors(2 ** 24, { TMUX: '1' }); |
||||||
|
* // Returns false (the environment setting pretends to support 2 ** 8 colors).
|
||||||
|
* ``` |
||||||
|
* @since v11.13.0, v10.16.0 |
||||||
|
* @param [count=16] The number of colors that are requested (minimum 2). |
||||||
|
* @param [env=process.env] An object containing the environment variables to check. This enables simulating the usage of a specific terminal. |
||||||
|
*/ |
||||||
|
hasColors(count?: number): boolean; |
||||||
|
hasColors(env?: object): boolean; |
||||||
|
hasColors(count: number, env?: object): boolean; |
||||||
|
/** |
||||||
|
* `writeStream.getWindowSize()` returns the size of the TTY |
||||||
|
* corresponding to this `WriteStream`. The array is of the type`[numColumns, numRows]` where `numColumns` and `numRows` represent the number |
||||||
|
* of columns and rows in the corresponding TTY. |
||||||
|
* @since v0.7.7 |
||||||
|
*/ |
||||||
|
getWindowSize(): [number, number]; |
||||||
|
/** |
||||||
|
* A `number` specifying the number of columns the TTY currently has. This property |
||||||
|
* is updated whenever the `'resize'` event is emitted. |
||||||
|
* @since v0.7.7 |
||||||
|
*/ |
||||||
|
columns: number; |
||||||
|
/** |
||||||
|
* A `number` specifying the number of rows the TTY currently has. This property |
||||||
|
* is updated whenever the `'resize'` event is emitted. |
||||||
|
* @since v0.7.7 |
||||||
|
*/ |
||||||
|
rows: number; |
||||||
|
/** |
||||||
|
* A `boolean` that is always `true`. |
||||||
|
* @since v0.5.8 |
||||||
|
*/ |
||||||
|
isTTY: boolean; |
||||||
|
} |
||||||
|
} |
||||||
|
declare module 'node:tty' { |
||||||
|
export * from 'tty'; |
||||||
|
} |
@ -0,0 +1,897 @@ |
|||||||
|
/** |
||||||
|
* The `url` module provides utilities for URL resolution and parsing. It can be |
||||||
|
* accessed using: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import url from 'url'; |
||||||
|
* ``` |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/url.js)
|
||||||
|
*/ |
||||||
|
declare module 'url' { |
||||||
|
import { Blob } from 'node:buffer'; |
||||||
|
import { ClientRequestArgs } from 'node:http'; |
||||||
|
import { ParsedUrlQuery, ParsedUrlQueryInput } from 'node:querystring'; |
||||||
|
// Input to `url.format`
|
||||||
|
interface UrlObject { |
||||||
|
auth?: string | null | undefined; |
||||||
|
hash?: string | null | undefined; |
||||||
|
host?: string | null | undefined; |
||||||
|
hostname?: string | null | undefined; |
||||||
|
href?: string | null | undefined; |
||||||
|
pathname?: string | null | undefined; |
||||||
|
protocol?: string | null | undefined; |
||||||
|
search?: string | null | undefined; |
||||||
|
slashes?: boolean | null | undefined; |
||||||
|
port?: string | number | null | undefined; |
||||||
|
query?: string | null | ParsedUrlQueryInput | undefined; |
||||||
|
} |
||||||
|
// Output of `url.parse`
|
||||||
|
interface Url { |
||||||
|
auth: string | null; |
||||||
|
hash: string | null; |
||||||
|
host: string | null; |
||||||
|
hostname: string | null; |
||||||
|
href: string; |
||||||
|
path: string | null; |
||||||
|
pathname: string | null; |
||||||
|
protocol: string | null; |
||||||
|
search: string | null; |
||||||
|
slashes: boolean | null; |
||||||
|
port: string | null; |
||||||
|
query: string | null | ParsedUrlQuery; |
||||||
|
} |
||||||
|
interface UrlWithParsedQuery extends Url { |
||||||
|
query: ParsedUrlQuery; |
||||||
|
} |
||||||
|
interface UrlWithStringQuery extends Url { |
||||||
|
query: string | null; |
||||||
|
} |
||||||
|
/** |
||||||
|
* The `url.parse()` method takes a URL string, parses it, and returns a URL |
||||||
|
* object. |
||||||
|
* |
||||||
|
* A `TypeError` is thrown if `urlString` is not a string. |
||||||
|
* |
||||||
|
* A `URIError` is thrown if the `auth` property is present but cannot be decoded. |
||||||
|
* |
||||||
|
* Use of the legacy `url.parse()` method is discouraged. Users should |
||||||
|
* use the WHATWG `URL` API. Because the `url.parse()` method uses a |
||||||
|
* lenient, non-standard algorithm for parsing URL strings, security |
||||||
|
* issues can be introduced. Specifically, issues with [host name spoofing](https://hackerone.com/reports/678487) and
|
||||||
|
* incorrect handling of usernames and passwords have been identified. |
||||||
|
* |
||||||
|
* Deprecation of this API has been shelved for now primarily due to the the |
||||||
|
* inability of the [WHATWG API to parse relative URLs](https://github.com/nodejs/node/issues/12682#issuecomment-1154492373).
|
||||||
|
* [Discussions are ongoing](https://github.com/whatwg/url/issues/531) for the best way to resolve this.
|
||||||
|
* |
||||||
|
* @since v0.1.25 |
||||||
|
* @param urlString The URL string to parse. |
||||||
|
* @param [parseQueryString=false] If `true`, the `query` property will always be set to an object returned by the {@link querystring} module's `parse()` method. If `false`, the `query` property |
||||||
|
* on the returned URL object will be an unparsed, undecoded string. |
||||||
|
* @param [slashesDenoteHost=false] If `true`, the first token after the literal string `//` and preceding the next `/` will be interpreted as the `host`. For instance, given `//foo/bar`, the |
||||||
|
* result would be `{host: 'foo', pathname: '/bar'}` rather than `{pathname: '//foo/bar'}`. |
||||||
|
*/ |
||||||
|
function parse(urlString: string): UrlWithStringQuery; |
||||||
|
function parse(urlString: string, parseQueryString: false | undefined, slashesDenoteHost?: boolean): UrlWithStringQuery; |
||||||
|
function parse(urlString: string, parseQueryString: true, slashesDenoteHost?: boolean): UrlWithParsedQuery; |
||||||
|
function parse(urlString: string, parseQueryString: boolean, slashesDenoteHost?: boolean): Url; |
||||||
|
/** |
||||||
|
* The `url.format()` method returns a formatted URL string derived from`urlObject`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const url = require('url'); |
||||||
|
* url.format({ |
||||||
|
* protocol: 'https', |
||||||
|
* hostname: 'example.com', |
||||||
|
* pathname: '/some/path', |
||||||
|
* query: { |
||||||
|
* page: 1, |
||||||
|
* format: 'json' |
||||||
|
* } |
||||||
|
* }); |
||||||
|
* |
||||||
|
* // => 'https://example.com/some/path?page=1&format=json'
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* If `urlObject` is not an object or a string, `url.format()` will throw a `TypeError`. |
||||||
|
* |
||||||
|
* The formatting process operates as follows: |
||||||
|
* |
||||||
|
* * A new empty string `result` is created. |
||||||
|
* * If `urlObject.protocol` is a string, it is appended as-is to `result`. |
||||||
|
* * Otherwise, if `urlObject.protocol` is not `undefined` and is not a string, an `Error` is thrown. |
||||||
|
* * For all string values of `urlObject.protocol` that _do not end_ with an ASCII |
||||||
|
* colon (`:`) character, the literal string `:` will be appended to `result`. |
||||||
|
* * If either of the following conditions is true, then the literal string `//`will be appended to `result`: |
||||||
|
* * `urlObject.slashes` property is true; |
||||||
|
* * `urlObject.protocol` begins with `http`, `https`, `ftp`, `gopher`, or`file`; |
||||||
|
* * If the value of the `urlObject.auth` property is truthy, and either`urlObject.host` or `urlObject.hostname` are not `undefined`, the value of`urlObject.auth` will be coerced into a string |
||||||
|
* and appended to `result`followed by the literal string `@`. |
||||||
|
* * If the `urlObject.host` property is `undefined` then: |
||||||
|
* * If the `urlObject.hostname` is a string, it is appended to `result`. |
||||||
|
* * Otherwise, if `urlObject.hostname` is not `undefined` and is not a string, |
||||||
|
* an `Error` is thrown. |
||||||
|
* * If the `urlObject.port` property value is truthy, and `urlObject.hostname`is not `undefined`: |
||||||
|
* * The literal string `:` is appended to `result`, and |
||||||
|
* * The value of `urlObject.port` is coerced to a string and appended to`result`. |
||||||
|
* * Otherwise, if the `urlObject.host` property value is truthy, the value of`urlObject.host` is coerced to a string and appended to `result`. |
||||||
|
* * If the `urlObject.pathname` property is a string that is not an empty string: |
||||||
|
* * If the `urlObject.pathname`_does not start_ with an ASCII forward slash |
||||||
|
* (`/`), then the literal string `'/'` is appended to `result`. |
||||||
|
* * The value of `urlObject.pathname` is appended to `result`. |
||||||
|
* * Otherwise, if `urlObject.pathname` is not `undefined` and is not a string, an `Error` is thrown. |
||||||
|
* * If the `urlObject.search` property is `undefined` and if the `urlObject.query`property is an `Object`, the literal string `?` is appended to `result`followed by the output of calling the |
||||||
|
* `querystring` module's `stringify()`method passing the value of `urlObject.query`. |
||||||
|
* * Otherwise, if `urlObject.search` is a string: |
||||||
|
* * If the value of `urlObject.search`_does not start_ with the ASCII question |
||||||
|
* mark (`?`) character, the literal string `?` is appended to `result`. |
||||||
|
* * The value of `urlObject.search` is appended to `result`. |
||||||
|
* * Otherwise, if `urlObject.search` is not `undefined` and is not a string, an `Error` is thrown. |
||||||
|
* * If the `urlObject.hash` property is a string: |
||||||
|
* * If the value of `urlObject.hash`_does not start_ with the ASCII hash (`#`) |
||||||
|
* character, the literal string `#` is appended to `result`. |
||||||
|
* * The value of `urlObject.hash` is appended to `result`. |
||||||
|
* * Otherwise, if the `urlObject.hash` property is not `undefined` and is not a |
||||||
|
* string, an `Error` is thrown. |
||||||
|
* * `result` is returned. |
||||||
|
* @since v0.1.25 |
||||||
|
* @deprecated Legacy: Use the WHATWG URL API instead. |
||||||
|
* @param urlObject A URL object (as returned by `url.parse()` or constructed otherwise). If a string, it is converted to an object by passing it to `url.parse()`. |
||||||
|
*/ |
||||||
|
function format(urlObject: URL, options?: URLFormatOptions): string; |
||||||
|
/** |
||||||
|
* The `url.format()` method returns a formatted URL string derived from`urlObject`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const url = require('url'); |
||||||
|
* url.format({ |
||||||
|
* protocol: 'https', |
||||||
|
* hostname: 'example.com', |
||||||
|
* pathname: '/some/path', |
||||||
|
* query: { |
||||||
|
* page: 1, |
||||||
|
* format: 'json' |
||||||
|
* } |
||||||
|
* }); |
||||||
|
* |
||||||
|
* // => 'https://example.com/some/path?page=1&format=json'
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* If `urlObject` is not an object or a string, `url.format()` will throw a `TypeError`. |
||||||
|
* |
||||||
|
* The formatting process operates as follows: |
||||||
|
* |
||||||
|
* * A new empty string `result` is created. |
||||||
|
* * If `urlObject.protocol` is a string, it is appended as-is to `result`. |
||||||
|
* * Otherwise, if `urlObject.protocol` is not `undefined` and is not a string, an `Error` is thrown. |
||||||
|
* * For all string values of `urlObject.protocol` that _do not end_ with an ASCII |
||||||
|
* colon (`:`) character, the literal string `:` will be appended to `result`. |
||||||
|
* * If either of the following conditions is true, then the literal string `//`will be appended to `result`: |
||||||
|
* * `urlObject.slashes` property is true; |
||||||
|
* * `urlObject.protocol` begins with `http`, `https`, `ftp`, `gopher`, or`file`; |
||||||
|
* * If the value of the `urlObject.auth` property is truthy, and either`urlObject.host` or `urlObject.hostname` are not `undefined`, the value of`urlObject.auth` will be coerced into a string |
||||||
|
* and appended to `result`followed by the literal string `@`. |
||||||
|
* * If the `urlObject.host` property is `undefined` then: |
||||||
|
* * If the `urlObject.hostname` is a string, it is appended to `result`. |
||||||
|
* * Otherwise, if `urlObject.hostname` is not `undefined` and is not a string, |
||||||
|
* an `Error` is thrown. |
||||||
|
* * If the `urlObject.port` property value is truthy, and `urlObject.hostname`is not `undefined`: |
||||||
|
* * The literal string `:` is appended to `result`, and |
||||||
|
* * The value of `urlObject.port` is coerced to a string and appended to`result`. |
||||||
|
* * Otherwise, if the `urlObject.host` property value is truthy, the value of`urlObject.host` is coerced to a string and appended to `result`. |
||||||
|
* * If the `urlObject.pathname` property is a string that is not an empty string: |
||||||
|
* * If the `urlObject.pathname`_does not start_ with an ASCII forward slash |
||||||
|
* (`/`), then the literal string `'/'` is appended to `result`. |
||||||
|
* * The value of `urlObject.pathname` is appended to `result`. |
||||||
|
* * Otherwise, if `urlObject.pathname` is not `undefined` and is not a string, an `Error` is thrown. |
||||||
|
* * If the `urlObject.search` property is `undefined` and if the `urlObject.query`property is an `Object`, the literal string `?` is appended to `result`followed by the output of calling the |
||||||
|
* `querystring` module's `stringify()`method passing the value of `urlObject.query`. |
||||||
|
* * Otherwise, if `urlObject.search` is a string: |
||||||
|
* * If the value of `urlObject.search`_does not start_ with the ASCII question |
||||||
|
* mark (`?`) character, the literal string `?` is appended to `result`. |
||||||
|
* * The value of `urlObject.search` is appended to `result`. |
||||||
|
* * Otherwise, if `urlObject.search` is not `undefined` and is not a string, an `Error` is thrown. |
||||||
|
* * If the `urlObject.hash` property is a string: |
||||||
|
* * If the value of `urlObject.hash`_does not start_ with the ASCII hash (`#`) |
||||||
|
* character, the literal string `#` is appended to `result`. |
||||||
|
* * The value of `urlObject.hash` is appended to `result`. |
||||||
|
* * Otherwise, if the `urlObject.hash` property is not `undefined` and is not a |
||||||
|
* string, an `Error` is thrown. |
||||||
|
* * `result` is returned. |
||||||
|
* @since v0.1.25 |
||||||
|
* @deprecated Legacy: Use the WHATWG URL API instead. |
||||||
|
* @param urlObject A URL object (as returned by `url.parse()` or constructed otherwise). If a string, it is converted to an object by passing it to `url.parse()`. |
||||||
|
*/ |
||||||
|
function format(urlObject: UrlObject | string): string; |
||||||
|
/** |
||||||
|
* The `url.resolve()` method resolves a target URL relative to a base URL in a |
||||||
|
* manner similar to that of a web browser resolving an anchor tag. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const url = require('url'); |
||||||
|
* url.resolve('/one/two/three', 'four'); // '/one/two/four'
|
||||||
|
* url.resolve('http://example.com/', '/one'); // 'http://example.com/one'
|
||||||
|
* url.resolve('http://example.com/one', '/two'); // 'http://example.com/two'
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* To achieve the same result using the WHATWG URL API: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* function resolve(from, to) { |
||||||
|
* const resolvedUrl = new URL(to, new URL(from, 'resolve://')); |
||||||
|
* if (resolvedUrl.protocol === 'resolve:') { |
||||||
|
* // `from` is a relative URL.
|
||||||
|
* const { pathname, search, hash } = resolvedUrl; |
||||||
|
* return pathname + search + hash; |
||||||
|
* } |
||||||
|
* return resolvedUrl.toString(); |
||||||
|
* } |
||||||
|
* |
||||||
|
* resolve('/one/two/three', 'four'); // '/one/two/four'
|
||||||
|
* resolve('http://example.com/', '/one'); // 'http://example.com/one'
|
||||||
|
* resolve('http://example.com/one', '/two'); // 'http://example.com/two'
|
||||||
|
* ``` |
||||||
|
* @since v0.1.25 |
||||||
|
* @deprecated Legacy: Use the WHATWG URL API instead. |
||||||
|
* @param from The base URL to use if `to` is a relative URL. |
||||||
|
* @param to The target URL to resolve. |
||||||
|
*/ |
||||||
|
function resolve(from: string, to: string): string; |
||||||
|
/** |
||||||
|
* Returns the [Punycode](https://tools.ietf.org/html/rfc5891#section-4.4) ASCII serialization of the `domain`. If `domain` is an
|
||||||
|
* invalid domain, the empty string is returned. |
||||||
|
* |
||||||
|
* It performs the inverse operation to {@link domainToUnicode}. |
||||||
|
* |
||||||
|
* This feature is only available if the `node` executable was compiled with `ICU` enabled. If not, the domain names are passed through unchanged. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import url from 'url'; |
||||||
|
* |
||||||
|
* console.log(url.domainToASCII('español.com')); |
||||||
|
* // Prints xn--espaol-zwa.com
|
||||||
|
* console.log(url.domainToASCII('中文.com')); |
||||||
|
* // Prints xn--fiq228c.com
|
||||||
|
* console.log(url.domainToASCII('xn--iñvalid.com')); |
||||||
|
* // Prints an empty string
|
||||||
|
* ``` |
||||||
|
* @since v7.4.0, v6.13.0 |
||||||
|
*/ |
||||||
|
function domainToASCII(domain: string): string; |
||||||
|
/** |
||||||
|
* Returns the Unicode serialization of the `domain`. If `domain` is an invalid |
||||||
|
* domain, the empty string is returned. |
||||||
|
* |
||||||
|
* It performs the inverse operation to {@link domainToASCII}. |
||||||
|
* |
||||||
|
* This feature is only available if the `node` executable was compiled with `ICU` enabled. If not, the domain names are passed through unchanged. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import url from 'url'; |
||||||
|
* |
||||||
|
* console.log(url.domainToUnicode('xn--espaol-zwa.com')); |
||||||
|
* // Prints español.com
|
||||||
|
* console.log(url.domainToUnicode('xn--fiq228c.com')); |
||||||
|
* // Prints 中文.com
|
||||||
|
* console.log(url.domainToUnicode('xn--iñvalid.com')); |
||||||
|
* // Prints an empty string
|
||||||
|
* ``` |
||||||
|
* @since v7.4.0, v6.13.0 |
||||||
|
*/ |
||||||
|
function domainToUnicode(domain: string): string; |
||||||
|
/** |
||||||
|
* This function ensures the correct decodings of percent-encoded characters as |
||||||
|
* well as ensuring a cross-platform valid absolute path string. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import { fileURLToPath } from 'url'; |
||||||
|
* |
||||||
|
* const __filename = fileURLToPath(import.meta.url); |
||||||
|
* |
||||||
|
* new URL('file:///C:/path/').pathname; // Incorrect: /C:/path/
|
||||||
|
* fileURLToPath('file:///C:/path/'); // Correct: C:\path\ (Windows)
|
||||||
|
* |
||||||
|
* new URL('file://nas/foo.txt').pathname; // Incorrect: /foo.txt
|
||||||
|
* fileURLToPath('file://nas/foo.txt'); // Correct: \\nas\foo.txt (Windows)
|
||||||
|
* |
||||||
|
* new URL('file:///你好.txt').pathname; // Incorrect: /%E4%BD%A0%E5%A5%BD.txt
|
||||||
|
* fileURLToPath('file:///你好.txt'); // Correct: /你好.txt (POSIX)
|
||||||
|
* |
||||||
|
* new URL('file:///hello world').pathname; // Incorrect: /hello%20world
|
||||||
|
* fileURLToPath('file:///hello world'); // Correct: /hello world (POSIX)
|
||||||
|
* ``` |
||||||
|
* @since v10.12.0 |
||||||
|
* @param url The file URL string or URL object to convert to a path. |
||||||
|
* @return The fully-resolved platform-specific Node.js file path. |
||||||
|
*/ |
||||||
|
function fileURLToPath(url: string | URL): string; |
||||||
|
/** |
||||||
|
* This function ensures that `path` is resolved absolutely, and that the URL |
||||||
|
* control characters are correctly encoded when converting into a File URL. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import { pathToFileURL } from 'url'; |
||||||
|
* |
||||||
|
* new URL('/foo#1', 'file:'); // Incorrect: file:///foo#1
|
||||||
|
* pathToFileURL('/foo#1'); // Correct: file:///foo%231 (POSIX)
|
||||||
|
* |
||||||
|
* new URL('/some/path%.c', 'file:'); // Incorrect: file:///some/path%.c
|
||||||
|
* pathToFileURL('/some/path%.c'); // Correct: file:///some/path%25.c (POSIX)
|
||||||
|
* ``` |
||||||
|
* @since v10.12.0 |
||||||
|
* @param path The path to convert to a File URL. |
||||||
|
* @return The file URL object. |
||||||
|
*/ |
||||||
|
function pathToFileURL(path: string): URL; |
||||||
|
/** |
||||||
|
* This utility function converts a URL object into an ordinary options object as |
||||||
|
* expected by the `http.request()` and `https.request()` APIs. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import { urlToHttpOptions } from 'url'; |
||||||
|
* const myURL = new URL('https://a:b@測試?abc#foo'); |
||||||
|
* |
||||||
|
* console.log(urlToHttpOptions(myURL)); |
||||||
|
* /* |
||||||
|
* { |
||||||
|
* protocol: 'https:', |
||||||
|
* hostname: 'xn--g6w251d', |
||||||
|
* hash: '#foo', |
||||||
|
* search: '?abc', |
||||||
|
* pathname: '/', |
||||||
|
* path: '/?abc', |
||||||
|
* href: 'https://a:b@xn--g6w251d/?abc#foo', |
||||||
|
* auth: 'a:b' |
||||||
|
* } |
||||||
|
* |
||||||
|
* ``` |
||||||
|
* @since v15.7.0, v14.18.0 |
||||||
|
* @param url The `WHATWG URL` object to convert to an options object. |
||||||
|
* @return Options object |
||||||
|
*/ |
||||||
|
function urlToHttpOptions(url: URL): ClientRequestArgs; |
||||||
|
interface URLFormatOptions { |
||||||
|
auth?: boolean | undefined; |
||||||
|
fragment?: boolean | undefined; |
||||||
|
search?: boolean | undefined; |
||||||
|
unicode?: boolean | undefined; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Browser-compatible `URL` class, implemented by following the WHATWG URL |
||||||
|
* Standard. [Examples of parsed URLs](https://url.spec.whatwg.org/#example-url-parsing) may be found in the Standard itself.
|
||||||
|
* The `URL` class is also available on the global object. |
||||||
|
* |
||||||
|
* In accordance with browser conventions, all properties of `URL` objects |
||||||
|
* are implemented as getters and setters on the class prototype, rather than as |
||||||
|
* data properties on the object itself. Thus, unlike `legacy urlObject` s, |
||||||
|
* using the `delete` keyword on any properties of `URL` objects (e.g. `delete myURL.protocol`, `delete myURL.pathname`, etc) has no effect but will still |
||||||
|
* return `true`. |
||||||
|
* @since v7.0.0, v6.13.0 |
||||||
|
*/ |
||||||
|
class URL { |
||||||
|
/** |
||||||
|
* Creates a `'blob:nodedata:...'` URL string that represents the given `Blob` object and can be used to retrieve the `Blob` later. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { |
||||||
|
* Blob, |
||||||
|
* resolveObjectURL, |
||||||
|
* } = require('buffer'); |
||||||
|
* |
||||||
|
* const blob = new Blob(['hello']); |
||||||
|
* const id = URL.createObjectURL(blob); |
||||||
|
* |
||||||
|
* // later...
|
||||||
|
* |
||||||
|
* const otherBlob = resolveObjectURL(id); |
||||||
|
* console.log(otherBlob.size); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* The data stored by the registered `Blob` will be retained in memory until`URL.revokeObjectURL()` is called to remove it. |
||||||
|
* |
||||||
|
* `Blob` objects are registered within the current thread. If using Worker |
||||||
|
* Threads, `Blob` objects registered within one Worker will not be available |
||||||
|
* to other workers or the main thread. |
||||||
|
* @since v16.7.0 |
||||||
|
* @experimental |
||||||
|
*/ |
||||||
|
static createObjectURL(blob: Blob): string; |
||||||
|
/** |
||||||
|
* Removes the stored `Blob` identified by the given ID. Attempting to revoke a |
||||||
|
* ID that isn’t registered will silently fail. |
||||||
|
* @since v16.7.0 |
||||||
|
* @experimental |
||||||
|
* @param id A `'blob:nodedata:...` URL string returned by a prior call to `URL.createObjectURL()`. |
||||||
|
*/ |
||||||
|
static revokeObjectURL(objectUrl: string): void; |
||||||
|
constructor(input: string, base?: string | URL); |
||||||
|
/** |
||||||
|
* Gets and sets the fragment portion of the URL. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const myURL = new URL('https://example.org/foo#bar'); |
||||||
|
* console.log(myURL.hash); |
||||||
|
* // Prints #bar
|
||||||
|
* |
||||||
|
* myURL.hash = 'baz'; |
||||||
|
* console.log(myURL.href); |
||||||
|
* // Prints https://example.org/foo#baz
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Invalid URL characters included in the value assigned to the `hash` property |
||||||
|
* are `percent-encoded`. The selection of which characters to |
||||||
|
* percent-encode may vary somewhat from what the {@link parse} and {@link format} methods would produce. |
||||||
|
*/ |
||||||
|
hash: string; |
||||||
|
/** |
||||||
|
* Gets and sets the host portion of the URL. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const myURL = new URL('https://example.org:81/foo'); |
||||||
|
* console.log(myURL.host); |
||||||
|
* // Prints example.org:81
|
||||||
|
* |
||||||
|
* myURL.host = 'example.com:82'; |
||||||
|
* console.log(myURL.href); |
||||||
|
* // Prints https://example.com:82/foo
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Invalid host values assigned to the `host` property are ignored. |
||||||
|
*/ |
||||||
|
host: string; |
||||||
|
/** |
||||||
|
* Gets and sets the host name portion of the URL. The key difference between`url.host` and `url.hostname` is that `url.hostname` does _not_ include the |
||||||
|
* port. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const myURL = new URL('https://example.org:81/foo'); |
||||||
|
* console.log(myURL.hostname); |
||||||
|
* // Prints example.org
|
||||||
|
* |
||||||
|
* // Setting the hostname does not change the port
|
||||||
|
* myURL.hostname = 'example.com:82'; |
||||||
|
* console.log(myURL.href); |
||||||
|
* // Prints https://example.com:81/foo
|
||||||
|
* |
||||||
|
* // Use myURL.host to change the hostname and port
|
||||||
|
* myURL.host = 'example.org:82'; |
||||||
|
* console.log(myURL.href); |
||||||
|
* // Prints https://example.org:82/foo
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Invalid host name values assigned to the `hostname` property are ignored. |
||||||
|
*/ |
||||||
|
hostname: string; |
||||||
|
/** |
||||||
|
* Gets and sets the serialized URL. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const myURL = new URL('https://example.org/foo'); |
||||||
|
* console.log(myURL.href); |
||||||
|
* // Prints https://example.org/foo
|
||||||
|
* |
||||||
|
* myURL.href = 'https://example.com/bar'; |
||||||
|
* console.log(myURL.href); |
||||||
|
* // Prints https://example.com/bar
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Getting the value of the `href` property is equivalent to calling {@link toString}. |
||||||
|
* |
||||||
|
* Setting the value of this property to a new value is equivalent to creating a |
||||||
|
* new `URL` object using `new URL(value)`. Each of the `URL`object's properties will be modified. |
||||||
|
* |
||||||
|
* If the value assigned to the `href` property is not a valid URL, a `TypeError`will be thrown. |
||||||
|
*/ |
||||||
|
href: string; |
||||||
|
/** |
||||||
|
* Gets the read-only serialization of the URL's origin. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const myURL = new URL('https://example.org/foo/bar?baz'); |
||||||
|
* console.log(myURL.origin); |
||||||
|
* // Prints https://example.org
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const idnURL = new URL('https://測試'); |
||||||
|
* console.log(idnURL.origin); |
||||||
|
* // Prints https://xn--g6w251d
|
||||||
|
* |
||||||
|
* console.log(idnURL.hostname); |
||||||
|
* // Prints xn--g6w251d
|
||||||
|
* ``` |
||||||
|
*/ |
||||||
|
readonly origin: string; |
||||||
|
/** |
||||||
|
* Gets and sets the password portion of the URL. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const myURL = new URL('https://abc:xyz@example.com'); |
||||||
|
* console.log(myURL.password); |
||||||
|
* // Prints xyz
|
||||||
|
* |
||||||
|
* myURL.password = '123'; |
||||||
|
* console.log(myURL.href); |
||||||
|
* // Prints https://abc:123@example.com
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Invalid URL characters included in the value assigned to the `password` property |
||||||
|
* are `percent-encoded`. The selection of which characters to |
||||||
|
* percent-encode may vary somewhat from what the {@link parse} and {@link format} methods would produce. |
||||||
|
*/ |
||||||
|
password: string; |
||||||
|
/** |
||||||
|
* Gets and sets the path portion of the URL. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const myURL = new URL('https://example.org/abc/xyz?123'); |
||||||
|
* console.log(myURL.pathname); |
||||||
|
* // Prints /abc/xyz
|
||||||
|
* |
||||||
|
* myURL.pathname = '/abcdef'; |
||||||
|
* console.log(myURL.href); |
||||||
|
* // Prints https://example.org/abcdef?123
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Invalid URL characters included in the value assigned to the `pathname`property are `percent-encoded`. The selection of which characters |
||||||
|
* to percent-encode may vary somewhat from what the {@link parse} and {@link format} methods would produce. |
||||||
|
*/ |
||||||
|
pathname: string; |
||||||
|
/** |
||||||
|
* Gets and sets the port portion of the URL. |
||||||
|
* |
||||||
|
* The port value may be a number or a string containing a number in the range`0` to `65535` (inclusive). Setting the value to the default port of the`URL` objects given `protocol` will |
||||||
|
* result in the `port` value becoming |
||||||
|
* the empty string (`''`). |
||||||
|
* |
||||||
|
* The port value can be an empty string in which case the port depends on |
||||||
|
* the protocol/scheme: |
||||||
|
* |
||||||
|
* <omitted> |
||||||
|
* |
||||||
|
* Upon assigning a value to the port, the value will first be converted to a |
||||||
|
* string using `.toString()`. |
||||||
|
* |
||||||
|
* If that string is invalid but it begins with a number, the leading number is |
||||||
|
* assigned to `port`. |
||||||
|
* If the number lies outside the range denoted above, it is ignored. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const myURL = new URL('https://example.org:8888'); |
||||||
|
* console.log(myURL.port); |
||||||
|
* // Prints 8888
|
||||||
|
* |
||||||
|
* // Default ports are automatically transformed to the empty string
|
||||||
|
* // (HTTPS protocol's default port is 443)
|
||||||
|
* myURL.port = '443'; |
||||||
|
* console.log(myURL.port); |
||||||
|
* // Prints the empty string
|
||||||
|
* console.log(myURL.href); |
||||||
|
* // Prints https://example.org/
|
||||||
|
* |
||||||
|
* myURL.port = 1234; |
||||||
|
* console.log(myURL.port); |
||||||
|
* // Prints 1234
|
||||||
|
* console.log(myURL.href); |
||||||
|
* // Prints https://example.org:1234/
|
||||||
|
* |
||||||
|
* // Completely invalid port strings are ignored
|
||||||
|
* myURL.port = 'abcd'; |
||||||
|
* console.log(myURL.port); |
||||||
|
* // Prints 1234
|
||||||
|
* |
||||||
|
* // Leading numbers are treated as a port number
|
||||||
|
* myURL.port = '5678abcd'; |
||||||
|
* console.log(myURL.port); |
||||||
|
* // Prints 5678
|
||||||
|
* |
||||||
|
* // Non-integers are truncated
|
||||||
|
* myURL.port = 1234.5678; |
||||||
|
* console.log(myURL.port); |
||||||
|
* // Prints 1234
|
||||||
|
* |
||||||
|
* // Out-of-range numbers which are not represented in scientific notation
|
||||||
|
* // will be ignored.
|
||||||
|
* myURL.port = 1e10; // 10000000000, will be range-checked as described below
|
||||||
|
* console.log(myURL.port); |
||||||
|
* // Prints 1234
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Numbers which contain a decimal point, |
||||||
|
* such as floating-point numbers or numbers in scientific notation, |
||||||
|
* are not an exception to this rule. |
||||||
|
* Leading numbers up to the decimal point will be set as the URL's port, |
||||||
|
* assuming they are valid: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* myURL.port = 4.567e21; |
||||||
|
* console.log(myURL.port); |
||||||
|
* // Prints 4 (because it is the leading number in the string '4.567e21')
|
||||||
|
* ``` |
||||||
|
*/ |
||||||
|
port: string; |
||||||
|
/** |
||||||
|
* Gets and sets the protocol portion of the URL. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const myURL = new URL('https://example.org'); |
||||||
|
* console.log(myURL.protocol); |
||||||
|
* // Prints https:
|
||||||
|
* |
||||||
|
* myURL.protocol = 'ftp'; |
||||||
|
* console.log(myURL.href); |
||||||
|
* // Prints ftp://example.org/
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Invalid URL protocol values assigned to the `protocol` property are ignored. |
||||||
|
*/ |
||||||
|
protocol: string; |
||||||
|
/** |
||||||
|
* Gets and sets the serialized query portion of the URL. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const myURL = new URL('https://example.org/abc?123'); |
||||||
|
* console.log(myURL.search); |
||||||
|
* // Prints ?123
|
||||||
|
* |
||||||
|
* myURL.search = 'abc=xyz'; |
||||||
|
* console.log(myURL.href); |
||||||
|
* // Prints https://example.org/abc?abc=xyz
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Any invalid URL characters appearing in the value assigned the `search`property will be `percent-encoded`. The selection of which |
||||||
|
* characters to percent-encode may vary somewhat from what the {@link parse} and {@link format} methods would produce. |
||||||
|
*/ |
||||||
|
search: string; |
||||||
|
/** |
||||||
|
* Gets the `URLSearchParams` object representing the query parameters of the |
||||||
|
* URL. This property is read-only but the `URLSearchParams` object it provides |
||||||
|
* can be used to mutate the URL instance; to replace the entirety of query |
||||||
|
* parameters of the URL, use the {@link search} setter. See `URLSearchParams` documentation for details. |
||||||
|
* |
||||||
|
* Use care when using `.searchParams` to modify the `URL` because, |
||||||
|
* per the WHATWG specification, the `URLSearchParams` object uses |
||||||
|
* different rules to determine which characters to percent-encode. For |
||||||
|
* instance, the `URL` object will not percent encode the ASCII tilde (`~`) |
||||||
|
* character, while `URLSearchParams` will always encode it: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const myUrl = new URL('https://example.org/abc?foo=~bar'); |
||||||
|
* |
||||||
|
* console.log(myUrl.search); // prints ?foo=~bar
|
||||||
|
* |
||||||
|
* // Modify the URL via searchParams...
|
||||||
|
* myUrl.searchParams.sort(); |
||||||
|
* |
||||||
|
* console.log(myUrl.search); // prints ?foo=%7Ebar
|
||||||
|
* ``` |
||||||
|
*/ |
||||||
|
readonly searchParams: URLSearchParams; |
||||||
|
/** |
||||||
|
* Gets and sets the username portion of the URL. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const myURL = new URL('https://abc:xyz@example.com'); |
||||||
|
* console.log(myURL.username); |
||||||
|
* // Prints abc
|
||||||
|
* |
||||||
|
* myURL.username = '123'; |
||||||
|
* console.log(myURL.href); |
||||||
|
* // Prints https://123:xyz@example.com/
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Any invalid URL characters appearing in the value assigned the `username`property will be `percent-encoded`. The selection of which |
||||||
|
* characters to percent-encode may vary somewhat from what the {@link parse} and {@link format} methods would produce. |
||||||
|
*/ |
||||||
|
username: string; |
||||||
|
/** |
||||||
|
* The `toString()` method on the `URL` object returns the serialized URL. The |
||||||
|
* value returned is equivalent to that of {@link href} and {@link toJSON}. |
||||||
|
*/ |
||||||
|
toString(): string; |
||||||
|
/** |
||||||
|
* The `toJSON()` method on the `URL` object returns the serialized URL. The |
||||||
|
* value returned is equivalent to that of {@link href} and {@link toString}. |
||||||
|
* |
||||||
|
* This method is automatically called when an `URL` object is serialized |
||||||
|
* with [`JSON.stringify()`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/JSON/stringify).
