Added Provoke ability to Artifact Axes. Created and began implementation

of Knight and Dark Spider.
This commit is contained in:
sigonasr2 2017-05-22 20:09:14 -05:00
parent 80adc60e12
commit 7bafd04a6e
25 changed files with 3556 additions and 70 deletions

Binary file not shown.

View File

@ -38,6 +38,7 @@ public class ChargeZombie {
Math.abs(z)<outerradius && Math.abs(z)<outerradius &&
(aPlugin.API.isDestroyable(m.getLocation().add(x,y,z).getBlock()) || (aPlugin.API.isDestroyable(m.getLocation().add(x,y,z).getBlock()) ||
m.getLocation().add(x,y,z).getBlock().getType()==Material.OBSIDIAN)) { m.getLocation().add(x,y,z).getBlock().getType()==Material.OBSIDIAN)) {
if (m.getTarget()!=null && m.getTarget().isValid()) {
if (!(y==0 && m.getTarget().getLocation().getY()>m.getLocation().getY()) || !m.getLocation().add(x,y,z).getBlock().getType().isSolid()) { //Player is higher than zombie. Don't break blocks in front of it. Climb up them. Unless it's lava. if (!(y==0 && m.getTarget().getLocation().getY()>m.getLocation().getY()) || !m.getLocation().add(x,y,z).getBlock().getType().isSolid()) { //Player is higher than zombie. Don't break blocks in front of it. Climb up them. Unless it's lava.
if (!(y<0 && (m.getTarget().getLocation().getY()>m.getLocation().getY()-1))) { //Player is lower than zombie. Break blocks below it to get to the player. if (!(y<0 && (m.getTarget().getLocation().getY()>m.getLocation().getY()-1))) { //Player is lower than zombie. Break blocks below it to get to the player.
boolean brokeliquid = false; boolean brokeliquid = false;
@ -63,6 +64,31 @@ public class ChargeZombie {
} }
} }
} }
} else {
if (y>=0) {
boolean brokeliquid = false;
//Break it.
if (ChanceToBreak(m.getLocation().add(x,y,z).getBlock())) {
if (m.getLocation().add(x,y,z).getBlock().getType()==Material.WATER ||
m.getLocation().add(x,y,z).getBlock().getType()==Material.STATIONARY_WATER ||
m.getLocation().add(x,y,z).getBlock().getType()==Material.LAVA ||
m.getLocation().add(x,y,z).getBlock().getType()==Material.STATIONARY_LAVA) {
brokeliquid=true;
if (m.getLocation().add(x,y,z).getBlock().getType()==Material.STATIONARY_LAVA) {
m.getLocation().add(x,y,z).getBlock().setType(Material.OBSIDIAN);
SoundUtils.playGlobalSound(m.getLocation().add(x,y,z),Sound.BLOCK_FIRE_EXTINGUISH, 1f, 1f);
}
}
if (!brokeliquid) {
SoundUtils.playGlobalSound(m.getLocation().add(x,y,z),Sound.BLOCK_STONE_BREAK, 1.0f, 1.0f);
}
m.getLocation().add(x,y,z).getBlock().breakNaturally();
aPlugin.API.sendBlockBreakPacket(m.getLocation().add(x,y,z).getBlock(), -1);
} else {
aPlugin.API.sendBlockBreakPacket(m.getLocation().add(x,y,z).getBlock(), (int)(Math.random()*6)+3);
}
}
}
} else } else
if (Math.abs(x)>=outerradius || if (Math.abs(x)>=outerradius ||
Math.abs(y)>=outerradius+1 || Math.abs(y)>=outerradius+1 ||

View File

@ -76,9 +76,12 @@ import sig.plugin.TwosideKeeper.HelperStructures.Utils.EntityUtils;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.IndicatorType; import sig.plugin.TwosideKeeper.HelperStructures.Utils.IndicatorType;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.SoundUtils; import sig.plugin.TwosideKeeper.HelperStructures.Utils.SoundUtils;
import sig.plugin.TwosideKeeper.HolidayEvents.Christmas; import sig.plugin.TwosideKeeper.HolidayEvents.Christmas;
import sig.plugin.TwosideKeeper.Monster.DarkSpider;
import sig.plugin.TwosideKeeper.Monster.DarkSpiderMinion;
import sig.plugin.TwosideKeeper.Monster.Dummy; import sig.plugin.TwosideKeeper.Monster.Dummy;
import sig.plugin.TwosideKeeper.Monster.HellfireGhast; import sig.plugin.TwosideKeeper.Monster.HellfireGhast;
import sig.plugin.TwosideKeeper.Monster.HellfireSpider; import sig.plugin.TwosideKeeper.Monster.HellfireSpider;
import sig.plugin.TwosideKeeper.Monster.Knight;
public class CustomDamage { public class CustomDamage {
@ -1559,6 +1562,10 @@ public class CustomDamage {
wi.runHitEvent(p, dmg); wi.runHitEvent(p, dmg);
} }
} }
if (TwosideKeeper.custommonsters.containsKey(target.getUniqueId())) {
CustomMonster cm = TwosideKeeper.custommonsters.get(target.getUniqueId());
cm.onHitEvent(p, dmg);
}
if (target instanceof Villager) { if (target instanceof Villager) {
Villager v = (Villager)target; Villager v = (Villager)target;
/*for (UUID id : TwosideKeeper.custommonsters.keySet()) { /*for (UUID id : TwosideKeeper.custommonsters.keySet()) {
@ -1791,6 +1798,26 @@ public class CustomDamage {
addHellfireGhastToList(m); addHellfireGhastToList(m);
addBlazeToList(m); addBlazeToList(m);
addWitherToList(m); addWitherToList(m);
addKnighttoList(m);
removeStraySpiderMinions(m);
}
private static void removeStraySpiderMinions(LivingEntity m) {
if (!TwosideKeeper.custommonsters.containsKey(m.getUniqueId()) &&
DarkSpiderMinion.isDarkSpiderMinion(m)) {
m.remove();
}
}
private static void addKnighttoList(LivingEntity m) {
if (!TwosideKeeper.custommonsters.containsKey(m.getUniqueId()) &&
(Knight.isKnight(m) ||
(m instanceof Skeleton &&
Knight.randomlyConvertAsKnight(m)))) {
TwosideKeeper.custommonsters.put(m.getUniqueId(),new Knight(m));
TwosideKeeper.log("Spawned a new "+LivingEntityStructure.getCustomLivingEntityName(m), 0);
TwosideKeeper.LAST_SPECIAL_SPAWN=TwosideKeeper.getServerTickTime();
}
} }
private static void addWitherToList(LivingEntity m) { private static void addWitherToList(LivingEntity m) {
@ -2298,6 +2325,12 @@ public class CustomDamage {
} }
les.checkedforcubes=true; les.checkedforcubes=true;
} }
if (Knight.isKnight(target)) {
dmgreductiondiv += Knight.getDamageReduction();
} else
if (DarkSpider.isDarkSpider(target)){
dmgreductiondiv += DarkSpider.getDamageReduction();
}
} }
for (int i=0;i<armor.length;i++) { for (int i=0;i<armor.length;i++) {
@ -2824,7 +2857,7 @@ public class CustomDamage {
double headshotvaly=0.22/TwosideKeeper.HEADSHOT_ACC; double headshotvaly=0.22/TwosideKeeper.HEADSHOT_ACC;
TwosideKeeper.log("In here.", 5); TwosideKeeper.log("In here.", 5);
if (proj.getShooter() instanceof Player) { if (proj.getShooter() instanceof Player) {
TwosideKeeper.log("We somehow made it to here???", 0); //TwosideKeeper.log("We somehow made it to here???", 0);
Player p = (Player)proj.getShooter(); Player p = (Player)proj.getShooter();
if (PlayerMode.isRanger(p) && if (PlayerMode.isRanger(p) &&
GenericFunctions.getBowMode(p)==BowMode.SNIPE) { GenericFunctions.getBowMode(p)==BowMode.SNIPE) {

View File

@ -6,6 +6,8 @@ import org.bukkit.entity.LivingEntity;
import org.bukkit.entity.Monster; import org.bukkit.entity.Monster;
import org.bukkit.entity.Player; import org.bukkit.entity.Player;
import sig.plugin.TwosideKeeper.Events.EntityChannelCastEvent;
public class CustomMonster { public class CustomMonster {
protected LivingEntity m; protected LivingEntity m;
@ -48,5 +50,20 @@ public class CustomMonster {
} }
public void customHitHandler(double dmg) { public void customHitHandler(double dmg) {
}
public void onHitEvent(LivingEntity damager, double damage) {
}
public void cleanup() {
}
public void entityCleanup() {
}
public void runChannelCastEvent(EntityChannelCastEvent ev) {
} }
} }

View File

@ -596,6 +596,7 @@ public enum ArtifactAbility {
text=DisplayAbility(COMBO,playerdmgval,targetitem,slot);msg1.addExtra(text);if(!text.getText().equalsIgnoreCase("")){++i;}if(i%4==0){msg1.addExtra("\n");} text=DisplayAbility(COMBO,playerdmgval,targetitem,slot);msg1.addExtra(text);if(!text.getText().equalsIgnoreCase("")){++i;}if(i%4==0){msg1.addExtra("\n");}
} else } else
if (path==UpgradePath.AXE) { if (path==UpgradePath.AXE) {
text=DisplayAbility(PROVOKE,playerdmgval,targetitem,slot);msg1.addExtra(text);if(!text.getText().equalsIgnoreCase("")){++i;}if(i%4==0){msg1.addExtra("\n");}
//text=DisplayAbility(BREAKDOWN,playerdmgval,targetitem,slot);msg1.addExtra(text);if(!text.getText().equalsIgnoreCase("")){++i;}if(i%4==0){msg1.addExtra("\n");} //text=DisplayAbility(BREAKDOWN,playerdmgval,targetitem,slot);msg1.addExtra(text);if(!text.getText().equalsIgnoreCase("")){++i;}if(i%4==0){msg1.addExtra("\n");}
//text=DisplayAbility(BUTCHERY,playerdmgval,targetitem,slot);msg1.addExtra(text);if(!text.getText().equalsIgnoreCase("")){++i;}if(i%4==0){msg1.addExtra("\n");} //text=DisplayAbility(BUTCHERY,playerdmgval,targetitem,slot);msg1.addExtra(text);if(!text.getText().equalsIgnoreCase("")){++i;}if(i%4==0){msg1.addExtra("\n");}
if (TwosideKeeper.NEWARTIFACTABILITIES_ACTIVATED) { if (TwosideKeeper.NEWARTIFACTABILITIES_ACTIVATED) {

View File

@ -115,7 +115,12 @@ public class Channel {
public void setCancelled(boolean isCancelled) { public void setCancelled(boolean isCancelled) {
cancelled=isCancelled; cancelled=isCancelled;
LivingEntityStructure.setChannelingBar(l, "");
if (channelBar!=null) {
channelBar.removeAll();
} }
}
public LivingEntity getLivingEntity() { public LivingEntity getLivingEntity() {
return l; return l;

View File

@ -3683,6 +3683,7 @@ public class GenericFunctions {
if (!Buff.hasBuff(p, "COOLDOWN_UNDYING_RAGE")) { if (!Buff.hasBuff(p, "COOLDOWN_UNDYING_RAGE")) {
Buff.addBuff(p, "UNKILLABLE", new Buff("Unkillable",ItemSet.getHighestTierInSet(p, ItemSet.LEGION)*20+120,0,org.bukkit.Color.PURPLE,ChatColor.YELLOW+"",true)); Buff.addBuff(p, "UNKILLABLE", new Buff("Unkillable",ItemSet.getHighestTierInSet(p, ItemSet.LEGION)*20+120,0,org.bukkit.Color.PURPLE,ChatColor.YELLOW+"",true));
Buff.addBuff(p, "COOLDOWN_UNDYING_RAGE", new Buff("Undying Rage Cooldown",20*60,0,null,ChatColor.WHITE+"",true)); Buff.addBuff(p, "COOLDOWN_UNDYING_RAGE", new Buff("Undying Rage Cooldown",20*60,0,null,ChatColor.WHITE+"",true));
pd.damagepool=0;
} }
} }
//return true; //return true;
@ -3954,7 +3955,11 @@ public class GenericFunctions {
LivingEntityStructure.GetLivingEntityStructure(m).setGlobalGlow(color); LivingEntityStructure.GetLivingEntityStructure(m).setGlobalGlow(color);
} }
public static void DealDamageToNearbyPlayers(Location l, double basedmg, int range, boolean knockup, double knockupamt, Entity damager, String reason, boolean truedmg) { public static List<Player> DealDamageToNearbyPlayers(Location l, double basedmg, int range, boolean knockup, boolean dodgeable, double knockupamt, Entity damager, String reason, boolean truedmg) {
return DealDamageToNearbyPlayers(l,basedmg,range,knockup,dodgeable,knockupamt,damager,reason,truedmg,false);
}
public static List<Player> DealDamageToNearbyPlayers(Location l, double basedmg, int range, boolean knockup, boolean dodgeable, double knockupamt, Entity damager, String reason, boolean truedmg, boolean truepctdmg) {
List<Player> players = getNearbyPlayers(l,range); List<Player> players = getNearbyPlayers(l,range);
//We cleared the non-living entities, deal damage to the rest. //We cleared the non-living entities, deal damage to the rest.
for (Player p : players) { for (Player p : players) {
@ -3962,12 +3967,16 @@ public class GenericFunctions {
/*if (knockup && p.getHealth()>0) { //Prevent knockups if we die to the attack. /*if (knockup && p.getHealth()>0) { //Prevent knockups if we die to the attack.
p.setVelocity(new Vector(0,knockupamt,0)); p.setVelocity(new Vector(0,knockupamt,0));
}*/ }*/
if (CustomDamage.ApplyDamage(basedmg, damager, p, null, reason, (truedmg)?CustomDamage.TRUEDMG:CustomDamage.NONE)) { if (truepctdmg) {
basedmg = p.getMaxHealth()*basedmg;
}
if (CustomDamage.ApplyDamage(basedmg, damager, p, null, reason, (truedmg|truepctdmg)?(CustomDamage.TRUEDMG|CustomDamage.IGNORE_DAMAGE_TICK|(dodgeable?CustomDamage.NONE:CustomDamage.IGNOREDODGE)):CustomDamage.NONE)) {
if (knockup && p.getHealth()>0) { //Prevent knockups if we die to the attack. if (knockup && p.getHealth()>0) { //Prevent knockups if we die to the attack.
p.setVelocity(new Vector(0,knockupamt,0)); p.setVelocity(new Vector(0,knockupamt,0));
} }
} }
} }
return players;
} }
/** /**
@ -4670,7 +4679,6 @@ public class GenericFunctions {
set.add(Material.STATIONARY_WATER); set.add(Material.STATIONARY_WATER);
Block b = player.getTargetBlock(set, 100); Block b = player.getTargetBlock(set, 100);
if (b!=null && b.getType()!=Material.AIR) { if (b!=null && b.getType()!=Material.AIR) {
SoundUtils.playGlobalSound(player.getLocation(), Sound.BLOCK_NOTE_BASS, 1.0f, 1.0f);
Vector dir = player.getLocation().getDirection(); Vector dir = player.getLocation().getDirection();
//player.teleport(); //player.teleport();
Location blockcenter = b.getLocation().add(0.5,0.5,0.5); Location blockcenter = b.getLocation().add(0.5,0.5,0.5);
@ -4707,6 +4715,7 @@ public class GenericFunctions {
blockcenter.getWorld().spawnParticle(Particle.NOTE, teleportloc, 5); blockcenter.getWorld().spawnParticle(Particle.NOTE, teleportloc, 5);
teleportloc.setDirection(dir); teleportloc.setDirection(dir);
player.teleport(teleportloc); player.teleport(teleportloc);
SoundUtils.playGlobalSound(teleportloc, Sound.BLOCK_NOTE_BASS, 1.0f, 1.0f);
PlayerStructure pd = PlayerStructure.GetPlayerStructure(player); PlayerStructure pd = PlayerStructure.GetPlayerStructure(player);
pd.lastusedassassinate=TwosideKeeper.getServerTickTime(); pd.lastusedassassinate=TwosideKeeper.getServerTickTime();
if (name!=Material.SKULL_ITEM || pd.lastlifesavertime+GetModifiedCooldown(TwosideKeeper.LIFESAVER_COOLDOWN,player)<TwosideKeeper.getServerTickTime()) { //Don't overwrite life saver cooldowns. if (name!=Material.SKULL_ITEM || pd.lastlifesavertime+GetModifiedCooldown(TwosideKeeper.LIFESAVER_COOLDOWN,player)<TwosideKeeper.getServerTickTime()) { //Don't overwrite life saver cooldowns.