|
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const myURLs = [ |
||||||
|
* new URL('https://www.example.com'), |
||||||
|
* new URL('https://test.example.org'), |
||||||
|
* ]; |
||||||
|
* console.log(JSON.stringify(myURLs)); |
||||||
|
* // Prints ["https://www.example.com/","https://test.example.org/"]
|
||||||
|
* ``` |
||||||
|
*/ |
||||||
|
toJSON(): string; |
||||||
|
} |
||||||
|
/** |
||||||
|
* The `URLSearchParams` API provides read and write access to the query of a`URL`. The `URLSearchParams` class can also be used standalone with one of the |
||||||
|
* four following constructors. |
||||||
|
* The `URLSearchParams` class is also available on the global object. |
||||||
|
* |
||||||
|
* The WHATWG `URLSearchParams` interface and the `querystring` module have
|
||||||
|
* similar purpose, but the purpose of the `querystring` module is more |
||||||
|
* general, as it allows the customization of delimiter characters (`&` and `=`). |
||||||
|
* On the other hand, this API is designed purely for URL query strings. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const myURL = new URL('https://example.org/?abc=123'); |
||||||
|
* console.log(myURL.searchParams.get('abc')); |
||||||
|
* // Prints 123
|
||||||
|
* |
||||||
|
* myURL.searchParams.append('abc', 'xyz'); |
||||||
|
* console.log(myURL.href); |
||||||
|
* // Prints https://example.org/?abc=123&abc=xyz
|
||||||
|
* |
||||||
|
* myURL.searchParams.delete('abc'); |
||||||
|
* myURL.searchParams.set('a', 'b'); |
||||||
|
* console.log(myURL.href); |
||||||
|
* // Prints https://example.org/?a=b
|
||||||
|
* |
||||||
|
* const newSearchParams = new URLSearchParams(myURL.searchParams); |
||||||
|
* // The above is equivalent to
|
||||||
|
* // const newSearchParams = new URLSearchParams(myURL.search);
|
||||||
|
* |
||||||
|
* newSearchParams.append('a', 'c'); |
||||||
|
* console.log(myURL.href); |
||||||
|
* // Prints https://example.org/?a=b
|
||||||
|
* console.log(newSearchParams.toString()); |
||||||
|
* // Prints a=b&a=c
|
||||||
|
* |
||||||
|
* // newSearchParams.toString() is implicitly called
|
||||||
|
* myURL.search = newSearchParams; |
||||||
|
* console.log(myURL.href); |
||||||
|
* // Prints https://example.org/?a=b&a=c
|
||||||
|
* newSearchParams.delete('a'); |
||||||
|
* console.log(myURL.href); |
||||||
|
* // Prints https://example.org/?a=b&a=c
|
||||||
|
* ``` |
||||||
|
* @since v7.5.0, v6.13.0 |
||||||
|
*/ |
||||||
|
class URLSearchParams implements Iterable<[string, string]> { |
||||||
|
constructor(init?: URLSearchParams | string | Record<string, string | ReadonlyArray<string>> | Iterable<[string, string]> | ReadonlyArray<[string, string]>); |
||||||
|
/** |
||||||
|
* Append a new name-value pair to the query string. |
||||||
|
*/ |
||||||
|
append(name: string, value: string): void; |
||||||
|
/** |
||||||
|
* Remove all name-value pairs whose name is `name`. |
||||||
|
*/ |
||||||
|
delete(name: string): void; |
||||||
|
/** |
||||||
|
* Returns an ES6 `Iterator` over each of the name-value pairs in the query. |
||||||
|
* Each item of the iterator is a JavaScript `Array`. The first item of the `Array`is the `name`, the second item of the `Array` is the `value`. |
||||||
|
* |
||||||
|
* Alias for `urlSearchParams[@@iterator]()`. |
||||||
|
*/ |
||||||
|
entries(): IterableIterator<[string, string]>; |
||||||
|
/** |
||||||
|
* Iterates over each name-value pair in the query and invokes the given function. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const myURL = new URL('https://example.org/?a=b&c=d'); |
||||||
|
* myURL.searchParams.forEach((value, name, searchParams) => { |
||||||
|
* console.log(name, value, myURL.searchParams === searchParams); |
||||||
|
* }); |
||||||
|
* // Prints:
|
||||||
|
* // a b true
|
||||||
|
* // c d true
|
||||||
|
* ``` |
||||||
|
* @param fn Invoked for each name-value pair in the query |
||||||
|
* @param thisArg To be used as `this` value for when `fn` is called |
||||||
|
*/ |
||||||
|
forEach<TThis = this>(callback: (this: TThis, value: string, name: string, searchParams: URLSearchParams) => void, thisArg?: TThis): void; |
||||||
|
/** |
||||||
|
* Returns the value of the first name-value pair whose name is `name`. If there |
||||||
|
* are no such pairs, `null` is returned. |
||||||
|
* @return or `null` if there is no name-value pair with the given `name`. |
||||||
|
*/ |
||||||
|
get(name: string): string | null; |
||||||
|
/** |
||||||
|
* Returns the values of all name-value pairs whose name is `name`. If there are |
||||||
|
* no such pairs, an empty array is returned. |
||||||
|
*/ |
||||||
|
getAll(name: string): string[]; |
||||||
|
/** |
||||||
|
* Returns `true` if there is at least one name-value pair whose name is `name`. |
||||||
|
*/ |
||||||
|
has(name: string): boolean; |
||||||
|
/** |
||||||
|
* Returns an ES6 `Iterator` over the names of each name-value pair. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const params = new URLSearchParams('foo=bar&foo=baz'); |
||||||
|
* for (const name of params.keys()) { |
||||||
|
* console.log(name); |
||||||
|
* } |
||||||
|
* // Prints:
|
||||||
|
* // foo
|
||||||
|
* // foo
|
||||||
|
* ``` |
||||||
|
*/ |
||||||
|
keys(): IterableIterator<string>; |
||||||
|
/** |
||||||
|
* Sets the value in the `URLSearchParams` object associated with `name` to`value`. If there are any pre-existing name-value pairs whose names are `name`, |
||||||
|
* set the first such pair's value to `value` and remove all others. If not, |
||||||
|
* append the name-value pair to the query string. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const params = new URLSearchParams(); |
||||||
|
* params.append('foo', 'bar'); |
||||||
|
* params.append('foo', 'baz'); |
||||||
|
* params.append('abc', 'def'); |
||||||
|
* console.log(params.toString()); |
||||||
|
* // Prints foo=bar&foo=baz&abc=def
|
||||||
|
* |
||||||
|
* params.set('foo', 'def'); |
||||||
|
* params.set('xyz', 'opq'); |
||||||
|
* console.log(params.toString()); |
||||||
|
* // Prints foo=def&abc=def&xyz=opq
|
||||||
|
* ``` |
||||||
|
*/ |
||||||
|
set(name: string, value: string): void; |
||||||
|
/** |
||||||
|
* Sort all existing name-value pairs in-place by their names. Sorting is done |
||||||
|
* with a [stable sorting algorithm](https://en.wikipedia.org/wiki/Sorting_algorithm#Stability), so relative order between name-value pairs
|
||||||
|
* with the same name is preserved. |
||||||
|
* |
||||||
|
* This method can be used, in particular, to increase cache hits. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const params = new URLSearchParams('query[]=abc&type=search&query[]=123'); |
||||||
|
* params.sort(); |
||||||
|
* console.log(params.toString()); |
||||||
|
* // Prints query%5B%5D=abc&query%5B%5D=123&type=search
|
||||||
|
* ``` |
||||||
|
* @since v7.7.0, v6.13.0 |
||||||
|
*/ |
||||||
|
sort(): void; |
||||||
|
/** |
||||||
|
* Returns the search parameters serialized as a string, with characters |
||||||
|
* percent-encoded where necessary. |
||||||
|
*/ |
||||||
|
toString(): string; |
||||||
|
/** |
||||||
|
* Returns an ES6 `Iterator` over the values of each name-value pair. |
||||||
|
*/ |
||||||
|
values(): IterableIterator<string>; |
||||||
|
[Symbol.iterator](): IterableIterator<[string, string]>; |
||||||
|
} |
||||||
|
import { URL as _URL, URLSearchParams as _URLSearchParams } from 'url'; |
||||||
|
global { |
||||||
|
interface URLSearchParams extends _URLSearchParams {} |
||||||
|
interface URL extends _URL {} |
||||||
|
interface Global { |
||||||
|
URL: typeof _URL; |
||||||
|
URLSearchParams: typeof _URLSearchParams; |
||||||
|
} |
||||||
|
/** |
||||||
|
* `URL` class is a global reference for `require('url').URL` |
||||||
|
* https://nodejs.org/api/url.html#the-whatwg-url-api
|
||||||
|
* @since v10.0.0 |
||||||
|
*/ |
||||||
|
var URL: typeof globalThis extends { |
||||||
|
onmessage: any; |
||||||
|
URL: infer URL; |
||||||
|
} |
||||||
|
? URL |
||||||
|
: typeof _URL; |
||||||
|
/** |
||||||
|
* `URLSearchParams` class is a global reference for `require('url').URLSearchParams` |
||||||
|
* https://nodejs.org/api/url.html#class-urlsearchparams
|
||||||
|
* @since v10.0.0 |
||||||
|
*/ |
||||||
|
var URLSearchParams: typeof globalThis extends { |
||||||
|
onmessage: any; |
||||||
|
URLSearchParams: infer URLSearchParams; |
||||||
|
} |
||||||
|
? URLSearchParams |
||||||
|
: typeof _URLSearchParams; |
||||||
|
} |
||||||
|
} |
||||||
|
declare module 'node:url' { |
||||||
|
export * from 'url'; |
||||||
|
} |
File diff suppressed because it is too large
Load Diff
@ -0,0 +1,396 @@ |
|||||||
|
/** |
||||||
|
* The `v8` module exposes APIs that are specific to the version of [V8](https://developers.google.com/v8/) built into the Node.js binary. It can be accessed using:
|
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const v8 = require('v8'); |
||||||
|
* ``` |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/v8.js)
|
||||||
|
*/ |
||||||
|
declare module 'v8' { |
||||||
|
import { Readable } from 'node:stream'; |
||||||
|
interface HeapSpaceInfo { |
||||||
|
space_name: string; |
||||||
|
space_size: number; |
||||||
|
space_used_size: number; |
||||||
|
space_available_size: number; |
||||||
|
physical_space_size: number; |
||||||
|
} |
||||||
|
// ** Signifies if the --zap_code_space option is enabled or not. 1 == enabled, 0 == disabled. */
|
||||||
|
type DoesZapCodeSpaceFlag = 0 | 1; |
||||||
|
interface HeapInfo { |
||||||
|
total_heap_size: number; |
||||||
|
total_heap_size_executable: number; |
||||||
|
total_physical_size: number; |
||||||
|
total_available_size: number; |
||||||
|
used_heap_size: number; |
||||||
|
heap_size_limit: number; |
||||||
|
malloced_memory: number; |
||||||
|
peak_malloced_memory: number; |
||||||
|
does_zap_garbage: DoesZapCodeSpaceFlag; |
||||||
|
number_of_native_contexts: number; |
||||||
|
number_of_detached_contexts: number; |
||||||
|
} |
||||||
|
interface HeapCodeStatistics { |
||||||
|
code_and_metadata_size: number; |
||||||
|
bytecode_and_metadata_size: number; |
||||||
|
external_script_source_size: number; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Returns an integer representing a version tag derived from the V8 version, |
||||||
|
* command-line flags, and detected CPU features. This is useful for determining |
||||||
|
* whether a `vm.Script` `cachedData` buffer is compatible with this instance |
||||||
|
* of V8. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* console.log(v8.cachedDataVersionTag()); // 3947234607
|
||||||
|
* // The value returned by v8.cachedDataVersionTag() is derived from the V8
|
||||||
|
* // version, command-line flags, and detected CPU features. Test that the value
|
||||||
|
* // does indeed update when flags are toggled.
|
||||||
|
* v8.setFlagsFromString('--allow_natives_syntax'); |
||||||
|
* console.log(v8.cachedDataVersionTag()); // 183726201
|
||||||
|
* ``` |
||||||
|
* @since v8.0.0 |
||||||
|
*/ |
||||||
|
function cachedDataVersionTag(): number; |
||||||
|
/** |
||||||
|
* Returns an object with the following properties: |
||||||
|
* |
||||||
|
* `does_zap_garbage` is a 0/1 boolean, which signifies whether the`--zap_code_space` option is enabled or not. This makes V8 overwrite heap |
||||||
|
* garbage with a bit pattern. The RSS footprint (resident set size) gets bigger |
||||||
|
* because it continuously touches all heap pages and that makes them less likely |
||||||
|
* to get swapped out by the operating system. |
||||||
|
* |
||||||
|
* `number_of_native_contexts` The value of native\_context is the number of the |
||||||
|
* top-level contexts currently active. Increase of this number over time indicates |
||||||
|
* a memory leak. |
||||||
|
* |
||||||
|
* `number_of_detached_contexts` The value of detached\_context is the number |
||||||
|
* of contexts that were detached and not yet garbage collected. This number |
||||||
|
* being non-zero indicates a potential memory leak. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* { |
||||||
|
* total_heap_size: 7326976, |
||||||
|
* total_heap_size_executable: 4194304, |
||||||
|
* total_physical_size: 7326976, |
||||||
|
* total_available_size: 1152656, |
||||||
|
* used_heap_size: 3476208, |
||||||
|
* heap_size_limit: 1535115264, |
||||||
|
* malloced_memory: 16384, |
||||||
|
* peak_malloced_memory: 1127496, |
||||||
|
* does_zap_garbage: 0, |
||||||
|
* number_of_native_contexts: 1, |
||||||
|
* number_of_detached_contexts: 0 |
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v1.0.0 |
||||||
|
*/ |
||||||
|
function getHeapStatistics(): HeapInfo; |
||||||
|
/** |
||||||
|
* Returns statistics about the V8 heap spaces, i.e. the segments which make up |
||||||
|
* the V8 heap. Neither the ordering of heap spaces, nor the availability of a |
||||||
|
* heap space can be guaranteed as the statistics are provided via the |
||||||
|
* V8[`GetHeapSpaceStatistics`](https://v8docs.nodesource.com/node-13.2/d5/dda/classv8_1_1_isolate.html#ac673576f24fdc7a33378f8f57e1d13a4) function and may change from one V8 version to the
|
||||||
|
* next. |
||||||
|
* |
||||||
|
* The value returned is an array of objects containing the following properties: |
||||||
|
* |
||||||
|
* ```json
|
||||||
|
* [ |
||||||
|
* { |
||||||
|
* "space_name": "new_space", |
||||||
|
* "space_size": 2063872, |
||||||
|
* "space_used_size": 951112, |
||||||
|
* "space_available_size": 80824, |
||||||
|
* "physical_space_size": 2063872 |
||||||
|
* }, |
||||||
|
* { |
||||||
|
* "space_name": "old_space", |
||||||
|
* "space_size": 3090560, |
||||||
|
* "space_used_size": 2493792, |
||||||
|
* "space_available_size": 0, |
||||||
|
* "physical_space_size": 3090560 |
||||||
|
* }, |
||||||
|
* { |
||||||
|
* "space_name": "code_space", |
||||||
|
* "space_size": 1260160, |
||||||
|
* "space_used_size": 644256, |
||||||
|
* "space_available_size": 960, |
||||||
|
* "physical_space_size": 1260160 |
||||||
|
* }, |
||||||
|
* { |
||||||
|
* "space_name": "map_space", |
||||||
|
* "space_size": 1094160, |
||||||
|
* "space_used_size": 201608, |
||||||
|
* "space_available_size": 0, |
||||||
|
* "physical_space_size": 1094160 |
||||||
|
* }, |
||||||
|
* { |
||||||
|
* "space_name": "large_object_space", |
||||||
|
* "space_size": 0, |
||||||
|
* "space_used_size": 0, |
||||||
|
* "space_available_size": 1490980608, |
||||||
|
* "physical_space_size": 0 |
||||||
|
* } |
||||||
|
* ] |
||||||
|
* ``` |
||||||
|
* @since v6.0.0 |
||||||
|
*/ |
||||||
|
function getHeapSpaceStatistics(): HeapSpaceInfo[]; |
||||||
|
/** |
||||||
|
* The `v8.setFlagsFromString()` method can be used to programmatically set |
||||||
|
* V8 command-line flags. This method should be used with care. Changing settings |
||||||
|
* after the VM has started may result in unpredictable behavior, including |
||||||
|
* crashes and data loss; or it may simply do nothing. |
||||||
|
* |
||||||
|
* The V8 options available for a version of Node.js may be determined by running`node --v8-options`. |
||||||
|
* |
||||||
|
* Usage: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* // Print GC events to stdout for one minute.
|
||||||
|
* const v8 = require('v8'); |
||||||
|
* v8.setFlagsFromString('--trace_gc'); |
||||||
|
* setTimeout(() => { v8.setFlagsFromString('--notrace_gc'); }, 60e3); |
||||||
|
* ``` |
||||||
|
* @since v1.0.0 |
||||||
|
*/ |
||||||
|
function setFlagsFromString(flags: string): void; |
||||||
|
/** |
||||||
|
* Generates a snapshot of the current V8 heap and returns a Readable |
||||||
|
* Stream that may be used to read the JSON serialized representation. |
||||||
|
* This JSON stream format is intended to be used with tools such as |
||||||
|
* Chrome DevTools. The JSON schema is undocumented and specific to the |
||||||
|
* V8 engine. Therefore, the schema may change from one version of V8 to the next. |
||||||
|
* |
||||||
|
* Creating a heap snapshot requires memory about twice the size of the heap at |
||||||
|
* the time the snapshot is created. This results in the risk of OOM killers |
||||||
|
* terminating the process. |
||||||
|
* |
||||||
|
* Generating a snapshot is a synchronous operation which blocks the event loop |
||||||
|
* for a duration depending on the heap size. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* // Print heap snapshot to the console
|
||||||
|
* const v8 = require('v8'); |
||||||
|
* const stream = v8.getHeapSnapshot(); |
||||||
|
* stream.pipe(process.stdout); |
||||||
|
* ``` |
||||||
|
* @since v11.13.0 |
||||||
|
* @return A Readable Stream containing the V8 heap snapshot |
||||||
|
*/ |
||||||
|
function getHeapSnapshot(): Readable; |
||||||
|
/** |
||||||
|
* Generates a snapshot of the current V8 heap and writes it to a JSON |
||||||
|
* file. This file is intended to be used with tools such as Chrome |
||||||
|
* DevTools. The JSON schema is undocumented and specific to the V8 |
||||||
|
* engine, and may change from one version of V8 to the next. |
||||||
|
* |
||||||
|
* A heap snapshot is specific to a single V8 isolate. When using `worker threads`, a heap snapshot generated from the main thread will |
||||||
|
* not contain any information about the workers, and vice versa. |
||||||
|
* |
||||||
|
* Creating a heap snapshot requires memory about twice the size of the heap at |
||||||
|
* the time the snapshot is created. This results in the risk of OOM killers |
||||||
|
* terminating the process. |
||||||
|
* |
||||||
|
* Generating a snapshot is a synchronous operation which blocks the event loop |
||||||
|
* for a duration depending on the heap size. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { writeHeapSnapshot } = require('v8'); |
||||||
|
* const { |
||||||
|
* Worker, |
||||||
|
* isMainThread, |
||||||
|
* parentPort |
||||||
|
* } = require('worker_threads'); |
||||||
|
* |
||||||
|
* if (isMainThread) { |
||||||
|
* const worker = new Worker(__filename); |
||||||
|
* |
||||||
|
* worker.once('message', (filename) => { |
||||||
|
* console.log(`worker heapdump: ${filename}`); |
||||||
|
* // Now get a heapdump for the main thread.
|
||||||
|
* console.log(`main thread heapdump: ${writeHeapSnapshot()}`); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* // Tell the worker to create a heapdump.
|
||||||
|
* worker.postMessage('heapdump'); |
||||||
|
* } else { |
||||||
|
* parentPort.once('message', (message) => { |
||||||
|
* if (message === 'heapdump') { |
||||||
|
* // Generate a heapdump for the worker
|
||||||
|
* // and return the filename to the parent.
|
||||||
|
* parentPort.postMessage(writeHeapSnapshot()); |
||||||
|
* } |
||||||
|
* }); |
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v11.13.0 |
||||||
|
* @param filename The file path where the V8 heap snapshot is to be saved. If not specified, a file name with the pattern `'Heap-${yyyymmdd}-${hhmmss}-${pid}-${thread_id}.heapsnapshot'` will be |
||||||
|
* generated, where `{pid}` will be the PID of the Node.js process, `{thread_id}` will be `0` when `writeHeapSnapshot()` is called from the main Node.js thread or the id of a |
||||||
|
* worker thread. |
||||||
|
* @return The filename where the snapshot was saved. |
||||||
|
*/ |
||||||
|
function writeHeapSnapshot(filename?: string): string; |
||||||
|
/** |
||||||
|
* Returns an object with the following properties: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* { |
||||||
|
* code_and_metadata_size: 212208, |
||||||
|
* bytecode_and_metadata_size: 161368, |
||||||
|
* external_script_source_size: 1410794 |
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v12.8.0 |
||||||
|
*/ |
||||||
|
function getHeapCodeStatistics(): HeapCodeStatistics; |
||||||
|
/** |
||||||
|
* @since v8.0.0 |
||||||
|
*/ |
||||||
|
class Serializer { |
||||||
|
/** |
||||||
|
* Writes out a header, which includes the serialization format version. |
||||||
|
*/ |
||||||
|
writeHeader(): void; |
||||||
|
/** |
||||||
|
* Serializes a JavaScript value and adds the serialized representation to the |
||||||
|
* internal buffer. |
||||||
|
* |
||||||
|
* This throws an error if `value` cannot be serialized. |
||||||
|
*/ |
||||||
|
writeValue(val: any): boolean; |
||||||
|
/** |
||||||
|
* Returns the stored internal buffer. This serializer should not be used once |
||||||
|
* the buffer is released. Calling this method results in undefined behavior |
||||||
|
* if a previous write has failed. |
||||||
|
*/ |
||||||
|
releaseBuffer(): Buffer; |
||||||
|
/** |
||||||
|
* Marks an `ArrayBuffer` as having its contents transferred out of band. |
||||||
|
* Pass the corresponding `ArrayBuffer` in the deserializing context to `deserializer.transferArrayBuffer()`. |
||||||
|
* @param id A 32-bit unsigned integer. |
||||||
|
* @param arrayBuffer An `ArrayBuffer` instance. |
||||||
|
*/ |
||||||
|
transferArrayBuffer(id: number, arrayBuffer: ArrayBuffer): void; |
||||||
|
/** |
||||||
|
* Write a raw 32-bit unsigned integer. |
||||||
|
* For use inside of a custom `serializer._writeHostObject()`. |
||||||
|
*/ |
||||||
|
writeUint32(value: number): void; |
||||||
|
/** |
||||||
|
* Write a raw 64-bit unsigned integer, split into high and low 32-bit parts. |
||||||
|
* For use inside of a custom `serializer._writeHostObject()`. |
||||||
|
*/ |
||||||
|
writeUint64(hi: number, lo: number): void; |
||||||
|
/** |
||||||
|
* Write a JS `number` value. |
||||||
|
* For use inside of a custom `serializer._writeHostObject()`. |
||||||
|
*/ |
||||||
|
writeDouble(value: number): void; |
||||||
|
/** |
||||||
|
* Write raw bytes into the serializer’s internal buffer. The deserializer |
||||||
|
* will require a way to compute the length of the buffer. |
||||||
|
* For use inside of a custom `serializer._writeHostObject()`. |
||||||
|
*/ |
||||||
|
writeRawBytes(buffer: NodeJS.TypedArray): void; |
||||||
|
} |
||||||
|
/** |
||||||
|
* A subclass of `Serializer` that serializes `TypedArray`(in particular `Buffer`) and `DataView` objects as host objects, and only |
||||||
|
* stores the part of their underlying `ArrayBuffer`s that they are referring to. |
||||||
|
* @since v8.0.0 |
||||||
|
*/ |
||||||
|
class DefaultSerializer extends Serializer {} |
||||||
|
/** |
||||||
|
* @since v8.0.0 |
||||||
|
*/ |
||||||
|
class Deserializer { |
||||||
|
constructor(data: NodeJS.TypedArray); |
||||||
|
/** |
||||||
|
* Reads and validates a header (including the format version). |
||||||
|
* May, for example, reject an invalid or unsupported wire format. In that case, |
||||||
|
* an `Error` is thrown. |
||||||
|
*/ |
||||||
|
readHeader(): boolean; |
||||||
|
/** |
||||||
|
* Deserializes a JavaScript value from the buffer and returns it. |
||||||
|
*/ |
||||||
|
readValue(): any; |
||||||
|
/** |
||||||
|
* Marks an `ArrayBuffer` as having its contents transferred out of band. |
||||||
|
* Pass the corresponding `ArrayBuffer` in the serializing context to `serializer.transferArrayBuffer()` (or return the `id` from `serializer._getSharedArrayBufferId()` in the case of |
||||||
|
* `SharedArrayBuffer`s). |
||||||
|
* @param id A 32-bit unsigned integer. |
||||||
|
* @param arrayBuffer An `ArrayBuffer` instance. |
||||||
|
*/ |
||||||
|
transferArrayBuffer(id: number, arrayBuffer: ArrayBuffer): void; |
||||||
|
/** |
||||||
|
* Reads the underlying wire format version. Likely mostly to be useful to |
||||||
|
* legacy code reading old wire format versions. May not be called before`.readHeader()`. |
||||||
|
*/ |
||||||
|
getWireFormatVersion(): number; |
||||||
|
/** |
||||||
|
* Read a raw 32-bit unsigned integer and return it. |
||||||
|
* For use inside of a custom `deserializer._readHostObject()`. |
||||||
|
*/ |
||||||
|
readUint32(): number; |
||||||
|
/** |
||||||
|
* Read a raw 64-bit unsigned integer and return it as an array `[hi, lo]`with two 32-bit unsigned integer entries. |
||||||
|
* For use inside of a custom `deserializer._readHostObject()`. |
||||||
|
*/ |
||||||
|
readUint64(): [number, number]; |
||||||
|
/** |
||||||
|
* Read a JS `number` value. |
||||||
|
* For use inside of a custom `deserializer._readHostObject()`. |
||||||
|
*/ |
||||||
|
readDouble(): number; |
||||||
|
/** |
||||||
|
* Read raw bytes from the deserializer’s internal buffer. The `length` parameter |
||||||
|
* must correspond to the length of the buffer that was passed to `serializer.writeRawBytes()`. |
||||||
|
* For use inside of a custom `deserializer._readHostObject()`. |
||||||
|
*/ |
||||||
|
readRawBytes(length: number): Buffer; |
||||||
|
} |
||||||
|
/** |
||||||
|
* A subclass of `Deserializer` corresponding to the format written by `DefaultSerializer`. |
||||||
|
* @since v8.0.0 |
||||||
|
*/ |
||||||
|
class DefaultDeserializer extends Deserializer {} |
||||||
|
/** |
||||||
|
* Uses a `DefaultSerializer` to serialize `value` into a buffer. |
||||||
|
* |
||||||
|
* `ERR_BUFFER_TOO_LARGE` will be thrown when trying to |
||||||
|
* serialize a huge object which requires buffer |
||||||
|
* larger than `buffer.constants.MAX_LENGTH`. |
||||||
|
* @since v8.0.0 |
||||||
|
*/ |
||||||
|
function serialize(value: any): Buffer; |
||||||
|
/** |
||||||
|
* Uses a `DefaultDeserializer` with default options to read a JS value |
||||||
|
* from a buffer. |
||||||
|
* @since v8.0.0 |
||||||
|
* @param buffer A buffer returned by {@link serialize}. |
||||||
|
*/ |
||||||
|
function deserialize(buffer: NodeJS.TypedArray): any; |
||||||
|
/** |
||||||
|
* The `v8.takeCoverage()` method allows the user to write the coverage started by `NODE_V8_COVERAGE` to disk on demand. This method can be invoked multiple |
||||||
|
* times during the lifetime of the process. Each time the execution counter will |
||||||
|
* be reset and a new coverage report will be written to the directory specified |
||||||
|
* by `NODE_V8_COVERAGE`. |
||||||
|
* |
||||||
|
* When the process is about to exit, one last coverage will still be written to |
||||||
|
* disk unless {@link stopCoverage} is invoked before the process exits. |
||||||
|
* @since v15.1.0, v14.18.0, v12.22.0 |
||||||
|
*/ |
||||||
|
function takeCoverage(): void; |
||||||
|
/** |
||||||
|
* The `v8.stopCoverage()` method allows the user to stop the coverage collection |
||||||
|
* started by `NODE_V8_COVERAGE`, so that V8 can release the execution count |
||||||
|
* records and optimize code. This can be used in conjunction with {@link takeCoverage} if the user wants to collect the coverage on demand. |
||||||
|
* @since v15.1.0, v14.18.0, v12.22.0 |
||||||
|
*/ |
||||||
|
function stopCoverage(): void; |
||||||
|
} |
||||||
|
declare module 'node:v8' { |
||||||
|
export * from 'v8'; |
||||||
|
} |
@ -0,0 +1,509 @@ |
|||||||
|
/** |
||||||
|
* The `vm` module enables compiling and running code within V8 Virtual |
||||||
|
* Machine contexts. |
||||||
|
* |
||||||
|
* **The `vm` module is not a security** |
||||||
|
* **mechanism. Do not use it to run untrusted code.** |
||||||
|
* |
||||||
|
* JavaScript code can be compiled and run immediately or |
||||||
|
* compiled, saved, and run later. |
||||||
|
* |
||||||
|
* A common use case is to run the code in a different V8 Context. This means |
||||||
|
* invoked code has a different global object than the invoking code. |
||||||
|
* |
||||||
|
* One can provide the context by `contextifying` an |
||||||
|
* object. The invoked code treats any property in the context like a |
||||||
|
* global variable. Any changes to global variables caused by the invoked |
||||||
|
* code are reflected in the context object. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const vm = require('vm'); |
||||||
|
* |
||||||
|
* const x = 1; |
||||||
|
* |
||||||
|
* const context = { x: 2 }; |
||||||
|
* vm.createContext(context); // Contextify the object.
|
||||||
|
* |
||||||
|
* const code = 'x += 40; var y = 17;'; |
||||||
|
* // `x` and `y` are global variables in the context.
|
||||||
|
* // Initially, x has the value 2 because that is the value of context.x.
|
||||||
|
* vm.runInContext(code, context); |
||||||
|
* |
||||||
|
* console.log(context.x); // 42
|
||||||
|
* console.log(context.y); // 17
|
||||||
|
* |
||||||
|
* console.log(x); // 1; y is not defined.
|
||||||
|
* ``` |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/vm.js)
|
||||||
|
*/ |
||||||
|
declare module 'vm' { |
||||||
|
interface Context extends NodeJS.Dict<any> {} |
||||||
|
interface BaseOptions { |
||||||
|
/** |
||||||
|
* Specifies the filename used in stack traces produced by this script. |
||||||
|
* Default: `''`. |
||||||
|
*/ |
||||||
|
filename?: string | undefined; |
||||||
|
/** |
||||||
|
* Specifies the line number offset that is displayed in stack traces produced by this script. |
||||||
|
* Default: `0`. |
||||||
|
*/ |
||||||
|
lineOffset?: number | undefined; |
||||||
|
/** |
||||||
|
* Specifies the column number offset that is displayed in stack traces produced by this script. |
||||||
|
* @default 0 |
||||||
|
*/ |
||||||
|
columnOffset?: number | undefined; |
||||||
|
} |
||||||
|
interface ScriptOptions extends BaseOptions { |
||||||
|
displayErrors?: boolean | undefined; |
||||||
|
timeout?: number | undefined; |
||||||
|
cachedData?: Buffer | undefined; |
||||||
|
/** @deprecated in favor of `script.createCachedData()` */ |
||||||
|
produceCachedData?: boolean | undefined; |
||||||
|
} |
||||||
|
interface RunningScriptOptions extends BaseOptions { |
||||||
|
/** |
||||||
|
* When `true`, if an `Error` occurs while compiling the `code`, the line of code causing the error is attached to the stack trace. |
||||||
|
* Default: `true`. |
||||||
|
*/ |
||||||
|
displayErrors?: boolean | undefined; |
||||||
|
/** |
||||||
|
* Specifies the number of milliseconds to execute code before terminating execution. |
||||||
|
* If execution is terminated, an `Error` will be thrown. This value must be a strictly positive integer. |
||||||
|
*/ |
||||||
|
timeout?: number | undefined; |
||||||
|
/** |
||||||
|
* If `true`, the execution will be terminated when `SIGINT` (Ctrl+C) is received. |
||||||
|
* Existing handlers for the event that have been attached via `process.on('SIGINT')` will be disabled during script execution, but will continue to work after that. |
||||||
|
* If execution is terminated, an `Error` will be thrown. |
||||||
|
* Default: `false`. |
||||||
|
*/ |
||||||
|
breakOnSigint?: boolean | undefined; |
||||||
|
/** |
||||||
|
* If set to `afterEvaluate`, microtasks will be run immediately after the script has run. |
||||||
|
*/ |
||||||
|
microtaskMode?: 'afterEvaluate' | undefined; |
||||||
|
} |
||||||
|
interface CompileFunctionOptions extends BaseOptions { |
||||||
|
/** |
||||||
|
* Provides an optional data with V8's code cache data for the supplied source. |
||||||
|
*/ |
||||||
|
cachedData?: Buffer | undefined; |
||||||
|
/** |
||||||
|
* Specifies whether to produce new cache data. |
||||||
|
* Default: `false`, |
||||||
|
*/ |
||||||
|
produceCachedData?: boolean | undefined; |
||||||
|
/** |
||||||
|
* The sandbox/context in which the said function should be compiled in. |
||||||
|
*/ |
||||||
|
parsingContext?: Context | undefined; |
||||||
|
/** |
||||||
|
* An array containing a collection of context extensions (objects wrapping the current scope) to be applied while compiling |
||||||
|
*/ |
||||||
|
contextExtensions?: Object[] | undefined; |
||||||
|
} |
||||||
|
interface CreateContextOptions { |
||||||
|
/** |
||||||
|
* Human-readable name of the newly created context. |
||||||
|
* @default 'VM Context i' Where i is an ascending numerical index of the created context. |
||||||
|
*/ |
||||||
|
name?: string | undefined; |
||||||
|
/** |
||||||
|
* Corresponds to the newly created context for display purposes. |
||||||
|
* The origin should be formatted like a `URL`, but with only the scheme, host, and port (if necessary), |
||||||
|
* like the value of the `url.origin` property of a URL object. |
||||||
|
* Most notably, this string should omit the trailing slash, as that denotes a path. |
||||||
|
* @default '' |
||||||
|
*/ |
||||||
|
origin?: string | undefined; |
||||||
|
codeGeneration?: |
||||||
|
| { |
||||||
|
/** |
||||||
|
* If set to false any calls to eval or function constructors (Function, GeneratorFunction, etc) |
||||||
|
* will throw an EvalError. |
||||||
|
* @default true |
||||||
|
*/ |
||||||
|
strings?: boolean | undefined; |
||||||
|
/** |
||||||
|
* If set to false any attempt to compile a WebAssembly module will throw a WebAssembly.CompileError. |
||||||
|
* @default true |
||||||
|
*/ |
||||||
|
wasm?: boolean | undefined; |
||||||
|
} |
||||||
|
| undefined; |
||||||
|
/** |
||||||
|
* If set to `afterEvaluate`, microtasks will be run immediately after the script has run. |
||||||
|
*/ |
||||||
|
microtaskMode?: 'afterEvaluate' | undefined; |
||||||
|
} |
||||||
|
type MeasureMemoryMode = 'summary' | 'detailed'; |
||||||
|
interface MeasureMemoryOptions { |
||||||
|
/** |
||||||
|
* @default 'summary' |
||||||
|
*/ |
||||||
|
mode?: MeasureMemoryMode | undefined; |
||||||
|
context?: Context | undefined; |
||||||
|
} |
||||||
|
interface MemoryMeasurement { |
||||||
|
total: { |
||||||
|
jsMemoryEstimate: number; |
||||||
|
jsMemoryRange: [number, number]; |
||||||
|
}; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Instances of the `vm.Script` class contain precompiled scripts that can be |
||||||
|
* executed in specific contexts. |
||||||
|
* @since v0.3.1 |
||||||
|
*/ |
||||||
|
class Script { |
||||||
|
constructor(code: string, options?: ScriptOptions); |
||||||
|
/** |
||||||
|
* Runs the compiled code contained by the `vm.Script` object within the given`contextifiedObject` and returns the result. Running code does not have access |
||||||
|
* to local scope. |
||||||
|
* |
||||||
|
* The following example compiles code that increments a global variable, sets |
||||||
|
* the value of another global variable, then execute the code multiple times. |
||||||
|
* The globals are contained in the `context` object. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const vm = require('vm'); |
||||||
|
* |
||||||
|
* const context = { |
||||||
|
* animal: 'cat', |
||||||
|
* count: 2 |
||||||
|
* }; |
||||||
|
* |
||||||
|
* const script = new vm.Script('count += 1; name = "kitty";'); |
||||||
|
* |
||||||
|
* vm.createContext(context); |
||||||
|
* for (let i = 0; i < 10; ++i) { |
||||||
|
* script.runInContext(context); |
||||||
|
* } |
||||||
|
* |
||||||
|
* console.log(context); |
||||||
|
* // Prints: { animal: 'cat', count: 12, name: 'kitty' }
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Using the `timeout` or `breakOnSigint` options will result in new event loops |
||||||
|
* and corresponding threads being started, which have a non-zero performance |
||||||
|
* overhead. |
||||||
|
* @since v0.3.1 |
||||||
|
* @param contextifiedObject A `contextified` object as returned by the `vm.createContext()` method. |
||||||
|
* @return the result of the very last statement executed in the script. |
||||||
|
*/ |
||||||
|
runInContext(contextifiedObject: Context, options?: RunningScriptOptions): any; |
||||||
|
/** |
||||||
|
* First contextifies the given `contextObject`, runs the compiled code contained |
||||||
|
* by the `vm.Script` object within the created context, and returns the result. |
||||||
|
* Running code does not have access to local scope. |
||||||
|
* |
||||||
|
* The following example compiles code that sets a global variable, then executes |
||||||
|
* the code multiple times in different contexts. The globals are set on and |
||||||
|
* contained within each individual `context`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const vm = require('vm'); |
||||||
|
* |
||||||
|
* const script = new vm.Script('globalVar = "set"'); |
||||||
|
* |
||||||
|
* const contexts = [{}, {}, {}]; |
||||||
|
* contexts.forEach((context) => { |
||||||
|
* script.runInNewContext(context); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* console.log(contexts); |
||||||
|
* // Prints: [{ globalVar: 'set' }, { globalVar: 'set' }, { globalVar: 'set' }]
|
||||||
|
* ``` |
||||||
|
* @since v0.3.1 |
||||||
|
* @param contextObject An object that will be `contextified`. If `undefined`, a new object will be created. |
||||||
|
* @return the result of the very last statement executed in the script. |
||||||
|
*/ |
||||||
|
runInNewContext(contextObject?: Context, options?: RunningScriptOptions): any; |
||||||
|
/** |
||||||
|
* Runs the compiled code contained by the `vm.Script` within the context of the |
||||||
|
* current `global` object. Running code does not have access to local scope, but _does_ have access to the current `global` object. |
||||||
|
* |
||||||
|
* The following example compiles code that increments a `global` variable then |
||||||
|
* executes that code multiple times: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const vm = require('vm'); |
||||||
|
* |
||||||
|
* global.globalVar = 0; |
||||||
|
* |
||||||
|
* const script = new vm.Script('globalVar += 1', { filename: 'myfile.vm' }); |
||||||
|
* |
||||||
|
* for (let i = 0; i < 1000; ++i) { |
||||||
|
* script.runInThisContext(); |
||||||
|
* } |
||||||
|
* |
||||||
|
* console.log(globalVar); |
||||||
|
* |
||||||
|
* // 1000
|
||||||
|
* ``` |
||||||
|
* @since v0.3.1 |
||||||
|
* @return the result of the very last statement executed in the script. |
||||||
|
*/ |
||||||
|
runInThisContext(options?: RunningScriptOptions): any; |
||||||
|
/** |
||||||
|
* Creates a code cache that can be used with the `Script` constructor's`cachedData` option. Returns a `Buffer`. This method may be called at any |
||||||
|
* time and any number of times. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const script = new vm.Script(` |
||||||
|
* function add(a, b) { |
||||||
|
* return a + b; |
||||||
|
* } |
||||||
|
* |
||||||
|
* const x = add(1, 2); |
||||||
|
* `);
|
||||||
|
* |
||||||
|
* const cacheWithoutX = script.createCachedData(); |
||||||
|
* |
||||||
|
* script.runInThisContext(); |
||||||
|
* |
||||||
|
* const cacheWithX = script.createCachedData(); |
||||||
|
* ``` |
||||||
|
* @since v10.6.0 |
||||||
|
*/ |
||||||
|
createCachedData(): Buffer; |
||||||
|
/** @deprecated in favor of `script.createCachedData()` */ |
||||||
|
cachedDataProduced?: boolean | undefined; |
||||||
|
cachedDataRejected?: boolean | undefined; |
||||||
|
cachedData?: Buffer | undefined; |
||||||
|
} |
||||||
|
/** |
||||||
|
* If given a `contextObject`, the `vm.createContext()` method will `prepare
|
||||||
|
* that object` so that it can be used in calls to {@link runInContext} or `script.runInContext()`. Inside such scripts,
|
||||||
|
* the `contextObject` will be the global object, retaining all of its existing |
||||||
|
* properties but also having the built-in objects and functions any standard [global object](https://es5.github.io/#x15.1) has. Outside of scripts run by the vm module, global variables
|
||||||
|
* will remain unchanged. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const vm = require('vm'); |
||||||
|
* |
||||||
|
* global.globalVar = 3; |
||||||
|
* |
||||||
|
* const context = { globalVar: 1 }; |
||||||
|
* vm.createContext(context); |
||||||
|
* |
||||||
|
* vm.runInContext('globalVar *= 2;', context); |
||||||
|
* |
||||||
|
* console.log(context); |
||||||
|
* // Prints: { globalVar: 2 }
|
||||||
|
* |
||||||
|
* console.log(global.globalVar); |
||||||
|
* // Prints: 3
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* If `contextObject` is omitted (or passed explicitly as `undefined`), a new, |
||||||
|
* empty `contextified` object will be returned. |
||||||
|
* |
||||||
|
* The `vm.createContext()` method is primarily useful for creating a single |
||||||
|
* context that can be used to run multiple scripts. For instance, if emulating a |
||||||
|
* web browser, the method can be used to create a single context representing a |
||||||
|
* window's global object, then run all `<script>` tags together within that |
||||||
|
* context. |
||||||
|
* |
||||||
|
* The provided `name` and `origin` of the context are made visible through the |
||||||
|
* Inspector API. |
||||||
|
* @since v0.3.1 |
||||||
|
* @return contextified object. |
||||||
|
*/ |
||||||
|
function createContext(sandbox?: Context, options?: CreateContextOptions): Context; |
||||||
|
/** |
||||||
|
* Returns `true` if the given `object` object has been `contextified` using {@link createContext}. |
||||||
|
* @since v0.11.7 |
||||||
|
*/ |
||||||
|
function isContext(sandbox: Context): boolean; |
||||||
|
/** |
||||||
|
* The `vm.runInContext()` method compiles `code`, runs it within the context of |
||||||
|
* the `contextifiedObject`, then returns the result. Running code does not have |
||||||
|
* access to the local scope. The `contextifiedObject` object _must_ have been |
||||||
|
* previously `contextified` using the {@link createContext} method. |
||||||
|
* |
||||||
|
* If `options` is a string, then it specifies the filename. |
||||||
|
* |
||||||
|
* The following example compiles and executes different scripts using a single `contextified` object: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const vm = require('vm'); |
||||||
|
* |
||||||
|
* const contextObject = { globalVar: 1 }; |
||||||
|
* vm.createContext(contextObject); |
||||||
|
* |
||||||
|
* for (let i = 0; i < 10; ++i) { |
||||||
|
* vm.runInContext('globalVar *= 2;', contextObject); |
||||||
|
* } |
||||||
|
* console.log(contextObject); |
||||||
|
* // Prints: { globalVar: 1024 }
|
||||||
|
* ``` |
||||||
|
* @since v0.3.1 |
||||||
|
* @param code The JavaScript code to compile and run. |
||||||
|
* @param contextifiedObject The `contextified` object that will be used as the `global` when the `code` is compiled and run. |
||||||
|
* @return the result of the very last statement executed in the script. |
||||||
|
*/ |
||||||
|
function runInContext(code: string, contextifiedObject: Context, options?: RunningScriptOptions | string): any; |
||||||
|
/** |
||||||
|
* The `vm.runInNewContext()` first contextifies the given `contextObject` (or |
||||||
|
* creates a new `contextObject` if passed as `undefined`), compiles the `code`, |
||||||
|
* runs it within the created context, then returns the result. Running code |
||||||
|
* does not have access to the local scope. |
||||||
|
* |
||||||
|
* If `options` is a string, then it specifies the filename. |
||||||
|
* |
||||||
|
* The following example compiles and executes code that increments a global |
||||||
|
* variable and sets a new one. These globals are contained in the `contextObject`. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const vm = require('vm'); |
||||||
|
* |
||||||
|
* const contextObject = { |
||||||
|
* animal: 'cat', |
||||||
|
* count: 2 |
||||||
|
* }; |
||||||
|
* |
||||||
|
* vm.runInNewContext('count += 1; name = "kitty"', contextObject); |
||||||
|
* console.log(contextObject); |
||||||
|
* // Prints: { animal: 'cat', count: 3, name: 'kitty' }
|
||||||
|
* ``` |
||||||
|
* @since v0.3.1 |
||||||
|
* @param code The JavaScript code to compile and run. |
||||||
|
* @param contextObject An object that will be `contextified`. If `undefined`, a new object will be created. |
||||||
|
* @return the result of the very last statement executed in the script. |
||||||
|
*/ |
||||||
|
function runInNewContext(code: string, contextObject?: Context, options?: RunningScriptOptions | string): any; |
||||||
|
/** |
||||||
|
* `vm.runInThisContext()` compiles `code`, runs it within the context of the |
||||||
|
* current `global` and returns the result. Running code does not have access to |
||||||
|
* local scope, but does have access to the current `global` object. |
||||||
|
* |
||||||
|
* If `options` is a string, then it specifies the filename. |
||||||
|
* |
||||||
|
* The following example illustrates using both `vm.runInThisContext()` and |
||||||
|
* the JavaScript [`eval()`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/eval) function to run the same code:
|
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const vm = require('vm'); |
||||||
|
* let localVar = 'initial value'; |
||||||
|
* |
||||||
|
* const vmResult = vm.runInThisContext('localVar = "vm";'); |
||||||
|
* console.log(`vmResult: '${vmResult}', localVar: '${localVar}'`); |
||||||
|
* // Prints: vmResult: 'vm', localVar: 'initial value'
|
||||||
|
* |
||||||
|
* const evalResult = eval('localVar = "eval";'); |
||||||
|
* console.log(`evalResult: '${evalResult}', localVar: '${localVar}'`); |
||||||
|
* // Prints: evalResult: 'eval', localVar: 'eval'
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Because `vm.runInThisContext()` does not have access to the local scope,`localVar` is unchanged. In contrast, |
||||||
|
* [`eval()`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/eval) _does_ have access to the
|
||||||
|
* local scope, so the value `localVar` is changed. In this way`vm.runInThisContext()` is much like an [indirect `eval()` call](https://es5.github.io/#x10.4.2), e.g.`(0,eval)('code')`.
|
||||||
|
* |
||||||
|
* ## Example: Running an HTTP server within a VM |
||||||
|
* |
||||||
|
* When using either `script.runInThisContext()` or {@link runInThisContext}, the code is executed within the current V8 global |
||||||
|
* context. The code passed to this VM context will have its own isolated scope. |
||||||
|
* |
||||||
|
* In order to run a simple web server using the `http` module the code passed to |
||||||
|
* the context must either call `require('http')` on its own, or have a reference |
||||||
|
* to the `http` module passed to it. For instance: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* 'use strict'; |
||||||
|
* const vm = require('vm'); |
||||||
|
* |
||||||
|
* const code = ` |
||||||
|
* ((require) => { |
||||||
|
* const http = require('http'); |
||||||
|
* |
||||||
|
* http.createServer((request, response) => { |
||||||
|
* response.writeHead(200, { 'Content-Type': 'text/plain' }); |
||||||
|
* response.end('Hello World\\n'); |
||||||
|
* }).listen(8124); |
||||||
|
* |
||||||
|
* console.log('Server running at http://127.0.0.1:8124/'); |
||||||
|
* })`;
|
||||||
|
* |
||||||
|
* vm.runInThisContext(code)(require); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* The `require()` in the above case shares the state with the context it is |
||||||
|
* passed from. This may introduce risks when untrusted code is executed, e.g. |
||||||
|
* altering objects in the context in unwanted ways. |
||||||
|
* @since v0.3.1 |
||||||
|
* @param code The JavaScript code to compile and run. |
||||||
|
* @return the result of the very last statement executed in the script. |
||||||
|
*/ |
||||||
|
function runInThisContext(code: string, options?: RunningScriptOptions | string): any; |
||||||
|
/** |
||||||
|
* Compiles the given code into the provided context (if no context is |
||||||
|
* supplied, the current context is used), and returns it wrapped inside a |
||||||
|
* function with the given `params`. |
||||||
|
* @since v10.10.0 |
||||||
|
* @param code The body of the function to compile. |
||||||
|
* @param params An array of strings containing all parameters for the function. |
||||||
|
*/ |
||||||
|
function compileFunction(code: string, params?: ReadonlyArray<string>, options?: CompileFunctionOptions): Function; |
||||||
|
/** |
||||||
|
* Measure the memory known to V8 and used by all contexts known to the |
||||||
|
* current V8 isolate, or the main context. |
||||||
|
* |
||||||
|
* The format of the object that the returned Promise may resolve with is |
||||||
|
* specific to the V8 engine and may change from one version of V8 to the next. |
||||||
|
* |
||||||
|
* The returned result is different from the statistics returned by`v8.getHeapSpaceStatistics()` in that `vm.measureMemory()` measure the |
||||||
|
* memory reachable by each V8 specific contexts in the current instance of |
||||||
|
* the V8 engine, while the result of `v8.getHeapSpaceStatistics()` measure |
||||||
|
* the memory occupied by each heap space in the current V8 instance. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const vm = require('vm'); |
||||||
|
* // Measure the memory used by the main context.
|
||||||
|
* vm.measureMemory({ mode: 'summary' }) |
||||||
|
* // This is the same as vm.measureMemory()
|
||||||
|
* .then((result) => { |
||||||
|
* // The current format is:
|
||||||
|
* // {
|
||||||
|
* // total: {
|
||||||
|
* // jsMemoryEstimate: 2418479, jsMemoryRange: [ 2418479, 2745799 ]
|
||||||
|
* // }
|
||||||
|
* // }
|
||||||
|
* console.log(result); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* const context = vm.createContext({ a: 1 }); |
||||||
|
* vm.measureMemory({ mode: 'detailed', execution: 'eager' }) |
||||||
|
* .then((result) => { |
||||||
|
* // Reference the context here so that it won't be GC'ed
|
||||||
|
* // until the measurement is complete.
|
||||||
|
* console.log(context.a); |
||||||
|
* // {
|
||||||
|
* // total: {
|
||||||
|
* // jsMemoryEstimate: 2574732,
|
||||||
|
* // jsMemoryRange: [ 2574732, 2904372 ]
|
||||||
|
* // },
|
||||||
|
* // current: {
|
||||||
|
* // jsMemoryEstimate: 2438996,
|
||||||
|
* // jsMemoryRange: [ 2438996, 2768636 ]
|
||||||
|
* // },
|
||||||
|
* // other: [
|
||||||
|
* // {
|
||||||
|
* // jsMemoryEstimate: 135736,
|
||||||
|
* // jsMemoryRange: [ 135736, 465376 ]
|
||||||
|
* // }
|
||||||
|
* // ]
|
||||||
|
* // }
|
||||||
|
* console.log(result); |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* @since v13.10.0 |
||||||
|
* @experimental |
||||||
|
*/ |
||||||
|
function measureMemory(options?: MeasureMemoryOptions): Promise<MemoryMeasurement>; |
||||||
|
} |
||||||
|
declare module 'node:vm' { |
||||||
|
export * from 'vm'; |
||||||
|
} |
@ -0,0 +1,158 @@ |
|||||||
|
/** |
||||||
|
* The WASI API provides an implementation of the [WebAssembly System Interface](https://wasi.dev/) specification. WASI gives sandboxed WebAssembly applications access to the
|
||||||
|
* underlying operating system via a collection of POSIX-like functions. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* import { readFile } from 'fs/promises'; |
||||||
|
* import { WASI } from 'wasi'; |
||||||
|
* import { argv, env } from 'process'; |
||||||
|
* |
||||||
|
* const wasi = new WASI({ |
||||||
|
* args: argv, |
||||||
|
* env, |
||||||
|
* preopens: { |
||||||
|
* '/sandbox': '/some/real/path/that/wasm/can/access' |
||||||
|
* } |
||||||
|
* }); |
||||||
|
* |
||||||
|
* // Some WASI binaries require:
|
||||||
|
* // const importObject = { wasi_unstable: wasi.wasiImport };
|
||||||
|
* const importObject = { wasi_snapshot_preview1: wasi.wasiImport }; |
||||||
|
* |
||||||
|
* const wasm = await WebAssembly.compile( |
||||||
|
* await readFile(new URL('./demo.wasm', import.meta.url)) |
||||||
|
* ); |
||||||
|
* const instance = await WebAssembly.instantiate(wasm, importObject); |
||||||
|
* |
||||||
|
* wasi.start(instance); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* To run the above example, create a new WebAssembly text format file named`demo.wat`: |
||||||
|
* |
||||||
|
* ```text
|
||||||
|
* (module |
||||||
|
* ;; Import the required fd_write WASI function which will write the given io vectors to stdout |
||||||
|
* ;; The function signature for fd_write is: |
||||||
|
* ;; (File Descriptor, *iovs, iovs_len, nwritten) -> Returns number of bytes written |
||||||
|
* (import "wasi_snapshot_preview1" "fd_write" (func $fd_write (param i32 i32 i32 i32) (result i32))) |
||||||
|
* |
||||||
|
* (memory 1) |
||||||
|
* (export "memory" (memory 0)) |
||||||
|
* |
||||||
|
* ;; Write 'hello world\n' to memory at an offset of 8 bytes |
||||||
|
* ;; Note the trailing newline which is required for the text to appear |
||||||
|
* (data (i32.const 8) "hello world\n") |
||||||
|
* |
||||||
|
* (func $main (export "_start") |
||||||
|
* ;; Creating a new io vector within linear memory |
||||||
|
* (i32.store (i32.const 0) (i32.const 8)) ;; iov.iov_base - This is a pointer to the start of the 'hello world\n' string |
||||||
|
* (i32.store (i32.const 4) (i32.const 12)) ;; iov.iov_len - The length of the 'hello world\n' string |
||||||
|
* |
||||||
|
* (call $fd_write |
||||||
|
* (i32.const 1) ;; file_descriptor - 1 for stdout |
||||||
|
* (i32.const 0) ;; *iovs - The pointer to the iov array, which is stored at memory location 0 |
||||||
|
* (i32.const 1) ;; iovs_len - We're printing 1 string stored in an iov - so one. |
||||||
|
* (i32.const 20) ;; nwritten - A place in memory to store the number of bytes written |
||||||
|
* ) |
||||||
|
* drop ;; Discard the number of bytes written from the top of the stack |
||||||
|
* ) |
||||||
|
* ) |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Use [wabt](https://github.com/WebAssembly/wabt) to compile `.wat` to `.wasm`
|
||||||
|
* |
||||||
|
* ```console
|
||||||
|
* $ wat2wasm demo.wat |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* The `--experimental-wasi-unstable-preview1` CLI argument is needed for this |
||||||
|
* example to run. |
||||||
|
* @experimental |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/wasi.js)
|
||||||
|
*/ |
||||||
|
declare module 'wasi' { |
||||||
|
interface WASIOptions { |
||||||
|
/** |
||||||
|
* An array of strings that the WebAssembly application will |
||||||
|
* see as command line arguments. The first argument is the virtual path to the |
||||||
|
* WASI command itself. |
||||||
|
*/ |
||||||
|
args?: string[] | undefined; |
||||||
|
/** |
||||||
|
* An object similar to `process.env` that the WebAssembly |
||||||
|
* application will see as its environment. |
||||||
|
*/ |
||||||
|
env?: object | undefined; |
||||||
|
/** |
||||||
|
* This object represents the WebAssembly application's |
||||||
|
* sandbox directory structure. The string keys of `preopens` are treated as |
||||||
|
* directories within the sandbox. The corresponding values in `preopens` are |
||||||
|
* the real paths to those directories on the host machine. |
||||||
|
*/ |
||||||
|
preopens?: NodeJS.Dict<string> | undefined; |
||||||
|
/** |
||||||
|
* By default, WASI applications terminate the Node.js |
||||||
|
* process via the `__wasi_proc_exit()` function. Setting this option to `true` |
||||||
|
* causes `wasi.start()` to return the exit code rather than terminate the |
||||||
|
* process. |
||||||
|
* @default false |
||||||
|
*/ |
||||||
|
returnOnExit?: boolean | undefined; |
||||||
|
/** |
||||||
|
* The file descriptor used as standard input in the WebAssembly application. |
||||||
|
* @default 0 |
||||||
|
*/ |
||||||
|
stdin?: number | undefined; |
||||||
|
/** |
||||||
|
* The file descriptor used as standard output in the WebAssembly application. |
||||||
|
* @default 1 |
||||||
|
*/ |
||||||
|
stdout?: number | undefined; |
||||||
|
/** |
||||||
|
* The file descriptor used as standard error in the WebAssembly application. |
||||||
|
* @default 2 |
||||||
|
*/ |
||||||
|
stderr?: number | undefined; |
||||||
|
} |
||||||
|
/** |
||||||
|
* The `WASI` class provides the WASI system call API and additional convenience |
||||||
|
* methods for working with WASI-based applications. Each `WASI` instance |
||||||
|
* represents a distinct sandbox environment. For security purposes, each `WASI`instance must have its command-line arguments, environment variables, and |
||||||
|
* sandbox directory structure configured explicitly. |
||||||
|
* @since v13.3.0, v12.16.0 |
||||||
|
*/ |
||||||
|
class WASI { |
||||||
|
constructor(options?: WASIOptions); |
||||||
|
/** |
||||||
|
* Attempt to begin execution of `instance` as a WASI command by invoking its`_start()` export. If `instance` does not contain a `_start()` export, or if`instance` contains an `_initialize()` |
||||||
|
* export, then an exception is thrown. |
||||||
|
* |
||||||
|
* `start()` requires that `instance` exports a [`WebAssembly.Memory`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/WebAssembly/Memory) named`memory`. If
|
||||||
|
* `instance` does not have a `memory` export an exception is thrown. |
||||||
|
* |
||||||
|
* If `start()` is called more than once, an exception is thrown. |
||||||
|
* @since v13.3.0, v12.16.0 |
||||||
|
*/ |
||||||
|
start(instance: object): void; // TODO: avoid DOM dependency until WASM moved to own lib.
|
||||||
|
/** |
||||||
|
* Attempt to initialize `instance` as a WASI reactor by invoking its`_initialize()` export, if it is present. If `instance` contains a `_start()`export, then an exception is thrown. |
||||||
|
* |
||||||
|
* `initialize()` requires that `instance` exports a [`WebAssembly.Memory`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/WebAssembly/Memory) named`memory`.
|
||||||
|
* If `instance` does not have a `memory` export an exception is thrown. |
||||||
|
* |
||||||
|
* If `initialize()` is called more than once, an exception is thrown. |
||||||
|
* @since v14.6.0, v12.19.0 |
||||||
|
*/ |
||||||
|
initialize(instance: object): void; // TODO: avoid DOM dependency until WASM moved to own lib.
|
||||||
|
/** |
||||||
|
* `wasiImport` is an object that implements the WASI system call API. This object |
||||||
|
* should be passed as the `wasi_snapshot_preview1` import during the instantiation |
||||||
|
* of a [`WebAssembly.Instance`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/WebAssembly/Instance).
|
||||||
|
* @since v13.3.0, v12.16.0 |
||||||
|
*/ |
||||||
|
readonly wasiImport: NodeJS.Dict<any>; // TODO: Narrow to DOM types
|
||||||
|
} |
||||||
|
} |
||||||
|
declare module 'node:wasi' { |
||||||
|
export * from 'wasi'; |
||||||
|
} |
@ -0,0 +1,646 @@ |
|||||||
|
/** |
||||||
|
* The `worker_threads` module enables the use of threads that execute JavaScript |
||||||
|
* in parallel. To access it: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const worker = require('worker_threads'); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Workers (threads) are useful for performing CPU-intensive JavaScript operations. |
||||||
|
* They do not help much with I/O-intensive work. The Node.js built-in |
||||||
|
* asynchronous I/O operations are more efficient than Workers can be. |
||||||
|
* |
||||||
|
* Unlike `child_process` or `cluster`, `worker_threads` can share memory. They do |
||||||
|
* so by transferring `ArrayBuffer` instances or sharing `SharedArrayBuffer`instances. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { |
||||||
|
* Worker, isMainThread, parentPort, workerData |
||||||
|
* } = require('worker_threads'); |
||||||
|
* |
||||||
|
* if (isMainThread) { |
||||||
|
* module.exports = function parseJSAsync(script) { |
||||||
|
* return new Promise((resolve, reject) => { |
||||||
|
* const worker = new Worker(__filename, { |
||||||
|
* workerData: script |
||||||
|
* }); |
||||||
|
* worker.on('message', resolve); |
||||||
|
* worker.on('error', reject); |
||||||
|
* worker.on('exit', (code) => { |
||||||
|
* if (code !== 0) |
||||||
|
* reject(new Error(`Worker stopped with exit code ${code}`)); |
||||||
|
* }); |
||||||
|
* }); |
||||||
|
* }; |
||||||
|
* } else { |
||||||
|
* const { parse } = require('some-js-parsing-library'); |
||||||
|
* const script = workerData; |
||||||
|
* parentPort.postMessage(parse(script)); |
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* The above example spawns a Worker thread for each `parseJSAsync()` call. In |
||||||
|
* practice, use a pool of Workers for these kinds of tasks. Otherwise, the |
||||||
|
* overhead of creating Workers would likely exceed their benefit. |
||||||
|
* |
||||||
|
* When implementing a worker pool, use the `AsyncResource` API to inform |
||||||
|
* diagnostic tools (e.g. to provide asynchronous stack traces) about the |
||||||
|
* correlation between tasks and their outcomes. See `"Using AsyncResource for a Worker thread pool"` in the `async_hooks` documentation for an example implementation. |
||||||
|
* |
||||||
|
* Worker threads inherit non-process-specific options by default. Refer to `Worker constructor options` to know how to customize worker thread options, |
||||||
|
* specifically `argv` and `execArgv` options. |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/worker_threads.js)
|
||||||
|
*/ |
||||||
|
declare module 'worker_threads' { |
||||||
|
import { Blob } from 'node:buffer'; |
||||||
|
import { Context } from 'node:vm'; |
||||||
|
import { EventEmitter } from 'node:events'; |
||||||
|
import { EventLoopUtilityFunction } from 'node:perf_hooks'; |
||||||
|
import { FileHandle } from 'node:fs/promises'; |
||||||
|
import { Readable, Writable } from 'node:stream'; |
||||||
|
import { URL } from 'node:url'; |
||||||
|
import { X509Certificate } from 'node:crypto'; |
||||||
|
const isMainThread: boolean; |
||||||
|
const parentPort: null | MessagePort; |
||||||
|
const resourceLimits: ResourceLimits; |
||||||
|
const SHARE_ENV: unique symbol; |
||||||
|
const threadId: number; |
||||||
|
const workerData: any; |
||||||
|
/** |
||||||
|
* Instances of the `worker.MessageChannel` class represent an asynchronous, |
||||||
|
* two-way communications channel. |
||||||
|
* The `MessageChannel` has no methods of its own. `new MessageChannel()`yields an object with `port1` and `port2` properties, which refer to linked `MessagePort` instances. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { MessageChannel } = require('worker_threads'); |
||||||
|
* |
||||||
|
* const { port1, port2 } = new MessageChannel(); |
||||||
|
* port1.on('message', (message) => console.log('received', message)); |
||||||
|
* port2.postMessage({ foo: 'bar' }); |
||||||
|
* // Prints: received { foo: 'bar' } from the `port1.on('message')` listener
|
||||||
|
* ``` |
||||||
|
* @since v10.5.0 |
||||||
|
*/ |
||||||
|
class MessageChannel { |
||||||
|
readonly port1: MessagePort; |
||||||
|
readonly port2: MessagePort; |
||||||
|
} |
||||||
|
interface WorkerPerformance { |
||||||
|
eventLoopUtilization: EventLoopUtilityFunction; |
||||||
|
} |
||||||
|
type TransferListItem = ArrayBuffer | MessagePort | FileHandle | X509Certificate | Blob; |
||||||
|
/** |
||||||
|
* Instances of the `worker.MessagePort` class represent one end of an |
||||||
|
* asynchronous, two-way communications channel. It can be used to transfer |
||||||
|
* structured data, memory regions and other `MessagePort`s between different `Worker` s. |
||||||
|
* |
||||||
|
* This implementation matches [browser `MessagePort`](https://developer.mozilla.org/en-US/docs/Web/API/MessagePort) s.
|
||||||
|
* @since v10.5.0 |
||||||
|
*/ |
||||||
|
class MessagePort extends EventEmitter { |
||||||
|
/** |
||||||
|
* Disables further sending of messages on either side of the connection. |
||||||
|
* This method can be called when no further communication will happen over this`MessagePort`. |
||||||
|
* |
||||||
|
* The `'close' event` is emitted on both `MessagePort` instances that |
||||||
|
* are part of the channel. |
||||||
|
* @since v10.5.0 |
||||||
|
*/ |
||||||
|
close(): void; |
||||||
|
/** |
||||||
|
* Sends a JavaScript value to the receiving side of this channel.`value` is transferred in a way which is compatible with |
||||||
|
* the [HTML structured clone algorithm](https://developer.mozilla.org/en-US/docs/Web/API/Web_Workers_API/Structured_clone_algorithm).
|
||||||
|
* |
||||||
|
* In particular, the significant differences to `JSON` are: |
||||||
|
* |
||||||
|
* * `value` may contain circular references. |
||||||
|
* * `value` may contain instances of builtin JS types such as `RegExp`s,`BigInt`s, `Map`s, `Set`s, etc. |
||||||
|
* * `value` may contain typed arrays, both using `ArrayBuffer`s |
||||||
|
* and `SharedArrayBuffer`s. |
||||||
|
* * `value` may contain [`WebAssembly.Module`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/WebAssembly/Module) instances.
|
||||||
|
* * `value` may not contain native (C++-backed) objects other than: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { MessageChannel } = require('worker_threads'); |
||||||
|
* const { port1, port2 } = new MessageChannel(); |
||||||
|
* |
||||||
|
* port1.on('message', (message) => console.log(message)); |
||||||
|
* |
||||||
|
* const circularData = {}; |
||||||
|
* circularData.foo = circularData; |
||||||
|
* // Prints: { foo: [Circular] }
|
||||||
|
* port2.postMessage(circularData); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* `transferList` may be a list of [`ArrayBuffer`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/ArrayBuffer), `MessagePort` and `FileHandle` objects.
|
||||||
|
* After transferring, they are not usable on the sending side of the channel |
||||||
|
* anymore (even if they are not contained in `value`). Unlike with `child processes`, transferring handles such as network sockets is currently |
||||||
|
* not supported. |
||||||
|
* |
||||||
|
* If `value` contains [`SharedArrayBuffer`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/SharedArrayBuffer) instances, those are accessible
|
||||||
|
* from either thread. They cannot be listed in `transferList`. |
||||||
|
* |
||||||
|
* `value` may still contain `ArrayBuffer` instances that are not in`transferList`; in that case, the underlying memory is copied rather than moved. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { MessageChannel } = require('worker_threads'); |
||||||
|
* const { port1, port2 } = new MessageChannel(); |
||||||
|
* |
||||||
|
* port1.on('message', (message) => console.log(message)); |
||||||
|
* |
||||||
|
* const uint8Array = new Uint8Array([ 1, 2, 3, 4 ]); |
||||||
|
* // This posts a copy of `uint8Array`:
|
||||||
|
* port2.postMessage(uint8Array); |
||||||
|
* // This does not copy data, but renders `uint8Array` unusable:
|
||||||
|
* port2.postMessage(uint8Array, [ uint8Array.buffer ]); |
||||||
|
* |
||||||
|
* // The memory for the `sharedUint8Array` is accessible from both the
|
||||||
|
* // original and the copy received by `.on('message')`:
|
||||||
|
* const sharedUint8Array = new Uint8Array(new SharedArrayBuffer(4)); |
||||||
|
* port2.postMessage(sharedUint8Array); |
||||||
|
* |
||||||
|
* // This transfers a freshly created message port to the receiver.
|
||||||
|
* // This can be used, for example, to create communication channels between
|
||||||
|
* // multiple `Worker` threads that are children of the same parent thread.
|
||||||
|
* const otherChannel = new MessageChannel(); |
||||||
|
* port2.postMessage({ port: otherChannel.port1 }, [ otherChannel.port1 ]); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* The message object is cloned immediately, and can be modified after |
||||||
|
* posting without having side effects. |
||||||
|
* |
||||||
|
* For more information on the serialization and deserialization mechanisms |
||||||
|
* behind this API, see the `serialization API of the v8 module`. |
||||||
|
* @since v10.5.0 |
||||||
|
*/ |
||||||
|
postMessage(value: any, transferList?: ReadonlyArray<TransferListItem>): void; |
||||||
|
/** |
||||||
|
* Opposite of `unref()`. Calling `ref()` on a previously `unref()`ed port does _not_ let the program exit if it's the only active handle left (the default |
||||||
|
* behavior). If the port is `ref()`ed, calling `ref()` again has no effect. |
||||||
|
* |
||||||
|
* If listeners are attached or removed using `.on('message')`, the port |
||||||
|
* is `ref()`ed and `unref()`ed automatically depending on whether |
||||||
|
* listeners for the event exist. |
||||||
|
* @since v10.5.0 |
||||||
|
*/ |
||||||
|
ref(): void; |
||||||
|
/** |
||||||
|
* Calling `unref()` on a port allows the thread to exit if this is the only |
||||||
|
* active handle in the event system. If the port is already `unref()`ed calling`unref()` again has no effect. |
||||||
|
* |
||||||
|
* If listeners are attached or removed using `.on('message')`, the port is`ref()`ed and `unref()`ed automatically depending on whether |
||||||
|
* listeners for the event exist. |
||||||
|
* @since v10.5.0 |
||||||
|
*/ |
||||||
|
unref(): void; |
||||||
|
/** |
||||||
|
* Starts receiving messages on this `MessagePort`. When using this port |
||||||
|
* as an event emitter, this is called automatically once `'message'`listeners are attached. |
||||||
|
* |
||||||
|
* This method exists for parity with the Web `MessagePort` API. In Node.js, |
||||||
|
* it is only useful for ignoring messages when no event listener is present. |
||||||
|
* Node.js also diverges in its handling of `.onmessage`. Setting it |
||||||
|
* automatically calls `.start()`, but unsetting it lets messages queue up |
||||||
|
* until a new handler is set or the port is discarded. |
||||||
|
* @since v10.5.0 |
||||||
|
*/ |
||||||
|
start(): void; |
||||||
|
addListener(event: 'close', listener: () => void): this; |
||||||
|
addListener(event: 'message', listener: (value: any) => void): this; |
||||||
|
addListener(event: 'messageerror', listener: (error: Error) => void): this; |
||||||
|
addListener(event: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
emit(event: 'close'): boolean; |
||||||
|
emit(event: 'message', value: any): boolean; |
||||||
|
emit(event: 'messageerror', error: Error): boolean; |
||||||
|
emit(event: string | symbol, ...args: any[]): boolean; |
||||||
|
on(event: 'close', listener: () => void): this; |
||||||
|
on(event: 'message', listener: (value: any) => void): this; |
||||||
|
on(event: 'messageerror', listener: (error: Error) => void): this; |
||||||
|
on(event: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
once(event: 'close', listener: () => void): this; |
||||||
|
once(event: 'message', listener: (value: any) => void): this; |
||||||
|
once(event: 'messageerror', listener: (error: Error) => void): this; |
||||||
|
once(event: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
prependListener(event: 'close', listener: () => void): this; |
||||||
|
prependListener(event: 'message', listener: (value: any) => void): this; |
||||||
|
prependListener(event: 'messageerror', listener: (error: Error) => void): this; |
||||||
|
prependListener(event: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
prependOnceListener(event: 'close', listener: () => void): this; |
||||||
|
prependOnceListener(event: 'message', listener: (value: any) => void): this; |
||||||
|
prependOnceListener(event: 'messageerror', listener: (error: Error) => void): this; |
||||||
|
prependOnceListener(event: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
removeListener(event: 'close', listener: () => void): this; |
||||||
|
removeListener(event: 'message', listener: (value: any) => void): this; |
||||||
|
removeListener(event: 'messageerror', listener: (error: Error) => void): this; |
||||||
|
removeListener(event: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
off(event: 'close', listener: () => void): this; |
||||||
|
off(event: 'message', listener: (value: any) => void): this; |
||||||
|
off(event: 'messageerror', listener: (error: Error) => void): this; |
||||||
|
off(event: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
} |
||||||
|
interface WorkerOptions { |
||||||
|
/** |
||||||
|
* List of arguments which would be stringified and appended to |
||||||
|
* `process.argv` in the worker. This is mostly similar to the `workerData` |
||||||
|
* but the values will be available on the global `process.argv` as if they |
||||||
|
* were passed as CLI options to the script. |
||||||
|
*/ |
||||||
|
argv?: any[] | undefined; |
||||||
|
env?: NodeJS.Dict<string> | typeof SHARE_ENV | undefined; |
||||||
|
eval?: boolean | undefined; |
||||||
|
workerData?: any; |
||||||
|
stdin?: boolean | undefined; |
||||||
|
stdout?: boolean | undefined; |
||||||
|
stderr?: boolean | undefined; |
||||||
|
execArgv?: string[] | undefined; |
||||||
|
resourceLimits?: ResourceLimits | undefined; |
||||||
|
/** |
||||||
|
* Additional data to send in the first worker message. |
||||||
|
*/ |
||||||
|
transferList?: TransferListItem[] | undefined; |
||||||
|
/** |
||||||
|
* @default true |
||||||
|
*/ |
||||||
|
trackUnmanagedFds?: boolean | undefined; |
||||||
|
} |
||||||
|
interface ResourceLimits { |
||||||
|
/** |
||||||
|
* The maximum size of a heap space for recently created objects. |
||||||
|
*/ |
||||||
|
maxYoungGenerationSizeMb?: number | undefined; |
||||||
|
/** |
||||||
|
* The maximum size of the main heap in MB. |
||||||
|
*/ |
||||||
|
maxOldGenerationSizeMb?: number | undefined; |
||||||
|
/** |
||||||
|
* The size of a pre-allocated memory range used for generated code. |
||||||
|
*/ |
||||||
|
codeRangeSizeMb?: number | undefined; |
||||||
|
/** |
||||||
|
* The default maximum stack size for the thread. Small values may lead to unusable Worker instances. |
||||||
|
* @default 4 |
||||||
|
*/ |
||||||
|
stackSizeMb?: number | undefined; |
||||||
|
} |
||||||
|
/** |
||||||
|
* The `Worker` class represents an independent JavaScript execution thread. |
||||||
|
* Most Node.js APIs are available inside of it. |
||||||
|
* |
||||||
|
* Notable differences inside a Worker environment are: |
||||||
|
* |
||||||
|
* * The `process.stdin`, `process.stdout` and `process.stderr` may be redirected by the parent thread. |
||||||
|
* * The `require('worker_threads').isMainThread` property is set to `false`. |
||||||
|
* * The `require('worker_threads').parentPort` message port is available. |
||||||
|
* * `process.exit()` does not stop the whole program, just the single thread, |
||||||
|
* and `process.abort()` is not available. |
||||||
|
* * `process.chdir()` and `process` methods that set group or user ids |
||||||
|
* are not available. |
||||||
|
* * `process.env` is a copy of the parent thread's environment variables, |
||||||
|
* unless otherwise specified. Changes to one copy are not visible in other |
||||||
|
* threads, and are not visible to native add-ons (unless `worker.SHARE_ENV` is passed as the `env` option to the `Worker` constructor). |
||||||
|
* * `process.title` cannot be modified. |
||||||
|
* * Signals are not delivered through `process.on('...')`. |
||||||
|
* * Execution may stop at any point as a result of `worker.terminate()` being invoked. |
||||||
|
* * IPC channels from parent processes are not accessible. |
||||||
|
* * The `trace_events` module is not supported. |
||||||
|
* * Native add-ons can only be loaded from multiple threads if they fulfill `certain conditions`. |
||||||
|
* |
||||||
|
* Creating `Worker` instances inside of other `Worker`s is possible. |
||||||
|
* |
||||||
|
* Like [Web Workers](https://developer.mozilla.org/en-US/docs/Web/API/Web_Workers_API) and the `cluster module`, two-way communication can be
|
||||||
|
* achieved through inter-thread message passing. Internally, a `Worker` has a |
||||||
|
* built-in pair of `MessagePort` s that are already associated with each other |
||||||
|
* when the `Worker` is created. While the `MessagePort` object on the parent side |
||||||
|
* is not directly exposed, its functionalities are exposed through `worker.postMessage()` and the `worker.on('message')` event |
||||||
|
* on the `Worker` object for the parent thread. |
||||||
|
* |
||||||
|
* To create custom messaging channels (which is encouraged over using the default |
||||||
|
* global channel because it facilitates separation of concerns), users can create |
||||||
|
* a `MessageChannel` object on either thread and pass one of the`MessagePort`s on that `MessageChannel` to the other thread through a |
||||||
|
* pre-existing channel, such as the global one. |
||||||
|
* |
||||||
|
* See `port.postMessage()` for more information on how messages are passed, |
||||||
|
* and what kind of JavaScript values can be successfully transported through |
||||||
|
* the thread barrier. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const assert = require('assert'); |
||||||
|
* const { |
||||||
|
* Worker, MessageChannel, MessagePort, isMainThread, parentPort |
||||||
|
* } = require('worker_threads'); |
||||||
|
* if (isMainThread) { |
||||||
|
* const worker = new Worker(__filename); |
||||||
|
* const subChannel = new MessageChannel(); |
||||||
|
* worker.postMessage({ hereIsYourPort: subChannel.port1 }, [subChannel.port1]); |
||||||
|
* subChannel.port2.on('message', (value) => { |
||||||
|
* console.log('received:', value); |
||||||
|
* }); |
||||||
|
* } else { |
||||||
|
* parentPort.once('message', (value) => { |
||||||
|
* assert(value.hereIsYourPort instanceof MessagePort); |
||||||
|
* value.hereIsYourPort.postMessage('the worker is sending this'); |
||||||
|
* value.hereIsYourPort.close(); |
||||||
|
* }); |
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v10.5.0 |
||||||
|
*/ |
||||||
|
class Worker extends EventEmitter { |
||||||
|
/** |
||||||
|
* If `stdin: true` was passed to the `Worker` constructor, this is a |
||||||
|
* writable stream. The data written to this stream will be made available in |
||||||
|
* the worker thread as `process.stdin`. |
||||||
|
* @since v10.5.0 |
||||||
|
*/ |
||||||
|
readonly stdin: Writable | null; |
||||||
|
/** |
||||||
|
* This is a readable stream which contains data written to `process.stdout` inside the worker thread. If `stdout: true` was not passed to the `Worker` constructor, then data is piped to the |
||||||
|
* parent thread's `process.stdout` stream. |
||||||
|
* @since v10.5.0 |
||||||
|
*/ |
||||||
|
readonly stdout: Readable; |
||||||
|
/** |
||||||
|
* This is a readable stream which contains data written to `process.stderr` inside the worker thread. If `stderr: true` was not passed to the `Worker` constructor, then data is piped to the |
||||||
|
* parent thread's `process.stderr` stream. |
||||||
|
* @since v10.5.0 |
||||||
|
*/ |
||||||
|
readonly stderr: Readable; |
||||||
|
/** |
||||||
|
* An integer identifier for the referenced thread. Inside the worker thread, |
||||||
|
* it is available as `require('worker_threads').threadId`. |
||||||
|
* This value is unique for each `Worker` instance inside a single process. |
||||||
|
* @since v10.5.0 |
||||||
|
*/ |
||||||
|
readonly threadId: number; |
||||||
|
/** |
||||||
|
* Provides the set of JS engine resource constraints for this Worker thread. |
||||||
|
* If the `resourceLimits` option was passed to the `Worker` constructor, |
||||||
|
* this matches its values. |
||||||
|
* |
||||||
|
* If the worker has stopped, the return value is an empty object. |
||||||
|
* @since v13.2.0, v12.16.0 |
||||||
|
*/ |
||||||
|
readonly resourceLimits?: ResourceLimits | undefined; |
||||||
|
/** |
||||||
|
* An object that can be used to query performance information from a worker |
||||||
|
* instance. Similar to `perf_hooks.performance`. |
||||||
|
* @since v15.1.0, v14.17.0, v12.22.0 |
||||||
|
*/ |
||||||
|
readonly performance: WorkerPerformance; |
||||||
|
/** |
||||||
|
* @param filename The path to the Worker’s main script or module.