View File

@ -0,0 +1,65 @@
package sig.plugin.TwosideKeeper.HelperStructures.Effects;
import org.bukkit.Effect;
import org.bukkit.Location;
import org.bukkit.Particle;
import org.bukkit.entity.LivingEntity;
import org.bukkit.entity.Player;
import sig.plugin.TwosideKeeper.TwosideKeeper;
import sig.plugin.TwosideKeeper.HelperStructures.Common.GenericFunctions;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.Classes.ColoredParticle;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.Classes.MixedDamage;
public class DarkSlash extends WindSlash{
final static int EFFECT_DENSITY = 10;
final static Particle EFFECT_PARTICLE = Particle.ENCHANTMENT_TABLE;
final static float SPEED_MULT = 2.5f;
public DarkSlash(Location loc, LivingEntity l, MixedDamage dmg, int tick_duration) {
super(loc, l, dmg, tick_duration);
}
public boolean runTick() {
if (!moveWindSlash()) {
return false;
}
createParticles();
damageNearbyTargets();
if (TwosideKeeper.getServerTickTime()>death_time) {
return false;
}
return true;
}
protected void createParticles() {
//loc.getWorld().spawnParticle(Particle.END_ROD, loc.clone().add(0,-SLASH_SIZE/2,0), 4);
for (int i=0;i<EFFECT_DENSITY;i++) {
Location randloc = loc.clone();
loc.getWorld().spawnParticle(EFFECT_PARTICLE, randloc.add(randloc.getDirection().setY(randloc.getDirection().getY()*2).multiply(Math.random())).clone().add(0,-SLASH_SIZE/2,0), 1);
}
//loc.getWorld().playEffect(loc.clone().add(0,-SLASH_SIZE/2,0), Effect.DRAGON_BREATH, 4);
//loc.getWorld().playEffect(loc.clone().add(0,-SLASH_SIZE/2,0), Effect.COLOURED_DUST, 20);
Location baseloc = loc.clone();
final int density=100;
final int height=30;
for (int j=0;j<density;j++) {
for (int i=0;i<height;i++) {
ColoredParticle.RED_DUST.send(baseloc.clone().add(0,-SLASH_SIZE/2,0).add(0,(2d/height)*i,0)
, 20, 0, 0, 255);
}
baseloc.add(baseloc.getDirection().multiply(SPEED_MULT/density));
}
}
private void damageNearbyTargets() {
//GenericFunctions.DealDamageToNearbyMobs(loc, dmg, SLASH_SIZE, false, 0, sourcep, sourcep.getEquipment().getItemInMainHand(), false, "Dark Slash");
GenericFunctions.DealDamageToNearbyPlayers(loc, dmg.getDmgComponent(), SLASH_SIZE, false, true, 0, l, "Dark Slash", false, false);
if (dmg.getTruePctDmgComponent()>0) {GenericFunctions.DealDamageToNearbyPlayers(loc, dmg.getTruePctDmgComponent(), SLASH_SIZE, false, true, 0, l, "Dark Slash", false, true);}
if (dmg.getTrueDmgComponent()>0) {GenericFunctions.DealDamageToNearbyPlayers(loc, dmg.getTrueDmgComponent(), SLASH_SIZE, false, true, 0, l, "Dark Slash", true, false);}
}
}

View File

@ -195,10 +195,9 @@ public class TemporaryBlock {
public static boolean isTemporaryBlock(Block b) { public static boolean isTemporaryBlock(Block b) {
return TwosideKeeper.temporaryblocks.containsKey(TemporaryBlock.getLocationKey(b)); return TwosideKeeper.temporaryblocks.containsKey(TemporaryBlock.getLocationKey(b));
} }
@Deprecated
public static boolean isStandingOnSpecialBlock(Location l, String specialKey) { public static boolean isStandingOnSpecialBlock(Location l, String specialKey) {
//return TwosideKeeper.temporaryblocks.containsKey(TemporaryBlock.getLocationKey(b)); //return TwosideKeeper.temporaryblocks.containsKey(TemporaryBlock.getLocationKey(b));
Block b = l.getBlock(); Block b = l.getBlock().getRelative(0, -1, 0);
//TwosideKeeper.log(b.toString(), 0); //TwosideKeeper.log(b.toString(), 0);
if (b!=null) { if (b!=null) {
return TwosideKeeper.temporaryblocks.containsKey(TemporaryBlock.getLocationKey(b,specialKey)); return TwosideKeeper.temporaryblocks.containsKey(TemporaryBlock.getLocationKey(b,specialKey));
@ -206,7 +205,6 @@ public class TemporaryBlock {
return false; return false;
} }
} }
@Deprecated
public static boolean isInRangeOfSpecialBlock(Location l, double range, String specialKey) { public static boolean isInRangeOfSpecialBlock(Location l, double range, String specialKey) {
Block b = l.getBlock(); Block b = l.getBlock();
//TwosideKeeper.log(b.toString(), 0); //TwosideKeeper.log(b.toString(), 0);

View File

@ -3,6 +3,7 @@ package sig.plugin.TwosideKeeper.HelperStructures.Effects;
import org.bukkit.Location; import org.bukkit.Location;
import org.bukkit.Particle; import org.bukkit.Particle;
import org.bukkit.Sound; import org.bukkit.Sound;
import org.bukkit.entity.LivingEntity;
import org.bukkit.entity.Player; import org.bukkit.entity.Player;
import org.bukkit.util.Vector; import org.bukkit.util.Vector;
@ -11,11 +12,13 @@ import sig.plugin.TwosideKeeper.TwosideKeeper;
import sig.plugin.TwosideKeeper.HelperStructures.Common.GenericFunctions; import sig.plugin.TwosideKeeper.HelperStructures.Common.GenericFunctions;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.BlockUtils; import sig.plugin.TwosideKeeper.HelperStructures.Utils.BlockUtils;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.SoundUtils; import sig.plugin.TwosideKeeper.HelperStructures.Utils.SoundUtils;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.Classes.MixedDamage;
public class WindSlash { public class WindSlash {
Location loc; Location loc;
Player sourcep; Player sourcep;
double dmg; LivingEntity l;
MixedDamage dmg;
long lasteffect; long lasteffect;
long death_time; long death_time;
final static int EFFECT_DENSITY = 20; final static int EFFECT_DENSITY = 20;
@ -27,6 +30,15 @@ public class WindSlash {
public WindSlash(Location loc, Player p, double dmg, int tick_duration) { public WindSlash(Location loc, Player p, double dmg, int tick_duration) {
this.loc=loc.clone().add(0,p.getEyeHeight(),0); this.loc=loc.clone().add(0,p.getEyeHeight(),0);
this.sourcep=p; this.sourcep=p;
this.dmg=MixedDamage.v(dmg);
this.death_time = TwosideKeeper.getServerTickTime()+tick_duration;
this.lasteffect=TwosideKeeper.getServerTickTime();
SoundUtils.playGlobalSound(loc,Sound.BLOCK_PORTAL_TRIGGER, 0.2f, 2.0f);
}
public WindSlash(Location loc, LivingEntity l, MixedDamage dmg, int tick_duration) {
this.loc=loc.clone().add(0,l.getEyeHeight(),0);
this.l=l;
this.dmg=dmg; this.dmg=dmg;
this.death_time = TwosideKeeper.getServerTickTime()+tick_duration; this.death_time = TwosideKeeper.getServerTickTime()+tick_duration;
this.lasteffect=TwosideKeeper.getServerTickTime(); this.lasteffect=TwosideKeeper.getServerTickTime();
@ -46,10 +58,10 @@ public class WindSlash {
} }
private void damageNearbyTargets() { private void damageNearbyTargets() {
GenericFunctions.DealDamageToNearbyMobs(loc, dmg, SLASH_SIZE, false, 0, sourcep, sourcep.getEquipment().getItemInMainHand(), false, "Wind Slash"); GenericFunctions.DealDamageToNearbyMobs(loc, dmg.getDmgComponent(), SLASH_SIZE, false, 0, sourcep, sourcep.getEquipment().getItemInMainHand(), false, "Wind Slash");
} }
private boolean moveWindSlash() { protected boolean moveWindSlash() {
Location origloc = loc.clone(); Location origloc = loc.clone();
Vector move = origloc.getDirection().setY(origloc.getDirection().getY()/1.4).multiply(SPEED_MULT); Vector move = origloc.getDirection().setY(origloc.getDirection().getY()/1.4).multiply(SPEED_MULT);
float dist = SPEED_MULT; float dist = SPEED_MULT;
@ -64,7 +76,7 @@ public class WindSlash {
//TwosideKeeper.log("New Location: "+loc, 0); //TwosideKeeper.log("New Location: "+loc, 0);
} }
private void createParticles() { protected void createParticles() {
loc.getWorld().spawnParticle(Particle.SWEEP_ATTACK, loc.clone().add(0,-SLASH_SIZE/2,0), 2); loc.getWorld().spawnParticle(Particle.SWEEP_ATTACK, loc.clone().add(0,-SLASH_SIZE/2,0), 2);
for (int i=0;i<EFFECT_DENSITY;i++) { for (int i=0;i<EFFECT_DENSITY;i++) {
Location randloc = loc.clone(); Location randloc = loc.clone();

View File

@ -28,7 +28,10 @@ public enum LivingEntityDifficulty {
DEADLY(1000,ChatColor.GOLD+"Deadly"), DEADLY(1000,ChatColor.GOLD+"Deadly"),
HELLFIRE(5000,ChatColor.DARK_RED+"Hellfire"), HELLFIRE(5000,ChatColor.DARK_RED+"Hellfire"),
ELITE(10000,ChatColor.DARK_PURPLE+"Elite"), ELITE(10000,ChatColor.DARK_PURPLE+"Elite"),
END(6000,ChatColor.DARK_BLUE+""+ChatColor.MAGIC+"End"); END(6000,ChatColor.DARK_BLUE+""+ChatColor.MAGIC+"End"),
T1_MINIBOSS(9000,ChatColor.GOLD+""+ChatColor.BOLD+"T1"+ChatColor.RESET),
T2_MINIBOSS(9010,ChatColor.GOLD+""+ChatColor.BOLD+"T2"+ChatColor.RESET),
T3_MINIBOSS(9020,ChatColor.GOLD+""+ChatColor.BOLD+"T3"+ChatColor.RESET);
int rating; int rating;
String difficultyString; String difficultyString;

View File

@ -0,0 +1,52 @@
package sig.plugin.TwosideKeeper.HelperStructures;
import sig.plugin.TwosideKeeper.TwosideKeeper;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.Classes.MixedDamage;
public class Spell {
String name;
int[] cast_time;
int[] cooldown_time;
MixedDamage[] damage;
long last_casted_spell;
public Spell(String name, int[] cast_time, int[] cooldowns) {
this.name=name;
this.cast_time=cast_time;
this.cooldown_time=cooldowns;
this.damage=null;
this.last_casted_spell=TwosideKeeper.getServerTickTime();
}
public Spell(String name, int[] cast_time, int[] cooldowns, MixedDamage[] damage) {
this.name=name;
this.cast_time=cast_time;
this.cooldown_time=cooldowns;
this.damage=damage;
this.last_casted_spell=TwosideKeeper.getServerTickTime();
}
public String getName() {
return name;
}
public int[] getCastTimes() {
return cast_time;
}
public int[] getCooldowns() {
return cooldown_time;
}
public MixedDamage[] getDamageValues() {
return damage;
}
public long getLastCastedTime() {
return last_casted_spell;
}
public void setLastCastedTime(long time) {
last_casted_spell = time;
}
}

View File

@ -0,0 +1,23 @@
package sig.plugin.TwosideKeeper.HelperStructures.Utils.Classes;
import java.util.List;
import org.bukkit.Location;
import org.bukkit.entity.Player;
public enum ColoredParticle {
MOB_SPELL("SPELL_MOB"), MOB_SPELL_AMBIENT("SPELL_MOB_AMBIENT"), RED_DUST("REDSTONE");
private ColoredParticle(String name) {
this.name = name;
}
String name;
public void send(Location location, List<Player> players, int r, int g, int b) {
ParticleEffect.valueOf(name).display(r/255, g / 255, b / 255, 1, 0, location, players);
}
public void send(Location location, int Distance, int r, int g, int b) {
ParticleEffect.valueOf(name).display(r/255, g / 255, b / 255, 1, 0, location, Distance);
}
}

View File

@ -0,0 +1,48 @@
package sig.plugin.TwosideKeeper.HelperStructures.Utils.Classes;
public class MixedDamage {
double dmgcomponent;
double truepctdmgcomponent;
double truedmgcomponent;
public MixedDamage(double dmg) {
this.dmgcomponent=dmg;
this.truepctdmgcomponent=0;
this.truedmgcomponent=0;
}
public MixedDamage(double dmg,double truepctdmg) {
this.dmgcomponent=dmg;
this.truepctdmgcomponent=truepctdmg;
this.truedmgcomponent=0;
}
public MixedDamage(double dmg,double truepctdmg,double truedmg) {
this.dmgcomponent=dmg;
this.truepctdmgcomponent=truepctdmg;
this.truedmgcomponent=truedmg;
}
public static MixedDamage v(double dmg) {
return new MixedDamage(dmg);
}
public static MixedDamage v(double dmg,double truepctdmg) {
return new MixedDamage(dmg,truepctdmg);
}
public static MixedDamage v(double dmg,double truepctdmg,double truedmg) {
return new MixedDamage(dmg,truepctdmg,truedmg);
}
public double getDmgComponent() {
return dmgcomponent;
}
public double getTruePctDmgComponent() {
return truepctdmgcomponent;
}
public double getTrueDmgComponent() {
return truedmgcomponent;
}
public boolean hasTruePctDmgComponent() {
return truepctdmgcomponent>0;
}
public boolean hasTrueDmgComponent() {
return truedmgcomponent>0;
}
}

File diff suppressed because it is too large Load Diff

View File

@ -0,0 +1,605 @@
package sig.plugin.TwosideKeeper.HelperStructures.Utils.Classes;
import java.lang.reflect.Constructor;
import java.lang.reflect.Field;
import java.lang.reflect.InvocationTargetException;
import java.lang.reflect.Method;
import java.util.HashMap;
import java.util.Map;
import org.bukkit.Bukkit;
/**
* <b>ReflectionUtils</b>
* <p>
* This class provides useful methods which makes dealing with reflection much easier, especially when working with Bukkit
* <p>
* You are welcome to use it, modify it and redistribute it under the following conditions:
* <ul>
* <li>Don't claim this class as your own
* <li>Don't remove this disclaimer
* </ul>
* <p>
* <i>It would be nice if you provide credit to me if you use this class in a published project</i>
*
* @author DarkBlade12
* @version 1.1
*/
public final class ReflectionUtils {
// Prevent accidental construction
private ReflectionUtils() {}
/**
* Returns the constructor of a given class with the given parameter types
*
* @param clazz Target class
* @param parameterTypes Parameter types of the desired constructor
* @return The constructor of the target class with the specified parameter types
* @throws NoSuchMethodException If the desired constructor with the specified parameter types cannot be found
* @see DataType
* @see DataType#getPrimitive(Class[])
* @see DataType#compare(Class[], Class[])
*/
public static Constructor<?> getConstructor(Class<?> clazz, Class<?>... parameterTypes) throws NoSuchMethodException {
Class<?>[] primitiveTypes = DataType.getPrimitive(parameterTypes);
for (Constructor<?> constructor : clazz.getConstructors()) {
if (!DataType.compare(DataType.getPrimitive(constructor.getParameterTypes()), primitiveTypes)) {
continue;
}
return constructor;
}
throw new NoSuchMethodException("There is no such constructor in this class with the specified parameter types");
}
/**
* Returns the constructor of a desired class with the given parameter types
*
* @param className Name of the desired target class
* @param packageType Package where the desired target class is located
* @param parameterTypes Parameter types of the desired constructor
* @return The constructor of the desired target class with the specified parameter types
* @throws NoSuchMethodException If the desired constructor with the specified parameter types cannot be found
* @throws ClassNotFoundException ClassNotFoundException If the desired target class with the specified name and package cannot be found
* @see #getClass(String, PackageType)
* @see #getConstructor(Class, Class...)
*/
public static Constructor<?> getConstructor(String className, PackageType packageType, Class<?>... parameterTypes) throws NoSuchMethodException, ClassNotFoundException {
return getConstructor(packageType.getClass(className), parameterTypes);
}
/**
* Returns an instance of a class with the given arguments
*
* @param clazz Target class
* @param arguments Arguments which are used to construct an object of the target class
* @return The instance of the target class with the specified arguments
* @throws InstantiationException If you cannot create an instance of the target class due to certain circumstances
* @throws IllegalAccessException If the desired constructor cannot be accessed due to certain circumstances
* @throws IllegalArgumentException If the types of the arguments do not match the parameter types of the constructor (this should not occur since it searches for a constructor with the types of the arguments)
* @throws InvocationTargetException If the desired constructor cannot be invoked
* @throws NoSuchMethodException If the desired constructor with the specified arguments cannot be found
*/
public static Object instantiateObject(Class<?> clazz, Object... arguments) throws InstantiationException, IllegalAccessException, IllegalArgumentException, InvocationTargetException, NoSuchMethodException {
return getConstructor(clazz, DataType.getPrimitive(arguments)).newInstance(arguments);
}
/**
* Returns an instance of a desired class with the given arguments
*
* @param className Name of the desired target class
* @param packageType Package where the desired target class is located
* @param arguments Arguments which are used to construct an object of the desired target class
* @return The instance of the desired target class with the specified arguments
* @throws InstantiationException If you cannot create an instance of the desired target class due to certain circumstances
* @throws IllegalAccessException If the desired constructor cannot be accessed due to certain circumstances
* @throws IllegalArgumentException If the types of the arguments do not match the parameter types of the constructor (this should not occur since it searches for a constructor with the types of the arguments)
* @throws InvocationTargetException If the desired constructor cannot be invoked
* @throws NoSuchMethodException If the desired constructor with the specified arguments cannot be found
* @throws ClassNotFoundException If the desired target class with the specified name and package cannot be found
* @see #getClass(String, PackageType)
* @see #instantiateObject(Class, Object...)
*/
public static Object instantiateObject(String className, PackageType packageType, Object... arguments) throws InstantiationException, IllegalAccessException, IllegalArgumentException, InvocationTargetException, NoSuchMethodException, ClassNotFoundException {
return instantiateObject(packageType.getClass(className), arguments);
}
/**
* Returns a method of a class with the given parameter types
*
* @param clazz Target class
* @param methodName Name of the desired method
* @param parameterTypes Parameter types of the desired method
* @return The method of the target class with the specified name and parameter types
* @throws NoSuchMethodException If the desired method of the target class with the specified name and parameter types cannot be found
* @see DataType#getPrimitive(Class[])
* @see DataType#compare(Class[], Class[])
*/
public static Method getMethod(Class<?> clazz, String methodName, Class<?>... parameterTypes) throws NoSuchMethodException {
Class<?>[] primitiveTypes = DataType.getPrimitive(parameterTypes);
for (Method method : clazz.getMethods()) {
if (!method.getName().equals(methodName) || !DataType.compare(DataType.getPrimitive(method.getParameterTypes()), primitiveTypes)) {
continue;
}
return method;
}
throw new NoSuchMethodException("There is no such method in this class with the specified name and parameter types");
}
/**
* Returns a method of a desired class with the given parameter types
*
* @param className Name of the desired target class
* @param packageType Package where the desired target class is located
* @param methodName Name of the desired method
* @param parameterTypes Parameter types of the desired method
* @return The method of the desired target class with the specified name and parameter types
* @throws NoSuchMethodException If the desired method of the desired target class with the specified name and parameter types cannot be found
* @throws ClassNotFoundException If the desired target class with the specified name and package cannot be found
* @see #getClass(String, PackageType)
* @see #getMethod(Class, String, Class...)
*/
public static Method getMethod(String className, PackageType packageType, String methodName, Class<?>... parameterTypes) throws NoSuchMethodException, ClassNotFoundException {
return getMethod(packageType.getClass(className), methodName, parameterTypes);
}
/**
* Invokes a method on an object with the given arguments
*
* @param instance Target object
* @param methodName Name of the desired method
* @param arguments Arguments which are used to invoke the desired method
* @return The result of invoking the desired method on the target object
* @throws IllegalAccessException If the desired method cannot be accessed due to certain circumstances
* @throws IllegalArgumentException If the types of the arguments do not match the parameter types of the method (this should not occur since it searches for a method with the types of the arguments)
* @throws InvocationTargetException If the desired method cannot be invoked on the target object
* @throws NoSuchMethodException If the desired method of the class of the target object with the specified name and arguments cannot be found
* @see #getMethod(Class, String, Class...)
* @see DataType#getPrimitive(Object[])
*/
public static Object invokeMethod(Object instance, String methodName, Object... arguments) throws IllegalAccessException, IllegalArgumentException, InvocationTargetException, NoSuchMethodException {
return getMethod(instance.getClass(), methodName, DataType.getPrimitive(arguments)).invoke(instance, arguments);
}
/**
* Invokes a method of the target class on an object with the given arguments
*
* @param instance Target object
* @param clazz Target class
* @param methodName Name of the desired method
* @param arguments Arguments which are used to invoke the desired method
* @return The result of invoking the desired method on the target object
* @throws IllegalAccessException If the desired method cannot be accessed due to certain circumstances
* @throws IllegalArgumentException If the types of the arguments do not match the parameter types of the method (this should not occur since it searches for a method with the types of the arguments)
* @throws InvocationTargetException If the desired method cannot be invoked on the target object
* @throws NoSuchMethodException If the desired method of the target class with the specified name and arguments cannot be found
* @see #getMethod(Class, String, Class...)
* @see DataType#getPrimitive(Object[])
*/
public static Object invokeMethod(Object instance, Class<?> clazz, String methodName, Object... arguments) throws IllegalAccessException, IllegalArgumentException, InvocationTargetException, NoSuchMethodException {
return getMethod(clazz, methodName, DataType.getPrimitive(arguments)).invoke(instance, arguments);
}
/**
* Invokes a method of a desired class on an object with the given arguments
*
* @param instance Target object
* @param className Name of the desired target class
* @param packageType Package where the desired target class is located
* @param methodName Name of the desired method
* @param arguments Arguments which are used to invoke the desired method
* @return The result of invoking the desired method on the target object
* @throws IllegalAccessException If the desired method cannot be accessed due to certain circumstances
* @throws IllegalArgumentException If the types of the arguments do not match the parameter types of the method (this should not occur since it searches for a method with the types of the arguments)
* @throws InvocationTargetException If the desired method cannot be invoked on the target object
* @throws NoSuchMethodException If the desired method of the desired target class with the specified name and arguments cannot be found
* @throws ClassNotFoundException If the desired target class with the specified name and package cannot be found
* @see #getClass(String, PackageType)
* @see #invokeMethod(Object, Class, String, Object...)
*/
public static Object invokeMethod(Object instance, String className, PackageType packageType, String methodName, Object... arguments) throws IllegalAccessException, IllegalArgumentException, InvocationTargetException, NoSuchMethodException, ClassNotFoundException {
return invokeMethod(instance, packageType.getClass(className), methodName, arguments);
}
/**
* Returns a field of the target class with the given name
*
* @param clazz Target class
* @param declared Whether the desired field is declared or not
* @param fieldName Name of the desired field
* @return The field of the target class with the specified name
* @throws NoSuchFieldException If the desired field of the given class cannot be found
* @throws SecurityException If the desired field cannot be made accessible
*/
public static Field getField(Class<?> clazz, boolean declared, String fieldName) throws NoSuchFieldException, SecurityException {
Field field = declared ? clazz.getDeclaredField(fieldName) : clazz.getField(fieldName);
field.setAccessible(true);
return field;
}
/**
* Returns a field of a desired class with the given name
*
* @param className Name of the desired target class
* @param packageType Package where the desired target class is located
* @param declared Whether the desired field is declared or not
* @param fieldName Name of the desired field
* @return The field of the desired target class with the specified name
* @throws NoSuchFieldException If the desired field of the desired class cannot be found
* @throws SecurityException If the desired field cannot be made accessible
* @throws ClassNotFoundException If the desired target class with the specified name and package cannot be found
* @see #getField(Class, boolean, String)
*/
public static Field getField(String className, PackageType packageType, boolean declared, String fieldName) throws NoSuchFieldException, SecurityException, ClassNotFoundException {
return getField(packageType.getClass(className), declared, fieldName);
}
/**
* Returns the value of a field of the given class of an object
*
* @param instance Target object
* @param clazz Target class
* @param declared Whether the desired field is declared or not
* @param fieldName Name of the desired field
* @return The value of field of the target object
* @throws IllegalArgumentException If the target object does not feature the desired field
* @throws IllegalAccessException If the desired field cannot be accessed
* @throws NoSuchFieldException If the desired field of the target class cannot be found
* @throws SecurityException If the desired field cannot be made accessible
* @see #getField(Class, boolean, String)
*/
public static Object getValue(Object instance, Class<?> clazz, boolean declared, String fieldName) throws IllegalArgumentException, IllegalAccessException, NoSuchFieldException, SecurityException {
return getField(clazz, declared, fieldName).get(instance);
}
/**
* Returns the value of a field of a desired class of an object
*
* @param instance Target object
* @param className Name of the desired target class
* @param packageType Package where the desired target class is located
* @param declared Whether the desired field is declared or not
* @param fieldName Name of the desired field
* @return The value of field of the target object
* @throws IllegalArgumentException If the target object does not feature the desired field
* @throws IllegalAccessException If the desired field cannot be accessed
* @throws NoSuchFieldException If the desired field of the desired class cannot be found
* @throws SecurityException If the desired field cannot be made accessible
* @throws ClassNotFoundException If the desired target class with the specified name and package cannot be found
* @see #getValue(Object, Class, boolean, String)
*/
public static Object getValue(Object instance, String className, PackageType packageType, boolean declared, String fieldName) throws IllegalArgumentException, IllegalAccessException, NoSuchFieldException, SecurityException, ClassNotFoundException {
return getValue(instance, packageType.getClass(className), declared, fieldName);
}
/**
* Returns the value of a field with the given name of an object
*
* @param instance Target object
* @param declared Whether the desired field is declared or not
* @param fieldName Name of the desired field
* @return The value of field of the target object
* @throws IllegalArgumentException If the target object does not feature the desired field (should not occur since it searches for a field with the given name in the class of the object)
* @throws IllegalAccessException If the desired field cannot be accessed
* @throws NoSuchFieldException If the desired field of the target object cannot be found
* @throws SecurityException If the desired field cannot be made accessible
* @see #getValue(Object, Class, boolean, String)
*/
public static Object getValue(Object instance, boolean declared, String fieldName) throws IllegalArgumentException, IllegalAccessException, NoSuchFieldException, SecurityException {
return getValue(instance, instance.getClass(), declared, fieldName);
}
/**
* Sets the value of a field of the given class of an object
*
* @param instance Target object
* @param clazz Target class
* @param declared Whether the desired field is declared or not
* @param fieldName Name of the desired field
* @param value New value
* @throws IllegalArgumentException If the type of the value does not match the type of the desired field
* @throws IllegalAccessException If the desired field cannot be accessed
* @throws NoSuchFieldException If the desired field of the target class cannot be found
* @throws SecurityException If the desired field cannot be made accessible
* @see #getField(Class, boolean, String)
*/
public static void setValue(Object instance, Class<?> clazz, boolean declared, String fieldName, Object value) throws IllegalArgumentException, IllegalAccessException, NoSuchFieldException, SecurityException {
getField(clazz, declared, fieldName).set(instance, value);
}
/**
* Sets the value of a field of a desired class of an object
*
* @param instance Target object
* @param className Name of the desired target class
* @param packageType Package where the desired target class is located
* @param declared Whether the desired field is declared or not
* @param fieldName Name of the desired field
* @param value New value
* @throws IllegalArgumentException If the type of the value does not match the type of the desired field
* @throws IllegalAccessException If the desired field cannot be accessed
* @throws NoSuchFieldException If the desired field of the desired class cannot be found
* @throws SecurityException If the desired field cannot be made accessible
* @throws ClassNotFoundException If the desired target class with the specified name and package cannot be found
* @see #setValue(Object, Class, boolean, String, Object)
*/
public static void setValue(Object instance, String className, PackageType packageType, boolean declared, String fieldName, Object value) throws IllegalArgumentException, IllegalAccessException, NoSuchFieldException, SecurityException, ClassNotFoundException {
setValue(instance, packageType.getClass(className), declared, fieldName, value);
}
/**
* Sets the value of a field with the given name of an object
*
* @param instance Target object
* @param declared Whether the desired field is declared or not
* @param fieldName Name of the desired field
* @param value New value
* @throws IllegalArgumentException If the type of the value does not match the type of the desired field
* @throws IllegalAccessException If the desired field cannot be accessed
* @throws NoSuchFieldException If the desired field of the target object cannot be found
* @throws SecurityException If the desired field cannot be made accessible
* @see #setValue(Object, Class, boolean, String, Object)
*/
public static void setValue(Object instance, boolean declared, String fieldName, Object value) throws IllegalArgumentException, IllegalAccessException, NoSuchFieldException, SecurityException {
setValue(instance, instance.getClass(), declared, fieldName, value);
}
/**
* Represents an enumeration of dynamic packages of NMS and CraftBukkit
* <p>
* This class is part of the <b>ReflectionUtils</b> and follows the same usage conditions
*
* @author DarkBlade12
* @since 1.0
*/
public enum PackageType {
MINECRAFT_SERVER("net.minecraft.server." + getServerVersion()),
CRAFTBUKKIT("org.bukkit.craftbukkit." + getServerVersion()),
CRAFTBUKKIT_BLOCK(CRAFTBUKKIT, "block"),
CRAFTBUKKIT_CHUNKIO(CRAFTBUKKIT, "chunkio"),
CRAFTBUKKIT_COMMAND(CRAFTBUKKIT, "command"),
CRAFTBUKKIT_CONVERSATIONS(CRAFTBUKKIT, "conversations"),
CRAFTBUKKIT_ENCHANTMENS(CRAFTBUKKIT, "enchantments"),
CRAFTBUKKIT_ENTITY(CRAFTBUKKIT, "entity"),
CRAFTBUKKIT_EVENT(CRAFTBUKKIT, "event"),
CRAFTBUKKIT_GENERATOR(CRAFTBUKKIT, "generator"),
CRAFTBUKKIT_HELP(CRAFTBUKKIT, "help"),
CRAFTBUKKIT_INVENTORY(CRAFTBUKKIT, "inventory"),
CRAFTBUKKIT_MAP(CRAFTBUKKIT, "map"),
CRAFTBUKKIT_METADATA(CRAFTBUKKIT, "metadata"),
CRAFTBUKKIT_POTION(CRAFTBUKKIT, "potion"),
CRAFTBUKKIT_PROJECTILES(CRAFTBUKKIT, "projectiles"),
CRAFTBUKKIT_SCHEDULER(CRAFTBUKKIT, "scheduler"),
CRAFTBUKKIT_SCOREBOARD(CRAFTBUKKIT, "scoreboard"),
CRAFTBUKKIT_UPDATER(CRAFTBUKKIT, "updater"),
CRAFTBUKKIT_UTIL(CRAFTBUKKIT, "util");
private final String path;
/**
* Construct a new package type
*
* @param path Path of the package
*/
private PackageType(String path) {
this.path = path;
}
/**
* Construct a new package type
*
* @param parent Parent package of the package
* @param path Path of the package
*/
private PackageType(PackageType parent, String path) {
this(parent + "." + path);
}
/**
* Returns the path of this package type
*
* @return The path
*/
public String getPath() {
return path;
}
/**
* Returns the class with the given name
*
* @param className Name of the desired class
* @return The class with the specified name
* @throws ClassNotFoundException If the desired class with the specified name and package cannot be found
*/
public Class<?> getClass(String className) throws ClassNotFoundException {
return Class.forName(this + "." + className);
}
// Override for convenience
@Override
public String toString() {
return path;
}
/**
* Returns the version of your server
*
* @return The server version
*/
public static String getServerVersion() {
return Bukkit.getServer().getClass().getPackage().getName().substring(23);
}
}
/**
* Represents an enumeration of Java data types with corresponding classes
* <p>
* This class is part of the <b>ReflectionUtils</b> and follows the same usage conditions
*
* @author DarkBlade12
* @since 1.0
*/
public enum DataType {
BYTE(byte.class, Byte.class),
SHORT(short.class, Short.class),
INTEGER(int.class, Integer.class),
LONG(long.class, Long.class),
CHARACTER(char.class, Character.class),
FLOAT(float.class, Float.class),
DOUBLE(double.class, Double.class),
BOOLEAN(boolean.class, Boolean.class);
private static final Map<Class<?>, DataType> CLASS_MAP = new HashMap<Class<?>, DataType>();
private final Class<?> primitive;
private final Class<?> reference;
// Initialize map for quick class lookup
static {
for (DataType type : values()) {
CLASS_MAP.put(type.primitive, type);
CLASS_MAP.put(type.reference, type);
}
}
/**
* Construct a new data type
*
* @param primitive Primitive class of this data type
* @param reference Reference class of this data type
*/
private DataType(Class<?> primitive, Class<?> reference) {
this.primitive = primitive;
this.reference = reference;
}
/**
* Returns the primitive class of this data type
*
* @return The primitive class
*/
public Class<?> getPrimitive() {
return primitive;
}
/**
* Returns the reference class of this data type
*
* @return The reference class
*/
public Class<?> getReference() {
return reference;
}
/**
* Returns the data type with the given primitive/reference class
*
* @param clazz Primitive/Reference class of the data type
* @return The data type
*/
public static DataType fromClass(Class<?> clazz) {
return CLASS_MAP.get(clazz);
}
/**
* Returns the primitive class of the data type with the given reference class
*
* @param clazz Reference class of the data type
* @return The primitive class
*/
public static Class<?> getPrimitive(Class<?> clazz) {
DataType type = fromClass(clazz);
return type == null ? clazz : type.getPrimitive();
}
/**
* Returns the reference class of the data type with the given primitive class
*
* @param clazz Primitive class of the data type
* @return The reference class
*/
public static Class<?> getReference(Class<?> clazz) {
DataType type = fromClass(clazz);
return type == null ? clazz : type.getReference();
}
/**
* Returns the primitive class array of the given class array
*
* @param classes Given class array
* @return The primitive class array
*/
public static Class<?>[] getPrimitive(Class<?>[] classes) {
int length = classes == null ? 0 : classes.length;
Class<?>[] types = new Class<?>[length];
for (int index = 0; index < length; index++) {
types[index] = getPrimitive(classes[index]);
}
return types;
}
/**
* Returns the reference class array of the given class array
*
* @param classes Given class array
* @return The reference class array
*/
public static Class<?>[] getReference(Class<?>[] classes) {
int length = classes == null ? 0 : classes.length;
Class<?>[] types = new Class<?>[length];
for (int index = 0; index < length; index++) {
types[index] = getReference(classes[index]);
}
return types;
}
/**
* Returns the primitive class array of the given object array
*
* @param object Given object array
* @return The primitive class array
*/
public static Class<?>[] getPrimitive(Object[] objects) {
int length = objects == null ? 0 : objects.length;
Class<?>[] types = new Class<?>[length];
for (int index = 0; index < length; index++) {
types[index] = getPrimitive(objects[index].getClass());
}
return types;
}
/**
* Returns the reference class array of the given object array
*
* @param object Given object array
* @return The reference class array
*/
public static Class<?>[] getReference(Object[] objects) {
int length = objects == null ? 0 : objects.length;
Class<?>[] types = new Class<?>[length];
for (int index = 0; index < length; index++) {
types[index] = getReference(objects[index].getClass());
}
return types;
}
/**
* Compares two class arrays on equivalence
*
* @param primary Primary class array
* @param secondary Class array which is compared to the primary array
* @return Whether these arrays are equal or not
*/
public static boolean compare(Class<?>[] primary, Class<?>[] secondary) {
if (primary == null || secondary == null || primary.length != secondary.length) {
return false;
}
for (int index = 0; index < primary.length; index++) {
Class<?> primaryClass = primary[index];
Class<?> secondaryClass = secondary[index];
if (primaryClass.equals(secondaryClass) || primaryClass.isAssignableFrom(secondaryClass)) {
continue;
}
return false;
}
return true;
}
}
}