|
||||||
|
* Must be either an absolute path or a relative path (i.e. relative to the current working directory) starting with ./ or ../, |
||||||
|
* or a WHATWG URL object using file: protocol. If options.eval is true, this is a string containing JavaScript code rather than a path. |
||||||
|
*/ |
||||||
|
constructor(filename: string | URL, options?: WorkerOptions); |
||||||
|
/** |
||||||
|
* Send a message to the worker that is received via `require('worker_threads').parentPort.on('message')`. |
||||||
|
* See `port.postMessage()` for more details. |
||||||
|
* @since v10.5.0 |
||||||
|
*/ |
||||||
|
postMessage(value: any, transferList?: ReadonlyArray<TransferListItem>): void; |
||||||
|
/** |
||||||
|
* Opposite of `unref()`, calling `ref()` on a previously `unref()`ed worker does _not_ let the program exit if it's the only active handle left (the default |
||||||
|
* behavior). If the worker is `ref()`ed, calling `ref()` again has |
||||||
|
* no effect. |
||||||
|
* @since v10.5.0 |
||||||
|
*/ |
||||||
|
ref(): void; |
||||||
|
/** |
||||||
|
* Calling `unref()` on a worker allows the thread to exit if this is the only |
||||||
|
* active handle in the event system. If the worker is already `unref()`ed calling`unref()` again has no effect. |
||||||
|
* @since v10.5.0 |
||||||
|
*/ |
||||||
|
unref(): void; |
||||||
|
/** |
||||||
|
* Stop all JavaScript execution in the worker thread as soon as possible. |
||||||
|
* Returns a Promise for the exit code that is fulfilled when the `'exit' event` is emitted. |
||||||
|
* @since v10.5.0 |
||||||
|
*/ |
||||||
|
terminate(): Promise<number>; |
||||||
|
/** |
||||||
|
* Returns a readable stream for a V8 snapshot of the current state of the Worker. |
||||||
|
* See `v8.getHeapSnapshot()` for more details. |
||||||
|
* |
||||||
|
* If the Worker thread is no longer running, which may occur before the `'exit' event` is emitted, the returned `Promise` is rejected |
||||||
|
* immediately with an `ERR_WORKER_NOT_RUNNING` error. |
||||||
|
* @since v13.9.0, v12.17.0 |
||||||
|
* @return A promise for a Readable Stream containing a V8 heap snapshot |
||||||
|
*/ |
||||||
|
getHeapSnapshot(): Promise<Readable>; |
||||||
|
addListener(event: 'error', listener: (err: Error) => void): this; |
||||||
|
addListener(event: 'exit', listener: (exitCode: number) => void): this; |
||||||
|
addListener(event: 'message', listener: (value: any) => void): this; |
||||||
|
addListener(event: 'messageerror', listener: (error: Error) => void): this; |
||||||
|
addListener(event: 'online', listener: () => void): this; |
||||||
|
addListener(event: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
emit(event: 'error', err: Error): boolean; |
||||||
|
emit(event: 'exit', exitCode: number): boolean; |
||||||
|
emit(event: 'message', value: any): boolean; |
||||||
|
emit(event: 'messageerror', error: Error): boolean; |
||||||
|
emit(event: 'online'): boolean; |
||||||
|
emit(event: string | symbol, ...args: any[]): boolean; |
||||||
|
on(event: 'error', listener: (err: Error) => void): this; |
||||||
|
on(event: 'exit', listener: (exitCode: number) => void): this; |
||||||
|
on(event: 'message', listener: (value: any) => void): this; |
||||||
|
on(event: 'messageerror', listener: (error: Error) => void): this; |
||||||
|
on(event: 'online', listener: () => void): this; |
||||||
|
on(event: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
once(event: 'error', listener: (err: Error) => void): this; |
||||||
|
once(event: 'exit', listener: (exitCode: number) => void): this; |
||||||
|
once(event: 'message', listener: (value: any) => void): this; |
||||||
|
once(event: 'messageerror', listener: (error: Error) => void): this; |
||||||
|
once(event: 'online', listener: () => void): this; |
||||||
|
once(event: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
prependListener(event: 'error', listener: (err: Error) => void): this; |
||||||
|
prependListener(event: 'exit', listener: (exitCode: number) => void): this; |
||||||
|
prependListener(event: 'message', listener: (value: any) => void): this; |
||||||
|
prependListener(event: 'messageerror', listener: (error: Error) => void): this; |
||||||
|
prependListener(event: 'online', listener: () => void): this; |
||||||
|
prependListener(event: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
prependOnceListener(event: 'error', listener: (err: Error) => void): this; |
||||||
|
prependOnceListener(event: 'exit', listener: (exitCode: number) => void): this; |
||||||
|
prependOnceListener(event: 'message', listener: (value: any) => void): this; |
||||||
|
prependOnceListener(event: 'messageerror', listener: (error: Error) => void): this; |
||||||
|
prependOnceListener(event: 'online', listener: () => void): this; |
||||||
|
prependOnceListener(event: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
removeListener(event: 'error', listener: (err: Error) => void): this; |
||||||
|
removeListener(event: 'exit', listener: (exitCode: number) => void): this; |
||||||
|
removeListener(event: 'message', listener: (value: any) => void): this; |
||||||
|
removeListener(event: 'messageerror', listener: (error: Error) => void): this; |
||||||
|
removeListener(event: 'online', listener: () => void): this; |
||||||
|
removeListener(event: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
off(event: 'error', listener: (err: Error) => void): this; |
||||||
|
off(event: 'exit', listener: (exitCode: number) => void): this; |
||||||
|
off(event: 'message', listener: (value: any) => void): this; |
||||||
|
off(event: 'messageerror', listener: (error: Error) => void): this; |
||||||
|
off(event: 'online', listener: () => void): this; |
||||||
|
off(event: string | symbol, listener: (...args: any[]) => void): this; |
||||||
|
} |
||||||
|
interface BroadcastChannel extends NodeJS.RefCounted {} |
||||||
|
/** |
||||||
|
* Instances of `BroadcastChannel` allow asynchronous one-to-many communication |
||||||
|
* with all other `BroadcastChannel` instances bound to the same channel name. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* 'use strict'; |
||||||
|
* |
||||||
|
* const { |
||||||
|
* isMainThread, |
||||||
|
* BroadcastChannel, |
||||||
|
* Worker |
||||||
|
* } = require('worker_threads'); |
||||||
|
* |
||||||
|
* const bc = new BroadcastChannel('hello'); |
||||||
|
* |
||||||
|
* if (isMainThread) { |
||||||
|
* let c = 0; |
||||||
|
* bc.onmessage = (event) => { |
||||||
|
* console.log(event.data); |
||||||
|
* if (++c === 10) bc.close(); |
||||||
|
* }; |
||||||
|
* for (let n = 0; n < 10; n++) |
||||||
|
* new Worker(__filename); |
||||||
|
* } else { |
||||||
|
* bc.postMessage('hello from every worker'); |
||||||
|
* bc.close(); |
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v15.4.0 |
||||||
|
*/ |
||||||
|
class BroadcastChannel { |
||||||
|
readonly name: string; |
||||||
|
/** |
||||||
|
* Invoked with a single \`MessageEvent\` argument when a message is received.
|
||||||
|
* @since v15.4.0 |
||||||
|
*/ |
||||||
|
onmessage: (message: unknown) => void; |
||||||
|
/** |
||||||
|
* Invoked with a received message cannot be deserialized. |
||||||
|
* @since v15.4.0 |
||||||
|
*/ |
||||||
|
onmessageerror: (message: unknown) => void; |
||||||
|
constructor(name: string); |
||||||
|
/** |
||||||
|
* Closes the `BroadcastChannel` connection. |
||||||
|
* @since v15.4.0 |
||||||
|
*/ |
||||||
|
close(): void; |
||||||
|
/** |
||||||
|
* @since v15.4.0 |
||||||
|
* @param message Any cloneable JavaScript value. |
||||||
|
*/ |
||||||
|
postMessage(message: unknown): void; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Mark an object as not transferable. If `object` occurs in the transfer list of |
||||||
|
* a `port.postMessage()` call, it is ignored. |
||||||
|
* |
||||||
|
* In particular, this makes sense for objects that can be cloned, rather than |
||||||
|
* transferred, and which are used by other objects on the sending side. |
||||||
|
* For example, Node.js marks the `ArrayBuffer`s it uses for its `Buffer pool` with this. |
||||||
|
* |
||||||
|
* This operation cannot be undone. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { MessageChannel, markAsUntransferable } = require('worker_threads'); |
||||||
|
* |
||||||
|
* const pooledBuffer = new ArrayBuffer(8); |
||||||
|
* const typedArray1 = new Uint8Array(pooledBuffer); |
||||||
|
* const typedArray2 = new Float64Array(pooledBuffer); |
||||||
|
* |
||||||
|
* markAsUntransferable(pooledBuffer); |
||||||
|
* |
||||||
|
* const { port1 } = new MessageChannel(); |
||||||
|
* port1.postMessage(typedArray1, [ typedArray1.buffer ]); |
||||||
|
* |
||||||
|
* // The following line prints the contents of typedArray1 -- it still owns
|
||||||
|
* // its memory and has been cloned, not transferred. Without
|
||||||
|
* // `markAsUntransferable()`, this would print an empty Uint8Array.
|
||||||
|
* // typedArray2 is intact as well.
|
||||||
|
* console.log(typedArray1); |
||||||
|
* console.log(typedArray2); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* There is no equivalent to this API in browsers. |
||||||
|
* @since v14.5.0, v12.19.0 |
||||||
|
*/ |
||||||
|
function markAsUntransferable(object: object): void; |
||||||
|
/** |
||||||
|
* Transfer a `MessagePort` to a different `vm` Context. The original `port`object is rendered unusable, and the returned `MessagePort` instance |
||||||
|
* takes its place. |
||||||
|
* |
||||||
|
* The returned `MessagePort` is an object in the target context and |
||||||
|
* inherits from its global `Object` class. Objects passed to the [`port.onmessage()`](https://developer.mozilla.org/en-US/docs/Web/API/MessagePort/onmessage) listener are also created in the
|
||||||
|
* target context |
||||||
|
* and inherit from its global `Object` class. |
||||||
|
* |
||||||
|
* However, the created `MessagePort` no longer inherits from [`EventTarget`](https://developer.mozilla.org/en-US/docs/Web/API/EventTarget), and only
|
||||||
|
* [`port.onmessage()`](https://developer.mozilla.org/en-US/docs/Web/API/MessagePort/onmessage) can be used to receive
|
||||||
|
* events using it. |
||||||
|
* @since v11.13.0 |
||||||
|
* @param port The message port to transfer. |
||||||
|
* @param contextifiedSandbox A `contextified` object as returned by the `vm.createContext()` method. |
||||||
|
*/ |
||||||
|
function moveMessagePortToContext(port: MessagePort, contextifiedSandbox: Context): MessagePort; |
||||||
|
/** |
||||||
|
* Receive a single message from a given `MessagePort`. If no message is available,`undefined` is returned, otherwise an object with a single `message` property |
||||||
|
* that contains the message payload, corresponding to the oldest message in the`MessagePort`’s queue. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { MessageChannel, receiveMessageOnPort } = require('worker_threads'); |
||||||
|
* const { port1, port2 } = new MessageChannel(); |
||||||
|
* port1.postMessage({ hello: 'world' }); |
||||||
|
* |
||||||
|
* console.log(receiveMessageOnPort(port2)); |
||||||
|
* // Prints: { message: { hello: 'world' } }
|
||||||
|
* console.log(receiveMessageOnPort(port2)); |
||||||
|
* // Prints: undefined
|
||||||
|
* ``` |
||||||
|
* |
||||||
|
* When this function is used, no `'message'` event is emitted and the`onmessage` listener is not invoked. |
||||||
|
* @since v12.3.0 |
||||||
|
*/ |
||||||
|
function receiveMessageOnPort(port: MessagePort): |
||||||
|
| { |
||||||
|
message: any; |
||||||
|
} |
||||||
|
| undefined; |
||||||
|
type Serializable = string | object | number | boolean | bigint; |
||||||
|
/** |
||||||
|
* Within a worker thread, `worker.getEnvironmentData()` returns a clone |
||||||
|
* of data passed to the spawning thread's `worker.setEnvironmentData()`. |
||||||
|
* Every new `Worker` receives its own copy of the environment data |
||||||
|
* automatically. |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { |
||||||
|
* Worker, |
||||||
|
* isMainThread, |
||||||
|
* setEnvironmentData, |
||||||
|
* getEnvironmentData, |
||||||
|
* } = require('worker_threads'); |
||||||
|
* |
||||||
|
* if (isMainThread) { |
||||||
|
* setEnvironmentData('Hello', 'World!'); |
||||||
|
* const worker = new Worker(__filename); |
||||||
|
* } else { |
||||||
|
* console.log(getEnvironmentData('Hello')); // Prints 'World!'.
|
||||||
|
* } |
||||||
|
* ``` |
||||||
|
* @since v15.12.0, v14.18.0 |
||||||
|
* @param key Any arbitrary, cloneable JavaScript value that can be used as a {Map} key. |
||||||
|
*/ |
||||||
|
function getEnvironmentData(key: Serializable): Serializable; |
||||||
|
/** |
||||||
|
* The `worker.setEnvironmentData()` API sets the content of`worker.getEnvironmentData()` in the current thread and all new `Worker`instances spawned from the current context. |
||||||
|
* @since v15.12.0, v14.18.0 |
||||||
|
* @param key Any arbitrary, cloneable JavaScript value that can be used as a {Map} key. |
||||||
|
* @param value Any arbitrary, cloneable JavaScript value that will be cloned and passed automatically to all new `Worker` instances. If `value` is passed as `undefined`, any previously set value |
||||||
|
* for the `key` will be deleted. |
||||||
|
*/ |
||||||
|
function setEnvironmentData(key: Serializable, value: Serializable): void; |
||||||
|
} |
||||||
|
declare module 'node:worker_threads' { |
||||||
|
export * from 'worker_threads'; |
||||||
|
} |
@ -0,0 +1,517 @@ |
|||||||
|
/** |
||||||
|
* The `zlib` module provides compression functionality implemented using Gzip, |
||||||
|
* Deflate/Inflate, and Brotli. |
||||||
|
* |
||||||
|
* To access it: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const zlib = require('zlib'); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* Compression and decompression are built around the Node.js `Streams API`. |
||||||
|
* |
||||||
|
* Compressing or decompressing a stream (such as a file) can be accomplished by |
||||||
|
* piping the source stream through a `zlib` `Transform` stream into a destination |
||||||
|
* stream: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { createGzip } = require('zlib'); |
||||||
|
* const { pipeline } = require('stream'); |
||||||
|
* const { |
||||||
|
* createReadStream, |
||||||
|
* createWriteStream |
||||||
|
* } = require('fs'); |
||||||
|
* |
||||||
|
* const gzip = createGzip(); |
||||||
|
* const source = createReadStream('input.txt'); |
||||||
|
* const destination = createWriteStream('input.txt.gz'); |
||||||
|
* |
||||||
|
* pipeline(source, gzip, destination, (err) => { |
||||||
|
* if (err) { |
||||||
|
* console.error('An error occurred:', err); |
||||||
|
* process.exitCode = 1; |
||||||
|
* } |
||||||
|
* }); |
||||||
|
* |
||||||
|
* // Or, Promisified
|
||||||
|
* |
||||||
|
* const { promisify } = require('util'); |
||||||
|
* const pipe = promisify(pipeline); |
||||||
|
* |
||||||
|
* async function do_gzip(input, output) { |
||||||
|
* const gzip = createGzip(); |
||||||
|
* const source = createReadStream(input); |
||||||
|
* const destination = createWriteStream(output); |
||||||
|
* await pipe(source, gzip, destination); |
||||||
|
* } |
||||||
|
* |
||||||
|
* do_gzip('input.txt', 'input.txt.gz') |
||||||
|
* .catch((err) => { |
||||||
|
* console.error('An error occurred:', err); |
||||||
|
* process.exitCode = 1; |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* |
||||||
|
* It is also possible to compress or decompress data in a single step: |
||||||
|
* |
||||||
|
* ```js
|
||||||
|
* const { deflate, unzip } = require('zlib'); |
||||||
|
* |
||||||
|
* const input = '.................................'; |
||||||
|
* deflate(input, (err, buffer) => { |
||||||
|
* if (err) { |
||||||
|
* console.error('An error occurred:', err); |
||||||
|
* process.exitCode = 1; |
||||||
|
* } |
||||||
|
* console.log(buffer.toString('base64')); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* const buffer = Buffer.from('eJzT0yMAAGTvBe8=', 'base64'); |
||||||
|
* unzip(buffer, (err, buffer) => { |
||||||
|
* if (err) { |
||||||
|
* console.error('An error occurred:', err); |
||||||
|
* process.exitCode = 1; |
||||||
|
* } |
||||||
|
* console.log(buffer.toString()); |
||||||
|
* }); |
||||||
|
* |
||||||
|
* // Or, Promisified
|
||||||
|
* |
||||||
|
* const { promisify } = require('util'); |
||||||
|
* const do_unzip = promisify(unzip); |
||||||
|
* |
||||||
|
* do_unzip(buffer) |
||||||
|
* .then((buf) => console.log(buf.toString())) |
||||||
|
* .catch((err) => { |
||||||
|
* console.error('An error occurred:', err); |
||||||
|
* process.exitCode = 1; |
||||||
|
* }); |
||||||
|
* ``` |
||||||
|
* @since v0.5.8 |
||||||
|
* @see [source](https://github.com/nodejs/node/blob/v18.0.0/lib/zlib.js)
|
||||||
|
*/ |
||||||
|
declare module 'zlib' { |
||||||
|
import * as stream from 'node:stream'; |
||||||
|
interface ZlibOptions { |
||||||
|
/** |
||||||
|
* @default constants.Z_NO_FLUSH |
||||||
|
*/ |
||||||
|
flush?: number | undefined; |
||||||
|
/** |
||||||
|
* @default constants.Z_FINISH |
||||||
|
*/ |
||||||
|
finishFlush?: number | undefined; |
||||||
|
/** |
||||||
|
* @default 16*1024 |
||||||
|
*/ |
||||||
|
chunkSize?: number | undefined; |
||||||
|
windowBits?: number | undefined; |
||||||
|
level?: number | undefined; // compression only
|
||||||
|
memLevel?: number | undefined; // compression only
|
||||||
|
strategy?: number | undefined; // compression only
|
||||||
|
dictionary?: NodeJS.ArrayBufferView | ArrayBuffer | undefined; // deflate/inflate only, empty dictionary by default
|
||||||
|
info?: boolean | undefined; |
||||||
|
maxOutputLength?: number | undefined; |
||||||
|
} |
||||||
|
interface BrotliOptions { |
||||||
|
/** |
||||||
|
* @default constants.BROTLI_OPERATION_PROCESS |
||||||
|
*/ |
||||||
|
flush?: number | undefined; |
||||||
|
/** |
||||||
|
* @default constants.BROTLI_OPERATION_FINISH |
||||||
|
*/ |
||||||
|
finishFlush?: number | undefined; |
||||||
|
/** |
||||||
|
* @default 16*1024 |
||||||
|
*/ |
||||||
|
chunkSize?: number | undefined; |
||||||
|
params?: |
||||||
|
| { |
||||||
|
/** |
||||||
|
* Each key is a `constants.BROTLI_*` constant. |
||||||
|
*/ |
||||||
|
[key: number]: boolean | number; |
||||||
|
} |
||||||
|
| undefined; |
||||||
|
maxOutputLength?: number | undefined; |
||||||
|
} |
||||||
|
interface Zlib { |
||||||
|
/** @deprecated Use bytesWritten instead. */ |
||||||
|
readonly bytesRead: number; |
||||||
|
readonly bytesWritten: number; |
||||||
|
shell?: boolean | string | undefined; |
||||||
|
close(callback?: () => void): void; |
||||||
|
flush(kind?: number, callback?: () => void): void; |
||||||
|
flush(callback?: () => void): void; |
||||||
|
} |
||||||
|
interface ZlibParams { |
||||||
|
params(level: number, strategy: number, callback: () => void): void; |
||||||
|
} |
||||||
|
interface ZlibReset { |
||||||
|
reset(): void; |
||||||
|
} |
||||||
|
interface BrotliCompress extends stream.Transform, Zlib {} |
||||||
|
interface BrotliDecompress extends stream.Transform, Zlib {} |
||||||
|
interface Gzip extends stream.Transform, Zlib {} |
||||||
|
interface Gunzip extends stream.Transform, Zlib {} |
||||||
|
interface Deflate extends stream.Transform, Zlib, ZlibReset, ZlibParams {} |
||||||
|
interface Inflate extends stream.Transform, Zlib, ZlibReset {} |
||||||
|
interface DeflateRaw extends stream.Transform, Zlib, ZlibReset, ZlibParams {} |
||||||
|
interface InflateRaw extends stream.Transform, Zlib, ZlibReset {} |
||||||
|
interface Unzip extends stream.Transform, Zlib {} |
||||||
|
/** |
||||||
|
* Creates and returns a new `BrotliCompress` object. |
||||||
|
* @since v11.7.0, v10.16.0 |
||||||
|
*/ |
||||||
|
function createBrotliCompress(options?: BrotliOptions): BrotliCompress; |
||||||
|
/** |
||||||
|
* Creates and returns a new `BrotliDecompress` object. |
||||||
|
* @since v11.7.0, v10.16.0 |
||||||
|
*/ |
||||||
|
function createBrotliDecompress(options?: BrotliOptions): BrotliDecompress; |
||||||
|
/** |
||||||
|
* Creates and returns a new `Gzip` object. |
||||||
|
* See `example`. |
||||||
|
* @since v0.5.8 |
||||||
|
*/ |
||||||
|
function createGzip(options?: ZlibOptions): Gzip; |
||||||
|
/** |
||||||
|
* Creates and returns a new `Gunzip` object. |
||||||
|
* @since v0.5.8 |
||||||
|
*/ |
||||||
|
function createGunzip(options?: ZlibOptions): Gunzip; |
||||||
|
/** |
||||||
|
* Creates and returns a new `Deflate` object. |
||||||
|
* @since v0.5.8 |
||||||
|
*/ |
||||||
|
function createDeflate(options?: ZlibOptions): Deflate; |
||||||
|
/** |
||||||
|
* Creates and returns a new `Inflate` object. |
||||||
|
* @since v0.5.8 |
||||||
|
*/ |
||||||
|
function createInflate(options?: ZlibOptions): Inflate; |
||||||
|
/** |
||||||
|
* Creates and returns a new `DeflateRaw` object. |
||||||
|
* |
||||||
|
* An upgrade of zlib from 1.2.8 to 1.2.11 changed behavior when `windowBits`is set to 8 for raw deflate streams. zlib would automatically set `windowBits`to 9 if was initially set to 8\. Newer |
||||||
|
* versions of zlib will throw an exception, |
||||||
|
* so Node.js restored the original behavior of upgrading a value of 8 to 9, |
||||||
|
* since passing `windowBits = 9` to zlib actually results in a compressed stream |
||||||
|
* that effectively uses an 8-bit window only. |
||||||
|
* @since v0.5.8 |
||||||
|
*/ |
||||||
|
function createDeflateRaw(options?: ZlibOptions): DeflateRaw; |
||||||
|
/** |
||||||
|
* Creates and returns a new `InflateRaw` object. |
||||||
|
* @since v0.5.8 |
||||||
|
*/ |
||||||
|
function createInflateRaw(options?: ZlibOptions): InflateRaw; |
||||||
|
/** |
||||||
|
* Creates and returns a new `Unzip` object. |
||||||
|
* @since v0.5.8 |
||||||
|
*/ |
||||||
|
function createUnzip(options?: ZlibOptions): Unzip; |
||||||
|
type InputType = string | ArrayBuffer | NodeJS.ArrayBufferView; |
||||||
|
type CompressCallback = (error: Error | null, result: Buffer) => void; |
||||||
|
/** |
||||||
|
* @since v11.7.0, v10.16.0 |
||||||
|
*/ |
||||||
|
function brotliCompress(buf: InputType, options: BrotliOptions, callback: CompressCallback): void; |
||||||
|
function brotliCompress(buf: InputType, callback: CompressCallback): void; |
||||||
|
namespace brotliCompress { |
||||||
|
function __promisify__(buffer: InputType, options?: BrotliOptions): Promise<Buffer>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Compress a chunk of data with `BrotliCompress`. |
||||||
|
* @since v11.7.0, v10.16.0 |
||||||
|
*/ |
||||||
|
function brotliCompressSync(buf: InputType, options?: BrotliOptions): Buffer; |
||||||
|
/** |
||||||
|
* @since v11.7.0, v10.16.0 |
||||||
|
*/ |
||||||
|
function brotliDecompress(buf: InputType, options: BrotliOptions, callback: CompressCallback): void; |
||||||
|
function brotliDecompress(buf: InputType, callback: CompressCallback): void; |
||||||
|
namespace brotliDecompress { |
||||||
|
function __promisify__(buffer: InputType, options?: BrotliOptions): Promise<Buffer>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Decompress a chunk of data with `BrotliDecompress`. |
||||||
|
* @since v11.7.0, v10.16.0 |
||||||
|
*/ |
||||||
|
function brotliDecompressSync(buf: InputType, options?: BrotliOptions): Buffer; |
||||||
|
/** |
||||||
|
* @since v0.6.0 |
||||||
|
*/ |
||||||
|
function deflate(buf: InputType, callback: CompressCallback): void; |
||||||
|
function deflate(buf: InputType, options: ZlibOptions, callback: CompressCallback): void; |
||||||
|
namespace deflate { |
||||||
|
function __promisify__(buffer: InputType, options?: ZlibOptions): Promise<Buffer>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Compress a chunk of data with `Deflate`. |
||||||
|
* @since v0.11.12 |
||||||
|
*/ |
||||||
|
function deflateSync(buf: InputType, options?: ZlibOptions): Buffer; |
||||||
|
/** |
||||||
|
* @since v0.6.0 |
||||||
|
*/ |
||||||
|
function deflateRaw(buf: InputType, callback: CompressCallback): void; |
||||||
|
function deflateRaw(buf: InputType, options: ZlibOptions, callback: CompressCallback): void; |
||||||
|
namespace deflateRaw { |
||||||
|
function __promisify__(buffer: InputType, options?: ZlibOptions): Promise<Buffer>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Compress a chunk of data with `DeflateRaw`. |
||||||
|
* @since v0.11.12 |
||||||
|
*/ |
||||||
|
function deflateRawSync(buf: InputType, options?: ZlibOptions): Buffer; |
||||||
|
/** |
||||||
|
* @since v0.6.0 |
||||||
|
*/ |
||||||
|
function gzip(buf: InputType, callback: CompressCallback): void; |
||||||
|
function gzip(buf: InputType, options: ZlibOptions, callback: CompressCallback): void; |
||||||
|
namespace gzip { |
||||||
|
function __promisify__(buffer: InputType, options?: ZlibOptions): Promise<Buffer>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Compress a chunk of data with `Gzip`. |
||||||
|
* @since v0.11.12 |
||||||
|
*/ |
||||||
|
function gzipSync(buf: InputType, options?: ZlibOptions): Buffer; |
||||||
|
/** |
||||||
|
* @since v0.6.0 |
||||||
|
*/ |
||||||
|
function gunzip(buf: InputType, callback: CompressCallback): void; |
||||||
|
function gunzip(buf: InputType, options: ZlibOptions, callback: CompressCallback): void; |
||||||
|
namespace gunzip { |
||||||
|
function __promisify__(buffer: InputType, options?: ZlibOptions): Promise<Buffer>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Decompress a chunk of data with `Gunzip`. |
||||||
|
* @since v0.11.12 |
||||||
|
*/ |
||||||
|
function gunzipSync(buf: InputType, options?: ZlibOptions): Buffer; |
||||||
|
/** |
||||||
|
* @since v0.6.0 |
||||||
|
*/ |
||||||
|
function inflate(buf: InputType, callback: CompressCallback): void; |
||||||
|
function inflate(buf: InputType, options: ZlibOptions, callback: CompressCallback): void; |
||||||
|
namespace inflate { |
||||||
|
function __promisify__(buffer: InputType, options?: ZlibOptions): Promise<Buffer>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Decompress a chunk of data with `Inflate`. |
||||||
|
* @since v0.11.12 |
||||||
|
*/ |
||||||
|
function inflateSync(buf: InputType, options?: ZlibOptions): Buffer; |
||||||
|
/** |
||||||
|
* @since v0.6.0 |
||||||
|
*/ |
||||||
|
function inflateRaw(buf: InputType, callback: CompressCallback): void; |
||||||
|
function inflateRaw(buf: InputType, options: ZlibOptions, callback: CompressCallback): void; |
||||||
|
namespace inflateRaw { |
||||||
|
function __promisify__(buffer: InputType, options?: ZlibOptions): Promise<Buffer>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Decompress a chunk of data with `InflateRaw`. |
||||||
|
* @since v0.11.12 |
||||||
|
*/ |
||||||
|
function inflateRawSync(buf: InputType, options?: ZlibOptions): Buffer; |
||||||
|
/** |
||||||
|
* @since v0.6.0 |
||||||
|
*/ |
||||||
|
function unzip(buf: InputType, callback: CompressCallback): void; |
||||||
|
function unzip(buf: InputType, options: ZlibOptions, callback: CompressCallback): void; |
||||||
|
namespace unzip { |
||||||
|
function __promisify__(buffer: InputType, options?: ZlibOptions): Promise<Buffer>; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Decompress a chunk of data with `Unzip`. |
||||||
|
* @since v0.11.12 |
||||||
|
*/ |
||||||
|
function unzipSync(buf: InputType, options?: ZlibOptions): Buffer; |
||||||
|
namespace constants { |
||||||
|
const BROTLI_DECODE: number; |
||||||
|
const BROTLI_DECODER_ERROR_ALLOC_BLOCK_TYPE_TREES: number; |
||||||
|
const BROTLI_DECODER_ERROR_ALLOC_CONTEXT_MAP: number; |
||||||
|
const BROTLI_DECODER_ERROR_ALLOC_CONTEXT_MODES: number; |
||||||
|
const BROTLI_DECODER_ERROR_ALLOC_RING_BUFFER_1: number; |
||||||
|
const BROTLI_DECODER_ERROR_ALLOC_RING_BUFFER_2: number; |
||||||
|
const BROTLI_DECODER_ERROR_ALLOC_TREE_GROUPS: number; |
||||||
|
const BROTLI_DECODER_ERROR_DICTIONARY_NOT_SET: number; |
||||||
|
const BROTLI_DECODER_ERROR_FORMAT_BLOCK_LENGTH_1: number; |
||||||
|
const BROTLI_DECODER_ERROR_FORMAT_BLOCK_LENGTH_2: number; |
||||||
|
const BROTLI_DECODER_ERROR_FORMAT_CL_SPACE: number; |
||||||
|
const BROTLI_DECODER_ERROR_FORMAT_CONTEXT_MAP_REPEAT: number; |
||||||
|
const BROTLI_DECODER_ERROR_FORMAT_DICTIONARY: number; |
||||||
|
const BROTLI_DECODER_ERROR_FORMAT_DISTANCE: number; |
||||||
|
const BROTLI_DECODER_ERROR_FORMAT_EXUBERANT_META_NIBBLE: number; |
||||||
|
const BROTLI_DECODER_ERROR_FORMAT_EXUBERANT_NIBBLE: number; |
||||||
|
const BROTLI_DECODER_ERROR_FORMAT_HUFFMAN_SPACE: number; |
||||||
|
const BROTLI_DECODER_ERROR_FORMAT_PADDING_1: number; |
||||||
|
const BROTLI_DECODER_ERROR_FORMAT_PADDING_2: number; |
||||||
|
const BROTLI_DECODER_ERROR_FORMAT_RESERVED: number; |
||||||
|
const BROTLI_DECODER_ERROR_FORMAT_SIMPLE_HUFFMAN_ALPHABET: number; |
||||||
|
const BROTLI_DECODER_ERROR_FORMAT_SIMPLE_HUFFMAN_SAME: number; |
||||||
|
const BROTLI_DECODER_ERROR_FORMAT_TRANSFORM: number; |
||||||
|
const BROTLI_DECODER_ERROR_FORMAT_WINDOW_BITS: number; |
||||||
|
const BROTLI_DECODER_ERROR_INVALID_ARGUMENTS: number; |
||||||
|
const BROTLI_DECODER_ERROR_UNREACHABLE: number; |
||||||
|
const BROTLI_DECODER_NEEDS_MORE_INPUT: number; |
||||||
|
const BROTLI_DECODER_NEEDS_MORE_OUTPUT: number; |
||||||
|
const BROTLI_DECODER_NO_ERROR: number; |
||||||
|
const BROTLI_DECODER_PARAM_DISABLE_RING_BUFFER_REALLOCATION: number; |
||||||
|
const BROTLI_DECODER_PARAM_LARGE_WINDOW: number; |
||||||
|
const BROTLI_DECODER_RESULT_ERROR: number; |
||||||
|
const BROTLI_DECODER_RESULT_NEEDS_MORE_INPUT: number; |
||||||
|
const BROTLI_DECODER_RESULT_NEEDS_MORE_OUTPUT: number; |
||||||
|
const BROTLI_DECODER_RESULT_SUCCESS: number; |
||||||
|
const BROTLI_DECODER_SUCCESS: number; |
||||||
|
const BROTLI_DEFAULT_MODE: number; |
||||||
|
const BROTLI_DEFAULT_QUALITY: number; |
||||||
|
const BROTLI_DEFAULT_WINDOW: number; |
||||||
|
const BROTLI_ENCODE: number; |
||||||
|
const BROTLI_LARGE_MAX_WINDOW_BITS: number; |
||||||
|
const BROTLI_MAX_INPUT_BLOCK_BITS: number; |
||||||
|
const BROTLI_MAX_QUALITY: number; |
||||||
|
const BROTLI_MAX_WINDOW_BITS: number; |
||||||
|
const BROTLI_MIN_INPUT_BLOCK_BITS: number; |
||||||
|
const BROTLI_MIN_QUALITY: number; |
||||||
|
const BROTLI_MIN_WINDOW_BITS: number; |
||||||
|
const BROTLI_MODE_FONT: number; |
||||||
|
const BROTLI_MODE_GENERIC: number; |
||||||
|
const BROTLI_MODE_TEXT: number; |
||||||
|
const BROTLI_OPERATION_EMIT_METADATA: number; |
||||||
|
const BROTLI_OPERATION_FINISH: number; |
||||||
|
const BROTLI_OPERATION_FLUSH: number; |
||||||
|
const BROTLI_OPERATION_PROCESS: number; |
||||||
|
const BROTLI_PARAM_DISABLE_LITERAL_CONTEXT_MODELING: number; |
||||||
|
const BROTLI_PARAM_LARGE_WINDOW: number; |
||||||
|
const BROTLI_PARAM_LGBLOCK: number; |
||||||
|
const BROTLI_PARAM_LGWIN: number; |
||||||
|
const BROTLI_PARAM_MODE: number; |
||||||
|
const BROTLI_PARAM_NDIRECT: number; |
||||||
|
const BROTLI_PARAM_NPOSTFIX: number; |
||||||
|
const BROTLI_PARAM_QUALITY: number; |
||||||
|
const BROTLI_PARAM_SIZE_HINT: number; |
||||||
|
const DEFLATE: number; |
||||||
|
const DEFLATERAW: number; |
||||||
|
const GUNZIP: number; |
||||||
|
const GZIP: number; |
||||||
|
const INFLATE: number; |
||||||
|
const INFLATERAW: number; |
||||||
|
const UNZIP: number; |
||||||
|
// Allowed flush values.
|
||||||
|
const Z_NO_FLUSH: number; |
||||||
|
const Z_PARTIAL_FLUSH: number; |
||||||
|
const Z_SYNC_FLUSH: number; |
||||||
|
const Z_FULL_FLUSH: number; |
||||||
|
const Z_FINISH: number; |
||||||
|
const Z_BLOCK: number; |
||||||
|
const Z_TREES: number; |
||||||
|
// Return codes for the compression/decompression functions.
|
||||||
|
// Negative values are errors, positive values are used for special but normal events.
|
||||||
|
const Z_OK: number; |
||||||
|
const Z_STREAM_END: number; |
||||||
|
const Z_NEED_DICT: number; |
||||||
|
const Z_ERRNO: number; |
||||||
|
const Z_STREAM_ERROR: number; |
||||||
|
const Z_DATA_ERROR: number; |
||||||
|
const Z_MEM_ERROR: number; |
||||||
|
const Z_BUF_ERROR: number; |
||||||
|
const Z_VERSION_ERROR: number; |
||||||
|
// Compression levels.
|
||||||
|
const Z_NO_COMPRESSION: number; |
||||||
|
const Z_BEST_SPEED: number; |
||||||
|
const Z_BEST_COMPRESSION: number; |
||||||
|
const Z_DEFAULT_COMPRESSION: number; |
||||||
|
// Compression strategy.
|
||||||
|
const Z_FILTERED: number; |
||||||
|
const Z_HUFFMAN_ONLY: number; |
||||||
|
const Z_RLE: number; |
||||||
|
const Z_FIXED: number; |
||||||
|
const Z_DEFAULT_STRATEGY: number; |
||||||
|
const Z_DEFAULT_WINDOWBITS: number; |
||||||
|
const Z_MIN_WINDOWBITS: number; |
||||||
|
const Z_MAX_WINDOWBITS: number; |
||||||
|
const Z_MIN_CHUNK: number; |
||||||
|
const Z_MAX_CHUNK: number; |
||||||
|
const Z_DEFAULT_CHUNK: number; |
||||||
|
const Z_MIN_MEMLEVEL: number; |
||||||
|
const Z_MAX_MEMLEVEL: number; |
||||||
|
const Z_DEFAULT_MEMLEVEL: number; |
||||||
|
const Z_MIN_LEVEL: number; |
||||||
|
const Z_MAX_LEVEL: number; |
||||||
|
const Z_DEFAULT_LEVEL: number; |
||||||
|
const ZLIB_VERNUM: number; |
||||||
|
} |
||||||
|
// Allowed flush values.
|
||||||
|
/** @deprecated Use `constants.Z_NO_FLUSH` */ |
||||||
|
const Z_NO_FLUSH: number; |
||||||
|
/** @deprecated Use `constants.Z_PARTIAL_FLUSH` */ |
||||||
|
const Z_PARTIAL_FLUSH: number; |
||||||
|
/** @deprecated Use `constants.Z_SYNC_FLUSH` */ |
||||||
|
const Z_SYNC_FLUSH: number; |
||||||
|
/** @deprecated Use `constants.Z_FULL_FLUSH` */ |
||||||
|
const Z_FULL_FLUSH: number; |
||||||
|
/** @deprecated Use `constants.Z_FINISH` */ |
||||||
|
const Z_FINISH: number; |
||||||
|
/** @deprecated Use `constants.Z_BLOCK` */ |
||||||
|
const Z_BLOCK: number; |
||||||
|
/** @deprecated Use `constants.Z_TREES` */ |
||||||
|
const Z_TREES: number; |
||||||
|
// Return codes for the compression/decompression functions.
|
||||||
|
// Negative values are errors, positive values are used for special but normal events.
|
||||||
|
/** @deprecated Use `constants.Z_OK` */ |
||||||
|
const Z_OK: number; |
||||||
|
/** @deprecated Use `constants.Z_STREAM_END` */ |
||||||
|
const Z_STREAM_END: number; |
||||||
|
/** @deprecated Use `constants.Z_NEED_DICT` */ |
||||||
|
const Z_NEED_DICT: number; |
||||||
|
/** @deprecated Use `constants.Z_ERRNO` */ |
||||||
|
const Z_ERRNO: number; |
||||||
|
/** @deprecated Use `constants.Z_STREAM_ERROR` */ |
||||||
|
const Z_STREAM_ERROR: number; |
||||||
|
/** @deprecated Use `constants.Z_DATA_ERROR` */ |
||||||
|
const Z_DATA_ERROR: number; |
||||||
|
/** @deprecated Use `constants.Z_MEM_ERROR` */ |
||||||
|
const Z_MEM_ERROR: number; |
||||||
|
/** @deprecated Use `constants.Z_BUF_ERROR` */ |
||||||
|
const Z_BUF_ERROR: number; |
||||||
|
/** @deprecated Use `constants.Z_VERSION_ERROR` */ |
||||||
|
const Z_VERSION_ERROR: number; |
||||||
|
// Compression levels.
|
||||||
|
/** @deprecated Use `constants.Z_NO_COMPRESSION` */ |
||||||
|
const Z_NO_COMPRESSION: number; |
||||||
|
/** @deprecated Use `constants.Z_BEST_SPEED` */ |
||||||
|
const Z_BEST_SPEED: number; |
||||||
|
/** @deprecated Use `constants.Z_BEST_COMPRESSION` */ |
||||||
|
const Z_BEST_COMPRESSION: number; |
||||||
|
/** @deprecated Use `constants.Z_DEFAULT_COMPRESSION` */ |
||||||
|
const Z_DEFAULT_COMPRESSION: number; |
||||||
|
// Compression strategy.