View File

@ -16,6 +16,8 @@ import org.bukkit.entity.EntityType;
import org.bukkit.entity.LivingEntity; import org.bukkit.entity.LivingEntity;
import org.bukkit.entity.Player; import org.bukkit.entity.Player;
import org.bukkit.inventory.ItemStack; import org.bukkit.inventory.ItemStack;
import org.bukkit.util.Vector;
import org.bukkit.block.BlockFace;
import sig.plugin.TwosideKeeper.Buff; import sig.plugin.TwosideKeeper.Buff;
import sig.plugin.TwosideKeeper.LivingEntityStructure; import sig.plugin.TwosideKeeper.LivingEntityStructure;
@ -27,6 +29,9 @@ import sig.plugin.TwosideKeeper.HelperStructures.LivingEntityDifficulty;
import sig.plugin.TwosideKeeper.HelperStructures.Common.GenericFunctions; import sig.plugin.TwosideKeeper.HelperStructures.Common.GenericFunctions;
public class EntityUtils { public class EntityUtils {
final public static BlockFace[] faces = new BlockFace[]{BlockFace.EAST,BlockFace.SOUTH_EAST,BlockFace.SOUTH,
BlockFace.SOUTH_WEST,BlockFace.WEST,BlockFace.NORTH_WEST,BlockFace.NORTH,BlockFace.NORTH_EAST};
public static int CountNearbyEntityType(EntityType type, Entity ent, double range) { public static int CountNearbyEntityType(EntityType type, Entity ent, double range) {
List<Entity> ents = ent.getNearbyEntities(range, range, range); List<Entity> ents = ent.getNearbyEntities(range, range, range);
int count=0; int count=0;
@ -180,4 +185,22 @@ public class EntityUtils {
GenericFunctions.sendActionBarMessage((Player)l, ""); GenericFunctions.sendActionBarMessage((Player)l, "");
} }
} }
public static BlockFace getFacingDirection(LivingEntity l) {
Vector direction = l.getLocation().getDirection();
double rad = Math.atan2(direction.getZ(), direction.getX());
double dir = Math.toDegrees(rad);
if (dir<0) {
dir=360-Math.abs(dir);
//-90 180 + 90 = 270
// -0 180
//-180 360
}
//TwosideKeeper.log(Double.toString(dir), 0);
//+Z: 90 degrees (South)
//+X: 0 degrees (East)
//-Z: -90 degrees (North)
//-X: -180/180 degrees (West)
return faces[(int)((dir+22.5)/45)%faces.length];
}
} }

View File

@ -1,6 +1,7 @@
package sig.plugin.TwosideKeeper.HelperStructures.Utils; package sig.plugin.TwosideKeeper.HelperStructures.Utils;
import org.bukkit.Location; import org.bukkit.Location;
import org.bukkit.block.BlockFace;
import org.bukkit.util.Vector; import org.bukkit.util.Vector;
public class MovementUtils { public class MovementUtils {
@ -47,4 +48,36 @@ public class MovementUtils {
//TwosideKeeper.log("New angle is "+angle, 0); //TwosideKeeper.log("New angle is "+angle, 0);
return new Vector(-velx,-vely,-velz); return new Vector(-velx,-vely,-velz);
} }
/**
* Returns an array with a size of two elements:
* One pointing 45 degrees to the right of the specified direction.
* One pointing 45 degrees to the left of the specified direction.
*/
public static BlockFace[] get45DegreeDirections(BlockFace dir) {
int slotfound = 0;
for (int i=0;i<EntityUtils.faces.length;i++) {
if (EntityUtils.faces[i].equals(dir)) {
slotfound=i;
break;
}
}
return new BlockFace[]{EntityUtils.faces[(slotfound+1)%EntityUtils.faces.length],EntityUtils.faces[Math.floorMod((slotfound-1),EntityUtils.faces.length)]};
}
/**
* Returns an array with a size of two elements:
* One pointing 90 degrees to the right of the specified direction.
* One pointing 90 degrees to the left of the specified direction.
*/
public static BlockFace[] get90DegreeDirections(BlockFace dir) {
int slotfound = 0;
for (int i=0;i<EntityUtils.faces.length;i++) {
if (EntityUtils.faces[i].equals(dir)) {
slotfound=i;
break;
}
}
return new BlockFace[]{EntityUtils.faces[(slotfound+2)%EntityUtils.faces.length],EntityUtils.faces[Math.floorMod((slotfound-2),EntityUtils.faces.length)]};
}
} }