|
||||||
|
/** @deprecated Use `constants.Z_FILTERED` */ |
||||||
|
const Z_FILTERED: number; |
||||||
|
/** @deprecated Use `constants.Z_HUFFMAN_ONLY` */ |
||||||
|
const Z_HUFFMAN_ONLY: number; |
||||||
|
/** @deprecated Use `constants.Z_RLE` */ |
||||||
|
const Z_RLE: number; |
||||||
|
/** @deprecated Use `constants.Z_FIXED` */ |
||||||
|
const Z_FIXED: number; |
||||||
|
/** @deprecated Use `constants.Z_DEFAULT_STRATEGY` */ |
||||||
|
const Z_DEFAULT_STRATEGY: number; |
||||||
|
/** @deprecated */ |
||||||
|
const Z_BINARY: number; |
||||||
|
/** @deprecated */ |
||||||
|
const Z_TEXT: number; |
||||||
|
/** @deprecated */ |
||||||
|
const Z_ASCII: number; |
||||||
|
/** @deprecated */ |
||||||
|
const Z_UNKNOWN: number; |
||||||
|
/** @deprecated */ |
||||||
|
const Z_DEFLATED: number; |
||||||
|
} |
||||||
|
declare module 'node:zlib' { |
||||||
|
export * from 'zlib'; |
||||||
|
} |
@ -0,0 +1,88 @@ |
|||||||
|
data-uri-to-buffer |
||||||
|
================== |
||||||
|
### Generate a Buffer instance from a [Data URI][rfc] string |
||||||
|
[](https://travis-ci.org/TooTallNate/node-data-uri-to-buffer) |
||||||
|
|
||||||
|
This module accepts a ["data" URI][rfc] String of data, and returns a |
||||||
|
node.js `Buffer` instance with the decoded data. |
||||||
|
|
||||||
|
|
||||||
|
Installation |
||||||
|
------------ |
||||||
|
|
||||||
|
Install with `npm`: |
||||||
|
|
||||||
|
``` bash |
||||||
|
$ npm install data-uri-to-buffer |
||||||
|
``` |
||||||
|
|
||||||
|
|
||||||
|
Example |
||||||
|
------- |
||||||
|
|
||||||
|
``` js |
||||||
|
var dataUriToBuffer = require('data-uri-to-buffer'); |
||||||
|
|
||||||
|
// plain-text data is supported |
||||||
|
var uri = 'data:,Hello%2C%20World!'; |
||||||
|
var decoded = dataUriToBuffer(uri); |
||||||
|
console.log(decoded.toString()); |
||||||
|
// 'Hello, World!' |
||||||
|
|
||||||
|
// base64-encoded data is supported |
||||||
|
uri = 'data:text/plain;base64,SGVsbG8sIFdvcmxkIQ%3D%3D'; |
||||||
|
decoded = dataUriToBuffer(uri); |
||||||
|
console.log(decoded.toString()); |
||||||
|
// 'Hello, World!' |
||||||
|
``` |
||||||
|
|
||||||
|
|
||||||
|
API |
||||||
|
--- |
||||||
|
|
||||||
|
### dataUriToBuffer(String uri) → Buffer |
||||||
|
|
||||||
|
The `type` property on the Buffer instance gets set to the main type portion of |
||||||
|
the "mediatype" portion of the "data" URI, or defaults to `"text/plain"` if not |
||||||
|
specified. |
||||||
|
|
||||||
|
The `typeFull` property on the Buffer instance gets set to the entire |
||||||
|
"mediatype" portion of the "data" URI (including all parameters), or defaults |
||||||
|
to `"text/plain;charset=US-ASCII"` if not specified. |
||||||
|
|
||||||
|
The `charset` property on the Buffer instance gets set to the Charset portion of |
||||||
|
the "mediatype" portion of the "data" URI, or defaults to `"US-ASCII"` if the |
||||||
|
entire type is not specified, or defaults to `""` otherwise. |
||||||
|
|
||||||
|
*Note*: If the only the main type is specified but not the charset, e.g. |
||||||
|
`"data:text/plain,abc"`, the charset is set to the empty string. The spec only |
||||||
|
defaults to US-ASCII as charset if the entire type is not specified. |
||||||
|
|
||||||
|
|
||||||
|
License |
||||||
|
------- |
||||||
|
|
||||||
|
(The MIT License) |
||||||
|
|
||||||
|
Copyright (c) 2014 Nathan Rajlich <nathan@tootallnate.net> |
||||||
|
|
||||||
|
Permission is hereby granted, free of charge, to any person obtaining |
||||||
|
a copy of this software and associated documentation files (the |
||||||
|
'Software'), to deal in the Software without restriction, including |
||||||
|
without limitation the rights to use, copy, modify, merge, publish, |
||||||
|
distribute, sublicense, and/or sell copies of the Software, and to |
||||||
|
permit persons to whom the Software is furnished to do so, subject to |
||||||
|
the following conditions: |
||||||
|
|
||||||
|
The above copyright notice and this permission notice shall be |
||||||
|
included in all copies or substantial portions of the Software. |
||||||
|
|
||||||
|
THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, |
||||||
|
EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF |
||||||
|
MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. |
||||||
|
IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY |
||||||
|
CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, |
||||||
|
TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE |
||||||
|
SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. |
||||||
|
|
||||||
|
[rfc]: http://tools.ietf.org/html/rfc2397 |
@ -0,0 +1,15 @@ |
|||||||
|
/// <reference types="node" />
|
||||||
|
export interface MimeBuffer extends Buffer { |
||||||
|
type: string; |
||||||
|
typeFull: string; |
||||||
|
charset: string; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Returns a `Buffer` instance from the given data URI `uri`. |
||||||
|
* |
||||||
|
* @param {String} uri Data URI to turn into a Buffer instance |
||||||
|
* @returns {Buffer} Buffer instance from Data URI |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
export declare function dataUriToBuffer(uri: string): MimeBuffer; |
||||||
|
export default dataUriToBuffer; |
@ -0,0 +1,53 @@ |
|||||||
|
/** |
||||||
|
* Returns a `Buffer` instance from the given data URI `uri`. |
||||||
|
* |
||||||
|
* @param {String} uri Data URI to turn into a Buffer instance |
||||||
|
* @returns {Buffer} Buffer instance from Data URI |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
export function dataUriToBuffer(uri) { |
||||||
|
if (!/^data:/i.test(uri)) { |
||||||
|
throw new TypeError('`uri` does not appear to be a Data URI (must begin with "data:")'); |
||||||
|
} |
||||||
|
// strip newlines
|
||||||
|
uri = uri.replace(/\r?\n/g, ''); |
||||||
|
// split the URI up into the "metadata" and the "data" portions
|
||||||
|
const firstComma = uri.indexOf(','); |
||||||
|
if (firstComma === -1 || firstComma <= 4) { |
||||||
|
throw new TypeError('malformed data: URI'); |
||||||
|
} |
||||||
|
// remove the "data:" scheme and parse the metadata
|
||||||
|
const meta = uri.substring(5, firstComma).split(';'); |
||||||
|
let charset = ''; |
||||||
|
let base64 = false; |
||||||
|
const type = meta[0] || 'text/plain'; |
||||||
|
let typeFull = type; |
||||||
|
for (let i = 1; i < meta.length; i++) { |
||||||
|
if (meta[i] === 'base64') { |
||||||
|
base64 = true; |
||||||
|
} |
||||||
|
else { |
||||||
|
typeFull += `;${meta[i]}`; |
||||||
|
if (meta[i].indexOf('charset=') === 0) { |
||||||
|
charset = meta[i].substring(8); |
||||||
|
} |
||||||
|
} |
||||||
|
} |
||||||
|
// defaults to US-ASCII only if type is not provided
|
||||||
|
if (!meta[0] && !charset.length) { |
||||||
|
typeFull += ';charset=US-ASCII'; |
||||||
|
charset = 'US-ASCII'; |
||||||
|
} |
||||||
|
// get the encoded data portion and decode URI-encoded chars
|
||||||
|
const encoding = base64 ? 'base64' : 'ascii'; |
||||||
|
const data = unescape(uri.substring(firstComma + 1)); |
||||||
|
const buffer = Buffer.from(data, encoding); |
||||||
|
// set `.type` and `.typeFull` properties to MIME type
|
||||||
|
buffer.type = type; |
||||||
|
buffer.typeFull = typeFull; |
||||||
|
// set the `.charset` property
|
||||||
|
buffer.charset = charset; |
||||||
|
return buffer; |
||||||
|
} |
||||||
|
export default dataUriToBuffer; |
||||||
|
//# sourceMappingURL=index.js.map
|
@ -0,0 +1 @@ |
|||||||
|
{"version":3,"file":"index.js","sourceRoot":"","sources":["../src/index.ts"],"names":[],"mappings":"AAMA;;;;;;GAMG;AACH,MAAM,UAAU,eAAe,CAAC,GAAW;IAC1C,IAAI,CAAC,SAAS,CAAC,IAAI,CAAC,GAAG,CAAC,EAAE;QACzB,MAAM,IAAI,SAAS,CAClB,kEAAkE,CAClE,CAAC;KACF;IAED,iBAAiB;IACjB,GAAG,GAAG,GAAG,CAAC,OAAO,CAAC,QAAQ,EAAE,EAAE,CAAC,CAAC;IAEhC,+DAA+D;IAC/D,MAAM,UAAU,GAAG,GAAG,CAAC,OAAO,CAAC,GAAG,CAAC,CAAC;IACpC,IAAI,UAAU,KAAK,CAAC,CAAC,IAAI,UAAU,IAAI,CAAC,EAAE;QACzC,MAAM,IAAI,SAAS,CAAC,qBAAqB,CAAC,CAAC;KAC3C;IAED,mDAAmD;IACnD,MAAM,IAAI,GAAG,GAAG,CAAC,SAAS,CAAC,CAAC,EAAE,UAAU,CAAC,CAAC,KAAK,CAAC,GAAG,CAAC,CAAC;IAErD,IAAI,OAAO,GAAG,EAAE,CAAC;IACjB,IAAI,MAAM,GAAG,KAAK,CAAC;IACnB,MAAM,IAAI,GAAG,IAAI,CAAC,CAAC,CAAC,IAAI,YAAY,CAAC;IACrC,IAAI,QAAQ,GAAG,IAAI,CAAC;IACpB,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,IAAI,CAAC,MAAM,EAAE,CAAC,EAAE,EAAE;QACrC,IAAI,IAAI,CAAC,CAAC,CAAC,KAAK,QAAQ,EAAE;YACzB,MAAM,GAAG,IAAI,CAAC;SACd;aAAM;YACN,QAAQ,IAAI,IAAM,IAAI,CAAC,CAAC,CAAC,EAAE,CAAC;YAC5B,IAAI,IAAI,CAAC,CAAC,CAAC,CAAC,OAAO,CAAC,UAAU,CAAC,KAAK,CAAC,EAAE;gBACtC,OAAO,GAAG,IAAI,CAAC,CAAC,CAAC,CAAC,SAAS,CAAC,CAAC,CAAC,CAAC;aAC/B;SACD;KACD;IACD,oDAAoD;IACpD,IAAI,CAAC,IAAI,CAAC,CAAC,CAAC,IAAI,CAAC,OAAO,CAAC,MAAM,EAAE;QAChC,QAAQ,IAAI,mBAAmB,CAAC;QAChC,OAAO,GAAG,UAAU,CAAC;KACrB;IAED,4DAA4D;IAC5D,MAAM,QAAQ,GAAG,MAAM,CAAC,CAAC,CAAC,QAAQ,CAAC,CAAC,CAAC,OAAO,CAAC;IAC7C,MAAM,IAAI,GAAG,QAAQ,CAAC,GAAG,CAAC,SAAS,CAAC,UAAU,GAAG,CAAC,CAAC,CAAC,CAAC;IACrD,MAAM,MAAM,GAAG,MAAM,CAAC,IAAI,CAAC,IAAI,EAAE,QAAQ,CAAe,CAAC;IAEzD,sDAAsD;IACtD,MAAM,CAAC,IAAI,GAAG,IAAI,CAAC;IACnB,MAAM,CAAC,QAAQ,GAAG,QAAQ,CAAC;IAE3B,8BAA8B;IAC9B,MAAM,CAAC,OAAO,GAAG,OAAO,CAAC;IAEzB,OAAO,MAAM,CAAC;AACf,CAAC;AAED,eAAe,eAAe,CAAC"} |
@ -0,0 +1,15 @@ |
|||||||
|
/// <reference types="node" />
|
||||||
|
export interface MimeBuffer extends Buffer { |
||||||
|
type: string; |
||||||
|
typeFull: string; |
||||||
|
charset: string; |
||||||
|
} |
||||||
|
/** |
||||||
|
* Returns a `Buffer` instance from the given data URI `uri`. |
||||||
|
* |
||||||
|
* @param {String} uri Data URI to turn into a Buffer instance |
||||||
|
* @returns {Buffer} Buffer instance from Data URI |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
export declare function dataUriToBuffer(uri: string): MimeBuffer; |
||||||
|
export default dataUriToBuffer; |
@ -0,0 +1,53 @@ |
|||||||
|
/** |
||||||
|
* Returns a `Buffer` instance from the given data URI `uri`. |
||||||
|
* |
||||||
|
* @param {String} uri Data URI to turn into a Buffer instance |
||||||
|
* @returns {Buffer} Buffer instance from Data URI |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
export function dataUriToBuffer(uri) { |
||||||
|
if (!/^data:/i.test(uri)) { |
||||||
|
throw new TypeError('`uri` does not appear to be a Data URI (must begin with "data:")'); |
||||||
|
} |
||||||
|
// strip newlines
|
||||||
|
uri = uri.replace(/\r?\n/g, ''); |
||||||
|
// split the URI up into the "metadata" and the "data" portions
|
||||||
|
const firstComma = uri.indexOf(','); |
||||||
|
if (firstComma === -1 || firstComma <= 4) { |
||||||
|
throw new TypeError('malformed data: URI'); |
||||||
|
} |
||||||
|
// remove the "data:" scheme and parse the metadata
|
||||||
|
const meta = uri.substring(5, firstComma).split(';'); |
||||||
|
let charset = ''; |
||||||
|
let base64 = false; |
||||||
|
const type = meta[0] || 'text/plain'; |
||||||
|
let typeFull = type; |
||||||
|
for (let i = 1; i < meta.length; i++) { |
||||||
|
if (meta[i] === 'base64') { |
||||||
|
base64 = true; |
||||||
|
} |
||||||
|
else { |
||||||
|
typeFull += `;${meta[i]}`; |
||||||
|
if (meta[i].indexOf('charset=') === 0) { |
||||||
|
charset = meta[i].substring(8); |
||||||
|
} |
||||||
|
} |
||||||
|
} |
||||||
|
// defaults to US-ASCII only if type is not provided
|
||||||
|
if (!meta[0] && !charset.length) { |
||||||
|
typeFull += ';charset=US-ASCII'; |
||||||
|
charset = 'US-ASCII'; |
||||||
|
} |
||||||
|
// get the encoded data portion and decode URI-encoded chars
|
||||||
|
const encoding = base64 ? 'base64' : 'ascii'; |
||||||
|
const data = unescape(uri.substring(firstComma + 1)); |
||||||
|
const buffer = Buffer.from(data, encoding); |
||||||
|
// set `.type` and `.typeFull` properties to MIME type
|
||||||
|
buffer.type = type; |
||||||
|
buffer.typeFull = typeFull; |
||||||
|
// set the `.charset` property
|
||||||
|
buffer.charset = charset; |
||||||
|
return buffer; |
||||||
|
} |
||||||
|
export default dataUriToBuffer; |
||||||
|
//# sourceMappingURL=index.js.map
|
@ -0,0 +1 @@ |
|||||||
|
{"version":3,"file":"index.js","sourceRoot":"","sources":["../../src/index.ts"],"names":[],"mappings":"AAMA;;;;;;GAMG;AACH,MAAM,UAAU,eAAe,CAAC,GAAW;IAC1C,IAAI,CAAC,SAAS,CAAC,IAAI,CAAC,GAAG,CAAC,EAAE;QACzB,MAAM,IAAI,SAAS,CAClB,kEAAkE,CAClE,CAAC;KACF;IAED,iBAAiB;IACjB,GAAG,GAAG,GAAG,CAAC,OAAO,CAAC,QAAQ,EAAE,EAAE,CAAC,CAAC;IAEhC,+DAA+D;IAC/D,MAAM,UAAU,GAAG,GAAG,CAAC,OAAO,CAAC,GAAG,CAAC,CAAC;IACpC,IAAI,UAAU,KAAK,CAAC,CAAC,IAAI,UAAU,IAAI,CAAC,EAAE;QACzC,MAAM,IAAI,SAAS,CAAC,qBAAqB,CAAC,CAAC;KAC3C;IAED,mDAAmD;IACnD,MAAM,IAAI,GAAG,GAAG,CAAC,SAAS,CAAC,CAAC,EAAE,UAAU,CAAC,CAAC,KAAK,CAAC,GAAG,CAAC,CAAC;IAErD,IAAI,OAAO,GAAG,EAAE,CAAC;IACjB,IAAI,MAAM,GAAG,KAAK,CAAC;IACnB,MAAM,IAAI,GAAG,IAAI,CAAC,CAAC,CAAC,IAAI,YAAY,CAAC;IACrC,IAAI,QAAQ,GAAG,IAAI,CAAC;IACpB,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,IAAI,CAAC,MAAM,EAAE,CAAC,EAAE,EAAE;QACrC,IAAI,IAAI,CAAC,CAAC,CAAC,KAAK,QAAQ,EAAE;YACzB,MAAM,GAAG,IAAI,CAAC;SACd;aAAM;YACN,QAAQ,IAAI,IAAM,IAAI,CAAC,CAAC,CAAC,EAAE,CAAC;YAC5B,IAAI,IAAI,CAAC,CAAC,CAAC,CAAC,OAAO,CAAC,UAAU,CAAC,KAAK,CAAC,EAAE;gBACtC,OAAO,GAAG,IAAI,CAAC,CAAC,CAAC,CAAC,SAAS,CAAC,CAAC,CAAC,CAAC;aAC/B;SACD;KACD;IACD,oDAAoD;IACpD,IAAI,CAAC,IAAI,CAAC,CAAC,CAAC,IAAI,CAAC,OAAO,CAAC,MAAM,EAAE;QAChC,QAAQ,IAAI,mBAAmB,CAAC;QAChC,OAAO,GAAG,UAAU,CAAC;KACrB;IAED,4DAA4D;IAC5D,MAAM,QAAQ,GAAG,MAAM,CAAC,CAAC,CAAC,QAAQ,CAAC,CAAC,CAAC,OAAO,CAAC;IAC7C,MAAM,IAAI,GAAG,QAAQ,CAAC,GAAG,CAAC,SAAS,CAAC,UAAU,GAAG,CAAC,CAAC,CAAC,CAAC;IACrD,MAAM,MAAM,GAAG,MAAM,CAAC,IAAI,CAAC,IAAI,EAAE,QAAQ,CAAe,CAAC;IAEzD,sDAAsD;IACtD,MAAM,CAAC,IAAI,GAAG,IAAI,CAAC;IACnB,MAAM,CAAC,QAAQ,GAAG,QAAQ,CAAC;IAE3B,8BAA8B;IAC9B,MAAM,CAAC,OAAO,GAAG,OAAO,CAAC;IAEzB,OAAO,MAAM,CAAC;AACf,CAAC;AAED,eAAe,eAAe,CAAC"} |
@ -0,0 +1,4 @@ |
|||||||
|
/** |
||||||
|
* Module dependencies. |
||||||
|
*/ |
||||||
|
export {}; |
@ -0,0 +1,144 @@ |
|||||||
|
/** |
||||||
|
* Module dependencies. |
||||||
|
*/ |
||||||
|
import assert from 'assert'; |
||||||
|
import dataUriToBuffer from '../src'; |
||||||
|
describe('data-uri-to-buffer', function () { |
||||||
|
it('should decode bare-bones Data URIs', function () { |
||||||
|
var uri = 'data:,Hello%2C%20World!'; |
||||||
|
var buf = dataUriToBuffer(uri); |
||||||
|
assert.equal('text/plain', buf.type); |
||||||
|
assert.equal('text/plain;charset=US-ASCII', buf.typeFull); |
||||||
|
assert.equal('US-ASCII', buf.charset); |
||||||
|
assert.equal('Hello, World!', buf.toString()); |
||||||
|
}); |
||||||
|
it('should decode bare-bones "base64" Data URIs', function () { |
||||||
|
var uri = 'data:text/plain;base64,SGVsbG8sIFdvcmxkIQ%3D%3D'; |
||||||
|
var buf = dataUriToBuffer(uri); |
||||||
|
assert.equal('text/plain', buf.type); |
||||||
|
assert.equal('Hello, World!', buf.toString()); |
||||||
|
}); |
||||||
|
it('should decode plain-text Data URIs', function () { |
||||||
|
var html = '<!DOCTYPE html>' + |
||||||
|
'<html lang="en">' + |
||||||
|
'<head><title>Embedded Window</title></head>' + |
||||||
|
'<body><h1>42</h1></body>' + |
||||||
|
'</html>'; |
||||||
|
// Escape the HTML for URL formatting
|
||||||
|
var uri = 'data:text/html;charset=utf-8,' + encodeURIComponent(html); |
||||||
|
var buf = dataUriToBuffer(uri); |
||||||
|
assert.equal('text/html', buf.type); |
||||||
|
assert.equal('utf-8', buf.charset); |
||||||
|
assert.equal(html, buf.toString()); |
||||||
|
}); |
||||||
|
// the next 4 tests are from:
|
||||||
|
// https://bug161965.bugzilla.mozilla.org/attachment.cgi?id=94670&action=view
|
||||||
|
it('should decode "ISO-8859-8 in Base64" URIs', function () { |
||||||
|
var uri = 'data:text/plain;charset=iso-8859-8-i;base64,+ezl7Q=='; |
||||||
|
var buf = dataUriToBuffer(uri); |
||||||
|
assert.equal('text/plain', buf.type); |
||||||
|
assert.equal('iso-8859-8-i', buf.charset); |
||||||
|
assert.equal(4, buf.length); |
||||||
|
assert.equal(0xf9, buf[0]); |
||||||
|
assert.equal(0xec, buf[1]); |
||||||
|
assert.equal(0xe5, buf[2]); |
||||||
|
assert.equal(0xed, buf[3]); |
||||||
|
}); |
||||||
|
it('should decode "ISO-8859-8 in URL-encoding" URIs', function () { |
||||||
|
var uri = 'data:text/plain;charset=iso-8859-8-i,%f9%ec%e5%ed'; |
||||||
|
var buf = dataUriToBuffer(uri); |
||||||
|
assert.equal('text/plain', buf.type); |
||||||
|
assert.equal('iso-8859-8-i', buf.charset); |
||||||
|
assert.equal(4, buf.length); |
||||||
|
assert.equal(0xf9, buf[0]); |
||||||
|
assert.equal(0xec, buf[1]); |
||||||
|
assert.equal(0xe5, buf[2]); |
||||||
|
assert.equal(0xed, buf[3]); |
||||||
|
}); |
||||||
|
it('should decode "UTF-8 in Base64" URIs', function () { |
||||||
|
var uri = 'data:text/plain;charset=UTF-8;base64,16nXnNeV150='; |
||||||
|
var buf = dataUriToBuffer(uri); |
||||||
|
assert.equal('text/plain', buf.type); |
||||||
|
assert.equal('UTF-8', buf.charset); |
||||||
|
assert.equal(8, buf.length); |
||||||
|
assert.equal('שלום', buf.toString('utf8')); |
||||||
|
}); |
||||||
|
it('should decode "UTF-8 in URL-encoding" URIs', function () { |
||||||
|
var uri = 'data:text/plain;charset=UTF-8,%d7%a9%d7%9c%d7%95%d7%9d'; |
||||||
|
var buf = dataUriToBuffer(uri); |
||||||
|
assert.equal('text/plain', buf.type); |
||||||
|
assert.equal('UTF-8', buf.charset); |
||||||
|
assert.equal(8, buf.length); |
||||||
|
assert.equal('שלום', buf.toString('utf8')); |
||||||
|
}); |
||||||
|
// this next one is from Wikipedia IIRC
|
||||||
|
it('should decode "base64" Data URIs with newlines', function () { |
||||||
|
var uri = 'data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAUA\n' + |
||||||
|
'AAAFCAYAAACNbyblAAAAHElEQVQI12P4//8/w38GIAXDIBKE0DHxgljNBAAO\n' + |
||||||
|
'9TXL0Y4OHwAAAABJRU5ErkJggg=='; |
||||||
|
var buf = dataUriToBuffer(uri); |
||||||
|
assert.equal('image/png', buf.type); |
||||||
|
assert.equal('iVBORw0KGgoAAAANSUhEUgAAAAUA' + |
||||||
|
'AAAFCAYAAACNbyblAAAAHElEQVQI12P4//8/w38GIAXDIBKE0DHxgljNBAAO' + |
||||||
|
'9TXL0Y4OHwAAAABJRU5ErkJggg==', buf.toString('base64')); |
||||||
|
}); |
||||||
|
it('should decode a plain-text URI with a space character in it', function () { |
||||||
|
var uri = 'data:,foo bar'; |
||||||
|
var buf = dataUriToBuffer(uri); |
||||||
|
assert.equal('text/plain', buf.type); |
||||||
|
assert.equal('foo bar', buf.toString()); |
||||||
|
}); |
||||||
|
it('should decode data with a "," comma char', function () { |
||||||
|
var uri = 'data:,a,b'; |
||||||
|
var buf = dataUriToBuffer(uri); |
||||||
|
assert.equal('text/plain', buf.type); |
||||||
|
assert.equal('a,b', buf.toString()); |
||||||
|
}); |
||||||
|
it('should decode data with traditionally reserved characters like ";"', function () { |
||||||
|
var uri = 'data:,;test'; |
||||||
|
var buf = dataUriToBuffer(uri); |
||||||
|
assert.equal('text/plain', buf.type); |
||||||
|
assert.equal(';test', buf.toString()); |
||||||
|
}); |
||||||
|
it('should not default to US-ASCII if main type is provided', function () { |
||||||
|
var uri = 'data:text/plain,abc'; |
||||||
|
var buf = dataUriToBuffer(uri); |
||||||
|
assert.equal('text/plain', buf.type); |
||||||
|
assert.equal('text/plain', buf.typeFull); |
||||||
|
assert.equal('', buf.charset); |
||||||
|
assert.equal('abc', buf.toString()); |
||||||
|
}); |
||||||
|
it('should default to text/plain if main type is not provided', function () { |
||||||
|
var uri = 'data:;charset=UTF-8,abc'; |
||||||
|
var buf = dataUriToBuffer(uri); |
||||||
|
assert.equal('text/plain', buf.type); |
||||||
|
assert.equal('text/plain;charset=UTF-8', buf.typeFull); |
||||||
|
assert.equal('UTF-8', buf.charset); |
||||||
|
assert.equal('abc', buf.toString()); |
||||||
|
}); |
||||||
|
it('should not allow charset without a leading ;', function () { |
||||||
|
var uri = 'data:charset=UTF-8,abc'; |
||||||
|
var buf = dataUriToBuffer(uri); |
||||||
|
assert.equal('charset=UTF-8', buf.type); |
||||||
|
assert.equal('charset=UTF-8', buf.typeFull); |
||||||
|
assert.equal('', buf.charset); |
||||||
|
assert.equal('abc', buf.toString()); |
||||||
|
}); |
||||||
|
it('should allow custom media type parameters', function () { |
||||||
|
var uri = 'data:application/javascript;version=1.8;charset=UTF-8,abc'; |
||||||
|
var buf = dataUriToBuffer(uri); |
||||||
|
assert.equal('application/javascript', buf.type); |
||||||
|
assert.equal('application/javascript;version=1.8;charset=UTF-8', buf.typeFull); |
||||||
|
assert.equal('UTF-8', buf.charset); |
||||||
|
assert.equal('abc', buf.toString()); |
||||||
|
}); |
||||||
|
it('should allow base64 annotation anywhere', function () { |
||||||
|
var uri = 'data:text/plain;base64;charset=UTF-8,YWJj'; |
||||||
|
var buf = dataUriToBuffer(uri); |
||||||
|
assert.equal('text/plain', buf.type); |
||||||
|
assert.equal('text/plain;charset=UTF-8', buf.typeFull); |
||||||
|
assert.equal('UTF-8', buf.charset); |
||||||
|
assert.equal('abc', buf.toString()); |
||||||
|
}); |
||||||
|
}); |
||||||
|
//# sourceMappingURL=test.js.map
|
File diff suppressed because one or more lines are too long
@ -0,0 +1,62 @@ |
|||||||
|
{ |
||||||
|
"name": "data-uri-to-buffer", |
||||||
|
"version": "4.0.0", |
||||||
|
"description": "Generate a Buffer instance from a Data URI string", |
||||||
|
"type": "module", |
||||||
|
"main": "dist/index.js", |
||||||
|
"types": "dist/index.d.ts", |
||||||
|
"files": [ |
||||||
|
"dist", |
||||||
|
"src" |
||||||
|
], |
||||||
|
"scripts": { |
||||||
|
"build": "tsc", |
||||||
|
"test": "jest", |
||||||
|
"prepublishOnly": "npm run build" |
||||||
|
}, |
||||||
|
"repository": { |
||||||
|
"type": "git", |
||||||
|
"url": "git://github.com/TooTallNate/node-data-uri-to-buffer.git" |
||||||
|
}, |
||||||
|
"engines": { |
||||||
|
"node": ">= 12" |
||||||
|
}, |
||||||
|
"keywords": [ |
||||||
|
"data", |
||||||
|
"uri", |
||||||
|
"datauri", |
||||||
|
"data-uri", |
||||||
|
"buffer", |
||||||
|
"convert", |
||||||
|
"rfc2397", |
||||||
|
"2397" |
||||||
|
], |
||||||
|
"author": "Nathan Rajlich <nathan@tootallnate.net> (http://n8.io/)", |
||||||
|
"license": "MIT", |
||||||
|
"bugs": { |
||||||
|
"url": "https://github.com/TooTallNate/node-data-uri-to-buffer/issues" |
||||||
|
}, |
||||||
|
"homepage": "https://github.com/TooTallNate/node-data-uri-to-buffer", |
||||||
|
"devDependencies": { |
||||||
|
"@types/es6-promisify": "^5.0.0", |
||||||
|
"@types/mocha": "^9.0.0", |
||||||
|
"@types/node": "^10.5.3", |
||||||
|
"jest": "^27.2.2", |
||||||
|
"ts-jest": "^27.0.5", |
||||||
|
"typescript": "^4.4.3" |
||||||
|
}, |
||||||
|
"jest": { |
||||||
|
"preset": "ts-jest", |
||||||
|
"globals": { |
||||||
|
"ts-jest": { |
||||||
|
"diagnostics": false, |
||||||
|
"isolatedModules": true |
||||||
|
} |
||||||
|
}, |
||||||
|
"verbose": false, |
||||||
|
"testEnvironment": "node", |
||||||
|
"testMatch": [ |
||||||
|
"<rootDir>/test/**/*.test.ts" |
||||||
|
] |
||||||
|
} |
||||||
|
} |
@ -0,0 +1,68 @@ |
|||||||
|
export interface MimeBuffer extends Buffer { |
||||||
|
type: string; |
||||||
|
typeFull: string; |
||||||
|
charset: string; |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Returns a `Buffer` instance from the given data URI `uri`. |
||||||
|
* |
||||||
|
* @param {String} uri Data URI to turn into a Buffer instance |
||||||
|
* @returns {Buffer} Buffer instance from Data URI |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
export function dataUriToBuffer(uri: string): MimeBuffer { |
||||||
|
if (!/^data:/i.test(uri)) { |
||||||
|
throw new TypeError( |
||||||
|
'`uri` does not appear to be a Data URI (must begin with "data:")' |
||||||
|
); |
||||||
|
} |
||||||
|
|
||||||
|
// strip newlines
|
||||||
|
uri = uri.replace(/\r?\n/g, ''); |
||||||
|
|
||||||
|
// split the URI up into the "metadata" and the "data" portions
|
||||||
|
const firstComma = uri.indexOf(','); |
||||||
|
if (firstComma === -1 || firstComma <= 4) { |
||||||
|
throw new TypeError('malformed data: URI'); |
||||||
|
} |
||||||
|
|
||||||
|
// remove the "data:" scheme and parse the metadata
|
||||||
|
const meta = uri.substring(5, firstComma).split(';'); |
||||||
|
|
||||||
|
let charset = ''; |
||||||
|
let base64 = false; |
||||||
|
const type = meta[0] || 'text/plain'; |
||||||
|
let typeFull = type; |
||||||
|
for (let i = 1; i < meta.length; i++) { |
||||||
|
if (meta[i] === 'base64') { |
||||||
|
base64 = true; |
||||||
|
} else { |
||||||
|
typeFull += `;${ meta[i]}`; |
||||||
|
if (meta[i].indexOf('charset=') === 0) { |
||||||
|
charset = meta[i].substring(8); |
||||||
|
} |
||||||
|
} |
||||||
|
} |
||||||
|
// defaults to US-ASCII only if type is not provided
|
||||||
|
if (!meta[0] && !charset.length) { |
||||||
|
typeFull += ';charset=US-ASCII'; |
||||||
|
charset = 'US-ASCII'; |
||||||
|
} |
||||||
|
|
||||||
|
// get the encoded data portion and decode URI-encoded chars
|
||||||
|
const encoding = base64 ? 'base64' : 'ascii'; |
||||||
|
const data = unescape(uri.substring(firstComma + 1)); |
||||||
|
const buffer = Buffer.from(data, encoding) as MimeBuffer; |
||||||
|
|
||||||
|
// set `.type` and `.typeFull` properties to MIME type
|
||||||
|
buffer.type = type; |
||||||
|
buffer.typeFull = typeFull; |
||||||
|
|
||||||
|
// set the `.charset` property
|
||||||
|
buffer.charset = charset; |
||||||
|
|
||||||
|
return buffer; |
||||||
|
} |
||||||
|
|
||||||
|
export default dataUriToBuffer; |
@ -0,0 +1,20 @@ |
|||||||
|
(The MIT License) |
||||||
|
|
||||||
|
Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca> |
||||||
|
Copyright (c) 2018-2021 Josh Junon |
||||||
|
|
||||||
|
Permission is hereby granted, free of charge, to any person obtaining a copy of this software |
||||||
|
and associated documentation files (the 'Software'), to deal in the Software without restriction, |
||||||
|
including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, |
||||||
|
and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, |
||||||
|
subject to the following conditions: |
||||||
|
|
||||||
|
The above copyright notice and this permission notice shall be included in all copies or substantial |
||||||
|
portions of the Software. |
||||||
|
|
||||||
|
THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT |
||||||
|
LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. |
||||||
|
IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, |
||||||
|
WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE |
||||||
|
SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. |
||||||
|
|
@ -0,0 +1,481 @@ |
|||||||
|
# debug |
||||||
|
[](https://travis-ci.org/debug-js/debug) [](https://coveralls.io/github/debug-js/debug?branch=master) [](https://visionmedia-community-slackin.now.sh/) [](#backers) |
||||||
|
[](#sponsors) |
||||||
|
|
||||||
|
<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png"> |
||||||
|
|
||||||
|
A tiny JavaScript debugging utility modelled after Node.js core's debugging |
||||||
|
technique. Works in Node.js and web browsers. |
||||||
|
|
||||||
|
## Installation |
||||||
|
|
||||||
|
```bash |
||||||
|
$ npm install debug |
||||||
|
``` |
||||||
|
|
||||||
|
## Usage |
||||||
|
|
||||||
|
`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. |
||||||
|
|
||||||
|
Example [_app.js_](./examples/node/app.js): |
||||||
|
|
||||||
|
```js |
||||||
|
var debug = require('debug')('http') |
||||||
|
, http = require('http') |
||||||
|
, name = 'My App'; |
||||||
|
|
||||||
|
// fake app |
||||||
|
|
||||||
|
debug('booting %o', name); |
||||||
|
|
||||||
|
http.createServer(function(req, res){ |
||||||
|
debug(req.method + ' ' + req.url); |
||||||
|
res.end('hello\n'); |
||||||
|
}).listen(3000, function(){ |
||||||
|
debug('listening'); |
||||||
|
}); |
||||||
|
|
||||||
|
// fake worker of some kind |
||||||
|
|
||||||
|
require('./worker'); |
||||||
|
``` |
||||||
|
|
||||||
|
Example [_worker.js_](./examples/node/worker.js): |
||||||
|
|
||||||
|
```js |
||||||
|
var a = require('debug')('worker:a') |
||||||
|
, b = require('debug')('worker:b'); |
||||||
|
|
||||||
|
function work() { |
||||||
|
a('doing lots of uninteresting work'); |
||||||
|
setTimeout(work, Math.random() * 1000); |
||||||
|
} |
||||||
|
|
||||||
|
work(); |
||||||
|
|
||||||
|
function workb() { |
||||||
|
b('doing some work'); |
||||||
|
setTimeout(workb, Math.random() * 2000); |
||||||
|
} |
||||||
|
|
||||||
|
workb(); |
||||||
|
``` |
||||||
|
|
||||||
|
The `DEBUG` environment variable is then used to enable these based on space or |
||||||
|
comma-delimited names. |
||||||
|
|
||||||
|
Here are some examples: |
||||||
|
|
||||||
|
<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png"> |
||||||
|
<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png"> |
||||||
|
<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png"> |
||||||
|
|
||||||
|
#### Windows command prompt notes |
||||||
|
|
||||||
|
##### CMD |
||||||
|
|
||||||
|
On Windows the environment variable is set using the `set` command. |
||||||
|
|
||||||
|
```cmd |
||||||
|
set DEBUG=*,-not_this |
||||||
|
``` |
||||||
|
|
||||||
|
Example: |
||||||
|
|
||||||
|
```cmd |
||||||
|
set DEBUG=* & node app.js |
||||||
|
``` |
||||||
|
|
||||||
|
##### PowerShell (VS Code default) |
||||||
|
|
||||||
|
PowerShell uses different syntax to set environment variables. |
||||||
|
|
||||||
|
```cmd |
||||||
|
$env:DEBUG = "*,-not_this" |
||||||
|
``` |
||||||
|
|
||||||
|
Example: |
||||||
|
|
||||||
|
```cmd |
||||||
|
$env:DEBUG='app';node app.js |
||||||
|
``` |
||||||
|
|
||||||
|
Then, run the program to be debugged as usual. |
||||||
|
|
||||||
|
npm script example: |
||||||
|
```js |
||||||
|
"windowsDebug": "@powershell -Command $env:DEBUG='*';node app.js", |
||||||
|
``` |
||||||
|
|
||||||
|
## Namespace Colors |
||||||
|
|
||||||
|
Every debug instance has a color generated for it based on its namespace name. |
||||||
|
This helps when visually parsing the debug output to identify which debug instance |
||||||
|
a debug line belongs to. |
||||||
|
|
||||||
|
#### Node.js |
||||||
|
|
||||||
|
In Node.js, colors are enabled when stderr is a TTY. You also _should_ install |
||||||
|
the [`supports-color`](https://npmjs.org/supports-color) module alongside debug, |
||||||
|
otherwise debug will only use a small handful of basic colors. |
||||||
|
|
||||||
|
<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png"> |
||||||
|
|
||||||
|
#### Web Browser |
||||||
|
|
||||||
|
Colors are also enabled on "Web Inspectors" that understand the `%c` formatting |
||||||
|
option. These are WebKit web inspectors, Firefox ([since version |
||||||
|
31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) |
||||||
|
and the Firebug plugin for Firefox (any version). |
||||||
|
|
||||||
|
<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png"> |
||||||
|
|
||||||
|
|
||||||
|
## Millisecond diff |
||||||
|
|
||||||
|
When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. |
||||||
|
|
||||||
|
<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png"> |
||||||
|
|
||||||
|
When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below: |
||||||
|
|
||||||
|
<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png"> |
||||||
|
|
||||||
|
|
||||||
|
## Conventions |
||||||
|
|
||||||
|
If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output. |
||||||
|
|
||||||
|
## Wildcards |
||||||
|
|
||||||
|
The `*` character may be used as a wildcard. Suppose for example your library has |
||||||
|
debuggers named "connect:bodyParser", "connect:compress", "connect:session", |
||||||
|
instead of listing all three with |
||||||
|
`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do |
||||||
|
`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. |
||||||
|
|
||||||
|
You can also exclude specific debuggers by prefixing them with a "-" character. |
||||||
|
For example, `DEBUG=*,-connect:*` would include all debuggers except those |
||||||
|
starting with "connect:". |
||||||
|
|
||||||
|
## Environment Variables |
||||||
|
|
||||||
|
When running through Node.js, you can set a few environment variables that will |
||||||
|
change the behavior of the debug logging: |
||||||
|
|
||||||
|
| Name | Purpose | |
||||||
|
|-----------|-------------------------------------------------| |
||||||
|
| `DEBUG` | Enables/disables specific debugging namespaces. | |
||||||
|
| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY). | |
||||||
|
| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | |
||||||
|
| `DEBUG_DEPTH` | Object inspection depth. | |
||||||
|
| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | |
||||||
|
|
||||||
|
|
||||||
|
__Note:__ The environment variables beginning with `DEBUG_` end up being |
||||||
|
converted into an Options object that gets used with `%o`/`%O` formatters. |
||||||
|
See the Node.js documentation for |
||||||
|
[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) |
||||||
|
for the complete list. |
||||||
|
|
||||||
|
## Formatters |
||||||
|
|
||||||
|
Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. |
||||||
|
Below are the officially supported formatters: |
||||||
|
|
||||||
|
| Formatter | Representation | |
||||||
|
|-----------|----------------| |
||||||
|
| `%O` | Pretty-print an Object on multiple lines. | |
||||||
|
| `%o` | Pretty-print an Object all on a single line. | |
||||||
|
| `%s` | String. | |
||||||
|
| `%d` | Number (both integer and float). | |
||||||
|
| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | |
||||||
|
| `%%` | Single percent sign ('%'). This does not consume an argument. | |
||||||
|
|
||||||
|
|
||||||
|
### Custom formatters |
||||||
|
|
||||||
|
You can add custom formatters by extending the `debug.formatters` object. |
||||||
|
For example, if you wanted to add support for rendering a Buffer as hex with |
||||||
|
`%h`, you could do something like: |
||||||
|
|
||||||
|
```js |
||||||
|
const createDebug = require('debug') |
||||||
|
createDebug.formatters.h = (v) => { |
||||||
|
return v.toString('hex') |
||||||
|
} |
||||||
|
|
||||||
|
// …elsewhere |
||||||
|
const debug = createDebug('foo') |
||||||
|
debug('this is hex: %h', new Buffer('hello world')) |
||||||
|
// foo this is hex: 68656c6c6f20776f726c6421 +0ms |
||||||
|
``` |
||||||
|
|
||||||
|
|
||||||
|
## Browser Support |
||||||
|
|
||||||
|
You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), |
||||||
|
or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), |
||||||
|
if you don't want to build it yourself. |
||||||
|
|
||||||
|
Debug's enable state is currently persisted by `localStorage`. |
||||||
|
Consider the situation shown below where you have `worker:a` and `worker:b`, |
||||||
|
and wish to debug both. You can enable this using `localStorage.debug`: |
||||||
|
|
||||||
|
```js |
||||||
|
localStorage.debug = 'worker:*' |
||||||
|
``` |
||||||
|
|
||||||
|
And then refresh the page. |
||||||
|
|
||||||
|
```js |
||||||
|
a = debug('worker:a'); |
||||||
|
b = debug('worker:b'); |
||||||
|
|
||||||
|
setInterval(function(){ |
||||||
|
a('doing some work'); |
||||||
|
}, 1000); |
||||||
|
|
||||||
|
setInterval(function(){ |
||||||
|
b('doing some work'); |
||||||
|
}, 1200); |
||||||
|
``` |
||||||
|
|
||||||
|
In Chromium-based web browsers (e.g. Brave, Chrome, and Electron), the JavaScript console will—by default—only show messages logged by `debug` if the "Verbose" log level is _enabled_. |
||||||
|
|
||||||
|
<img width="647" src="https://user-images.githubusercontent.com/7143133/152083257-29034707-c42c-4959-8add-3cee850e6fcf.png"> |
||||||
|
|
||||||
|
## Output streams |
||||||
|
|
||||||
|
By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: |
||||||
|
|
||||||
|
Example [_stdout.js_](./examples/node/stdout.js): |
||||||
|
|
||||||
|
```js |
||||||
|
var debug = require('debug'); |
||||||
|
var error = debug('app:error'); |
||||||
|
|
||||||
|
// by default stderr is used |
||||||
|
error('goes to stderr!'); |
||||||
|
|
||||||
|
var log = debug('app:log'); |
||||||
|
// set this namespace to log via console.log |
||||||
|
log.log = console.log.bind(console); // don't forget to bind to console! |
||||||
|
log('goes to stdout'); |
||||||
|
error('still goes to stderr!'); |
||||||
|
|
||||||
|
// set all output to go via console.info |
||||||
|
// overrides all per-namespace log settings |
||||||
|
debug.log = console.info.bind(console); |
||||||
|
error('now goes to stdout via console.info'); |
||||||
|
log('still goes to stdout, but via console.info now'); |
||||||
|
``` |
||||||
|
|
||||||
|
## Extend |
||||||
|
You can simply extend debugger |
||||||
|
```js |
||||||
|
const log = require('debug')('auth'); |
||||||
|
|
||||||
|
//creates new debug instance with extended namespace |
||||||
|
const logSign = log.extend('sign'); |
||||||
|
const logLogin = log.extend('login'); |
||||||
|
|
||||||
|
log('hello'); // auth hello |
||||||
|
logSign('hello'); //auth:sign hello |
||||||
|
logLogin('hello'); //auth:login hello |
||||||
|
``` |
||||||
|
|
||||||
|
## Set dynamically |
||||||
|
|
||||||
|
You can also enable debug dynamically by calling the `enable()` method : |
||||||
|
|
||||||
|
```js |
||||||
|
let debug = require('debug'); |
||||||
|
|
||||||
|
console.log(1, debug.enabled('test')); |
||||||
|
|
||||||
|
debug.enable('test'); |
||||||
|
console.log(2, debug.enabled('test')); |
||||||
|
|
||||||
|
debug.disable(); |
||||||
|
console.log(3, debug.enabled('test')); |
||||||
|
|
||||||
|
``` |
||||||
|
|
||||||
|
print : |
||||||
|
``` |
||||||
|
1 false |
||||||
|
2 true |
||||||
|
3 false |
||||||
|
``` |
||||||
|
|
||||||
|
Usage : |
||||||
|
`enable(namespaces)` |
||||||
|
`namespaces` can include modes separated by a colon and wildcards. |
||||||
|
|
||||||
|
Note that calling `enable()` completely overrides previously set DEBUG variable : |
||||||
|
|
||||||
|
``` |
||||||
|
$ DEBUG=foo node -e 'var dbg = require("debug"); dbg.enable("bar"); console.log(dbg.enabled("foo"))' |
||||||
|
=> false |
||||||
|
``` |
||||||
|
|
||||||
|
`disable()` |
||||||
|
|
||||||
|
Will disable all namespaces. The functions returns the namespaces currently |
||||||
|
enabled (and skipped). This can be useful if you want to disable debugging |
||||||
|
temporarily without knowing what was enabled to begin with. |
||||||
|
|
||||||
|
For example: |
||||||
|
|
||||||
|
```js |
||||||
|
let debug = require('debug'); |
||||||
|
debug.enable('foo:*,-foo:bar'); |
||||||
|
let namespaces = debug.disable(); |
||||||
|
debug.enable(namespaces); |
||||||
|
``` |
||||||
|
|
||||||
|
Note: There is no guarantee that the string will be identical to the initial |
||||||
|
enable string, but semantically they will be identical. |
||||||
|
|
||||||
|
## Checking whether a debug target is enabled |
||||||
|
|
||||||
|
After you've created a debug instance, you can determine whether or not it is |
||||||
|
enabled by checking the `enabled` property: |
||||||
|
|
||||||
|
```javascript |
||||||
|
const debug = require('debug')('http'); |
||||||
|
|
||||||
|
if (debug.enabled) { |
||||||
|
// do stuff... |
||||||
|
} |
||||||
|
``` |
||||||
|
|
||||||
|
You can also manually toggle this property to force the debug instance to be |
||||||
|
enabled or disabled. |
||||||
|
|
||||||
|
## Usage in child processes |
||||||
|
|
||||||
|
Due to the way `debug` detects if the output is a TTY or not, colors are not shown in child processes when `stderr` is piped. A solution is to pass the `DEBUG_COLORS=1` environment variable to the child process. |
||||||
|
For example: |
||||||
|
|
||||||
|
```javascript |
||||||
|
worker = fork(WORKER_WRAP_PATH, [workerPath], { |
||||||
|
stdio: [ |
||||||
|
/* stdin: */ 0, |
||||||
|
/* stdout: */ 'pipe', |
||||||
|
/* stderr: */ 'pipe', |
||||||
|
'ipc', |
||||||
|
], |
||||||
|
env: Object.assign({}, process.env, { |
||||||
|
DEBUG_COLORS: 1 // without this settings, colors won't be shown |
||||||
|
}), |
||||||
|
}); |
||||||
|
|
||||||
|
worker.stderr.pipe(process.stderr, { end: false }); |
||||||
|
``` |
||||||
|
|
||||||
|
|
||||||
|
## Authors |
||||||
|
|
||||||
|
- TJ Holowaychuk |
||||||
|
- Nathan Rajlich |
||||||
|
- Andrew Rhyne |
||||||
|
- Josh Junon |
||||||
|
|
||||||
|
## Backers |
||||||
|
|
||||||
|
Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] |
||||||
|
|
||||||
|
<a href="https://opencollective.com/debug/backer/0/website" target="_blank"><img src="https://opencollective.com/debug/backer/0/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/1/website" target="_blank"><img src="https://opencollective.com/debug/backer/1/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/2/website" target="_blank"><img src="https://opencollective.com/debug/backer/2/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/3/website" target="_blank"><img src="https://opencollective.com/debug/backer/3/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/4/website" target="_blank"><img src="https://opencollective.com/debug/backer/4/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/5/website" target="_blank"><img src="https://opencollective.com/debug/backer/5/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/6/website" target="_blank"><img src="https://opencollective.com/debug/backer/6/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/7/website" target="_blank"><img src="https://opencollective.com/debug/backer/7/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/8/website" target="_blank"><img src="https://opencollective.com/debug/backer/8/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/9/website" target="_blank"><img src="https://opencollective.com/debug/backer/9/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/10/website" target="_blank"><img src="https://opencollective.com/debug/backer/10/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/11/website" target="_blank"><img src="https://opencollective.com/debug/backer/11/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/12/website" target="_blank"><img src="https://opencollective.com/debug/backer/12/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/13/website" target="_blank"><img src="https://opencollective.com/debug/backer/13/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/14/website" target="_blank"><img src="https://opencollective.com/debug/backer/14/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/15/website" target="_blank"><img src="https://opencollective.com/debug/backer/15/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/16/website" target="_blank"><img src="https://opencollective.com/debug/backer/16/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/17/website" target="_blank"><img src="https://opencollective.com/debug/backer/17/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/18/website" target="_blank"><img src="https://opencollective.com/debug/backer/18/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/19/website" target="_blank"><img src="https://opencollective.com/debug/backer/19/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/20/website" target="_blank"><img src="https://opencollective.com/debug/backer/20/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/21/website" target="_blank"><img src="https://opencollective.com/debug/backer/21/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/22/website" target="_blank"><img src="https://opencollective.com/debug/backer/22/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/23/website" target="_blank"><img src="https://opencollective.com/debug/backer/23/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/24/website" target="_blank"><img src="https://opencollective.com/debug/backer/24/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/25/website" target="_blank"><img src="https://opencollective.com/debug/backer/25/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/26/website" target="_blank"><img src="https://opencollective.com/debug/backer/26/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/27/website" target="_blank"><img src="https://opencollective.com/debug/backer/27/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/28/website" target="_blank"><img src="https://opencollective.com/debug/backer/28/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/backer/29/website" target="_blank"><img src="https://opencollective.com/debug/backer/29/avatar.svg"></a> |
||||||
|
|
||||||
|
|
||||||
|
## Sponsors |
||||||
|
|
||||||
|
Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] |
||||||
|
|
||||||
|
<a href="https://opencollective.com/debug/sponsor/0/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/0/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/1/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/1/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/2/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/2/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/3/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/3/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/4/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/4/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/5/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/5/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/6/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/6/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/7/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/7/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/8/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/8/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/9/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/9/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/10/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/10/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/11/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/11/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/12/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/12/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/13/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/13/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/14/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/14/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/15/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/15/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/16/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/16/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/17/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/17/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/18/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/18/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/19/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/19/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/20/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/20/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/21/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/21/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/22/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/22/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/23/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/23/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/24/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/24/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/25/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/25/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/26/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/26/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/27/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/27/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/28/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/28/avatar.svg"></a> |
||||||
|
<a href="https://opencollective.com/debug/sponsor/29/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/29/avatar.svg"></a> |
||||||
|
|
||||||
|
## License |
||||||
|
|
||||||
|
(The MIT License) |
||||||
|
|
||||||
|
Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca> |
||||||
|
Copyright (c) 2018-2021 Josh Junon |
||||||
|
|
||||||
|
Permission is hereby granted, free of charge, to any person obtaining |
||||||
|
a copy of this software and associated documentation files (the |
||||||
|
'Software'), to deal in the Software without restriction, including |
||||||
|
without limitation the rights to use, copy, modify, merge, publish, |
||||||
|
distribute, sublicense, and/or sell copies of the Software, and to |
||||||
|
permit persons to whom the Software is furnished to do so, subject to |
||||||
|
the following conditions: |
||||||
|
|
||||||
|
The above copyright notice and this permission notice shall be |
||||||
|
included in all copies or substantial portions of the Software. |
||||||
|
|
||||||
|
THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, |
||||||
|
EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF |
||||||
|
MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. |
||||||
|
IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY |
||||||
|
CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, |
||||||
|
TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE |
||||||
|
SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. |
@ -0,0 +1,59 @@ |
|||||||
|
{ |
||||||
|
"name": "debug", |
||||||
|
"version": "4.3.4", |
||||||
|
"repository": { |
||||||
|
"type": "git", |
||||||
|
"url": "git://github.com/debug-js/debug.git" |
||||||
|
}, |
||||||
|
"description": "Lightweight debugging utility for Node.js and the browser", |
||||||
|
"keywords": [ |
||||||
|
"debug", |
||||||
|
"log", |
||||||
|
"debugger" |
||||||
|
], |
||||||
|
"files": [ |
||||||
|
"src", |
||||||
|
"LICENSE", |
||||||
|
"README.md" |
||||||
|
], |
||||||
|
"author": "Josh Junon <josh.junon@protonmail.com>", |
||||||
|
"contributors": [ |
||||||
|
"TJ Holowaychuk <tj@vision-media.ca>", |
||||||
|
"Nathan Rajlich <nathan@tootallnate.net> (http://n8.io)", |
||||||
|
"Andrew Rhyne <rhyneandrew@gmail.com>" |
||||||
|
], |
||||||
|
"license": "MIT", |
||||||
|
"scripts": { |
||||||
|
"lint": "xo", |
||||||
|
"test": "npm run test:node && npm run test:browser && npm run lint", |
||||||
|
"test:node": "istanbul cover _mocha -- test.js", |
||||||
|
"test:browser": "karma start --single-run", |
||||||
|
"test:coverage": "cat ./coverage/lcov.info | coveralls" |
||||||
|
}, |
||||||
|
"dependencies": { |
||||||
|
"ms": "2.1.2" |
||||||
|
}, |
||||||
|
"devDependencies": { |
||||||
|
"brfs": "^2.0.1", |
||||||
|
"browserify": "^16.2.3", |
||||||
|
"coveralls": "^3.0.2", |
||||||
|
"istanbul": "^0.4.5", |
||||||
|
"karma": "^3.1.4", |
||||||
|
"karma-browserify": "^6.0.0", |
||||||
|
"karma-chrome-launcher": "^2.2.0", |
||||||
|
"karma-mocha": "^1.3.0", |
||||||
|
"mocha": "^5.2.0", |
||||||
|
"mocha-lcov-reporter": "^1.2.0", |
||||||
|
"xo": "^0.23.0" |
||||||
|
}, |
||||||
|
"peerDependenciesMeta": { |
||||||
|
"supports-color": { |
||||||
|
"optional": true |
||||||
|
} |
||||||
|
}, |
||||||
|
"main": "./src/index.js", |
||||||
|
"browser": "./src/browser.js", |
||||||
|
"engines": { |
||||||
|
"node": ">=6.0" |
||||||
|
} |
||||||
|
} |
@ -0,0 +1,269 @@ |
|||||||
|
/* eslint-env browser */ |
||||||
|
|
||||||
|
/** |
||||||
|
* This is the web browser implementation of `debug()`. |
||||||
|
*/ |
||||||
|
|
||||||
|
exports.formatArgs = formatArgs; |
||||||
|
exports.save = save; |
||||||
|
exports.load = load; |
||||||
|
exports.useColors = useColors; |
||||||
|
exports.storage = localstorage(); |
||||||
|
exports.destroy = (() => { |
||||||
|
let warned = false; |
||||||
|
|
||||||
|
return () => { |
||||||
|
if (!warned) { |
||||||
|
warned = true; |
||||||
|
console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.'); |
||||||
|
} |
||||||
|
}; |
||||||
|
})(); |
||||||
|
|
||||||
|
/** |
||||||
|
* Colors. |
||||||
|
*/ |
||||||
|
|
||||||
|
exports.colors = [ |
||||||
|
'#0000CC', |
||||||
|
'#0000FF', |
||||||
|
'#0033CC', |
||||||
|
'#0033FF', |
||||||
|
'#0066CC', |
||||||
|
'#0066FF', |
||||||
|
'#0099CC', |
||||||
|
'#0099FF', |
||||||
|
'#00CC00', |
||||||
|
'#00CC33', |
||||||
|
'#00CC66', |
||||||
|
'#00CC99', |
||||||
|
'#00CCCC', |
||||||
|
'#00CCFF', |
||||||
|
'#3300CC', |
||||||
|
'#3300FF', |
||||||
|
'#3333CC', |
||||||
|
'#3333FF', |
||||||
|
'#3366CC', |
||||||
|
'#3366FF', |
||||||
|
'#3399CC', |
||||||
|
'#3399FF', |
||||||
|
'#33CC00', |
||||||
|
'#33CC33', |
||||||
|
'#33CC66', |
||||||
|
'#33CC99', |
||||||
|
'#33CCCC', |
||||||
|
'#33CCFF', |
||||||
|
'#6600CC', |
||||||
|
'#6600FF', |
||||||
|
'#6633CC', |
||||||
|
'#6633FF', |
||||||
|
'#66CC00', |
||||||
|
'#66CC33', |
||||||
|
'#9900CC', |
||||||
|
'#9900FF', |
||||||
|
'#9933CC', |
||||||
|
'#9933FF', |
||||||
|
'#99CC00', |
||||||
|
'#99CC33', |
||||||
|
'#CC0000', |
||||||
|
'#CC0033', |
||||||
|
'#CC0066', |
||||||
|
'#CC0099', |
||||||
|
'#CC00CC', |
||||||
|
'#CC00FF', |
||||||
|
'#CC3300', |
||||||
|
'#CC3333', |
||||||
|
'#CC3366', |
||||||
|
'#CC3399', |
||||||
|
'#CC33CC', |
||||||
|
'#CC33FF', |
||||||
|
'#CC6600', |
||||||
|
'#CC6633', |
||||||
|
'#CC9900', |
||||||
|
'#CC9933', |
||||||
|
'#CCCC00', |
||||||
|
'#CCCC33', |
||||||
|
'#FF0000', |
||||||
|
'#FF0033', |
||||||
|
'#FF0066', |
||||||
|
'#FF0099', |
||||||
|
'#FF00CC', |
||||||
|
'#FF00FF', |
||||||
|
'#FF3300', |
||||||
|
'#FF3333', |
||||||
|
'#FF3366', |
||||||
|
'#FF3399', |
||||||
|
'#FF33CC', |
||||||
|
'#FF33FF', |
||||||
|
'#FF6600', |
||||||
|
'#FF6633', |
||||||
|
'#FF9900', |
||||||
|
'#FF9933', |
||||||
|
'#FFCC00', |
||||||
|
'#FFCC33' |
||||||
|
]; |
||||||
|
|
||||||
|
/** |
||||||
|
* Currently only WebKit-based Web Inspectors, Firefox >= v31, |
||||||
|
* and the Firebug extension (any Firefox version) are known |
||||||
|
* to support "%c" CSS customizations. |
||||||
|
* |
||||||
|
* TODO: add a `localStorage` variable to explicitly enable/disable colors |
||||||
|
*/ |
||||||
|
|
||||||
|
// eslint-disable-next-line complexity
|
||||||
|
function useColors() { |
||||||
|
// NB: In an Electron preload script, document will be defined but not fully
|
||||||
|
// initialized. Since we know we're in Chrome, we'll just detect this case
|
||||||
|
// explicitly
|
||||||
|
if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) { |
||||||
|
return true; |
||||||
|
} |
||||||
|
|
||||||
|
// Internet Explorer and Edge do not support colors.
|
||||||
|
if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) { |
||||||
|
return false; |
||||||
|
} |
||||||
|
|
||||||
|
// Is webkit? http://stackoverflow.com/a/16459606/376773
|
||||||
|
// document is undefined in react-native: https://github.com/facebook/react-native/pull/1632
|
||||||
|
return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || |
||||||
|
// Is firebug? http://stackoverflow.com/a/398120/376773
|
||||||
|
(typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || |
||||||
|
// Is firefox >= v31?
|
||||||
|
// https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
|
||||||
|
(typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || |
||||||
|
// Double check webkit in userAgent just in case we are in a worker
|
||||||
|
(typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Colorize log arguments if enabled. |
||||||
|
* |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
|
||||||
|
function formatArgs(args) { |
||||||
|
args[0] = (this.useColors ? '%c' : '') + |
||||||
|
this.namespace + |
||||||
|
(this.useColors ? ' %c' : ' ') + |
||||||
|
args[0] + |
||||||
|
(this.useColors ? '%c ' : ' ') + |
||||||
|
'+' + module.exports.humanize(this.diff); |
||||||
|
|
||||||
|
if (!this.useColors) { |
||||||
|
return; |
||||||
|
} |
||||||
|
|
||||||
|
const c = 'color: ' + this.color; |
||||||
|
args.splice(1, 0, c, 'color: inherit'); |
||||||
|
|
||||||
|
// The final "%c" is somewhat tricky, because there could be other
|
||||||
|
// arguments passed either before or after the %c, so we need to
|
||||||
|
// figure out the correct index to insert the CSS into
|
||||||
|
let index = 0; |
||||||
|
let lastC = 0; |
||||||
|
args[0].replace(/%[a-zA-Z%]/g, match => { |
||||||
|
if (match === '%%') { |
||||||
|
return; |
||||||
|
} |
||||||
|
index++; |
||||||
|
if (match === '%c') { |
||||||
|
// We only are interested in the *last* %c
|
||||||
|
// (the user may have provided their own)
|
||||||
|
lastC = index; |
||||||
|
} |
||||||
|
}); |
||||||
|
|
||||||
|
args.splice(lastC, 0, c); |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Invokes `console.debug()` when available. |
||||||
|
* No-op when `console.debug` is not a "function". |
||||||
|
* If `console.debug` is not available, falls back |
||||||
|
* to `console.log`. |
||||||
|
* |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
exports.log = console.debug || console.log || (() => {}); |
||||||
|
|
||||||
|
/** |
||||||
|
* Save `namespaces`. |
||||||
|
* |
||||||
|
* @param {String} namespaces |
||||||
|
* @api private |
||||||
|
*/ |
||||||
|
function save(namespaces) { |
||||||
|
try { |
||||||
|
if (namespaces) { |
||||||
|
exports.storage.setItem('debug', namespaces); |
||||||
|
} else { |
||||||
|
exports.storage.removeItem('debug'); |
||||||
|
} |
||||||
|
} catch (error) { |
||||||
|
// Swallow
|
||||||
|
// XXX (@Qix-) should we be logging these?
|
||||||
|
} |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Load `namespaces`. |
||||||
|
* |
||||||
|
* @return {String} returns the previously persisted debug modes |
||||||
|
* @api private |
||||||
|
*/ |
||||||
|
function load() { |
||||||
|
let r; |
||||||
|
try { |
||||||
|
r = exports.storage.getItem('debug'); |
||||||
|
} catch (error) { |
||||||
|
// Swallow
|
||||||
|
// XXX (@Qix-) should we be logging these?
|
||||||
|
} |
||||||
|
|
||||||
|
// If debug isn't set in LS, and we're in Electron, try to load $DEBUG
|
||||||
|
if (!r && typeof process !== 'undefined' && 'env' in process) { |
||||||
|
r = process.env.DEBUG; |
||||||
|
} |
||||||
|
|
||||||
|
return r; |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Localstorage attempts to return the localstorage. |
||||||
|
* |
||||||
|
* This is necessary because safari throws |
||||||
|
* when a user disables cookies/localstorage |
||||||
|
* and you attempt to access it. |
||||||
|
* |
||||||
|
* @return {LocalStorage} |
||||||
|
* @api private |
||||||
|
*/ |
||||||
|
|
||||||
|
function localstorage() { |
||||||
|
try { |
||||||
|
// TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context
|
||||||
|
// The Browser also has localStorage in the global context.
|
||||||
|
return localStorage; |
||||||
|
} catch (error) { |
||||||
|
// Swallow
|
||||||
|
// XXX (@Qix-) should we be logging these?
|
||||||
|
} |
||||||
|
} |
||||||
|
|
||||||
|
module.exports = require('./common')(exports); |
||||||
|
|
||||||
|
const {formatters} = module.exports; |
||||||
|
|
||||||
|
/** |
||||||
|
* Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. |
||||||
|
*/ |
||||||
|
|
||||||
|
formatters.j = function (v) { |
||||||
|
try { |
||||||
|
return JSON.stringify(v); |
||||||
|
} catch (error) { |
||||||
|
return '[UnexpectedJSONParseError]: ' + error.message; |
||||||
|
} |
||||||
|
}; |
@ -0,0 +1,274 @@ |
|||||||
|
|
||||||
|
/** |
||||||
|
* This is the common logic for both the Node.js and web browser |
||||||
|
* implementations of `debug()`. |
||||||
|
*/ |
||||||
|
|
||||||
|
function setup(env) { |
||||||
|
createDebug.debug = createDebug; |
||||||
|
createDebug.default = createDebug; |
||||||
|
createDebug.coerce = coerce; |
||||||
|
createDebug.disable = disable; |
||||||
|
createDebug.enable = enable; |
||||||
|
createDebug.enabled = enabled; |
||||||
|
createDebug.humanize = require('ms'); |
||||||
|
createDebug.destroy = destroy; |
||||||
|
|
||||||
|
Object.keys(env).forEach(key => { |
||||||
|
createDebug[key] = env[key]; |
||||||
|
}); |
||||||
|
|
||||||
|
/** |
||||||
|
* The currently active debug mode names, and names to skip. |
||||||
|
*/ |
||||||
|
|
||||||
|
createDebug.names = []; |
||||||
|
createDebug.skips = []; |
||||||
|
|
||||||
|
/** |
||||||
|
* Map of special "%n" handling functions, for the debug "format" argument. |
||||||
|
* |
||||||
|
* Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". |
||||||
|
*/ |
||||||
|
createDebug.formatters = {}; |
||||||
|
|
||||||
|
/** |
||||||
|
* Selects a color for a debug namespace |
||||||
|
* @param {String} namespace The namespace string for the debug instance to be colored |
||||||
|
* @return {Number|String} An ANSI color code for the given namespace |
||||||
|
* @api private |
||||||
|
*/ |
||||||
|
function selectColor(namespace) { |
||||||
|
let hash = 0; |
||||||
|
|
||||||
|
for (let i = 0; i < namespace.length; i++) { |
||||||
|
hash = ((hash << 5) - hash) + namespace.charCodeAt(i); |
||||||
|
hash |= 0; // Convert to 32bit integer
|
||||||
|
} |
||||||
|
|
||||||
|
return createDebug.colors[Math.abs(hash) % createDebug.colors.length]; |
||||||
|
} |
||||||
|
createDebug.selectColor = selectColor; |
||||||
|
|
||||||
|
/** |
||||||
|
* Create a debugger with the given `namespace`. |
||||||
|
* |
||||||
|
* @param {String} namespace |
||||||
|
* @return {Function} |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
function createDebug(namespace) { |
||||||
|
let prevTime; |
||||||
|
let enableOverride = null; |
||||||
|
let namespacesCache; |
||||||
|
let enabledCache; |
||||||
|
|
||||||
|
function debug(...args) { |
||||||
|
// Disabled?
|
||||||
|
if (!debug.enabled) { |
||||||
|
return; |
||||||
|
} |
||||||
|
|
||||||
|
const self = debug; |
||||||
|
|
||||||
|
// Set `diff` timestamp
|
||||||
|
const curr = Number(new Date()); |
||||||
|
const ms = curr - (prevTime || curr); |
||||||
|
self.diff = ms; |
||||||
|
self.prev = prevTime; |
||||||
|
self.curr = curr; |
||||||
|
prevTime = curr; |
||||||
|
|
||||||
|
args[0] = createDebug.coerce(args[0]); |
||||||
|
|
||||||
|
if (typeof args[0] !== 'string') { |
||||||
|
// Anything else let's inspect with %O
|
||||||
|
args.unshift('%O'); |
||||||
|
} |
||||||
|
|
||||||
|
// Apply any `formatters` transformations
|
||||||
|
let index = 0; |
||||||
|
args[0] = args[0].replace(/%([a-zA-Z%])/g, (match, format) => { |
||||||
|
// If we encounter an escaped % then don't increase the array index
|
||||||
|
if (match === '%%') { |
||||||
|
return '%'; |
||||||
|
} |
||||||
|
index++; |
||||||
|
const formatter = createDebug.formatters[format]; |
||||||
|
if (typeof formatter === 'function') { |
||||||
|
const val = args[index]; |
||||||
|
match = formatter.call(self, val); |
||||||
|
|
||||||
|
// Now we need to remove `args[index]` since it's inlined in the `format`
|
||||||
|
args.splice(index, 1); |
||||||
|
index--; |
||||||
|
} |
||||||
|
return match; |
||||||
|
}); |
||||||
|
|
||||||
|
// Apply env-specific formatting (colors, etc.)
|
||||||
|
createDebug.formatArgs.call(self, args); |
||||||
|
|
||||||
|
const logFn = self.log || createDebug.log; |
||||||
|
logFn.apply(self, args); |
||||||
|
} |
||||||
|
|
||||||
|
debug.namespace = namespace; |
||||||
|
debug.useColors = createDebug.useColors(); |
||||||
|
debug.color = createDebug.selectColor(namespace); |
||||||
|
debug.extend = extend; |
||||||
|
debug.destroy = createDebug.destroy; // XXX Temporary. Will be removed in the next major release.
|
||||||
|
|
||||||
|
Object.defineProperty(debug, 'enabled', { |
||||||
|
enumerable: true, |
||||||
|
configurable: false, |
||||||
|
get: () => { |
||||||
|
if (enableOverride !== null) { |
||||||
|
return enableOverride; |
||||||
|
} |
||||||
|
if (namespacesCache !== createDebug.namespaces) { |
||||||
|
namespacesCache = createDebug.namespaces; |
||||||
|
enabledCache = createDebug.enabled(namespace); |
||||||
|
} |
||||||
|
|
||||||
|
return enabledCache; |
||||||
|
}, |
||||||
|
set: v => { |
||||||
|
enableOverride = v; |
||||||
|
} |
||||||
|
}); |
||||||
|
|
||||||
|
// Env-specific initialization logic for debug instances
|
||||||
|
if (typeof createDebug.init === 'function') { |
||||||
|
createDebug.init(debug); |
||||||
|
} |
||||||
|
|
||||||
|
return debug; |
||||||
|
} |
||||||
|
|
||||||
|
function extend(namespace, delimiter) { |
||||||
|
const newDebug = createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace); |
||||||
|
newDebug.log = this.log; |
||||||
|
return newDebug; |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Enables a debug mode by namespaces. This can include modes |
||||||
|
* separated by a colon and wildcards. |
||||||
|
* |
||||||
|
* @param {String} namespaces |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
function enable(namespaces) { |
||||||
|
createDebug.save(namespaces); |
||||||
|
createDebug.namespaces = namespaces; |
||||||
|
|
||||||
|
createDebug.names = []; |
||||||
|
createDebug.skips = []; |
||||||
|
|
||||||
|
let i; |
||||||
|
const split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); |
||||||
|
const len = split.length; |
||||||
|
|
||||||
|
for (i = 0; i < len; i++) { |
||||||
|
if (!split[i]) { |
||||||
|
// ignore empty strings
|
||||||
|
continue; |
||||||
|
} |
||||||
|
|
||||||
|
namespaces = split[i].replace(/\*/g, '.*?'); |
||||||
|
|
||||||
|
if (namespaces[0] === '-') { |
||||||
|
createDebug.skips.push(new RegExp('^' + namespaces.slice(1) + '$')); |
||||||
|
} else { |
||||||
|
createDebug.names.push(new RegExp('^' + namespaces + '$')); |
||||||
|
} |
||||||
|
} |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Disable debug output. |
||||||
|
* |
||||||
|
* @return {String} namespaces |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
function disable() { |
||||||
|
const namespaces = [ |
||||||
|
...createDebug.names.map(toNamespace), |
||||||
|
...createDebug.skips.map(toNamespace).map(namespace => '-' + namespace) |
||||||
|
].join(','); |
||||||
|
createDebug.enable(''); |
||||||
|
return namespaces; |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Returns true if the given mode name is enabled, false otherwise. |
||||||
|
* |
||||||
|
* @param {String} name |
||||||
|
* @return {Boolean} |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
function enabled(name) { |
||||||
|
if (name[name.length - 1] === '*') { |
||||||
|
return true; |
||||||
|
} |
||||||
|
|
||||||
|
let i; |
||||||
|
let len; |
||||||
|
|
||||||
|
for (i = 0, len = createDebug.skips.length; i < len; i++) { |
||||||
|
if (createDebug.skips[i].test(name)) { |
||||||
|
return false; |
||||||
|
} |
||||||
|
} |
||||||
|
|
||||||
|
for (i = 0, len = createDebug.names.length; i < len; i++) { |
||||||
|
if (createDebug.names[i].test(name)) { |
||||||
|
return true; |
||||||
|
} |
||||||
|
} |
||||||
|
|
||||||
|
return false; |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Convert regexp to namespace |
||||||
|
* |
||||||
|
* @param {RegExp} regxep |
||||||
|
* @return {String} namespace |
||||||
|
* @api private |
||||||
|
*/ |
||||||
|
function toNamespace(regexp) { |
||||||
|
return regexp.toString() |
||||||
|
.substring(2, regexp.toString().length - 2) |
||||||
|
.replace(/\.\*\?$/, '*'); |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Coerce `val`. |
||||||
|
* |
||||||
|
* @param {Mixed} val |
||||||
|
* @return {Mixed} |
||||||
|
* @api private |
||||||
|
*/ |
||||||
|
function coerce(val) { |
||||||
|
if (val instanceof Error) { |
||||||
|
return val.stack || val.message; |
||||||
|
} |
||||||
|
return val; |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* XXX DO NOT USE. This is a temporary stub function. |
||||||
|
* XXX It WILL be removed in the next major release. |
||||||
|
*/ |
||||||
|
function destroy() { |
||||||
|
console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.'); |
||||||
|
} |
||||||
|
|
||||||
|
createDebug.enable(createDebug.load()); |
||||||
|
|
||||||
|
return createDebug; |
||||||
|
} |
||||||
|
|
||||||
|
module.exports = setup; |
@ -0,0 +1,10 @@ |
|||||||
|
/** |
||||||
|
* Detect Electron renderer / nwjs process, which is node, but we should |
||||||
|
* treat as a browser. |
||||||
|
*/ |
||||||
|
|
||||||
|
if (typeof process === 'undefined' || process.type === 'renderer' || process.browser === true || process.__nwjs) { |
||||||
|
module.exports = require('./browser.js'); |
||||||
|
} else { |
||||||
|
module.exports = require('./node.js'); |
||||||
|
} |
@ -0,0 +1,263 @@ |
|||||||
|
/** |
||||||
|
* Module dependencies. |
||||||
|
*/ |
||||||
|
|
||||||
|
const tty = require('tty'); |
||||||
|
const util = require('util'); |
||||||
|
|
||||||
|
/** |
||||||
|
* This is the Node.js implementation of `debug()`. |
||||||
|
*/ |
||||||
|
|
||||||
|
exports.init = init; |
||||||
|
exports.log = log; |
||||||
|
exports.formatArgs = formatArgs; |
||||||
|
exports.save = save; |
||||||
|
exports.load = load; |
||||||
|
exports.useColors = useColors; |
||||||
|
exports.destroy = util.deprecate( |
||||||
|
() => {}, |
||||||
|
'Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.' |
||||||
|
); |
||||||
|
|
||||||
|
/** |
||||||
|
* Colors. |
||||||
|
*/ |
||||||
|
|
||||||
|
exports.colors = [6, 2, 3, 4, 5, 1]; |
||||||
|
|
||||||
|
try { |
||||||
|
// Optional dependency (as in, doesn't need to be installed, NOT like optionalDependencies in package.json)
|
||||||
|
// eslint-disable-next-line import/no-extraneous-dependencies
|
||||||
|
const supportsColor = require('supports-color'); |
||||||
|
|
||||||
|
if (supportsColor && (supportsColor.stderr || supportsColor).level >= 2) { |
||||||
|
exports.colors = [ |
||||||
|
20, |
||||||
|
21, |
||||||
|
26, |
||||||
|
27, |
||||||
|
32, |
||||||
|
33, |
||||||
|
38, |
||||||
|
39, |
||||||
|
40, |
||||||
|
41, |
||||||
|
42, |
||||||
|
43, |
||||||
|
44, |
||||||
|
45, |
||||||
|
56, |
||||||
|
57, |
||||||
|
62, |
||||||
|
63, |
||||||
|
68, |
||||||
|
69, |
||||||
|
74, |
||||||
|
75, |
||||||
|
76, |
||||||
|
77, |
||||||
|
78, |
||||||
|
79, |
||||||
|
80, |
||||||
|
81, |
||||||
|
92, |
||||||
|
93, |
||||||
|
98, |
||||||
|
99, |
||||||
|
112, |
||||||
|
113, |
||||||
|
128, |
||||||
|
129, |
||||||
|
134, |
||||||
|
135, |
||||||
|
148, |
||||||
|
149, |
||||||
|
160, |
||||||
|
161, |
||||||
|
162, |
||||||
|
163, |
||||||
|
164, |
||||||
|
165, |
||||||
|
166, |
||||||
|
167, |
||||||
|
168, |
||||||
|
169, |
||||||
|
170, |
||||||
|
171, |
||||||
|
172, |
||||||
|
173, |
||||||
|
178, |
||||||
|
179, |
||||||
|
184, |
||||||
|
185, |
||||||
|
196, |
||||||
|
197, |
||||||
|
198, |
||||||
|
199, |
||||||
|
200, |
||||||
|
201, |
||||||
|
202, |
||||||
|
203, |
||||||
|
204, |
||||||
|
205, |
||||||
|
206, |
||||||
|
207, |
||||||
|
208, |
||||||
|
209, |
||||||
|
214, |
||||||
|
215, |
||||||
|
220, |
||||||
|
221 |
||||||
|
]; |
||||||
|
} |
||||||
|
} catch (error) { |
||||||
|
// Swallow - we only care if `supports-color` is available; it doesn't have to be.