View File

@ -15,6 +15,7 @@ import sig.plugin.TwosideKeeper.HelperStructures.Channel;
import sig.plugin.TwosideKeeper.HelperStructures.LivingEntityDifficulty; import sig.plugin.TwosideKeeper.HelperStructures.LivingEntityDifficulty;
import sig.plugin.TwosideKeeper.HelperStructures.Common.GenericFunctions; import sig.plugin.TwosideKeeper.HelperStructures.Common.GenericFunctions;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.DebugUtils; import sig.plugin.TwosideKeeper.HelperStructures.Utils.DebugUtils;
import sig.plugin.TwosideKeeper.Monster.Knight;
public class LivingEntityStructure { public class LivingEntityStructure {
public LivingEntity target; public LivingEntity target;
@ -115,6 +116,7 @@ public class LivingEntityStructure {
} }
public String getActualName() { public String getActualName() {
StringBuilder sb = new StringBuilder(prefix); StringBuilder sb = new StringBuilder(prefix);
if (prefix.length()==0) {
if (sb.length()>0 && difficulty_modifier.length()>0) { if (sb.length()>0 && difficulty_modifier.length()>0) {
sb.append(" "); sb.append(" ");
} }
@ -126,6 +128,9 @@ public class LivingEntityStructure {
if (sb.length()>0 && suffix.length()>0) { if (sb.length()>0 && suffix.length()>0) {
sb.append(" "); sb.append(" ");
} }
} else {
sb.append(" ");
}
sb.append(suffix); sb.append(suffix);
if (sb.length()>0 && suffix_bar.length()>0) { if (sb.length()>0 && suffix_bar.length()>0) {
sb.append(" "); sb.append(" ");
@ -208,7 +213,11 @@ public class LivingEntityStructure {
} else } else
if (GenericFunctions.isIsolatedTarget(m, p)) { if (GenericFunctions.isIsolatedTarget(m, p)) {
setGlow(p,GlowAPI.Color.WHITE); setGlow(p,GlowAPI.Color.WHITE);
} else { }
if (Knight.isKnight(m)) {
setGlow(p,GlowAPI.Color.AQUA);
}
else {
//No glow. //No glow.
//setGlow(p,null); //setGlow(p,null);
if (glowcolorlist.containsKey(p.getUniqueId())) { if (glowcolorlist.containsKey(p.getUniqueId())) {
@ -219,7 +228,7 @@ public class LivingEntityStructure {
if (!GlowAPI.isGlowing(m, p) && glowcolorlist.containsKey(p.getUniqueId())) { if (!GlowAPI.isGlowing(m, p) && glowcolorlist.containsKey(p.getUniqueId())) {
GlowAPI.setGlowing(m, glowcolorlist.get(p.getUniqueId()), p); GlowAPI.setGlowing(m, glowcolorlist.get(p.getUniqueId()), p);
} else } else
if (GlowAPI.isGlowing(m, p) && !glowcolorlist.get(p.getUniqueId()).equals(GlowAPI.getGlowColor(m, p))) { if (GlowAPI.isGlowing(m, p) && (p==null || !glowcolorlist.get(p.getUniqueId()).equals(GlowAPI.getGlowColor(m, p)))) {
GlowAPI.setGlowing(m, glowcolorlist.get(p.getUniqueId()), p); GlowAPI.setGlowing(m, glowcolorlist.get(p.getUniqueId()), p);
} }
} }

View File

@ -0,0 +1,204 @@
package sig.plugin.TwosideKeeper.Monster;
import java.util.ArrayList;
import java.util.List;
import org.bukkit.Bukkit;
import org.bukkit.ChatColor;
import org.bukkit.Color;
import org.bukkit.Particle;
import org.bukkit.Sound;
import org.bukkit.entity.CaveSpider;
import org.bukkit.entity.EntityType;
import org.bukkit.entity.LivingEntity;
import org.bukkit.entity.Player;
import org.bukkit.entity.Spider;
import org.bukkit.potion.PotionEffectType;
import sig.plugin.TwosideKeeper.Buff;
import sig.plugin.TwosideKeeper.CustomDamage;
import sig.plugin.TwosideKeeper.CustomMonster;
import sig.plugin.TwosideKeeper.LivingEntityStructure;
import sig.plugin.TwosideKeeper.MonsterController;
import sig.plugin.TwosideKeeper.TwosideKeeper;
import sig.plugin.TwosideKeeper.Events.EntityChannelCastEvent;
import sig.plugin.TwosideKeeper.HelperStructures.Channel;
import sig.plugin.TwosideKeeper.HelperStructures.LivingEntityDifficulty;
import sig.plugin.TwosideKeeper.HelperStructures.Spell;
import sig.plugin.TwosideKeeper.HelperStructures.Common.GenericFunctions;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.SoundUtils;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.Classes.MixedDamage;
public class DarkSpider extends CustomMonster{
Knight linked_knight;
final static int[] SILENCE_DURATIONS = new int[]{200,100,60};
final static int[] MINION_HEALTH = new int[]{900,3000,18000};
List<LivingEntity> temp_spiders = new ArrayList<LivingEntity>();
final Spell SPIDERSUMMON = new Spell("Summon Spider",new int[]{100,60,40},new int[]{600,500,400});
final Spell ULTRABURST = new Spell("UltraBurst",new int[]{80,80,80},new int[]{1200,900,800}, new MixedDamage[]{MixedDamage.v(200),MixedDamage.v(1000),MixedDamage.v(50,0.95)});
int randomness = 16;
public DarkSpider(LivingEntity m) {
super(m);
LivingEntityStructure les = LivingEntityStructure.GetLivingEntityStructure(m);
MonsterController.convertLivingEntity(m, LivingEntityDifficulty.NORMAL);
les.setCustomLivingEntityName(m, ChatColor.DARK_RED+"Dark Spider");
m.setMaxHealth(100000);
m.setHealth(m.getMaxHealth());
m.setAI(true);
}
public void runTick() {
if (canCastSpells()) { //SPELL CASTS HERE.
castSpiderSummon();
}
}
private void castSpiderSummon() {
CastSpell(SPIDERSUMMON);
}
public void runChannelCastEvent(EntityChannelCastEvent ev) {
switch (ev.getAbilityName()) {
case "Summon Spider":{
//Create another Spider.
DarkSpiderMinion dsm = InitializeDarkSpiderMinion(linked_knight);
dsm.linked_knight = linked_knight;
SPIDERSUMMON.setLastCastedTime(TwosideKeeper.getServerTickTime());
}break;
case "UltraBurst":{
playUltraBurst();
ULTRABURST.setLastCastedTime(TwosideKeeper.getServerTickTime());
}break;
}
}
private void playUltraBurst() {
SoundUtils.playGlobalSound(m.getLocation(), Sound.ENTITY_TNT_PRIMED, 1.0f, 1.0f);
for (int i=0;i<3;i++) {
Bukkit.getScheduler().runTaskLater(TwosideKeeper.plugin, ()->{
SoundUtils.playGlobalSound(m.getLocation(), Sound.ENTITY_TNT_PRIMED, 1.0f, 1.2f);}, (i+1)*10);
}
Bukkit.getScheduler().runTaskLater(TwosideKeeper.plugin, ()->{
aPlugin.API.sendSoundlessExplosion(m.getLocation(), 6);
m.getWorld().spawnParticle(Particle.LAVA, m.getLocation(), 30);
m.getWorld().spawnParticle(Particle.EXPLOSION_HUGE, m.getLocation(), 2);
SoundUtils.playGlobalSound(m.getLocation(), Sound.ENTITY_GENERIC_EXPLODE, 1.0f, 0.7f);
DealSpellDamageToNearbyPlayers(ULTRABURST,50,true,false,5);
m.remove();
}, 40);
}
private void DealSpellDamageToNearbyPlayers(Spell spell, int range, boolean knockup, boolean dodgeable, double knockupamt) {
List<Player> players = GenericFunctions.DealDamageToNearbyPlayers(m.getLocation(), spell.getDamageValues()[getDifficultySlot()].getDmgComponent(), range, knockup, dodgeable, knockupamt, m, spell.getName(), false);
if (spell.getDamageValues()[getDifficultySlot()].hasTruePctDmgComponent()) {GenericFunctions.DealDamageToNearbyPlayers(m.getLocation(), spell.getDamageValues()[getDifficultySlot()].getTruePctDmgComponent(), range, knockup, dodgeable, knockupamt, m, spell.getName(), false,true);}
if (spell.getDamageValues()[getDifficultySlot()].hasTrueDmgComponent()) {GenericFunctions.DealDamageToNearbyPlayers(m.getLocation(), spell.getDamageValues()[getDifficultySlot()].getTrueDmgComponent(), range, knockup, dodgeable, knockupamt, m, spell.getName(), true);}
for (Player p : players) {
GenericFunctions.addStackingPotionEffect(p, PotionEffectType.CONFUSION, 20*6, 1);
}
}
private DarkSpiderMinion InitializeDarkSpiderMinion(Knight knight) {
LivingEntity knight_ent = knight.GetMonster();
CaveSpider s = (CaveSpider)knight_ent.getWorld().spawnEntity(m.getLocation(), EntityType.CAVE_SPIDER);
DarkSpiderMinion dsm = new DarkSpiderMinion(s);
TwosideKeeper.custommonsters.put(s.getUniqueId(), dsm);
s.setMaxHealth(MINION_HEALTH[getDifficultySlot()]);
s.setHealth(s.getMaxHealth());
temp_spiders.add(s);
return dsm;
}
protected void CastSpell(Spell spell) {
if (hasValidKnight() &&
cooldownIsAvailable(spell.getLastCastedTime(),spell)) {
Channel.createNewChannel(m, spell.getName(), spell.getCastTimes()[getDifficultySlot()]);
}
}
private boolean cooldownIsAvailable(long spell_timer, Spell spell) {
return spell_timer+spell.getCooldowns()[getDifficultySlot()]<=TwosideKeeper.getServerTickTime();
}
public static double getDamageReduction() {
return 1.0;
}
public static Spider InitializeDarkSpider(LivingEntity sourceKnight) {
Spider s = (Spider)sourceKnight.getWorld().spawnEntity(sourceKnight.getLocation(), EntityType.SPIDER);
DarkSpider ds = new DarkSpider(s);
TwosideKeeper.custommonsters.put(s.getUniqueId(), ds);
return s;
}
public static boolean isDarkSpider(LivingEntity m) {
return (m instanceof Spider) &&
m.getMaxHealth()==100000 &&
MonsterController.getLivingEntityDifficulty(m)==LivingEntityDifficulty.NORMAL;
}
public LivingEntityDifficulty getDifficulty() {
if (hasValidKnight()) {
return MonsterController.getLivingEntityDifficulty(linked_knight.GetMonster());
} else {
return LivingEntityDifficulty.T1_MINIBOSS;
}
}
private boolean hasValidKnight() {
return linked_knight!=null && linked_knight.GetMonster()!=null && linked_knight.GetMonster().isValid();
}
public int getDifficultySlot() {
switch (getDifficulty()) {
case T1_MINIBOSS:{
return 0;
}
case T2_MINIBOSS:{
return 1;
}
case T3_MINIBOSS:{
return 2;
}
default:{
TwosideKeeper.log("WARNING! Could not get proper difficulty slot for Difficulty "+getDifficulty()+". Defaulting to slot 0.", 1);
return 0;
}
}
}
public boolean canCastSpells() {
return Math.random()<=1/16d && !Buff.hasBuff(m, "SILENCE") && hasValidKnight() && linked_knight.startedfight && !Channel.isChanneling(m);
}
public void onHitEvent(LivingEntity damager, double damage) {
Buff.addBuff(
m, "SILENCE", new Buff(
"Silence",SILENCE_DURATIONS[getDifficultySlot()],
0,Color.BLUE,ChatColor.WHITE+"",false));
if (Channel.isChanneling(m)) {
Channel.stopChanneling(m);
}
if (hasValidKnight() &&
(damager instanceof Player)) {
linked_knight.addParticipant((Player)damager);
}
}
public void cleanup() {
for (LivingEntity l : temp_spiders) {
if (l!=null && l.isValid()) {
if (TwosideKeeper.custommonsters.containsKey(l.getUniqueId())) {
CustomMonster cm = TwosideKeeper.custommonsters.get(l.getUniqueId());
cm.cleanup();
}
l.remove();
}
}
m.remove();
}
}

View File

@ -0,0 +1,38 @@
package sig.plugin.TwosideKeeper.Monster;
import org.bukkit.ChatColor;
import org.bukkit.attribute.Attribute;
import org.bukkit.entity.CaveSpider;
import org.bukkit.entity.LivingEntity;
import org.bukkit.entity.Spider;
import sig.plugin.TwosideKeeper.CustomMonster;
import sig.plugin.TwosideKeeper.LivingEntityStructure;
import sig.plugin.TwosideKeeper.MonsterController;
import sig.plugin.TwosideKeeper.HelperStructures.LivingEntityDifficulty;
import sig.plugin.TwosideKeeper.HelperStructures.Spell;
public class DarkSpiderMinion extends DarkSpider{
public DarkSpiderMinion(LivingEntity m) {
super(m);
LivingEntityStructure les = LivingEntityStructure.GetLivingEntityStructure(m);
les.setCustomLivingEntityName(m, ChatColor.DARK_PURPLE+"Dark Spider Minion");
m.getAttribute(Attribute.GENERIC_MOVEMENT_SPEED).setBaseValue(0.5f);
}
public void runTick() {
super.runTick();
if (canCastSpells()) {
CastSpell(ULTRABURST);
}
}
public static boolean isDarkSpiderMinion(LivingEntity m) {
return (m instanceof CaveSpider) &&
(m.getMaxHealth()==MINION_HEALTH[0] ||
m.getMaxHealth()==MINION_HEALTH[1] ||
m.getMaxHealth()==MINION_HEALTH[2]) &&
MonsterController.getLivingEntityDifficulty(m)==LivingEntityDifficulty.NORMAL;
}
}

View File

@ -0,0 +1,603 @@
package sig.plugin.TwosideKeeper.Monster;
import java.text.DecimalFormat;
import java.util.ArrayList;
import java.util.HashMap;
import java.util.List;
import org.bukkit.Bukkit;
import org.bukkit.ChatColor;
import org.bukkit.Location;
import org.bukkit.Material;
import org.bukkit.Particle;
import org.bukkit.Sound;
import org.bukkit.block.BlockFace;
import org.bukkit.boss.BarColor;
import org.bukkit.boss.BarFlag;
import org.bukkit.boss.BarStyle;
import org.bukkit.boss.BossBar;
import org.bukkit.enchantments.Enchantment;
import org.bukkit.entity.Entity;
import org.bukkit.entity.LivingEntity;
import org.bukkit.entity.Monster;
import org.bukkit.entity.Player;
import org.bukkit.entity.Skeleton;
import org.bukkit.entity.Skeleton.SkeletonType;
import org.inventivetalent.glow.GlowAPI.Color;
import org.bukkit.entity.Spider;
import org.bukkit.inventory.ItemStack;
import org.bukkit.util.Vector;
import sig.plugin.TwosideKeeper.Buff;
import sig.plugin.TwosideKeeper.ChargeZombie;
import sig.plugin.TwosideKeeper.CustomMonster;
import sig.plugin.TwosideKeeper.LivingEntityStructure;
import sig.plugin.TwosideKeeper.MonsterController;
import sig.plugin.TwosideKeeper.TwosideKeeper;
import sig.plugin.TwosideKeeper.Events.EntityChannelCastEvent;
import sig.plugin.TwosideKeeper.HelperStructures.Channel;
import sig.plugin.TwosideKeeper.HelperStructures.LivingEntityDifficulty;
import sig.plugin.TwosideKeeper.HelperStructures.Spell;
import sig.plugin.TwosideKeeper.HelperStructures.Common.GenericFunctions;
import sig.plugin.TwosideKeeper.HelperStructures.Effects.DarkSlash;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.BlockUtils;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.EntityUtils;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.ItemUtils;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.MovementUtils;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.SoundUtils;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.Classes.MixedDamage;
public class Knight extends CustomMonster{
DarkSpider spider_pet;
protected String arrow = "->";
protected List<Player> participantlist = new ArrayList<Player>();
protected HashMap<String,Double> dpslist = new HashMap<String,Double>();
BossBar healthbar;
long lasthit;
boolean startedfight=false;
boolean isFlying=false;
private long stuckTimer=0;
int scroll=0;
private Location lastLoc = null;
final static int[] ASSASSINATE_COOLDOWN = new int[]{320,280,240};
long lastusedassassinate = TwosideKeeper.getServerTickTime();
final Spell DARKSLASH = new Spell("Dark Slash",new int[]{60,40,40},new int[]{400,300,200},new MixedDamage[]{MixedDamage.v(150),MixedDamage.v(300),MixedDamage.v(300,0.1)});
final Spell LINEDRIVE = new Spell("Line Drive",new int[]{20,10,10},new int[]{800,700,600},new MixedDamage[]{MixedDamage.v(200),MixedDamage.v(400),MixedDamage.v(400, 0.2)});
int randomness = 20;
public Knight(LivingEntity m) {
super(m);
LivingEntityStructure les = LivingEntityStructure.GetLivingEntityStructure(m);
les.setCustomLivingEntityName(m, ChatColor.GOLD+"Knight");
LivingEntityDifficulty led = MonsterController.getLivingEntityDifficulty(m);
switch (led) {
case T1_MINIBOSS:{
m.setMaxHealth(18000);
}break;
case T2_MINIBOSS:{
m.setMaxHealth(47000);
}break;
case T3_MINIBOSS:{
m.setMaxHealth(116000);
}break;
}
m.setHealth(m.getMaxHealth());
relinkToSpider();
m.setAI(false);
createBossHealthbar();
//GenericFunctions.setGlowing(m, Color.AQUA);
setupDarkSword();
}
public void runTick() {
updateHealthbarForNearbyPlayers();
relinkToSpider();
displayDarkSwordParticles();
updateTargetIfLost();
regenerateHealthAndResetBossIfIdle();
keepHealthbarUpdated();
keepSpiderPetNearby();
unstuckIfStuck();
preventTargetFromBeingTheSameAsSpider();
increaseBarTextScroll();
performSpells();
}
public void runChannelCastEvent(EntityChannelCastEvent ev) {
switch (ev.getAbilityName()) {
case "Dark Slash":{
TwosideKeeper.windslashes.add(
new DarkSlash(m.getLocation(),m,DARKSLASH.getDamageValues()[getDifficultySlot()],20*20)
);
BlockFace[] dirs = MovementUtils.get45DegreeDirections(EntityUtils.getFacingDirection(m));
for (BlockFace face : dirs) {
TwosideKeeper.windslashes.add(
new DarkSlash(m.getLocation().add(
new Vector(face.getModX(),face.getModY(),face.getModZ()).multiply(3)
),m,DARKSLASH.getDamageValues()[getDifficultySlot()],20*20)
);
}
DARKSLASH.setLastCastedTime(TwosideKeeper.getServerTickTime());
}break;
case "Line Drive":{
m.setVelocity(new Vector(0,0.6,0));
Bukkit.getScheduler().runTaskLater(TwosideKeeper.plugin, ()->{
m.setVelocity(m.getLocation().getDirection().multiply(8));
int range = 8;
double xspd = m.getLocation().getDirection().getX()*2;
double zspd = m.getLocation().getDirection().getZ()*2;
for (int i=0;i<range;i++) {
Location particlepos = m.getLocation().add(i*xspd,0,i*zspd);
for (int j=0;j<50;j++) {
particlepos.add(j*(xspd/50),0,j*(zspd/50));
}
Location newpos = m.getLocation().add(i*xspd,0,i*zspd);
if (!BlockUtils.isPassThrough(newpos)) {
break;
}
Bukkit.getScheduler().runTaskLater(TwosideKeeper.plugin,
()->{
},2);
}
}, 4);
}break;
}
}
protected void CastSpell(Spell spell) {
if (cooldownIsAvailable(spell.getLastCastedTime(),spell)) {
//Face target.
FaceTarget(m);
Channel.createNewChannel(m, spell.getName(), spell.getCastTimes()[getDifficultySlot()]);
}
}
private void FaceTarget(LivingEntity m) {
if (((Monster)m).getTarget()!=null) {
Location loc = m.getLocation();
loc.setDirection(MovementUtils.pointTowardsLocation(loc, ((Monster)m).getTarget().getLocation()));
m.teleport(loc);
}
}
private boolean cooldownIsAvailable(long spell_timer, Spell spell) {
return spell_timer+spell.getCooldowns()[getDifficultySlot()]<=TwosideKeeper.getServerTickTime();
}
private void performSpells() {
final Runnable[] actions = new Runnable[]{
()->{performAssassinate();},
()->{CastSpell(DARKSLASH);},
()->{changeAggroToRandomNewTarget();CastSpell(LINEDRIVE);}};
if (canCastSpells()) {
for (Runnable r : actions) {
if (Math.random()<=1d/actions.length) {
Bukkit.getScheduler().runTask(TwosideKeeper.plugin, r);
break;
}
}
}
}
private void performAssassinate() {
if (lastusedassassinate+ASSASSINATE_COOLDOWN[getDifficultySlot()]<=TwosideKeeper.getServerTickTime()) {
lastusedassassinate=TwosideKeeper.getServerTickTime();
Player p = setAggroOnRandomTarget();
Location teleloc = p.getLocation().add(p.getLocation().getDirection().multiply(-1d));
if (teleloc.getBlock().getType().isSolid() ||
teleloc.getBlock().getRelative(0,1,0).getType().isSolid()) {
teleloc = p.getLocation();
}
m.teleport(teleloc);
SoundUtils.playGlobalSound(m.getLocation(), Sound.BLOCK_NOTE_SNARE, 1.0f, 1.0f);
}
}
private Player setAggroOnRandomTarget() {
Player p = pickRandomTarget();
setAggro((Monster)m,p);
return p;
}
public LivingEntityDifficulty getDifficulty() {
return MonsterController.getLivingEntityDifficulty(m);
}
public int getDifficultySlot() {
switch (getDifficulty()) {
case T1_MINIBOSS:{
return 0;
}
case T2_MINIBOSS:{
return 1;
}
case T3_MINIBOSS:{
return 2;
}
default:{
TwosideKeeper.log("WARNING! Could not get proper difficulty slot for Difficulty "+getDifficulty()+". Defaulting to slot 0.", 1);
return 0;
}
}
}
private void changeAggroToRandomNewTarget() {
if (Math.random()<=0.5) {
Monster me = (Monster)m;
Player newtarget = pickRandomTarget();
setAggro(me, newtarget);
}
}
private void setAggro(Monster me, Player newtarget) {
if (newtarget!=null) {
me.setTarget(newtarget);
LivingEntityStructure les = LivingEntityStructure.GetLivingEntityStructure(m);
les.SetTarget(me.getTarget());
}
}
private Player pickRandomTarget() {
if (participantlist.size()>0) {
for (Player p : participantlist) {
if (Math.random()<=1d/participantlist.size()) {
return p;
}
}
return participantlist.get(0);
} else {
return null;
}
}
private boolean canCastSpells() {
return Math.random()<=1/20d && !Buff.hasBuff(m, "SILENCE") && startedfight && !Channel.isChanneling(m);
}
private void preventTargetFromBeingTheSameAsSpider() {
if (isValidSpiderPet()) {
Monster me = (Monster)m;
Monster spider = (Monster)spider_pet.GetMonster();
if (spider.getTarget()!=null && me.getTarget()!=null &&
spider.getTarget().equals(me.getTarget())) {
if (Math.random()<=0.5) {
Location newloc = spider.getLocation().add(Math.random()*15-5,0,0);
if (!newloc.getBlock().getType().isSolid() &&
!newloc.getBlock().getRelative(0,1,0).getType().isSolid()) {
//SoundUtils.playGlobalSound(spider.getLocation(), Sound.ENTITY_ENDERMEN_TELEPORT, 1.0f, 1.0f);
spider.teleport(newloc);
spider.setTarget(null);
}
} else {
Location newloc = spider.getLocation().add(Math.random()*10-5,0,0);
if (!newloc.getBlock().getType().isSolid() &&
!newloc.getBlock().getRelative(0,1,0).getType().isSolid()) {
//SoundUtils.playGlobalSound(spider.getLocation(), Sound.ENTITY_ENDERMEN_TELEPORT, 1.0f, 1.0f);
spider.teleport(newloc);
spider.setTarget(null);
}
}
}
}
}
private boolean isValidSpiderPet() {
return spider_pet!=null && spider_pet.GetMonster()!=null &&
spider_pet.GetMonster().isValid();
}
private void unstuckIfStuck() {
if (!startedfight) {
ChargeZombie.BreakBlocksAroundArea((Monster)m, 1);
} else
if (startedfight) {
lastLoc = m.getLocation().clone();
if (lastLoc!=null && lastLoc.distance(m.getLocation())<=0.4) {
stuckTimer++;
//TwosideKeeper.log("Stuck. "+stuckTimer, 0);
ChargeZombie.BreakBlocksAroundArea((Monster)m, 1);
} else {
stuckTimer=0;
}
if (!Channel.isChanneling(m) && stuckTimer>5) {
//Teleport randomly.
double numb = Math.random();
if (numb<=0.33) {
SoundUtils.playGlobalSound(m.getLocation(), Sound.ENTITY_ENDERMEN_TELEPORT, 0.4f, 0.95f);
m.teleport(m.getLocation().add(Math.random()*10-5,0,0));
} else
if (numb<=0.5) {
SoundUtils.playGlobalSound(m.getLocation(), Sound.ENTITY_ENDERMEN_TELEPORT, 0.4f, 0.95f);
m.teleport(m.getLocation().add(0,0,Math.random()*10-5));
}
stuckTimer=0;
}
}
}
private void keepSpiderPetNearby() {
if (isValidSpiderPet()) {
LivingEntityStructure les = LivingEntityStructure.GetLivingEntityStructure(spider_pet.GetMonster());
les.SetTarget(m);
}
}
private void keepHealthbarUpdated() {
healthbar.setProgress(m.getHealth()/m.getMaxHealth());
Monster me = (Monster)m;
healthbar.setTitle(GenericFunctions.getDisplayName(m) + ((me.getTarget()!=null && (me.getTarget() instanceof Player))?(ChatColor.DARK_AQUA+" "+arrow+" "+ChatColor.YELLOW+((Player)me.getTarget()).getName()):""));
if (isValidSpiderPet()) {
spider_pet.GetMonster().setHealth(spider_pet.GetMonster().getMaxHealth());
}
}
private void regenerateHealthAndResetBossIfIdle() {
if (lasthit+20*15<=TwosideKeeper.getServerTickTime()) {
GenericFunctions.HealEntity(m, m.getMaxHealth()*0.01);
if (startedfight) {
healthbar.setColor(BarColor.GREEN);
}
} else {
if (startedfight) {
healthbar.setColor(BarColor.BLUE);
}
}
if (participantlist.size()==0 && startedfight) {
startedfight=false;
m.setAI(false);
m.setHealth(m.getMaxHealth());
announceFailedTakedown();
}
}
private void updateTargetIfLost() {
Monster mm = (Monster)m;
LivingEntityStructure les = LivingEntityStructure.GetLivingEntityStructure(m);
if (mm.getTarget()==null || !mm.getTarget().isValid() ||
les.GetTarget()==null || !mm.getTarget().isValid() ||
(!isFlying && (mm.getTarget().getLocation().distanceSquared(mm.getLocation())>2500 ||
les.GetTarget().getLocation().distanceSquared(mm.getLocation())>2500
))) {
//See if there's another participant in the list. Choose randomly.
while (participantlist.size()>0) {
Player p = participantlist.get((int)(Math.random()*participantlist.size()));
if (p!=null && p.isValid() &&
(isFlying || p.getLocation().distanceSquared(mm.getLocation())<=2500)) {
mm.setTarget(p);
les.SetTarget(p);
break;
} else {
participantlist.remove(p);
}
}
if (participantlist.size()==0 && startedfight) {
//This fight has failed.
announceFailedTakedown();
startedfight=false;
}
}
}
public void announceFailedTakedown() {
if (dpslist.size()>0 && !m.isDead()) {
Bukkit.getServer().broadcastMessage(GenericFunctions.getDisplayName(m)+" Takedown Failed...");
Bukkit.getServer().broadcastMessage(ChatColor.YELLOW+"DPS Breakdown:");
Bukkit.getServer().broadcastMessage(generateDPSReport());
aPlugin.API.discordSendRaw(GenericFunctions.getDisplayName(m)+" Takedown Failed...\n\n"+ChatColor.YELLOW+"DPS Breakdown:"+"\n```\n"+generateDPSReport()+"\n```");
dpslist.clear();
PerformSpiderCleanup();
healthbar.setColor(BarColor.WHITE);
}
}
private void PerformSpiderCleanup() {
if (spider_pet!=null && spider_pet.GetMonster()!=null) {
spider_pet.GetMonster().remove();
spider_pet.cleanup();
}
}
public String generateDPSReport() {
//Sorts a list of players by DPS contribution.
List<Double> sorted_dmg = new ArrayList<Double>();
List<String> sorted_pl = new ArrayList<String>();
double totaldmg = 0;
for (String pl : dpslist.keySet()) {
double dmg = dpslist.get(pl);
int slot = 0;
totaldmg+=dmg;
for (int i=0;i<sorted_dmg.size();i++) {
if (dmg>sorted_dmg.get(i)) {
break;
} else {
slot++;
}
}
sorted_pl.add(slot,pl);
sorted_dmg.add(slot,dmg);
}
StringBuilder finalstr = new StringBuilder();
DecimalFormat df = new DecimalFormat("0.00");
for (int i=0;i<sorted_pl.size();i++) {
if (finalstr.length()!=0) {
finalstr.append("\n");
}
finalstr.append(sorted_pl.get(i)+": "+df.format(sorted_dmg.get(i))+" dmg ("+df.format((sorted_dmg.get(i)/totaldmg)*100)+"%)");
}
return finalstr.toString();
}
private void setupDarkSword() {
ItemStack weap = new ItemStack(Material.STONE_SWORD);
for (Enchantment ench : Enchantment.values()) {
weap.addUnsafeEnchantment(ench, 10);
}
ItemUtils.setDisplayName(weap, ChatColor.DARK_PURPLE+"Dark Sword");
m.getEquipment().setItemInMainHand(new ItemStack(Material.AIR));
m.getEquipment().setItemInOffHand(weap);
m.getEquipment().setItemInOffHandDropChance(0.2f);
}
private void createBossHealthbar() {
healthbar = Bukkit.getServer().createBossBar(GenericFunctions.getDisplayName(m), BarColor.WHITE, BarStyle.SEGMENTED_10, BarFlag.CREATE_FOG);
healthbar.setProgress(m.getHealth()/m.getMaxHealth());
}
public void onHitEvent(LivingEntity damager, double damage) {
addTarget(damager,damage);
healthbar.setProgress(m.getHealth()/m.getMaxHealth());
lasthit=TwosideKeeper.getServerTickTime();
if (!startedfight) {
startedfight=true;
healthbar.setColor(BarColor.BLUE);
}
m.setAI(true);
}
private void addTarget(LivingEntity damager, double dmg) {
if (damager instanceof Player) {
Player p = (Player)damager;
addParticipant(p);
if (!dpslist.containsKey(p.getName())) {
dpslist.put(p.getName(), dmg);
} else {
dpslist.put(p.getName(), dpslist.get(p.getName())+dmg);
}
}
}
public void addParticipant(Player p) {
if (!participantlist.contains(p)) {
participantlist.add(p);
}
}
private void displayDarkSwordParticles() {
Location sparkleloc = m.getEyeLocation().add(0,-0.25,0);
sparkleloc.setDirection(m.getLocation().getDirection().multiply(3));
m.getWorld().spawnParticle(Particle.SPELL, sparkleloc, 2);
}
private void relinkToSpider() {
if (spider_pet==null ||
spider_pet.GetMonster()==null || !spider_pet.GetMonster().isValid()) {
findNewPet();
}
}
private void findNewPet() {
for (Entity e : m.getNearbyEntities(50, 50, 50)) {
if (e instanceof Spider) {
if (AttemptToFindCompanionSpider(e)) {
return;
}
}
}
Spider s = DarkSpider.InitializeDarkSpider(m);
SetupSpiderPet(s);
}
private boolean AttemptToFindCompanionSpider(Entity e) {
Spider ss = (Spider)e;
if (DarkSpider.isDarkSpider(ss)) {
SetupSpiderPet(ss);
return true;
}
return false;
}
private void updateHealthbarForNearbyPlayers() {
for (Player p : healthbar.getPlayers()) {
if (p.getLocation().distanceSquared(m.getLocation())>2500) {
healthbar.removePlayer(p);
}
}
for (Entity e : m.getNearbyEntities(50, 50, 50)) {
if (e instanceof Player) {
Player p = (Player)e;
healthbar.addPlayer(p);
}
}
}
private void SetupSpiderPet(LivingEntity m) {
if (!TwosideKeeper.custommonsters.containsKey(m)) {
TwosideKeeper.custommonsters.put(m.getUniqueId(),new DarkSpider((LivingEntity)m));
}
spider_pet=(DarkSpider)TwosideKeeper.custommonsters.get(m.getUniqueId());
spider_pet.GetMonster().setAI(false);
spider_pet.linked_knight=this;
}
public static boolean randomlyConvertAsKnight(LivingEntity m) {
return randomlyConvertAsKnight(m,false);
}
public static boolean randomlyConvertAsKnight(LivingEntity m, boolean force) {
if ((TwosideKeeper.MINIBOSSES_ACTIVATED &&
TwosideKeeper.LAST_SPECIAL_SPAWN+(6000/Math.max(Bukkit.getOnlinePlayers().size(),1))<=TwosideKeeper.getServerTickTime() &&
Math.random()<=0.01) || force) {
Skeleton s = (Skeleton)m;
s.setSkeletonType(SkeletonType.WITHER);
Spider ss = DarkSpider.InitializeDarkSpider(m);
//ss.setPassenger(s);
//Determine distance from Twoside for Difficulty.
double chancer = TwosideKeeper.TWOSIDE_LOCATION.distanceSquared(m.getLocation());
if (Math.random()*chancer<4000000) {
MonsterController.convertLivingEntity(m, LivingEntityDifficulty.T1_MINIBOSS);
} else
if (Math.random()*chancer<25000000) {
MonsterController.convertLivingEntity(m, LivingEntityDifficulty.T2_MINIBOSS);
} else {
MonsterController.convertLivingEntity(m, LivingEntityDifficulty.T3_MINIBOSS);
}
return true;
}
return false;
}
public static boolean isKnight(LivingEntity m) {
return m instanceof Skeleton &&
((Skeleton)m).getSkeletonType()==SkeletonType.WITHER &&
(
MonsterController.getLivingEntityDifficulty(m)==LivingEntityDifficulty.T1_MINIBOSS ||
MonsterController.getLivingEntityDifficulty(m)==LivingEntityDifficulty.T2_MINIBOSS ||
MonsterController.getLivingEntityDifficulty(m)==LivingEntityDifficulty.T3_MINIBOSS
);
}
public static double getDamageReduction() {
return 0.2;
}
public void cleanup() {
healthbar.removeAll();
if (startedfight) {
announceFailedTakedown();
startedfight=false;
}
PerformSpiderCleanup();
}
protected void increaseBarTextScroll() {
scroll++;
switch (scroll%22) {
case 11:{
arrow=" -";
}break;
case 12:{
arrow=" ";
}break;
case 13:{
arrow="> ";
}break;
case 14:{
arrow="->";
}break;
}
}
}