|
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Build up the default `inspectOpts` object from the environment variables. |
||||||
|
* |
||||||
|
* $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js |
||||||
|
*/ |
||||||
|
|
||||||
|
exports.inspectOpts = Object.keys(process.env).filter(key => { |
||||||
|
return /^debug_/i.test(key); |
||||||
|
}).reduce((obj, key) => { |
||||||
|
// Camel-case
|
||||||
|
const prop = key |
||||||
|
.substring(6) |
||||||
|
.toLowerCase() |
||||||
|
.replace(/_([a-z])/g, (_, k) => { |
||||||
|
return k.toUpperCase(); |
||||||
|
}); |
||||||
|
|
||||||
|
// Coerce string value into JS value
|
||||||
|
let val = process.env[key]; |
||||||
|
if (/^(yes|on|true|enabled)$/i.test(val)) { |
||||||
|
val = true; |
||||||
|
} else if (/^(no|off|false|disabled)$/i.test(val)) { |
||||||
|
val = false; |
||||||
|
} else if (val === 'null') { |
||||||
|
val = null; |
||||||
|
} else { |
||||||
|
val = Number(val); |
||||||
|
} |
||||||
|
|
||||||
|
obj[prop] = val; |
||||||
|
return obj; |
||||||
|
}, {}); |
||||||
|
|
||||||
|
/** |
||||||
|
* Is stdout a TTY? Colored output is enabled when `true`. |
||||||
|
*/ |
||||||
|
|
||||||
|
function useColors() { |
||||||
|
return 'colors' in exports.inspectOpts ? |
||||||
|
Boolean(exports.inspectOpts.colors) : |
||||||
|
tty.isatty(process.stderr.fd); |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Adds ANSI color escape codes if enabled. |
||||||
|
* |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
|
||||||
|
function formatArgs(args) { |
||||||
|
const {namespace: name, useColors} = this; |
||||||
|
|
||||||
|
if (useColors) { |
||||||
|
const c = this.color; |
||||||
|
const colorCode = '\u001B[3' + (c < 8 ? c : '8;5;' + c); |
||||||
|
const prefix = ` ${colorCode};1m${name} \u001B[0m`; |
||||||
|
|
||||||
|
args[0] = prefix + args[0].split('\n').join('\n' + prefix); |
||||||
|
args.push(colorCode + 'm+' + module.exports.humanize(this.diff) + '\u001B[0m'); |
||||||
|
} else { |
||||||
|
args[0] = getDate() + name + ' ' + args[0]; |
||||||
|
} |
||||||
|
} |
||||||
|
|
||||||
|
function getDate() { |
||||||
|
if (exports.inspectOpts.hideDate) { |
||||||
|
return ''; |
||||||
|
} |
||||||
|
return new Date().toISOString() + ' '; |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Invokes `util.format()` with the specified arguments and writes to stderr. |
||||||
|
*/ |
||||||
|
|
||||||
|
function log(...args) { |
||||||
|
return process.stderr.write(util.format(...args) + '\n'); |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Save `namespaces`. |
||||||
|
* |
||||||
|
* @param {String} namespaces |
||||||
|
* @api private |
||||||
|
*/ |
||||||
|
function save(namespaces) { |
||||||
|
if (namespaces) { |
||||||
|
process.env.DEBUG = namespaces; |
||||||
|
} else { |
||||||
|
// If you set a process.env field to null or undefined, it gets cast to the
|
||||||
|
// string 'null' or 'undefined'. Just delete instead.
|
||||||
|
delete process.env.DEBUG; |
||||||
|
} |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Load `namespaces`. |
||||||
|
* |
||||||
|
* @return {String} returns the previously persisted debug modes |
||||||
|
* @api private |
||||||
|
*/ |
||||||
|
|
||||||
|
function load() { |
||||||
|
return process.env.DEBUG; |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Init logic for `debug` instances. |
||||||
|
* |
||||||
|
* Create a new `inspectOpts` object in case `useColors` is set |
||||||
|
* differently for a particular `debug` instance. |
||||||
|
*/ |
||||||
|
|
||||||
|
function init(debug) { |
||||||
|
debug.inspectOpts = {}; |
||||||
|
|
||||||
|
const keys = Object.keys(exports.inspectOpts); |
||||||
|
for (let i = 0; i < keys.length; i++) { |
||||||
|
debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; |
||||||
|
} |
||||||
|
} |
||||||
|
|
||||||
|
module.exports = require('./common')(exports); |
||||||
|
|
||||||
|
const {formatters} = module.exports; |
||||||
|
|
||||||
|
/** |
||||||
|
* Map %o to `util.inspect()`, all on a single line. |
||||||
|
*/ |
||||||
|
|
||||||
|
formatters.o = function (v) { |
||||||
|
this.inspectOpts.colors = this.useColors; |
||||||
|
return util.inspect(v, this.inspectOpts) |
||||||
|
.split('\n') |
||||||
|
.map(str => str.trim()) |
||||||
|
.join(' '); |
||||||
|
}; |
||||||
|
|
||||||
|
/** |
||||||
|
* Map %O to `util.inspect()`, allowing multiple lines if needed. |
||||||
|
*/ |
||||||
|
|
||||||
|
formatters.O = function (v) { |
||||||
|
this.inspectOpts.colors = this.useColors; |
||||||
|
return util.inspect(v, this.inspectOpts); |
||||||
|
}; |
@ -0,0 +1,356 @@ |
|||||||
|
# Changelog |
||||||
|
|
||||||
|
All notable changes to this project will be documented in this file. See [standard-version](https://github.com/conventional-changelog/standard-version) for commit guidelines. |
||||||
|
|
||||||
|
## [Unreleased](https://github.com/motdotla/dotenv/compare/v16.0.1...master) |
||||||
|
|
||||||
|
## [16.0.1](https://github.com/motdotla/dotenv/compare/v16.0.0...v16.0.1) (2022-05-10) |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
- Minor README clarifications |
||||||
|
- Development ONLY: updated devDependencies as recommended for development only security risks ([#658](https://github.com/motdotla/dotenv/pull/658)) |
||||||
|
|
||||||
|
## [16.0.0](https://github.com/motdotla/dotenv/compare/v15.0.1...v16.0.0) (2022-02-02) |
||||||
|
|
||||||
|
### Added |
||||||
|
|
||||||
|
- _Breaking:_ Backtick support 🎉 ([#615](https://github.com/motdotla/dotenv/pull/615)) |
||||||
|
|
||||||
|
If you had values containing the backtick character, please quote those values with either single or double quotes. |
||||||
|
|
||||||
|
## [15.0.1](https://github.com/motdotla/dotenv/compare/v15.0.0...v15.0.1) (2022-02-02) |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
- Properly parse empty single or double quoted values 🐞 ([#614](https://github.com/motdotla/dotenv/pull/614)) |
||||||
|
|
||||||
|
## [15.0.0](https://github.com/motdotla/dotenv/compare/v14.3.2...v15.0.0) (2022-01-31) |
||||||
|
|
||||||
|
`v15.0.0` is a major new release with some important breaking changes. |
||||||
|
|
||||||
|
### Added |
||||||
|
|
||||||
|
- _Breaking:_ Multiline parsing support (just works. no need for the flag.) |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
- _Breaking:_ `#` marks the beginning of a comment (UNLESS the value is wrapped in quotes. Please update your `.env` files to wrap in quotes any values containing `#`. For example: `SECRET_HASH="something-with-a-#-hash"`). |
||||||
|
|
||||||
|
..Understandably, (as some teams have noted) this is tedious to do across the entire team. To make it less tedious, we recommend using [dotenv cli](https://github.com/dotenv-org/cli) going forward. It's an optional plugin that will keep your `.env` files in sync between machines, environments, or team members. |
||||||
|
|
||||||
|
### Removed |
||||||
|
|
||||||
|
- _Breaking:_ Remove multiline option (just works out of the box now. no need for the flag.) |
||||||
|
|
||||||
|
## [14.3.2](https://github.com/motdotla/dotenv/compare/v14.3.1...v14.3.2) (2022-01-25) |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
- Preserve backwards compatibility on values containing `#` 🐞 ([#603](https://github.com/motdotla/dotenv/pull/603)) |
||||||
|
|
||||||
|
## [14.3.1](https://github.com/motdotla/dotenv/compare/v14.3.0...v14.3.1) (2022-01-25) |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
- Preserve backwards compatibility on exports by re-introducing the prior in-place exports 🐞 ([#606](https://github.com/motdotla/dotenv/pull/606)) |
||||||
|
|
||||||
|
## [14.3.0](https://github.com/motdotla/dotenv/compare/v14.2.0...v14.3.0) (2022-01-24) |
||||||
|
|
||||||
|
### Added |
||||||
|
|
||||||
|
- Add `multiline` option 🎉 ([#486](https://github.com/motdotla/dotenv/pull/486)) |
||||||
|
|
||||||
|
## [14.2.0](https://github.com/motdotla/dotenv/compare/v14.1.1...v14.2.0) (2022-01-17) |
||||||
|
|
||||||
|
### Added |
||||||
|
|
||||||
|
- Add `dotenv_config_override` cli option |
||||||
|
- Add `DOTENV_CONFIG_OVERRIDE` command line env option |
||||||
|
|
||||||
|
## [14.1.1](https://github.com/motdotla/dotenv/compare/v14.1.0...v14.1.1) (2022-01-17) |
||||||
|
|
||||||
|
### Added |
||||||
|
|
||||||
|
- Add React gotcha to FAQ on README |
||||||
|
|
||||||
|
## [14.1.0](https://github.com/motdotla/dotenv/compare/v14.0.1...v14.1.0) (2022-01-17) |
||||||
|
|
||||||
|
### Added |
||||||
|
|
||||||
|
- Add `override` option 🎉 ([#595](https://github.com/motdotla/dotenv/pull/595)) |
||||||
|
|
||||||
|
## [14.0.1](https://github.com/motdotla/dotenv/compare/v14.0.0...v14.0.1) (2022-01-16) |
||||||
|
|
||||||
|
### Added |
||||||
|
|
||||||
|
- Log error on failure to load `.env` file ([#594](https://github.com/motdotla/dotenv/pull/594)) |
||||||
|
|
||||||
|
## [14.0.0](https://github.com/motdotla/dotenv/compare/v13.0.1...v14.0.0) (2022-01-16) |
||||||
|
|
||||||
|
### Added |
||||||
|
|
||||||
|
- _Breaking:_ Support inline comments for the parser 🎉 ([#568](https://github.com/motdotla/dotenv/pull/568)) |
||||||
|
|
||||||
|
## [13.0.1](https://github.com/motdotla/dotenv/compare/v13.0.0...v13.0.1) (2022-01-16) |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
* Hide comments and newlines from debug output ([#404](https://github.com/motdotla/dotenv/pull/404)) |
||||||
|
|
||||||
|
## [13.0.0](https://github.com/motdotla/dotenv/compare/v12.0.4...v13.0.0) (2022-01-16) |
||||||
|
|
||||||
|
### Added |
||||||
|
|
||||||
|
* _Breaking:_ Add type file for `config.js` ([#539](https://github.com/motdotla/dotenv/pull/539)) |
||||||
|
|
||||||
|
## [12.0.4](https://github.com/motdotla/dotenv/compare/v12.0.3...v12.0.4) (2022-01-16) |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
* README updates |
||||||
|
* Minor order adjustment to package json format |
||||||
|
|
||||||
|
## [12.0.3](https://github.com/motdotla/dotenv/compare/v12.0.2...v12.0.3) (2022-01-15) |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
* Simplified jsdoc for consistency across editors |
||||||
|
|
||||||
|
## [12.0.2](https://github.com/motdotla/dotenv/compare/v12.0.1...v12.0.2) (2022-01-15) |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
* Improve embedded jsdoc type documentation |
||||||
|
|
||||||
|
## [12.0.1](https://github.com/motdotla/dotenv/compare/v12.0.0...v12.0.1) (2022-01-15) |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
* README updates and clarifications |
||||||
|
|
||||||
|
## [12.0.0](https://github.com/motdotla/dotenv/compare/v11.0.0...v12.0.0) (2022-01-15) |
||||||
|
|
||||||
|
### Removed |
||||||
|
|
||||||
|
- _Breaking:_ drop support for Flow static type checker ([#584](https://github.com/motdotla/dotenv/pull/584)) |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
- Move types/index.d.ts to lib/main.d.ts ([#585](https://github.com/motdotla/dotenv/pull/585)) |
||||||
|
- Typescript cleanup ([#587](https://github.com/motdotla/dotenv/pull/587)) |
||||||
|
- Explicit typescript inclusion in package.json ([#566](https://github.com/motdotla/dotenv/pull/566)) |
||||||
|
|
||||||
|
## [11.0.0](https://github.com/motdotla/dotenv/compare/v10.0.0...v11.0.0) (2022-01-11) |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
- _Breaking:_ drop support for Node v10 ([#558](https://github.com/motdotla/dotenv/pull/558)) |
||||||
|
- Patch debug option ([#550](https://github.com/motdotla/dotenv/pull/550)) |
||||||
|
|
||||||
|
## [10.0.0](https://github.com/motdotla/dotenv/compare/v9.0.2...v10.0.0) (2021-05-20) |
||||||
|
|
||||||
|
### Added |
||||||
|
|
||||||
|
- Add generic support to parse function |
||||||
|
- Allow for import "dotenv/config.js" |
||||||
|
- Add support to resolve home directory in path via ~ |
||||||
|
|
||||||
|
## [9.0.2](https://github.com/motdotla/dotenv/compare/v9.0.1...v9.0.2) (2021-05-10) |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
- Support windows newlines with debug mode |
||||||
|
|
||||||
|
## [9.0.1](https://github.com/motdotla/dotenv/compare/v9.0.0...v9.0.1) (2021-05-08) |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
- Updates to README |
||||||
|
|
||||||
|
## [9.0.0](https://github.com/motdotla/dotenv/compare/v8.6.0...v9.0.0) (2021-05-05) |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
- _Breaking:_ drop support for Node v8 |
||||||
|
|
||||||
|
## [8.6.0](https://github.com/motdotla/dotenv/compare/v8.5.1...v8.6.0) (2021-05-05) |
||||||
|
|
||||||
|
### Added |
||||||
|
|
||||||
|
- define package.json in exports |
||||||
|
|
||||||
|
## [8.5.1](https://github.com/motdotla/dotenv/compare/v8.5.0...v8.5.1) (2021-05-05) |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
- updated dev dependencies via npm audit |
||||||
|
|
||||||
|
## [8.5.0](https://github.com/motdotla/dotenv/compare/v8.4.0...v8.5.0) (2021-05-05) |
||||||
|
|
||||||
|
### Added |
||||||
|
|
||||||
|
- allow for `import "dotenv/config"` |
||||||
|
|
||||||
|
## [8.4.0](https://github.com/motdotla/dotenv/compare/v8.3.0...v8.4.0) (2021-05-05) |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
- point to exact types file to work with VS Code |
||||||
|
|
||||||
|
## [8.3.0](https://github.com/motdotla/dotenv/compare/v8.2.0...v8.3.0) (2021-05-05) |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
- _Breaking:_ drop support for Node v8 (mistake to be released as minor bump. later bumped to 9.0.0. see above.) |
||||||
|
|
||||||
|
## [8.2.0](https://github.com/motdotla/dotenv/compare/v8.1.0...v8.2.0) (2019-10-16) |
||||||
|
|
||||||
|
### Added |
||||||
|
|
||||||
|
- TypeScript types |
||||||
|
|
||||||
|
## [8.1.0](https://github.com/motdotla/dotenv/compare/v8.0.0...v8.1.0) (2019-08-18) |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
- _Breaking:_ drop support for Node v6 ([#392](https://github.com/motdotla/dotenv/issues/392)) |
||||||
|
|
||||||
|
# [8.0.0](https://github.com/motdotla/dotenv/compare/v7.0.0...v8.0.0) (2019-05-02) |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
- _Breaking:_ drop support for Node v6 ([#302](https://github.com/motdotla/dotenv/issues/392)) |
||||||
|
|
||||||
|
## [7.0.0] - 2019-03-12 |
||||||
|
|
||||||
|
### Fixed |
||||||
|
|
||||||
|
- Fix removing unbalanced quotes ([#376](https://github.com/motdotla/dotenv/pull/376)) |
||||||
|
|
||||||
|
### Removed |
||||||
|
|
||||||
|
- Removed `load` alias for `config` for consistency throughout code and documentation. |
||||||
|
|
||||||
|
## [6.2.0] - 2018-12-03 |
||||||
|
|
||||||
|
### Added |
||||||
|
|
||||||
|
- Support preload configuration via environment variables ([#351](https://github.com/motdotla/dotenv/issues/351)) |
||||||
|
|
||||||
|
## [6.1.0] - 2018-10-08 |
||||||
|
|
||||||
|
### Added |
||||||
|
|
||||||
|
- `debug` option for `config` and `parse` methods will turn on logging |
||||||
|
|
||||||
|
## [6.0.0] - 2018-06-02 |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
- _Breaking:_ drop support for Node v4 ([#304](https://github.com/motdotla/dotenv/pull/304)) |
||||||
|
|
||||||
|
## [5.0.0] - 2018-01-29 |
||||||
|
|
||||||
|
### Added |
||||||
|
|
||||||
|
- Testing against Node v8 and v9 |
||||||
|
- Documentation on trim behavior of values |
||||||
|
- Documentation on how to use with `import` |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
- _Breaking_: default `path` is now `path.resolve(process.cwd(), '.env')` |
||||||
|
- _Breaking_: does not write over keys already in `process.env` if the key has a falsy value |
||||||
|
- using `const` and `let` instead of `var` |
||||||
|
|
||||||
|
### Removed |
||||||
|
|
||||||
|
- Testing against Node v7 |
||||||
|
|
||||||
|
## [4.0.0] - 2016-12-23 |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
- Return Object with parsed content or error instead of false ([#165](https://github.com/motdotla/dotenv/pull/165)). |
||||||
|
|
||||||
|
### Removed |
||||||
|
|
||||||
|
- `verbose` option removed in favor of returning result. |
||||||
|
|
||||||
|
## [3.0.0] - 2016-12-20 |
||||||
|
|
||||||
|
### Added |
||||||
|
|
||||||
|
- `verbose` option will log any error messages. Off by default. |
||||||
|
- parses email addresses correctly |
||||||
|
- allow importing config method directly in ES6 |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
- Suppress error messages by default ([#154](https://github.com/motdotla/dotenv/pull/154)) |
||||||
|
- Ignoring more files for NPM to make package download smaller |
||||||
|
|
||||||
|
### Fixed |
||||||
|
|
||||||
|
- False positive test due to case-sensitive variable ([#124](https://github.com/motdotla/dotenv/pull/124)) |
||||||
|
|
||||||
|
### Removed |
||||||
|
|
||||||
|
- `silent` option removed in favor of `verbose` |
||||||
|
|
||||||
|
## [2.0.0] - 2016-01-20 |
||||||
|
|
||||||
|
### Added |
||||||
|
|
||||||
|
- CHANGELOG to ["make it easier for users and contributors to see precisely what notable changes have been made between each release"](http://keepachangelog.com/). Linked to from README |
||||||
|
- LICENSE to be more explicit about what was defined in `package.json`. Linked to from README |
||||||
|
- Testing nodejs v4 on travis-ci |
||||||
|
- added examples of how to use dotenv in different ways |
||||||
|
- return parsed object on success rather than boolean true |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
- README has shorter description not referencing ruby gem since we don't have or want feature parity |
||||||
|
|
||||||
|
### Removed |
||||||
|
|
||||||
|
- Variable expansion and escaping so environment variables are encouraged to be fully orthogonal |
||||||
|
|
||||||
|
## [1.2.0] - 2015-06-20 |
||||||
|
|
||||||
|
### Added |
||||||
|
|
||||||
|
- Preload hook to require dotenv without including it in your code |
||||||
|
|
||||||
|
### Changed |
||||||
|
|
||||||
|
- clarified license to be "BSD-2-Clause" in `package.json` |
||||||
|
|
||||||
|
### Fixed |
||||||
|
|
||||||
|
- retain spaces in string vars |
||||||
|
|
||||||
|
## [1.1.0] - 2015-03-31 |
||||||
|
|
||||||
|
### Added |
||||||
|
|
||||||
|
- Silent option to silence `console.log` when `.env` missing |
||||||
|
|
||||||
|
## [1.0.0] - 2015-03-13 |
||||||
|
|
||||||
|
### Removed |
||||||
|
|
||||||
|
- support for multiple `.env` files. should always use one `.env` file for the current environment |
||||||
|
|
||||||
|
[7.0.0]: https://github.com/motdotla/dotenv/compare/v6.2.0...v7.0.0 |
||||||
|
[6.2.0]: https://github.com/motdotla/dotenv/compare/v6.1.0...v6.2.0 |
||||||
|
[6.1.0]: https://github.com/motdotla/dotenv/compare/v6.0.0...v6.1.0 |
||||||
|
[6.0.0]: https://github.com/motdotla/dotenv/compare/v5.0.0...v6.0.0 |
||||||
|
[5.0.0]: https://github.com/motdotla/dotenv/compare/v4.0.0...v5.0.0 |
||||||
|
[4.0.0]: https://github.com/motdotla/dotenv/compare/v3.0.0...v4.0.0 |
||||||
|
[3.0.0]: https://github.com/motdotla/dotenv/compare/v2.0.0...v3.0.0 |
||||||
|
[2.0.0]: https://github.com/motdotla/dotenv/compare/v1.2.0...v2.0.0 |
||||||
|
[1.2.0]: https://github.com/motdotla/dotenv/compare/v1.1.0...v1.2.0 |
||||||
|
[1.1.0]: https://github.com/motdotla/dotenv/compare/v1.0.0...v1.1.0 |
||||||
|
[1.0.0]: https://github.com/motdotla/dotenv/compare/v0.4.0...v1.0.0 |
@ -0,0 +1,23 @@ |
|||||||
|
Copyright (c) 2015, Scott Motte |
||||||
|
All rights reserved. |
||||||
|
|
||||||
|
Redistribution and use in source and binary forms, with or without |
||||||
|
modification, are permitted provided that the following conditions are met: |
||||||
|
|
||||||
|
* Redistributions of source code must retain the above copyright notice, this |
||||||
|
list of conditions and the following disclaimer. |
||||||
|
|
||||||
|
* Redistributions in binary form must reproduce the above copyright notice, |
||||||
|
this list of conditions and the following disclaimer in the documentation |
||||||
|
and/or other materials provided with the distribution. |
||||||
|
|
||||||
|
THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" |
||||||
|
AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE |
||||||
|
IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE |
||||||
|
DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE |
||||||
|
FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL |
||||||
|
DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR |
||||||
|
SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER |
||||||
|
CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, |
||||||
|
OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE |
||||||
|
OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. |
@ -0,0 +1,408 @@ |
|||||||
|
Works with [dotenv-vault](https://github.com/dotenv-org/dotenv-vault). Learn more at [dotenv.org/vault](https://dotenv.org/vault?r=1). |
||||||
|
|
||||||
|
# dotenv |
||||||
|
|
||||||
|
<img src="https://raw.githubusercontent.com/motdotla/dotenv/master/dotenv.png" alt="dotenv" align="right" /> |
||||||
|
|
||||||
|
Dotenv is a zero-dependency module that loads environment variables from a `.env` file into [`process.env`](https://nodejs.org/docs/latest/api/process.html#process_process_env). Storing configuration in the environment separate from code is based on [The Twelve-Factor App](http://12factor.net/config) methodology. |
||||||
|
|
||||||
|
[](https://travis-ci.org/motdotla/dotenv) |
||||||
|
[](https://ci.appveyor.com/project/motdotla/dotenv/branch/master) |
||||||
|
[](https://www.npmjs.com/package/dotenv) |
||||||
|
[](https://github.com/feross/standard) |
||||||
|
[](https://coveralls.io/github/motdotla/dotenv?branch=coverall-intergration) |
||||||
|
[](LICENSE) |
||||||
|
[](https://conventionalcommits.org) |
||||||
|
[](https://openbase.com/js/dotenv) |
||||||
|
|
||||||
|
## Install |
||||||
|
|
||||||
|
```bash |
||||||
|
# install locally (recommended) |
||||||
|
npm install dotenv --save |
||||||
|
``` |
||||||
|
|
||||||
|
Or installing with yarn? `yarn add dotenv` |
||||||
|
|
||||||
|
## Usage |
||||||
|
|
||||||
|
Create a `.env` file in the root of your project: |
||||||
|
|
||||||
|
```dosini |
||||||
|
S3_BUCKET="YOURS3BUCKET" |
||||||
|
SECRET_KEY="YOURSECRETKEYGOESHERE" |
||||||
|
``` |
||||||
|
|
||||||
|
As early as possible in your application, import and configure dotenv: |
||||||
|
|
||||||
|
```javascript |
||||||
|
require('dotenv').config() |
||||||
|
console.log(process.env) // remove this after you've confirmed it working |
||||||
|
``` |
||||||
|
|
||||||
|
.. or using ES6? |
||||||
|
|
||||||
|
```javascript |
||||||
|
import 'dotenv/config' // see https://github.com/motdotla/dotenv#how-do-i-use-dotenv-with-import |
||||||
|
import express from 'express' |
||||||
|
``` |
||||||
|
|
||||||
|
That's it. `process.env` now has the keys and values you defined in your `.env` file: |
||||||
|
|
||||||
|
```javascript |
||||||
|
require('dotenv').config() |
||||||
|
|
||||||
|
... |
||||||
|
|
||||||
|
s3.getBucketCors({Bucket: process.env.S3_BUCKET}, function(err, data) {}) |
||||||
|
``` |
||||||
|
|
||||||
|
### Multiline values |
||||||
|
|
||||||
|
If you need multiline variables, for example private keys, those are now supported (`>= v15.0.0`) with line breaks: |
||||||
|
|
||||||
|
```dosini |
||||||
|
PRIVATE_KEY="-----BEGIN RSA PRIVATE KEY----- |
||||||
|
... |
||||||
|
Kh9NV... |
||||||
|
... |
||||||
|
-----END DSA PRIVATE KEY-----" |
||||||
|
``` |
||||||
|
|
||||||
|
Alternatively, you can double quote strings and use the `\n` character: |
||||||
|
|
||||||
|
```dosini |
||||||
|
PRIVATE_KEY="-----BEGIN RSA PRIVATE KEY-----\nKh9NV...\n-----END DSA PRIVATE KEY-----\n" |
||||||
|
``` |
||||||
|
|
||||||
|
### Comments |
||||||
|
|
||||||
|
Comments may be added to your file on their own line or inline: |
||||||
|
|
||||||
|
```dosini |
||||||
|
# This is a comment |
||||||
|
SECRET_KEY=YOURSECRETKEYGOESHERE # comment |
||||||
|
SECRET_HASH="something-with-a-#-hash" |
||||||
|
``` |
||||||
|
|
||||||
|
Comments begin where a `#` exists, so if your value contains a `#` please wrap it in quotes. This is a breaking change from `>= v15.0.0` and on. |
||||||
|
|
||||||
|
### Parsing |
||||||
|
|
||||||
|
The engine which parses the contents of your file containing environment variables is available to use. It accepts a String or Buffer and will return an Object with the parsed keys and values. |
||||||
|
|
||||||
|
```javascript |
||||||
|
const dotenv = require('dotenv') |
||||||
|
const buf = Buffer.from('BASIC=basic') |
||||||
|
const config = dotenv.parse(buf) // will return an object |
||||||
|
console.log(typeof config, config) // object { BASIC : 'basic' } |
||||||
|
``` |
||||||
|
|
||||||
|
### Preload |
||||||
|
|
||||||
|
You can use the `--require` (`-r`) [command line option](https://nodejs.org/api/cli.html#-r---require-module) to preload dotenv. By doing this, you do not need to require and load dotenv in your application code. |
||||||
|
|
||||||
|
```bash |
||||||
|
$ node -r dotenv/config your_script.js |
||||||
|
``` |
||||||
|
|
||||||
|
The configuration options below are supported as command line arguments in the format `dotenv_config_<option>=value` |
||||||
|
|
||||||
|
```bash |
||||||
|
$ node -r dotenv/config your_script.js dotenv_config_path=/custom/path/to/.env dotenv_config_debug=true |
||||||
|
``` |
||||||
|
|
||||||
|
Additionally, you can use environment variables to set configuration options. Command line arguments will precede these. |
||||||
|
|
||||||
|
```bash |
||||||
|
$ DOTENV_CONFIG_<OPTION>=value node -r dotenv/config your_script.js |
||||||
|
``` |
||||||
|
|
||||||
|
```bash |
||||||
|
$ DOTENV_CONFIG_ENCODING=latin1 DOTENV_CONFIG_DEBUG=true node -r dotenv/config your_script.js dotenv_config_path=/custom/path/to/.env |
||||||
|
``` |
||||||
|
|
||||||
|
### Variable Expansion |
||||||
|
|
||||||
|
You need to add the value of another variable in one of your variables? Use [dotenv-expand](https://github.com/motdotla/dotenv-expand). |
||||||
|
|
||||||
|
### Syncing |
||||||
|
|
||||||
|
You need to keep `.env` files in sync between machines, environments, or team members? Use [dotenv-vault](https://github.com/dotenv-org/dotenv-vault). |
||||||
|
|
||||||
|
## Examples |
||||||
|
|
||||||
|
See [examples](https://github.com/dotenv-org/examples) of using dotenv with various frameworks, languages, and configurations. |
||||||
|
|
||||||
|
* [nodejs](https://github.com/dotenv-org/examples/tree/master/dotenv-nodejs) |
||||||
|
* [nodejs (debug on)](https://github.com/dotenv-org/examples/tree/master/dotenv-nodejs-debug) |
||||||
|
* [nodejs (override on)](https://github.com/dotenv-org/examples/tree/master/dotenv-nodejs-override) |
||||||
|
* [esm](https://github.com/dotenv-org/examples/tree/master/dotenv-esm) |
||||||
|
* [esm (preload)](https://github.com/dotenv-org/examples/tree/master/dotenv-esm-preload) |
||||||
|
* [typescript](https://github.com/dotenv-org/examples/tree/master/dotenv-typescript) |
||||||
|
* [typescript parse](https://github.com/dotenv-org/examples/tree/master/dotenv-typescript-parse) |
||||||
|
* [typescript config](https://github.com/dotenv-org/examples/tree/master/dotenv-typescript-config) |
||||||
|
* [webpack](https://github.com/dotenv-org/examples/tree/master/dotenv-webpack) |
||||||
|
* [webpack (plugin)](https://github.com/dotenv-org/examples/tree/master/dotenv-webpack2) |
||||||
|
* [react](https://github.com/dotenv-org/examples/tree/master/dotenv-react) |
||||||
|
* [react (typescript)](https://github.com/dotenv-org/examples/tree/master/dotenv-react-typescript) |
||||||
|
* [express](https://github.com/dotenv-org/examples/tree/master/dotenv-express) |
||||||
|
* [nestjs](https://github.com/dotenv-org/examples/tree/master/dotenv-nestjs) |
||||||
|
|
||||||
|
## Documentation |
||||||
|
|
||||||
|
Dotenv exposes two functions: |
||||||
|
|
||||||
|
* `config` |
||||||
|
* `parse` |
||||||
|
|
||||||
|
### Config |
||||||
|
|
||||||
|
`config` will read your `.env` file, parse the contents, assign it to |
||||||
|
[`process.env`](https://nodejs.org/docs/latest/api/process.html#process_process_env), |
||||||
|
and return an Object with a `parsed` key containing the loaded content or an `error` key if it failed. |
||||||
|
|
||||||
|
```js |
||||||
|
const result = dotenv.config() |
||||||
|
|
||||||
|
if (result.error) { |
||||||
|
throw result.error |
||||||
|
} |
||||||
|
|
||||||
|
console.log(result.parsed) |
||||||
|
``` |
||||||
|
|
||||||
|
You can additionally, pass options to `config`. |
||||||
|
|
||||||
|
#### Options |
||||||
|
|
||||||
|
##### Path |
||||||
|
|
||||||
|
Default: `path.resolve(process.cwd(), '.env')` |
||||||
|
|
||||||
|
Specify a custom path if your file containing environment variables is located elsewhere. |
||||||
|
|
||||||
|
```js |
||||||
|
require('dotenv').config({ path: '/custom/path/to/.env' }) |
||||||
|
``` |
||||||
|
|
||||||
|
##### Encoding |
||||||
|
|
||||||
|
Default: `utf8` |
||||||
|
|
||||||
|
Specify the encoding of your file containing environment variables. |
||||||
|
|
||||||
|
```js |
||||||
|
require('dotenv').config({ encoding: 'latin1' }) |
||||||
|
``` |
||||||
|
|
||||||
|
##### Debug |
||||||
|
|
||||||
|
Default: `false` |
||||||
|
|
||||||
|
Turn on logging to help debug why certain keys or values are not being set as you expect. |
||||||
|
|
||||||
|
```js |
||||||
|
require('dotenv').config({ debug: process.env.DEBUG }) |
||||||
|
``` |
||||||
|
|
||||||
|
##### Override |
||||||
|
|
||||||
|
Default: `false` |
||||||
|
|
||||||
|
Override any environment variables that have already been set on your machine with values from your .env file. |
||||||
|
|
||||||
|
```js |
||||||
|
require('dotenv').config({ override: true }) |
||||||
|
``` |
||||||
|
|
||||||
|
### Parse |
||||||
|
|
||||||
|
The engine which parses the contents of your file containing environment |
||||||
|
variables is available to use. It accepts a String or Buffer and will return |
||||||
|
an Object with the parsed keys and values. |
||||||
|
|
||||||
|
```js |
||||||
|
const dotenv = require('dotenv') |
||||||
|
const buf = Buffer.from('BASIC=basic') |
||||||
|
const config = dotenv.parse(buf) // will return an object |
||||||
|
console.log(typeof config, config) // object { BASIC : 'basic' } |
||||||
|
``` |
||||||
|
|
||||||
|
#### Options |
||||||
|
|
||||||
|
##### Debug |
||||||
|
|
||||||
|
Default: `false` |
||||||
|
|
||||||
|
Turn on logging to help debug why certain keys or values are not being set as you expect. |
||||||
|
|
||||||
|
```js |
||||||
|
const dotenv = require('dotenv') |
||||||
|
const buf = Buffer.from('hello world') |
||||||
|
const opt = { debug: true } |
||||||
|
const config = dotenv.parse(buf, opt) |
||||||
|
// expect a debug message because the buffer is not in KEY=VAL form |
||||||
|
``` |
||||||
|
|
||||||
|
## FAQ |
||||||
|
|
||||||
|
### Why is the `.env` file not loading my environment variables successfully? |
||||||
|
|
||||||
|
Most likely your `.env` file is not in the correct place. [See this stack overflow](https://stackoverflow.com/questions/42335016/dotenv-file-is-not-loading-environment-variables). |
||||||
|
|
||||||
|
Turn on debug mode and try again.. |
||||||
|
|
||||||
|
```js |
||||||
|
require('dotenv').config({ debug: true }) |
||||||
|
``` |
||||||
|
|
||||||
|
You will receive a helpful error outputted to your console. |
||||||
|
|
||||||
|
### Should I commit my `.env` file? |
||||||
|
|
||||||
|
No. We **strongly** recommend against committing your `.env` file to version |
||||||
|
control. It should only include environment-specific values such as database |
||||||
|
passwords or API keys. Your production database should have a different |
||||||
|
password than your development database. |
||||||
|
|
||||||
|
### Should I have multiple `.env` files? |
||||||
|
|
||||||
|
No. We **strongly** recommend against having a "main" `.env` file and an "environment" `.env` file like `.env.test`. Your config should vary between deploys, and you should not be sharing values between environments. |
||||||
|
|
||||||
|
> In a twelve-factor app, env vars are granular controls, each fully orthogonal to other env vars. They are never grouped together as “environments”, but instead are independently managed for each deploy. This is a model that scales up smoothly as the app naturally expands into more deploys over its lifetime. |
||||||
|
> |
||||||
|
> – [The Twelve-Factor App](http://12factor.net/config) |
||||||
|
|
||||||
|
### What rules does the parsing engine follow? |
||||||
|
|
||||||
|
The parsing engine currently supports the following rules: |
||||||
|
|
||||||
|
- `BASIC=basic` becomes `{BASIC: 'basic'}` |
||||||
|
- empty lines are skipped |
||||||
|
- lines beginning with `#` are treated as comments |
||||||
|
- `#` marks the beginning of a comment (unless when the value is wrapped in quotes) |
||||||
|
- empty values become empty strings (`EMPTY=` becomes `{EMPTY: ''}`) |
||||||
|
- inner quotes are maintained (think JSON) (`JSON={"foo": "bar"}` becomes `{JSON:"{\"foo\": \"bar\"}"`) |
||||||
|
- whitespace is removed from both ends of unquoted values (see more on [`trim`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/String/Trim)) (`FOO= some value ` becomes `{FOO: 'some value'}`) |
||||||
|
- single and double quoted values are escaped (`SINGLE_QUOTE='quoted'` becomes `{SINGLE_QUOTE: "quoted"}`) |
||||||
|
- single and double quoted values maintain whitespace from both ends (`FOO=" some value "` becomes `{FOO: ' some value '}`) |
||||||
|
- double quoted values expand new lines (`MULTILINE="new\nline"` becomes |
||||||
|
|
||||||
|
``` |
||||||
|
{MULTILINE: 'new |
||||||
|
line'} |
||||||
|
``` |
||||||
|
|
||||||
|
- backticks are supported (`` BACKTICK_KEY=`This has 'single' and "double" quotes inside of it.` ``) |
||||||
|
|
||||||
|
### What happens to environment variables that were already set? |
||||||
|
|
||||||
|
By default, we will never modify any environment variables that have already been set. In particular, if there is a variable in your `.env` file which collides with one that already exists in your environment, then that variable will be skipped. |
||||||
|
|
||||||
|
If instead, you want to override `process.env` use the `override` option. |
||||||
|
|
||||||
|
```javascript |
||||||
|
require('dotenv').config({ override: true }) |
||||||
|
``` |
||||||
|
|
||||||
|
### How come my environment variables are not showing up for React? |
||||||
|
|
||||||
|
Your React code is run in Webpack, where the `fs` module or even the `process` global itself are not accessible out-of-the-box. `process.env` can only be injected through Webpack configuration. |
||||||
|
|
||||||
|
If you are using [`react-scripts`](https://www.npmjs.com/package/react-scripts), which is distributed through [`create-react-app`](https://create-react-app.dev/), it has dotenv built in but with a quirk. Preface your environment variables with `REACT_APP_`. See [this stack overflow](https://stackoverflow.com/questions/42182577/is-it-possible-to-use-dotenv-in-a-react-project) for more details. |
||||||
|
|
||||||
|
If you are using other frameworks (e.g. Next.js, Gatsby...), you need to consult their documentation for how to inject environment variables into the client. |
||||||
|
|
||||||
|
### Can I customize/write plugins for dotenv? |
||||||
|
|
||||||
|
Yes! `dotenv.config()` returns an object representing the parsed `.env` file. This gives you everything you need to continue setting values on `process.env`. For example: |
||||||
|
|
||||||
|
```js |
||||||
|
const dotenv = require('dotenv') |
||||||
|
const variableExpansion = require('dotenv-expand') |
||||||
|
const myEnv = dotenv.config() |
||||||
|
variableExpansion(myEnv) |
||||||
|
``` |
||||||
|
|
||||||
|
### How do I use dotenv with `import`? |
||||||
|
|
||||||
|
Simply.. |
||||||
|
|
||||||
|
```javascript |
||||||
|
// index.mjs (ESM) |
||||||
|
import 'dotenv/config' // see https://github.com/motdotla/dotenv#how-do-i-use-dotenv-with-import |
||||||
|
import express from 'express' |
||||||
|
``` |
||||||
|
|
||||||
|
A little background.. |
||||||
|
|
||||||
|
> When you run a module containing an `import` declaration, the modules it imports are loaded first, then each module body is executed in a depth-first traversal of the dependency graph, avoiding cycles by skipping anything already executed. |
||||||
|
> |
||||||
|
> – [ES6 In Depth: Modules](https://hacks.mozilla.org/2015/08/es6-in-depth-modules/) |
||||||
|
|