View File

@ -36,6 +36,7 @@ import sig.plugin.TwosideKeeper.HelperStructures.Loot;
import sig.plugin.TwosideKeeper.HelperStructures.MonsterDifficulty; import sig.plugin.TwosideKeeper.HelperStructures.MonsterDifficulty;
import sig.plugin.TwosideKeeper.HelperStructures.MonsterType; import sig.plugin.TwosideKeeper.HelperStructures.MonsterType;
import sig.plugin.TwosideKeeper.HelperStructures.Common.GenericFunctions; import sig.plugin.TwosideKeeper.HelperStructures.Common.GenericFunctions;
import sig.plugin.TwosideKeeper.Monster.Knight;
public class MonsterController { public class MonsterController {
/** /**
@ -842,25 +843,14 @@ public class MonsterController {
}*/ }*/
LivingEntityStructure les = LivingEntityStructure.GetLivingEntityStructure(m); LivingEntityStructure les = LivingEntityStructure.GetLivingEntityStructure(m);
String difficulty_modifier = les.difficulty_modifier; String difficulty_modifier = les.difficulty_modifier;
if (difficulty_modifier.contains("Dangerous")) { for (LivingEntityDifficulty led : LivingEntityDifficulty.values()) {
return LivingEntityDifficulty.DANGEROUS; if (led!=LivingEntityDifficulty.NORMAL &&
} else difficulty_modifier.equalsIgnoreCase(led.getDifficultyString())) {
if (difficulty_modifier.contains("Deadly")) { return led;
return LivingEntityDifficulty.DEADLY;
} else
if (difficulty_modifier.contains("Hellfire")) {
return LivingEntityDifficulty.HELLFIRE;
} else
if (difficulty_modifier.contains("Elite")) {
return LivingEntityDifficulty.ELITE;
} else
if (difficulty_modifier.contains("End ")) {
return LivingEntityDifficulty.END;
} else
{
return LivingEntityDifficulty.NORMAL;
} }
} }
return LivingEntityDifficulty.NORMAL;
}
@Deprecated @Deprecated
public static LivingEntityDifficulty getOldLivingEntityDifficulty(LivingEntity m) { public static LivingEntityDifficulty getOldLivingEntityDifficulty(LivingEntity m) {
@ -1070,31 +1060,8 @@ public class MonsterController {
ms.UpdateGlow(); ms.UpdateGlow();
m.getAttribute(Attribute.GENERIC_FOLLOW_RANGE).setBaseValue(72.0); m.getAttribute(Attribute.GENERIC_FOLLOW_RANGE).setBaseValue(72.0);
}break; }break;
default: {
if (isAllowedToEquipItems(m)) {
m.getEquipment().clear();
RandomizeEquipment(m,0);
} else {
m.addPotionEffect(new PotionEffect(PotionEffectType.DAMAGE_RESISTANCE,Integer.MAX_VALUE,0));
}
SetupCustomName(led,m);
if(isZombieLeader(m))
{
m.addPotionEffect(new PotionEffect(PotionEffectType.DAMAGE_RESISTANCE,Integer.MAX_VALUE,8));
m.setMaxHealth(400);
m.setHealth(m.getMaxHealth());
m.setCustomName("Zombie Leader");
LivingEntityStructure ms = LivingEntityStructure.GetLivingEntityStructure(m);
ms.SetLeader(true);
ms.UpdateGlow();
TwosideKeeper.log("->Setting an entity with Difficulty "+led.name()+" w/"+m.getHealth()+"/"+m.getMaxHealth()+" HP to a Leader.",5);
} else {
m.setMaxHealth(m.getMaxHealth()*1.0);
m.setHealth(m.getMaxHealth());
}
m.getAttribute(Attribute.GENERIC_FOLLOW_RANGE).setBaseValue(24.0);
}break;
case END:{ case END:{
SetupCustomName(led,m);
//m.setCustomName(ChatColor.DARK_AQUA+"Dangerous Mob"); //m.setCustomName(ChatColor.DARK_AQUA+"Dangerous Mob");
//m.setCustomNameVisible(true); //m.setCustomNameVisible(true);
if (m.getType()!=EntityType.ENDERMAN) { if (m.getType()!=EntityType.ENDERMAN) {
@ -1121,6 +1088,35 @@ public class MonsterController {
} }
m.getAttribute(Attribute.GENERIC_FOLLOW_RANGE).setBaseValue(64.0); m.getAttribute(Attribute.GENERIC_FOLLOW_RANGE).setBaseValue(64.0);
}break; }break;
case T1_MINIBOSS:
case T2_MINIBOSS:
case T3_MINIBOSS:{
SetupCustomName(led,m);
}break;
default: {
if (isAllowedToEquipItems(m)) {
m.getEquipment().clear();
RandomizeEquipment(m,0);
} else {
m.addPotionEffect(new PotionEffect(PotionEffectType.DAMAGE_RESISTANCE,Integer.MAX_VALUE,0));
}
SetupCustomName(led,m);
if(isZombieLeader(m))
{
m.addPotionEffect(new PotionEffect(PotionEffectType.DAMAGE_RESISTANCE,Integer.MAX_VALUE,8));
m.setMaxHealth(400);
m.setHealth(m.getMaxHealth());
m.setCustomName("Zombie Leader");
LivingEntityStructure ms = LivingEntityStructure.GetLivingEntityStructure(m);
ms.SetLeader(true);
ms.UpdateGlow();
TwosideKeeper.log("->Setting an entity with Difficulty "+led.name()+" w/"+m.getHealth()+"/"+m.getMaxHealth()+" HP to a Leader.",5);
} else {
m.setMaxHealth(m.getMaxHealth()*1.0);
m.setHealth(m.getMaxHealth());
}
m.getAttribute(Attribute.GENERIC_FOLLOW_RANGE).setBaseValue(24.0);
}break;
} }
removeZombieLeaderAttribute(m); removeZombieLeaderAttribute(m);
return m; return m;

View File

@ -19,6 +19,7 @@ import org.bukkit.Bukkit;
import org.bukkit.ChatColor; import org.bukkit.ChatColor;
import org.bukkit.Chunk; import org.bukkit.Chunk;
import org.bukkit.Color; import org.bukkit.Color;
import org.bukkit.Effect;
import org.bukkit.GameMode; import org.bukkit.GameMode;
import org.bukkit.Location; import org.bukkit.Location;
import org.bukkit.Material; import org.bukkit.Material;
@ -28,6 +29,7 @@ import org.bukkit.Statistic;
import org.bukkit.WorldCreator; import org.bukkit.WorldCreator;
import org.bukkit.attribute.Attribute; import org.bukkit.attribute.Attribute;
import org.bukkit.block.Block; import org.bukkit.block.Block;
import org.bukkit.block.BlockFace;
import org.bukkit.block.BlockState; import org.bukkit.block.BlockState;
import org.bukkit.block.Chest; import org.bukkit.block.Chest;
import org.bukkit.block.DoubleChest; import org.bukkit.block.DoubleChest;
@ -149,6 +151,7 @@ import org.bukkit.event.player.PlayerToggleSprintEvent;
import org.bukkit.event.server.ServerCommandEvent; import org.bukkit.event.server.ServerCommandEvent;
import org.bukkit.event.server.ServerListPingEvent; import org.bukkit.event.server.ServerListPingEvent;
import org.bukkit.event.vehicle.VehicleDestroyEvent; import org.bukkit.event.vehicle.VehicleDestroyEvent;
import org.bukkit.event.vehicle.VehicleEnterEvent;
import org.bukkit.event.vehicle.VehicleExitEvent; import org.bukkit.event.vehicle.VehicleExitEvent;
import org.bukkit.event.weather.LightningStrikeEvent; import org.bukkit.event.weather.LightningStrikeEvent;
import org.bukkit.event.world.ChunkLoadEvent; import org.bukkit.event.world.ChunkLoadEvent;
@ -233,6 +236,7 @@ import sig.plugin.TwosideKeeper.HelperStructures.Common.ItemContainer;
import sig.plugin.TwosideKeeper.HelperStructures.Common.JobRecipe; import sig.plugin.TwosideKeeper.HelperStructures.Common.JobRecipe;
import sig.plugin.TwosideKeeper.HelperStructures.Common.RecipeCategory; import sig.plugin.TwosideKeeper.HelperStructures.Common.RecipeCategory;
import sig.plugin.TwosideKeeper.HelperStructures.Common.RecipeLinker; import sig.plugin.TwosideKeeper.HelperStructures.Common.RecipeLinker;
import sig.plugin.TwosideKeeper.HelperStructures.Effects.DarkSlash;
import sig.plugin.TwosideKeeper.HelperStructures.Effects.EarthWaveTask; import sig.plugin.TwosideKeeper.HelperStructures.Effects.EarthWaveTask;
import sig.plugin.TwosideKeeper.HelperStructures.Effects.LavaPlume; import sig.plugin.TwosideKeeper.HelperStructures.Effects.LavaPlume;
import sig.plugin.TwosideKeeper.HelperStructures.Effects.ReplaceBlockTask; import sig.plugin.TwosideKeeper.HelperStructures.Effects.ReplaceBlockTask;
@ -249,9 +253,12 @@ import sig.plugin.TwosideKeeper.HelperStructures.Utils.InventoryUtils;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.ItemCubeUtils; import sig.plugin.TwosideKeeper.HelperStructures.Utils.ItemCubeUtils;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.ItemUtils; import sig.plugin.TwosideKeeper.HelperStructures.Utils.ItemUtils;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.MessageUtils; import sig.plugin.TwosideKeeper.HelperStructures.Utils.MessageUtils;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.MovementUtils;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.PlayerUtils; import sig.plugin.TwosideKeeper.HelperStructures.Utils.PlayerUtils;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.SoundUtils; import sig.plugin.TwosideKeeper.HelperStructures.Utils.SoundUtils;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.TimeUtils; import sig.plugin.TwosideKeeper.HelperStructures.Utils.TimeUtils;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.Classes.ColoredParticle;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.Classes.MixedDamage;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.Classes.SoundData; import sig.plugin.TwosideKeeper.HelperStructures.Utils.Classes.SoundData;
import sig.plugin.TwosideKeeper.HolidayEvents.Christmas; import sig.plugin.TwosideKeeper.HolidayEvents.Christmas;
import sig.plugin.TwosideKeeper.HolidayEvents.TreeBuilder; import sig.plugin.TwosideKeeper.HolidayEvents.TreeBuilder;
@ -260,6 +267,7 @@ import sig.plugin.TwosideKeeper.Logging.LootLogger;
import sig.plugin.TwosideKeeper.Logging.MysteriousEssenceLogger; import sig.plugin.TwosideKeeper.Logging.MysteriousEssenceLogger;
import sig.plugin.TwosideKeeper.Monster.Dummy; import sig.plugin.TwosideKeeper.Monster.Dummy;
import sig.plugin.TwosideKeeper.Monster.HellfireGhast; import sig.plugin.TwosideKeeper.Monster.HellfireGhast;
import sig.plugin.TwosideKeeper.Monster.Knight;
import sig.plugin.TwosideKeeper.Monster.MonsterTemplate; import sig.plugin.TwosideKeeper.Monster.MonsterTemplate;
@ -312,6 +320,7 @@ public class TwosideKeeper extends JavaPlugin implements Listener {
public static Set<String> notWorldShop = new HashSet<String>(); public static Set<String> notWorldShop = new HashSet<String>();
public static List<Entity> suppressed_entities = new ArrayList<Entity>(); public static List<Entity> suppressed_entities = new ArrayList<Entity>();
public static List<LavaPlume> lavaplume_list = new ArrayList<LavaPlume>(); public static List<LavaPlume> lavaplume_list = new ArrayList<LavaPlume>();
public static long LAST_SPECIAL_SPAWN = 0;
public static CustomItem HUNTERS_COMPASS; public static CustomItem HUNTERS_COMPASS;
public static CustomItem UPGRADE_SHARD; public static CustomItem UPGRADE_SHARD;
@ -540,6 +549,7 @@ public class TwosideKeeper extends JavaPlugin implements Listener {
public final static boolean CHRISTMASLINGERINGEVENT_ACTIVATED=false; public final static boolean CHRISTMASLINGERINGEVENT_ACTIVATED=false;
public final static boolean ELITEGUARDIANS_ACTIVATED=false; public final static boolean ELITEGUARDIANS_ACTIVATED=false;
public final static boolean MINIBOSSES_ACTIVATED=false;
public final static boolean NEWARTIFACTABILITIES_ACTIVATED=false; public final static boolean NEWARTIFACTABILITIES_ACTIVATED=false;
public static final Set<EntityType> LIVING_ENTITY_TYPES = ImmutableSet.of( public static final Set<EntityType> LIVING_ENTITY_TYPES = ImmutableSet.of(
@ -784,6 +794,7 @@ public class TwosideKeeper extends JavaPlugin implements Listener {
sig.plugin.TwosideKeeper.Monster.Wither w = (sig.plugin.TwosideKeeper.Monster.Wither)cs; sig.plugin.TwosideKeeper.Monster.Wither w = (sig.plugin.TwosideKeeper.Monster.Wither)cs;
w.Cleanup(); w.Cleanup();
} }
cs.cleanup();
ScheduleRemoval(custommonsters,cs.m.getUniqueId()); ScheduleRemoval(custommonsters,cs.m.getUniqueId());
} else { } else {
cs.runTick(); cs.runTick();
@ -893,6 +904,7 @@ public class TwosideKeeper extends JavaPlugin implements Listener {
TwosideKeeper.log("WARNING! Structure Handling took longer than 1 tick! "+((int)(System.nanoTime()-totaltime)/1000000d)+"ms", 0); TwosideKeeper.log("WARNING! Structure Handling took longer than 1 tick! "+((int)(System.nanoTime()-totaltime)/1000000d)+"ms", 0);
} }
TwosideKeeper.HeartbeatLogger.AddEntry(ChatColor.LIGHT_PURPLE+"Total Structure Handling", (int)(System.nanoTime()-totaltime));totaltime=System.nanoTime(); TwosideKeeper.HeartbeatLogger.AddEntry(ChatColor.LIGHT_PURPLE+"Total Structure Handling", (int)(System.nanoTime()-totaltime));totaltime=System.nanoTime();
} }
private void UpdateLavaBlock(Block lavamod) { private void UpdateLavaBlock(Block lavamod) {
@ -1989,9 +2001,38 @@ public class TwosideKeeper extends JavaPlugin implements Listener {
} }
} }
}break; }break;
case "KNIGHT":{
LivingEntity m = MonsterController.convertLivingEntity((Skeleton)p.getWorld().spawnEntity(p.getLocation(),EntityType.SKELETON),
LivingEntityDifficulty.T1_MINIBOSS);
Knight.randomlyConvertAsKnight(m,true);
TwosideKeeper.custommonsters.put(m.getUniqueId(),new Knight(m));
}break;
case "DAMAGETEST":{
LivingEntity m = MonsterController.convertLivingEntity((Skeleton)p.getWorld().spawnEntity(p.getLocation(),EntityType.SKELETON),
LivingEntityDifficulty.T1_MINIBOSS);
GenericFunctions.DealDamageToNearbyPlayers(p.getLocation(), Double.parseDouble(args[1]), 50, true, false, 3, m, "Explosion", false, true);
m.remove();
}break;
case "FACINGDIRECTION":{
TwosideKeeper.log(EntityUtils.getFacingDirection(p).name(),0);
}break;
case "DARKSLASH":{
BlockFace[] dirs = MovementUtils.get90DegreeDirections(EntityUtils.getFacingDirection(p));
TwosideKeeper.windslashes.add(
new DarkSlash(p.getLocation(),p,MixedDamage.v(0),20*20)
);
for (BlockFace face : dirs) {
//TwosideKeeper.log("Vector is "+(new Vector(face.getModX(),face.getModY(),face.getModZ())), 0);
TwosideKeeper.windslashes.add(
new DarkSlash(p.getLocation().add(
new Vector(face.getModX(),face.getModY(),face.getModZ()).multiply(8)
),p,MixedDamage.v(0),20*20)
);
}
}break;
} }
} }
LivingEntity m = MonsterController.convertMonster((Monster)p.getWorld().spawnEntity(p.getLocation(),EntityType.ZOMBIE), MonsterDifficulty.ELITE); //LivingEntity m = MonsterController.convertMonster((Monster)p.getWorld().spawnEntity(p.getLocation(),EntityType.ZOMBIE), MonsterDifficulty.ELITE);
/* /*
StackTraceElement[] stacktrace = new Throwable().getStackTrace(); StackTraceElement[] stacktrace = new Throwable().getStackTrace();
StringBuilder stack = new StringBuilder("Mini stack tracer:"); StringBuilder stack = new StringBuilder("Mini stack tracer:");
@ -4533,6 +4574,11 @@ public class TwosideKeeper extends JavaPlugin implements Listener {
} }
}break; }break;
} }
UUID key = ev.getLivingEntity().getUniqueId();
if (custommonsters.containsKey(key)) {
CustomMonster cm = custommonsters.get(key);
cm.runChannelCastEvent(ev);
}
} }
@EventHandler(priority=EventPriority.LOW,ignoreCancelled = true) @EventHandler(priority=EventPriority.LOW,ignoreCancelled = true)
@ -4705,7 +4751,9 @@ public class TwosideKeeper extends JavaPlugin implements Listener {
} }
case "Explosion": case "Explosion":
case "BLOCK_EXPLOSION": case "BLOCK_EXPLOSION":
case "MELTING":{ case "MELTING":
case "UltraBurst":
{
return Pronouns.ChoosePronoun(5); return Pronouns.ChoosePronoun(5);
} }
case "Leap": { case "Leap": {
@ -4745,6 +4793,9 @@ public class TwosideKeeper extends JavaPlugin implements Listener {
case "Orni": { case "Orni": {
return "was killed by merely existing."; return "was killed by merely existing.";
} }
case "Dark Slash":{
return "was sliced into darkness.";
}
default:{ default:{
return "has died by "+pd.lasthitdesc; return "has died by "+pd.lasthitdesc;
} }
@ -6277,7 +6328,7 @@ public class TwosideKeeper extends JavaPlugin implements Listener {
for (Entity e : ev.getChunk().getEntities()) { for (Entity e : ev.getChunk().getEntities()) {
if (e instanceof LivingEntity) { if (e instanceof LivingEntity) {
LivingEntity l = (LivingEntity)e; LivingEntity l = (LivingEntity)e;
if (l!=null && l.isValid()) { if (l!=null && l.isValid() && (!(l instanceof Player))) {
LivingEntityStructure les = LivingEntityStructure.GetLivingEntityStructure(l); LivingEntityStructure les = LivingEntityStructure.GetLivingEntityStructure(l);
l.setCustomName(les.getUnloadedName()); l.setCustomName(les.getUnloadedName());
} }
@ -6320,6 +6371,7 @@ public class TwosideKeeper extends JavaPlugin implements Listener {
} }
} }
} }
CustomDamage.addToCustomStructures(m);
} }
} }
@ -6424,7 +6476,8 @@ public class TwosideKeeper extends JavaPlugin implements Listener {
} }
if (ev.getEntity() instanceof LivingEntity) { if (ev.getEntity() instanceof LivingEntity) {
LivingEntity m = ev.getEntity(); LivingEntity m = ev.getEntity();
LivingEntityStructure.GetLivingEntityStructure(m); //LivingEntityStructure.GetLivingEntityStructure(m);
CustomDamage.addToCustomStructures(m);
} }
} }
@ -9456,6 +9509,14 @@ public class TwosideKeeper extends JavaPlugin implements Listener {
} }
} }
@EventHandler(priority=EventPriority.LOW,ignoreCancelled = true)
public void MinecartExitEvent(VehicleEnterEvent ev) {
//Attempt to update the entity a few ticks later.
Bukkit.getScheduler().runTaskLater(plugin, ()->{
ev.getEntered().teleport(ev.getVehicle());
}, 5);
}
@EventHandler(priority=EventPriority.LOW,ignoreCancelled = true) @EventHandler(priority=EventPriority.LOW,ignoreCancelled = true)
public void MinecartExitEvent(VehicleExitEvent ev) { public void MinecartExitEvent(VehicleExitEvent ev) {
if (ev.getExited()!=null) { if (ev.getExited()!=null) {
@ -9564,6 +9625,7 @@ public class TwosideKeeper extends JavaPlugin implements Listener {
getConfig().set("LAST_ELITE_SPAWN", LAST_ELITE_SPAWN); getConfig().set("LAST_ELITE_SPAWN", LAST_ELITE_SPAWN);
getConfig().set("LAST_DEAL", LAST_DEAL); getConfig().set("LAST_DEAL", LAST_DEAL);
getConfig().set("WEATHER_WATCH_USERS", weather_watch_users); getConfig().set("WEATHER_WATCH_USERS", weather_watch_users);
getConfig().set("LAST_SPECIAL_SPAWN", LAST_SPECIAL_SPAWN);
if (ELITE_LOCATION!=null) { if (ELITE_LOCATION!=null) {
getConfig().set("ELITE_LOCATION_X", ELITE_LOCATION.getBlockX()); getConfig().set("ELITE_LOCATION_X", ELITE_LOCATION.getBlockX());
getConfig().set("ELITE_LOCATION_Z", ELITE_LOCATION.getBlockZ()); getConfig().set("ELITE_LOCATION_Z", ELITE_LOCATION.getBlockZ());
@ -9629,6 +9691,7 @@ public class TwosideKeeper extends JavaPlugin implements Listener {
getConfig().addDefault("WORLD_SHOP_MULT", worldShopPriceMult); getConfig().addDefault("WORLD_SHOP_MULT", worldShopPriceMult);
getConfig().addDefault("LAST_DEAL", TimeUtils.GetCurrentDayOfWeek()); getConfig().addDefault("LAST_DEAL", TimeUtils.GetCurrentDayOfWeek());
getConfig().addDefault("WEATHER_WATCH_USERS", weather_watch_users); getConfig().addDefault("WEATHER_WATCH_USERS", weather_watch_users);
getConfig().addDefault("LAST_SPECIAL_SPAWN", LAST_SPECIAL_SPAWN);
getConfig().options().copyDefaults(true); getConfig().options().copyDefaults(true);
saveConfig(); saveConfig();
SERVERTICK = getConfig().getLong("SERVERTICK"); SERVERTICK = getConfig().getLong("SERVERTICK");
@ -9667,6 +9730,7 @@ public class TwosideKeeper extends JavaPlugin implements Listener {
worldShopPriceMult = getConfig().getDouble("WORLD_SHOP_MULT"); worldShopPriceMult = getConfig().getDouble("WORLD_SHOP_MULT");
LAST_DEAL = getConfig().getInt("LAST_DEAL"); LAST_DEAL = getConfig().getInt("LAST_DEAL");
weather_watch_users = (List<String>)getConfig().getList("WEATHER_WATCH_USERS"); weather_watch_users = (List<String>)getConfig().getList("WEATHER_WATCH_USERS");
LAST_SPECIAL_SPAWN = getConfig().getLong("LAST_SPECIAL_SPAWN");
if (getConfig().contains("ELITE_LOCATION_X")) { if (getConfig().contains("ELITE_LOCATION_X")) {
int x = getConfig().getInt("ELITE_LOCATION_X"); int x = getConfig().getInt("ELITE_LOCATION_X");
int z = getConfig().getInt("ELITE_LOCATION_Z"); int z = getConfig().getInt("ELITE_LOCATION_Z");

View File

@ -1,6 +1,10 @@
package sig.plugin.TwosideKeeper; package sig.plugin.TwosideKeeper;
import org.bukkit.Bukkit;
import org.bukkit.entity.Player;
import sig.plugin.TwosideKeeper.HelperStructures.Common.BlockModifyQueue; import sig.plugin.TwosideKeeper.HelperStructures.Common.BlockModifyQueue;
import sig.plugin.TwosideKeeper.HelperStructures.Utils.Classes.ColoredParticle;
public class runServerTick implements Runnable{ public class runServerTick implements Runnable{
final int queuespd = 3; final int queuespd = 3;
@ -14,6 +18,15 @@ public class runServerTick implements Runnable{
} }
} }
runServerHeartbeat.resetDamageQueue(); runServerHeartbeat.resetDamageQueue();
/*if (Bukkit.getPlayer("sigonasr2")!=null) {
Player p = Bukkit.getPlayer("sigonasr2");
for (int i=0;i<200;i++) {
ColoredParticle.RED_DUST.send(p.getEyeLocation().add(
p.getLocation().getDirection()).add(0,-0.05*i,0)
, 20, 0, 0, 0);
}
}*/
} }
} }