||||||
|
What does this mean in plain language? It means you would think the following would work but it won't. |
||||||
|
|
||||||
|
```js |
||||||
|
// errorReporter.mjs |
||||||
|
import { Client } from 'best-error-reporting-service' |
||||||
|
|
||||||
|
export default new Client(process.env.API_KEY) |
||||||
|
|
||||||
|
// index.mjs |
||||||
|
import dotenv from 'dotenv' |
||||||
|
dotenv.config() |
||||||
|
|
||||||
|
import errorReporter from './errorReporter.mjs' |
||||||
|
errorReporter.report(new Error('documented example')) |
||||||
|
``` |
||||||
|
|
||||||
|
`process.env.API_KEY` will be blank. |
||||||
|
|
||||||
|
Instead the above code should be written as.. |
||||||
|
|
||||||
|
```js |
||||||
|
// errorReporter.mjs |
||||||
|
import { Client } from 'best-error-reporting-service' |
||||||
|
|
||||||
|
export default new Client(process.env.API_KEY) |
||||||
|
|
||||||
|
// index.mjs |
||||||
|
import 'dotenv/config' |
||||||
|
|
||||||
|
import errorReporter from './errorReporter.mjs' |
||||||
|
errorReporter.report(new Error('documented example')) |
||||||
|
``` |
||||||
|
|
||||||
|
Does that make sense? It's a bit unintuitive, but it is how importing of ES6 modules work. Here is a [working example of this pitfall](https://github.com/dotenv-org/examples/tree/master/dotenv-es6-import-pitfall). |
||||||
|
|
||||||
|
There are two alternatives to this approach: |
||||||
|
|
||||||
|
1. Preload dotenv: `node --require dotenv/config index.js` (_Note: you do not need to `import` dotenv with this approach_) |
||||||
|
2. Create a separate file that will execute `config` first as outlined in [this comment on #133](https://github.com/motdotla/dotenv/issues/133#issuecomment-255298822) |
||||||
|
|
||||||
|
### What about variable expansion? |
||||||
|
|
||||||
|
Try [dotenv-expand](https://github.com/motdotla/dotenv-expand) |
||||||
|
|
||||||
|
### What about syncing .env files? |
||||||
|
|
||||||
|
Use [dotenv-vault](https://github.com/dotenv-org/dotenv-vault) |
||||||
|
|
||||||
|
### What about securing .env files? |
||||||
|
|
||||||
|
Use [dotenv-vault](https://github.com/dotenv-org/dotenv-vault) |
||||||
|
|
||||||
|
## Contributing Guide |
||||||
|
|
||||||
|
See [CONTRIBUTING.md](CONTRIBUTING.md) |
||||||
|
|
||||||
|
## CHANGELOG |
||||||
|
|
||||||
|
See [CHANGELOG.md](CHANGELOG.md) |
||||||
|
|
||||||
|
## Who's using dotenv? |
||||||
|
|
||||||
|
[These npm modules depend on it.](https://www.npmjs.com/browse/depended/dotenv) |
||||||
|
|
||||||
|
Projects that expand it often use the [keyword "dotenv" on npm](https://www.npmjs.com/search?q=keywords:dotenv). |
@ -0,0 +1 @@ |
|||||||
|
export {}; |
@ -0,0 +1,9 @@ |
|||||||
|
(function () { |
||||||
|
require('./lib/main').config( |
||||||
|
Object.assign( |
||||||
|
{}, |
||||||
|
require('./lib/env-options'), |
||||||
|
require('./lib/cli-options')(process.argv) |
||||||
|
) |
||||||
|
) |
||||||
|
})() |
@ -0,0 +1,11 @@ |
|||||||
|
const re = /^dotenv_config_(encoding|path|debug|override)=(.+)$/ |
||||||
|
|
||||||
|
module.exports = function optionMatcher (args) { |
||||||
|
return args.reduce(function (acc, cur) { |
||||||
|
const matches = cur.match(re) |
||||||
|
if (matches) { |
||||||
|
acc[matches[1]] = matches[2] |
||||||
|
} |
||||||
|
return acc |
||||||
|
}, {}) |
||||||
|
} |
@ -0,0 +1,20 @@ |
|||||||
|
// ../config.js accepts options via environment variables
|
||||||
|
const options = {} |
||||||
|
|
||||||
|
if (process.env.DOTENV_CONFIG_ENCODING != null) { |
||||||
|
options.encoding = process.env.DOTENV_CONFIG_ENCODING |
||||||
|
} |
||||||
|
|
||||||
|
if (process.env.DOTENV_CONFIG_PATH != null) { |
||||||
|
options.path = process.env.DOTENV_CONFIG_PATH |
||||||
|
} |
||||||
|
|
||||||
|
if (process.env.DOTENV_CONFIG_DEBUG != null) { |
||||||
|
options.debug = process.env.DOTENV_CONFIG_DEBUG |
||||||
|
} |
||||||
|
|
||||||
|
if (process.env.DOTENV_CONFIG_OVERRIDE != null) { |
||||||
|
options.override = process.env.DOTENV_CONFIG_OVERRIDE |
||||||
|
} |
||||||
|
|
||||||
|
module.exports = options |
@ -0,0 +1,73 @@ |
|||||||
|
// TypeScript Version: 3.0
|
||||||
|
/// <reference types="node" />
|
||||||
|
|
||||||
|
export interface DotenvParseOutput { |
||||||
|
[name: string]: string; |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Parses a string or buffer in the .env file format into an object. |
||||||
|
* |
||||||
|
* See https://docs.dotenv.org
|
||||||
|
* |
||||||
|
* @param src - contents to be parsed. example: `'DB_HOST=localhost'` |
||||||
|
* @param options - additional options. example: `{ debug: true }` |
||||||
|
* @returns an object with keys and values based on `src`. example: `{ DB_HOST : 'localhost' }` |
||||||
|
*/ |
||||||
|
export function parse<T extends DotenvParseOutput = DotenvParseOutput>( |
||||||
|
src: string | Buffer |
||||||
|
): T; |
||||||
|
|
||||||
|
export interface DotenvConfigOptions { |
||||||
|
/** |
||||||
|
* Default: `path.resolve(process.cwd(), '.env')` |
||||||
|
* |
||||||
|
* Specify a custom path if your file containing environment variables is located elsewhere. |
||||||
|
* |
||||||
|
* example: `require('dotenv').config({ path: '/custom/path/to/.env' })` |
||||||
|
*/ |
||||||
|
path?: string; |
||||||
|
|
||||||
|
/** |
||||||
|
* Default: `utf8` |
||||||
|
* |
||||||
|
* Specify the encoding of your file containing environment variables. |
||||||
|
* |
||||||
|
* example: `require('dotenv').config({ encoding: 'latin1' })` |
||||||
|
*/ |
||||||
|
encoding?: string; |
||||||
|
|
||||||
|
/** |
||||||
|
* Default: `false` |
||||||
|
* |
||||||
|
* Turn on logging to help debug why certain keys or values are not being set as you expect. |
||||||
|
* |
||||||
|
* example: `require('dotenv').config({ debug: process.env.DEBUG })` |
||||||
|
*/ |
||||||
|
debug?: boolean; |
||||||
|
|
||||||
|
/** |
||||||
|
* Default: `false` |
||||||
|
* |
||||||
|
* Override any environment variables that have already been set on your machine with values from your .env file. |
||||||
|
* |
||||||
|
* example: `require('dotenv').config({ override: true })` |
||||||
|
*/ |
||||||
|
override?: boolean; |
||||||
|
} |
||||||
|
|
||||||
|
export interface DotenvConfigOutput { |
||||||
|
error?: Error; |
||||||
|
parsed?: DotenvParseOutput; |
||||||
|
} |
||||||
|
|
||||||
|
/** |
||||||
|
* Loads `.env` file contents into process.env. |
||||||
|
* |
||||||
|
* See https://docs.dotenv.org
|
||||||
|
* |
||||||
|
* @param options - additional options. example: `{ path: './custom/path', encoding: 'latin1', debug: true, override: false }` |
||||||
|
* @returns an object with a `parsed` key if successful or `error` key if an error occurred. example: { parsed: { KEY: 'value' } } |
||||||
|
* |
||||||
|
*/ |
||||||
|
export function config(options?: DotenvConfigOptions): DotenvConfigOutput; |
@ -0,0 +1,109 @@ |
|||||||
|
const fs = require('fs') |
||||||
|
const path = require('path') |
||||||
|
const os = require('os') |
||||||
|
|
||||||
|
const LINE = /(?:^|^)\s*(?:export\s+)?([\w.-]+)(?:\s*=\s*?|:\s+?)(\s*'(?:\\'|[^'])*'|\s*"(?:\\"|[^"])*"|\s*`(?:\\`|[^`])*`|[^#\r\n]+)?\s*(?:#.*)?(?:$|$)/mg |
||||||
|
|
||||||
|
// Parser src into an Object
|
||||||
|
function parse (src) { |
||||||
|
const obj = {} |
||||||
|
|
||||||
|
// Convert buffer to string
|
||||||
|
let lines = src.toString() |
||||||
|
|
||||||
|
// Convert line breaks to same format
|
||||||
|
lines = lines.replace(/\r\n?/mg, '\n') |
||||||
|
|
||||||
|
let match |
||||||
|
while ((match = LINE.exec(lines)) != null) { |
||||||
|
const key = match[1] |
||||||
|
|
||||||
|
// Default undefined or null to empty string
|
||||||
|
let value = (match[2] || '') |
||||||
|
|
||||||
|
// Remove whitespace
|
||||||
|
value = value.trim() |
||||||
|
|
||||||
|
// Check if double quoted
|
||||||
|
const maybeQuote = value[0] |
||||||
|
|
||||||
|
// Remove surrounding quotes
|
||||||
|
value = value.replace(/^(['"`])([\s\S]*)\1$/mg, '$2') |
||||||
|
|
||||||
|
// Expand newlines if double quoted
|
||||||
|
if (maybeQuote === '"') { |
||||||
|
value = value.replace(/\\n/g, '\n') |
||||||
|
value = value.replace(/\\r/g, '\r') |
||||||
|
} |
||||||
|
|
||||||
|
// Add to object
|
||||||
|
obj[key] = value |
||||||
|
} |
||||||
|
|
||||||
|
return obj |
||||||
|
} |
||||||
|
|
||||||
|
function _log (message) { |
||||||
|
console.log(`[dotenv][DEBUG] ${message}`) |
||||||
|
} |
||||||
|
|
||||||
|
function _resolveHome (envPath) { |
||||||
|
return envPath[0] === '~' ? path.join(os.homedir(), envPath.slice(1)) : envPath |
||||||
|
} |
||||||
|
|
||||||
|
// Populates process.env from .env file
|
||||||
|
function config (options) { |
||||||
|
let dotenvPath = path.resolve(process.cwd(), '.env') |
||||||
|
let encoding = 'utf8' |
||||||
|
const debug = Boolean(options && options.debug) |
||||||
|
const override = Boolean(options && options.override) |
||||||
|
|
||||||
|
if (options) { |
||||||
|
if (options.path != null) { |
||||||
|
dotenvPath = _resolveHome(options.path) |
||||||
|
} |
||||||
|
if (options.encoding != null) { |
||||||
|
encoding = options.encoding |
||||||
|
} |
||||||
|
} |
||||||
|
|
||||||
|
try { |
||||||
|
// Specifying an encoding returns a string instead of a buffer
|
||||||
|
const parsed = DotenvModule.parse(fs.readFileSync(dotenvPath, { encoding })) |
||||||
|
|
||||||
|
Object.keys(parsed).forEach(function (key) { |
||||||
|
if (!Object.prototype.hasOwnProperty.call(process.env, key)) { |
||||||
|
process.env[key] = parsed[key] |
||||||
|
} else { |
||||||
|
if (override === true) { |
||||||
|
process.env[key] = parsed[key] |
||||||
|
} |
||||||
|
|
||||||
|
if (debug) { |
||||||
|
if (override === true) { |
||||||
|
_log(`"${key}" is already defined in \`process.env\` and WAS overwritten`) |
||||||
|
} else { |
||||||
|
_log(`"${key}" is already defined in \`process.env\` and was NOT overwritten`) |
||||||
|
} |
||||||
|
} |
||||||
|
} |
||||||
|
}) |
||||||
|
|
||||||
|
return { parsed } |
||||||
|
} catch (e) { |
||||||
|
if (debug) { |
||||||
|
_log(`Failed to load ${dotenvPath} ${e.message}`) |
||||||
|
} |
||||||
|
|
||||||
|
return { error: e } |
||||||
|
} |
||||||
|
} |
||||||
|
|
||||||
|
const DotenvModule = { |
||||||
|
config, |
||||||
|
parse |
||||||
|
} |
||||||
|
|
||||||
|
module.exports.config = DotenvModule.config |
||||||
|
module.exports.parse = DotenvModule.parse |
||||||
|
module.exports = DotenvModule |
@ -0,0 +1,56 @@ |
|||||||
|
{ |
||||||
|
"name": "dotenv", |
||||||
|
"version": "16.0.1", |
||||||
|
"description": "Loads environment variables from .env file", |
||||||
|
"main": "lib/main.js", |
||||||
|
"types": "lib/main.d.ts", |
||||||
|
"exports": { |
||||||
|
".": { |
||||||
|
"require": "./lib/main.js", |
||||||
|
"types": "./lib/main.d.ts", |
||||||
|
"default": "./lib/main.js" |
||||||
|
}, |
||||||
|
"./config": "./config.js", |
||||||
|
"./config.js": "./config.js", |
||||||
|
"./package.json": "./package.json" |
||||||
|
}, |
||||||
|
"scripts": { |
||||||
|
"dts-check": "tsc --project tests/types/tsconfig.json", |
||||||
|
"lint": "standard", |
||||||
|
"lint-readme": "standard-markdown", |
||||||
|
"pretest": "npm run lint && npm run dts-check", |
||||||
|
"test": "tap tests/*.js --100 -Rspec", |
||||||
|
"prerelease": "npm test", |
||||||
|
"release": "standard-version" |
||||||
|
}, |
||||||
|
"repository": { |
||||||
|
"type": "git", |
||||||
|
"url": "git://github.com/motdotla/dotenv.git" |
||||||
|
}, |
||||||
|
"keywords": [ |
||||||
|
"dotenv", |
||||||
|
"env", |
||||||
|
".env", |
||||||
|
"environment", |
||||||
|
"variables", |
||||||
|
"config", |
||||||
|
"settings" |
||||||
|
], |
||||||
|
"readmeFilename": "README.md", |
||||||
|
"license": "BSD-2-Clause", |
||||||
|
"devDependencies": { |
||||||
|
"@types/node": "^17.0.9", |
||||||
|
"decache": "^4.6.1", |
||||||
|
"dtslint": "^3.7.0", |
||||||
|
"sinon": "^12.0.1", |
||||||
|
"standard": "^16.0.4", |
||||||
|
"standard-markdown": "^7.1.0", |
||||||
|
"standard-version": "^9.3.2", |
||||||
|
"tap": "^15.1.6", |
||||||
|
"tar": "^6.1.11", |
||||||
|
"typescript": "^4.5.4" |
||||||
|
}, |
||||||
|
"engines": { |
||||||
|
"node": ">=12" |
||||||
|
} |
||||||
|
} |
@ -0,0 +1,22 @@ |
|||||||
|
(The MIT License) |
||||||
|
|
||||||
|
Copyright (c) 2014-2015 Automattic <dev@cloudup.com> |
||||||
|
|
||||||
|
Permission is hereby granted, free of charge, to any person obtaining |
||||||
|
a copy of this software and associated documentation files (the |
||||||
|
'Software'), to deal in the Software without restriction, including |
||||||
|
without limitation the rights to use, copy, modify, merge, publish, |
||||||
|
distribute, sublicense, and/or sell copies of the Software, and to |
||||||
|
permit persons to whom the Software is furnished to do so, subject to |
||||||
|
the following conditions: |
||||||
|
|
||||||
|
The above copyright notice and this permission notice shall be |
||||||
|
included in all copies or substantial portions of the Software. |
||||||
|
|
||||||
|
THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, |
||||||
|
EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF |
||||||
|
MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. |
||||||
|
IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY |
||||||
|
CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, |
||||||
|
TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE |
||||||
|
SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. |
@ -0,0 +1,333 @@ |
|||||||
|
|
||||||
|
# Engine.IO client |
||||||
|
|
||||||
|
[](https://github.com/socketio/engine.io-client/actions) |
||||||
|
[](http://badge.fury.io/js/engine.io-client) |
||||||
|
|
||||||
|
This is the client for [Engine.IO](http://github.com/socketio/engine.io), |
||||||
|
the implementation of transport-based cross-browser/cross-device |
||||||
|
bi-directional communication layer for [Socket.IO](http://github.com/socketio/socket.io). |
||||||
|
|
||||||
|
## How to use |
||||||
|
|
||||||
|
### Standalone |
||||||
|
|
||||||
|
You can find an `engine.io.js` file in this repository, which is a |
||||||
|
standalone build you can use as follows: |
||||||
|
|
||||||
|
```html |
||||||
|
<script src="/path/to/engine.io.js"></script> |
||||||
|
<script> |
||||||
|
// eio = Socket |
||||||
|
const socket = eio('ws://localhost'); |
||||||
|
socket.on('open', () => { |
||||||
|
socket.on('message', (data) => {}); |
||||||
|
socket.on('close', () => {}); |
||||||
|
}); |
||||||
|
</script> |
||||||
|
``` |
||||||
|
|
||||||
|
### With browserify |
||||||
|
|
||||||
|
Engine.IO is a commonjs module, which means you can include it by using |
||||||
|
`require` on the browser and package using [browserify](http://browserify.org/): |
||||||
|
|
||||||
|
1. install the client package |
||||||
|
|
||||||
|
```bash |
||||||
|
$ npm install engine.io-client |
||||||
|
``` |
||||||
|
|
||||||
|
1. write your app code |
||||||
|
|
||||||
|
```js |
||||||
|
const { Socket } = require('engine.io-client'); |
||||||
|
const socket = new Socket('ws://localhost'); |
||||||
|
socket.on('open', () => { |
||||||
|
socket.on('message', (data) => {}); |
||||||
|
socket.on('close', () => {}); |
||||||
|
}); |
||||||
|
``` |
||||||
|
|
||||||
|
1. build your app bundle |
||||||
|
|
||||||
|
```bash |
||||||
|
$ browserify app.js > bundle.js |
||||||
|
``` |
||||||
|
|
||||||
|
1. include on your page |
||||||
|
|
||||||
|
```html |
||||||
|
<script src="/path/to/bundle.js"></script> |
||||||
|
``` |
||||||
|
|
||||||
|
### Sending and receiving binary |
||||||
|
|
||||||
|
```html |
||||||
|
<script src="/path/to/engine.io.js"></script> |
||||||
|
<script> |
||||||
|
const socket = eio('ws://localhost/'); |
||||||
|
socket.binaryType = 'blob'; |
||||||
|
socket.on('open', () => { |
||||||
|
socket.send(new Int8Array(5)); |
||||||
|
socket.on('message', (blob) => {}); |
||||||
|
socket.on('close', () => {}); |
||||||
|
}); |
||||||
|
</script> |
||||||
|
``` |
||||||
|
|
||||||
|
### Node.JS |
||||||
|
|
||||||
|
Add `engine.io-client` to your `package.json` and then: |
||||||
|
|
||||||
|
```js |
||||||
|
const { Socket } = require('engine.io-client'); |
||||||
|
const socket = new Socket('ws://localhost'); |
||||||
|
socket.on('open', () => { |
||||||
|
socket.on('message', (data) => {}); |
||||||
|
socket.on('close', () => {}); |
||||||
|
}); |
||||||
|
``` |
||||||
|
|
||||||
|
### Node.js with certificates |
||||||
|
```js |
||||||
|
const opts = { |
||||||
|
key: fs.readFileSync('test/fixtures/client.key'), |
||||||
|
cert: fs.readFileSync('test/fixtures/client.crt'), |
||||||
|
ca: fs.readFileSync('test/fixtures/ca.crt') |
||||||
|
}; |
||||||
|
|
||||||
|
const { Socket } = require('engine.io-client'); |
||||||
|
const socket = new Socket('ws://localhost', opts); |
||||||
|
socket.on('open', () => { |
||||||
|
socket.on('message', (data) => {}); |
||||||
|
socket.on('close', () => {}); |
||||||
|
}); |
||||||
|
``` |
||||||
|
|
||||||
|
### Node.js with extraHeaders |
||||||
|
```js |
||||||
|
const opts = { |
||||||
|
extraHeaders: { |
||||||
|
'X-Custom-Header-For-My-Project': 'my-secret-access-token', |
||||||
|
'Cookie': 'user_session=NI2JlCKF90aE0sJZD9ZzujtdsUqNYSBYxzlTsvdSUe35ZzdtVRGqYFr0kdGxbfc5gUOkR9RGp20GVKza; path=/; expires=Tue, 07-Apr-2015 18:18:08 GMT; secure; HttpOnly' |
||||||
|
} |
||||||
|
}; |
||||||
|
|
||||||
|
const { Socket } = require('engine.io-client'); |
||||||
|
const socket = new Socket('ws://localhost', opts); |
||||||
|
socket.on('open', () => { |
||||||
|
socket.on('message', (data) => {}); |
||||||
|
socket.on('close', () => {}); |
||||||
|
}); |
||||||
|
``` |
||||||
|
|
||||||
|
In the browser, the [WebSocket](https://developer.mozilla.org/en-US/docs/Web/API/WebSocket) object does not support additional headers. |
||||||
|
In case you want to add some headers as part of some authentication mechanism, you can use the `transportOptions` attribute. |
||||||
|
Please note that in this case the headers won't be sent in the WebSocket upgrade request. |
||||||
|
|
||||||
|
```js |
||||||
|
// WILL NOT WORK in the browser |
||||||
|
const socket = new Socket('http://localhost', { |
||||||
|
extraHeaders: { |
||||||
|
'X-Custom-Header-For-My-Project': 'will not be sent' |
||||||
|
} |
||||||
|
}); |
||||||
|
// WILL NOT WORK |
||||||
|
const socket = new Socket('http://localhost', { |
||||||
|
transports: ['websocket'], // polling is disabled |
||||||
|
transportOptions: { |
||||||
|
polling: { |
||||||
|
extraHeaders: { |
||||||
|
'X-Custom-Header-For-My-Project': 'will not be sent' |
||||||
|
} |
||||||
|
} |
||||||
|
} |
||||||
|
}); |
||||||
|
// WILL WORK |
||||||
|
const socket = new Socket('http://localhost', { |
||||||
|
transports: ['polling', 'websocket'], |
||||||
|
transportOptions: { |
||||||
|
polling: { |
||||||
|
extraHeaders: { |
||||||
|
'X-Custom-Header-For-My-Project': 'will be used' |
||||||
|
} |
||||||
|
} |
||||||
|
} |
||||||
|
}); |
||||||
|
``` |
||||||
|
|
||||||
|
## Features |
||||||
|
|
||||||
|
- Lightweight |
||||||
|
- Runs on browser and node.js seamlessly |
||||||
|
- Transports are independent of `Engine` |
||||||
|
- Easy to debug |
||||||
|
- Easy to unit test |
||||||
|
- Runs inside HTML5 WebWorker |
||||||
|
- Can send and receive binary data |
||||||
|
- Receives as ArrayBuffer or Blob when in browser, and Buffer or ArrayBuffer |
||||||
|
in Node |
||||||
|
- When XHR2 or WebSockets are used, binary is emitted directly. Otherwise |
||||||
|
binary is encoded into base64 strings, and decoded when binary types are |
||||||
|
supported. |
||||||
|
- With browsers that don't support ArrayBuffer, an object { base64: true, |
||||||
|
data: dataAsBase64String } is emitted on the `message` event. |
||||||
|
|
||||||
|
## API |
||||||
|
|
||||||
|
### Socket |
||||||
|
|
||||||
|
The client class. Mixes in [Emitter](http://github.com/component/emitter). |
||||||
|
Exposed as `eio` in the browser standalone build. |
||||||
|
|
||||||
|
#### Properties |
||||||
|
|
||||||
|
- `protocol` _(Number)_: protocol revision number |
||||||
|
- `binaryType` _(String)_ : can be set to 'arraybuffer' or 'blob' in browsers, |
||||||
|
and `buffer` or `arraybuffer` in Node. Blob is only used in browser if it's |
||||||
|
supported. |
||||||
|
|
||||||
|
#### Events |
||||||
|
|
||||||
|
- `open` |
||||||
|
- Fired upon successful connection. |
||||||
|
- `message` |
||||||
|
- Fired when data is received from the server. |
||||||
|
- **Arguments** |
||||||
|
- `String` | `ArrayBuffer`: utf-8 encoded data or ArrayBuffer containing |
||||||
|
binary data |
||||||
|
- `close` |
||||||
|
- Fired upon disconnection. In compliance with the WebSocket API spec, this event may be |
||||||
|
fired even if the `open` event does not occur (i.e. due to connection error or `close()`). |
||||||
|
- `error` |
||||||
|
- Fired when an error occurs. |
||||||
|
- `flush` |
||||||
|
- Fired upon completing a buffer flush |
||||||
|
- `drain` |
||||||
|
- Fired after `drain` event of transport if writeBuffer is empty |
||||||
|
- `upgradeError` |
||||||
|
- Fired if an error occurs with a transport we're trying to upgrade to. |
||||||
|
- `upgrade` |
||||||
|
- Fired upon upgrade success, after the new transport is set |
||||||
|
- `ping` |
||||||
|
- Fired upon receiving a ping packet. |
||||||
|
- `pong` |
||||||
|
- Fired upon _flushing_ a pong packet (ie: actual packet write out) |
||||||
|
|
||||||
|
#### Methods |
||||||
|
|
||||||
|
- **constructor** |
||||||
|
- Initializes the client |
||||||
|
- **Parameters** |
||||||
|
- `String` uri |
||||||
|
- `Object`: optional, options object |
||||||
|
- **Options** |
||||||
|
- `agent` (`http.Agent`): `http.Agent` to use, defaults to `false` (NodeJS only) |
||||||
|
- `upgrade` (`Boolean`): defaults to true, whether the client should try |
||||||
|
to upgrade the transport from long-polling to something better. |
||||||
|
- `forceBase64` (`Boolean`): forces base 64 encoding for polling transport even when XHR2 responseType is available and WebSocket even if the used standard supports binary. |
||||||
|
- `withCredentials` (`Boolean`): defaults to `false`, whether to include credentials (cookies, authorization headers, TLS client certificates, etc.) with cross-origin XHR polling requests. |
||||||
|
- `timestampRequests` (`Boolean`): whether to add the timestamp with each |
||||||
|
transport request. Note: polling requests are always stamped unless this |
||||||
|
option is explicitly set to `false` (`false`) |
||||||
|
- `timestampParam` (`String`): timestamp parameter (`t`) |
||||||
|
- `path` (`String`): path to connect to, default is `/engine.io` |
||||||
|
- `transports` (`Array`): a list of transports to try (in order). |
||||||
|
Defaults to `['polling', 'websocket']`. `Engine` |
||||||
|
always attempts to connect directly with the first one, provided the |
||||||
|
feature detection test for it passes. |
||||||
|
- `transportOptions` (`Object`): hash of options, indexed by transport name, overriding the common options for the given transport |
||||||
|
- `rememberUpgrade` (`Boolean`): defaults to false. |
||||||
|
If true and if the previous websocket connection to the server succeeded, |
||||||
|
the connection attempt will bypass the normal upgrade process and will initially |
||||||
|
try websocket. A connection attempt following a transport error will use the |
||||||
|
normal upgrade process. It is recommended you turn this on only when using |
||||||
|
SSL/TLS connections, or if you know that your network does not block websockets. |
||||||
|
- `pfx` (`String`|`Buffer`): Certificate, Private key and CA certificates to use for SSL. Can be used in Node.js client environment to manually specify certificate information. |
||||||
|
- `key` (`String`): Private key to use for SSL. Can be used in Node.js client environment to manually specify certificate information. |
||||||
|
- `passphrase` (`String`): A string of passphrase for the private key or pfx. Can be used in Node.js client environment to manually specify certificate information. |
||||||
|
- `cert` (`String`): Public x509 certificate to use. Can be used in Node.js client environment to manually specify certificate information. |
||||||
|
- `ca` (`String`|`Array`): An authority certificate or array of authority certificates to check the remote host against.. Can be used in Node.js client environment to manually specify certificate information. |
||||||
|
- `ciphers` (`String`): A string describing the ciphers to use or exclude. Consult the [cipher format list](http://www.openssl.org/docs/apps/ciphers.html#CIPHER_LIST_FORMAT) for details on the format. Can be used in Node.js client environment to manually specify certificate information. |
||||||
|
- `rejectUnauthorized` (`Boolean`): If true, the server certificate is verified against the list of supplied CAs. An 'error' event is emitted if verification fails. Verification happens at the connection level, before the HTTP request is sent. Can be used in Node.js client environment to manually specify certificate information. |
||||||
|
- `perMessageDeflate` (`Object|Boolean`): parameters of the WebSocket permessage-deflate extension |
||||||
|
(see [ws module](https://github.com/einaros/ws) api docs). Set to `false` to disable. (`true`) |
||||||
|
- `threshold` (`Number`): data is compressed only if the byte size is above this value. This option is ignored on the browser. (`1024`) |
||||||
|
- `extraHeaders` (`Object`): Headers that will be passed for each request to the server (via xhr-polling and via websockets). These values then can be used during handshake or for special proxies. Can only be used in Node.js client environment. |
||||||
|
- `onlyBinaryUpgrades` (`Boolean`): whether transport upgrades should be restricted to transports supporting binary data (`false`) |
||||||
|
- `forceNode` (`Boolean`): Uses NodeJS implementation for websockets - even if there is a native Browser-Websocket available, which is preferred by default over the NodeJS implementation. (This is useful when using hybrid platforms like nw.js or electron) (`false`, NodeJS only) |
||||||
|
- `localAddress` (`String`): the local IP address to connect to |
||||||
|
- `autoUnref` (`Boolean`): whether the transport should be `unref`'d upon creation. This calls `unref` on the underlying timers and sockets so that the program is allowed to exit if they are the only timers/sockets in the event system (Node.js only) |
||||||
|
- `useNativeTimers` (`Boolean`): Whether to always use the native timeouts. This allows the client to reconnect when the native timeout functions are overridden, such as when mock clocks are installed with [`@sinonjs/fake-timers`](https://github.com/sinonjs/fake-timers). |
||||||
|
- **Polling-only options** |
||||||
|
- `requestTimeout` (`Number`): Timeout for xhr-polling requests in milliseconds (`0`) |
||||||
|
- **Websocket-only options** |
||||||
|
- `protocols` (`Array`): a list of subprotocols (see [MDN reference](https://developer.mozilla.org/en-US/docs/Web/API/WebSockets_API/Writing_WebSocket_servers#Subprotocols)) |
||||||
|
- `closeOnBeforeunload` (`Boolean`): whether to silently close the connection when the [`beforeunload`](https://developer.mozilla.org/en-US/docs/Web/API/Window/beforeunload_event) event is emitted in the browser (defaults to `true`) |
||||||
|
- `send` |
||||||
|
- Sends a message to the server |
||||||
|
- **Parameters** |
||||||
|
- `String` | `ArrayBuffer` | `ArrayBufferView` | `Blob`: data to send |
||||||
|
- `Object`: optional, options object |
||||||
|
- `Function`: optional, callback upon `drain` |
||||||
|
- **Options** |
||||||
|
- `compress` (`Boolean`): whether to compress sending data. This option is ignored and forced to be `true` on the browser. (`true`) |
||||||
|
- `close` |
||||||
|
- Disconnects the client. |
||||||
|
|
||||||
|
### Transport |
||||||
|
|
||||||
|
The transport class. Private. _Inherits from EventEmitter_. |
||||||
|
|
||||||
|
#### Events |
||||||
|
|
||||||
|
- `poll`: emitted by polling transports upon starting a new request |
||||||
|
- `pollComplete`: emitted by polling transports upon completing a request |
||||||
|
- `drain`: emitted by polling transports upon a buffer drain |
||||||
|
|
||||||
|
## Tests |
||||||
|
|
||||||
|
`engine.io-client` is used to test |
||||||
|
[engine](http://github.com/socketio/engine.io). Running the `engine.io` |
||||||
|
test suite ensures the client works and vice-versa. |
||||||
|
|
||||||
|
Browser tests are run using [zuul](https://github.com/defunctzombie/zuul). You can |
||||||
|
run the tests locally using the following command. |
||||||
|
|
||||||
|
``` |
||||||
|
./node_modules/.bin/zuul --local 8080 -- test/index.js |
||||||
|
``` |
||||||
|
|
||||||
|
Additionally, `engine.io-client` has a standalone test suite you can run |
||||||
|
with `make test` which will run node.js and browser tests. You must have zuul setup with |
||||||
|
a saucelabs account. |
||||||
|
|
||||||
|
## Support |
||||||
|
|
||||||
|
The support channels for `engine.io-client` are the same as `socket.io`: |
||||||
|
- irc.freenode.net **#socket.io** |
||||||
|
- [Google Groups](http://groups.google.com/group/socket_io) |
||||||
|
- [Website](http://socket.io) |
||||||
|
|
||||||
|
## Development |
||||||
|
|
||||||
|
To contribute patches, run tests or benchmarks, make sure to clone the |
||||||
|
repository: |
||||||
|
|
||||||
|
```bash |
||||||
|
git clone git://github.com/socketio/engine.io-client.git |
||||||
|
``` |
||||||
|
|
||||||
|
Then: |
||||||
|
|
||||||
|
```bash |
||||||
|
cd engine.io-client |
||||||
|
npm install |
||||||
|
``` |
||||||
|
|
||||||
|
See the `Tests` section above for how to run tests before submitting any patches. |
||||||
|
|
||||||
|
## License |
||||||
|
|
||||||
|
MIT - Copyright (c) 2014 Automattic, Inc. |
@ -0,0 +1,4 @@ |
|||||||
|
"use strict"; |
||||||
|
Object.defineProperty(exports, "__esModule", { value: true }); |
||||||
|
const socket_js_1 = require("./socket.js"); |
||||||
|
exports.default = (uri, opts) => new socket_js_1.Socket(uri, opts); |
@ -0,0 +1,14 @@ |
|||||||
|
"use strict"; |
||||||
|
Object.defineProperty(exports, "__esModule", { value: true }); |
||||||
|
exports.hasCORS = void 0; |
||||||
|
// imported from https://github.com/component/has-cors
|
||||||
|
let value = false; |
||||||
|
try { |
||||||
|
value = typeof XMLHttpRequest !== 'undefined' && |
||||||
|
'withCredentials' in new XMLHttpRequest(); |
||||||
|
} |
||||||
|
catch (err) { |
||||||
|
// if XMLHttp support is disabled in IE then it will throw
|
||||||
|
// when trying to create
|
||||||
|
} |
||||||
|
exports.hasCORS = value; |
@ -0,0 +1,39 @@ |
|||||||
|
"use strict"; |
||||||
|
// imported from https://github.com/galkn/querystring
|
||||||
|
/** |
||||||
|
* Compiles a querystring |
||||||
|
* Returns string representation of the object |
||||||
|
* |
||||||
|
* @param {Object} |
||||||
|
* @api private |
||||||
|
*/ |
||||||
|
Object.defineProperty(exports, "__esModule", { value: true }); |
||||||
|
exports.decode = exports.encode = void 0; |
||||||
|
function encode(obj) { |
||||||
|
let str = ''; |
||||||
|
for (let i in obj) { |
||||||
|
if (obj.hasOwnProperty(i)) { |
||||||
|
if (str.length) |
||||||
|
str += '&'; |
||||||
|
str += encodeURIComponent(i) + '=' + encodeURIComponent(obj[i]); |
||||||
|
} |
||||||
|
} |
||||||
|
return str; |
||||||
|
} |
||||||
|
exports.encode = encode; |
||||||
|
/** |
||||||
|
* Parses a simple querystring into an object |
||||||
|
* |
||||||
|
* @param {String} qs |
||||||
|
* @api private |
||||||
|
*/ |
||||||
|
function decode(qs) { |
||||||
|
let qry = {}; |
||||||
|
let pairs = qs.split('&'); |
||||||
|
for (let i = 0, l = pairs.length; i < l; i++) { |
||||||
|
let pair = pairs[i].split('='); |
||||||
|
qry[decodeURIComponent(pair[0])] = decodeURIComponent(pair[1]); |
||||||
|
} |
||||||
|
return qry; |
||||||
|
} |
||||||
|
exports.decode = decode; |
@ -0,0 +1,53 @@ |
|||||||
|
"use strict"; |
||||||
|
Object.defineProperty(exports, "__esModule", { value: true }); |
||||||
|
exports.parse = void 0; |
||||||
|
// imported from https://github.com/galkn/parseuri
|
||||||
|
/** |
||||||
|
* Parses an URI |
||||||
|
* |
||||||
|
* @author Steven Levithan <stevenlevithan.com> (MIT license) |
||||||
|
* @api private |
||||||
|
*/ |
||||||
|
const re = /^(?:(?![^:@]+:[^:@\/]*@)(http|https|ws|wss):\/\/)?((?:(([^:@]*)(?::([^:@]*))?)?@)?((?:[a-f0-9]{0,4}:){2,7}[a-f0-9]{0,4}|[^:\/?#]*)(?::(\d*))?)(((\/(?:[^?#](?![^?#\/]*\.[^?#\/.]+(?:[?#]|$)))*\/?)?([^?#\/]*))(?:\?([^#]*))?(?:#(.*))?)/; |
||||||
|
const parts = [ |
||||||
|
'source', 'protocol', 'authority', 'userInfo', 'user', 'password', 'host', 'port', 'relative', 'path', 'directory', 'file', 'query', 'anchor' |
||||||
|
]; |
||||||
|
function parse(str) { |
||||||
|
const src = str, b = str.indexOf('['), e = str.indexOf(']'); |
||||||
|
if (b != -1 && e != -1) { |
||||||
|
str = str.substring(0, b) + str.substring(b, e).replace(/:/g, ';') + str.substring(e, str.length); |
||||||
|
} |
||||||
|
let m = re.exec(str || ''), uri = {}, i = 14; |
||||||
|
while (i--) { |
||||||
|
uri[parts[i]] = m[i] || ''; |
||||||
|
} |
||||||
|
if (b != -1 && e != -1) { |
||||||
|
uri.source = src; |
||||||
|
uri.host = uri.host.substring(1, uri.host.length - 1).replace(/;/g, ':'); |
||||||
|
uri.authority = uri.authority.replace('[', '').replace(']', '').replace(/;/g, ':'); |
||||||
|
uri.ipv6uri = true; |
||||||
|
} |
||||||
|
uri.pathNames = pathNames(uri, uri['path']); |
||||||
|
uri.queryKey = queryKey(uri, uri['query']); |
||||||
|
return uri; |
||||||
|
} |
||||||
|
exports.parse = parse; |
||||||
|
function pathNames(obj, path) { |
||||||
|
const regx = /\/{2,9}/g, names = path.replace(regx, "/").split("/"); |
||||||
|
if (path.substr(0, 1) == '/' || path.length === 0) { |
||||||
|
names.splice(0, 1); |
||||||
|
} |
||||||
|
if (path.substr(path.length - 1, 1) == '/') { |
||||||
|
names.splice(names.length - 1, 1); |
||||||
|
} |
||||||
|
return names; |
||||||
|
} |
||||||
|
function queryKey(uri, query) { |
||||||
|
const data = {}; |
||||||
|
query.replace(/(?:^|&)([^&=]*)=?([^&]*)/g, function ($0, $1, $2) { |
||||||
|
if ($1) { |
||||||
|
data[$1] = $2; |
||||||
|
} |
||||||
|
}); |
||||||
|
return data; |
||||||
|
} |
@ -0,0 +1,55 @@ |
|||||||
|
// imported from https://github.com/unshiftio/yeast
|
||||||
|
'use strict'; |
||||||
|
Object.defineProperty(exports, "__esModule", { value: true }); |
||||||
|
exports.yeast = exports.decode = exports.encode = void 0; |
||||||
|
const alphabet = '0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz-_'.split(''), length = 64, map = {}; |
||||||
|
let seed = 0, i = 0, prev; |
||||||
|
/** |
||||||
|
* Return a string representing the specified number. |
||||||
|
* |
||||||
|
* @param {Number} num The number to convert. |
||||||
|
* @returns {String} The string representation of the number. |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
function encode(num) { |
||||||
|
let encoded = ''; |
||||||
|
do { |
||||||
|
encoded = alphabet[num % length] + encoded; |
||||||
|
num = Math.floor(num / length); |
||||||
|
} while (num > 0); |
||||||
|
return encoded; |
||||||
|
} |
||||||
|
exports.encode = encode; |
||||||
|
/** |
||||||
|
* Return the integer value specified by the given string. |
||||||
|
* |
||||||
|
* @param {String} str The string to convert. |
||||||
|
* @returns {Number} The integer value represented by the string. |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
function decode(str) { |
||||||
|
let decoded = 0; |
||||||
|
for (i = 0; i < str.length; i++) { |
||||||
|
decoded = decoded * length + map[str.charAt(i)]; |
||||||
|
} |
||||||
|
return decoded; |
||||||
|
} |
||||||
|
exports.decode = decode; |
||||||
|
/** |
||||||
|
* Yeast: A tiny growing id generator. |
||||||
|
* |
||||||
|
* @returns {String} A unique id. |
||||||
|
* @api public |
||||||
|
*/ |
||||||
|
function yeast() { |
||||||
|
const now = encode(+new Date()); |
||||||
|
if (now !== prev) |
||||||
|
return seed = 0, prev = now; |
||||||
|
return now + '.' + encode(seed++); |
||||||
|
} |
||||||
|
exports.yeast = yeast; |
||||||
|
//
|
||||||
|
// Map each character to its index.
|
||||||
|
//
|
||||||
|
for (; i < length; i++) |
||||||
|
map[alphabet[i]] = i; |
Some files were not shown because too many files have changed in this diff Show More
Loading…
Reference in new issue